summaryrefslogtreecommitdiff
diff options
context:
space:
mode:
-rw-r--r--application.rb4
-rw-r--r--views/help.haml94
-rw-r--r--views/predict.haml2
-rw-r--r--views/style.scss14
4 files changed, 113 insertions, 1 deletions
diff --git a/application.rb b/application.rb
index ecdc603..ee7837f 100644
--- a/application.rb
+++ b/application.rb
@@ -530,6 +530,10 @@ post '/predict/?' do
end
end
+get '/help' do
+ haml :help
+end
+
get '/style.css' do
headers 'Content-Type' => 'text/css; charset=utf-8'
scss :style
diff --git a/views/help.haml b/views/help.haml
new file mode 100644
index 0000000..0f0134a
--- /dev/null
+++ b/views/help.haml
@@ -0,0 +1,94 @@
+%div.well
+ %h3 How to use batch prediction
+
+ %p
+ You have two options on how your comma sperated spreadsheet (
+ %strong CSV
+ ) needs to be structured to work with the batch prediction.
+ %br
+ One with only a list of compounds you want to predict and one where you can keep any kind of ID
+ for each compound for a better tracking of the results.
+ %br
+ Following examples for each option:
+
+ %br
+ %p
+ %div.row
+ %div.col-md-6
+ %strong Option 1:
+ %br
+ A spreadsheet with only
+ %strong one
+ column.
+ %strong Important is the header
+ containing the
+ %strong type
+ of the compounds.
+ %strong SMILES
+ or
+ %strong InChI
+ are accepted terms followed by corresponding compounds.
+ %div.col-md-6
+ %table.help
+ %tr.row
+ %th.col-md-12
+ SMILES
+ %tr.row
+ %td.col-md-12
+ C1ccccc1NN
+ %tr.row
+ %td.col-md-12
+ Cc1ccc(cc1\N=C=O)/N=C=O
+ %tr.row
+ %td.col-md-12
+ OC(=O)c1ccc(cc1)C(=O)O
+ %tr.row
+ %td.col-md-12
+ ="..."
+ %br
+ %p
+ %div.row
+ %div.col-md-6
+ %strong Option 2:
+ %br
+ A spreadsheet with
+ %strong two
+ columns where the
+ %strong first column must contain a header ID
+ followed by any kind of ID you want to keep for the results and a
+ %strong second column with a header SMILES or InChI
+ followed by corresponding compounds.
+ %div.col-md-6
+ %table.help
+ %tr.row
+ %th.col-md-4
+ ID
+ %th.col-md-8
+ SMILES
+ %tr.row
+ %td.col-md-4
+ 2735
+ %td.col-md-8
+ C1ccccc1NN
+ %tr.row
+ %td.col-md-4
+ A2
+ %td.col-md-8
+ O=C(OCCCC)C1=CC=CC=C1C(OCCCC)=O
+ %tr.row
+ %td.col-md-4
+ 82 B-6 304663
+ %td.col-md-8
+ CC(C)(C)C1=CC2(C=C(C1=O)C(C)(C)C)CCC(=O)O2
+ %tr.row
+ %td.col-md-4
+ ="..."
+ %td.col-md-8
+ ="..."
+ %br
+ %p
+ %strong Uploaded CSV files will be stored until you delete them.
+ %strong You can repeat the prediction whenever you select a file in the list of uploads.
+ %br
+ %strong Please note that a new file uploaded with a same name from the list of existing files
+ %strong will not overwrite the existing file and instead the existing file will be used !
diff --git a/views/predict.haml b/views/predict.haml
index 054bfa2..d638451 100644
--- a/views/predict.haml
+++ b/views/predict.haml
@@ -143,10 +143,10 @@
%p
%label{:for=>"fileselect"}
or upload a CSV file for batch predictions
- %a.btn.glyphicon.glyphicon-info-sign{:href=>"javascript:void(0)", :title=>"File format", :tabindex=>"0", data: {trigger:"focus", toggle:"popover", placement:"auto", html:"true", content:"First column must contain a header with \"SMILES\" or \"InChI\" and the compounds. Also note that a file with the same name of a file that already exists won't be processed."}}
%br
%span.btn.btn-default.btn-file
%input{:type=>"file", :name=> "fileselect", :id=>"fileselect", :autocomplete=>"off", :accept=>"text/csv"}
+ %a.btn.btn-warning{:href => to("/help"), :rel => "external", :style=>"margin-left: 1em;"} Help
%div.col-md-6
- if !@existing_datasets.blank?
%label{:for=>"storage"} or select an uploaded CSV file
diff --git a/views/style.scss b/views/style.scss
index fc6f8f2..f908812 100644
--- a/views/style.scss
+++ b/views/style.scss
@@ -120,3 +120,17 @@ tr.hide-top > td {
overflow-y: auto;
overflow-x: auto;
}
+.help table, .help th, .help td {
+ background-color: white;
+ border: 1px solid black;
+ border-bottom: none;
+ width: 100%;
+}
+.help th, .help td {
+ padding: 10px;
+ text-align: left;
+}
+.storage-list {
+ background-color: #fff;
+ padding: 1em;
+}