diff options
author | gebele <gebele@in-silico.ch> | 2018-06-29 12:41:41 +0000 |
---|---|---|
committer | gebele <gebele@in-silico.ch> | 2018-06-29 12:41:41 +0000 |
commit | 894ed0e7c8a35c9503f2fdb4f9923accde06ef0e (patch) | |
tree | 5b436f67874f92bd57f823618032a0a0f0372d90 /views/help.haml | |
parent | db1baa3261e4548d8ce43b08fa01ab41afc1a66a (diff) |
updated file format instructions
Diffstat (limited to 'views/help.haml')
-rw-r--r-- | views/help.haml | 94 |
1 files changed, 94 insertions, 0 deletions
diff --git a/views/help.haml b/views/help.haml new file mode 100644 index 0000000..0f0134a --- /dev/null +++ b/views/help.haml @@ -0,0 +1,94 @@ +%div.well + %h3 How to use batch prediction + + %p + You have two options on how your comma sperated spreadsheet ( + %strong CSV + ) needs to be structured to work with the batch prediction. + %br + One with only a list of compounds you want to predict and one where you can keep any kind of ID + for each compound for a better tracking of the results. + %br + Following examples for each option: + + %br + %p + %div.row + %div.col-md-6 + %strong Option 1: + %br + A spreadsheet with only + %strong one + column. + %strong Important is the header + containing the + %strong type + of the compounds. + %strong SMILES + or + %strong InChI + are accepted terms followed by corresponding compounds. + %div.col-md-6 + %table.help + %tr.row + %th.col-md-12 + SMILES + %tr.row + %td.col-md-12 + C1ccccc1NN + %tr.row + %td.col-md-12 + Cc1ccc(cc1\N=C=O)/N=C=O + %tr.row + %td.col-md-12 + OC(=O)c1ccc(cc1)C(=O)O + %tr.row + %td.col-md-12 + ="..." + %br + %p + %div.row + %div.col-md-6 + %strong Option 2: + %br + A spreadsheet with + %strong two + columns where the + %strong first column must contain a header ID + followed by any kind of ID you want to keep for the results and a + %strong second column with a header SMILES or InChI + followed by corresponding compounds. + %div.col-md-6 + %table.help + %tr.row + %th.col-md-4 + ID + %th.col-md-8 + SMILES + %tr.row + %td.col-md-4 + 2735 + %td.col-md-8 + C1ccccc1NN + %tr.row + %td.col-md-4 + A2 + %td.col-md-8 + O=C(OCCCC)C1=CC=CC=C1C(OCCCC)=O + %tr.row + %td.col-md-4 + 82 B-6 304663 + %td.col-md-8 + CC(C)(C)C1=CC2(C=C(C1=O)C(C)(C)C)CCC(=O)O2 + %tr.row + %td.col-md-4 + ="..." + %td.col-md-8 + ="..." + %br + %p + %strong Uploaded CSV files will be stored until you delete them. + %strong You can repeat the prediction whenever you select a file in the list of uploads. + %br + %strong Please note that a new file uploaded with a same name from the list of existing files + %strong will not overwrite the existing file and instead the existing file will be used ! |