diff options
Diffstat (limited to 'views/help.haml')
-rw-r--r-- | views/help.haml | 68 |
1 files changed, 68 insertions, 0 deletions
diff --git a/views/help.haml b/views/help.haml new file mode 100644 index 0000000..84be516 --- /dev/null +++ b/views/help.haml @@ -0,0 +1,68 @@ +%div.card.bg-light + %div.card-body + %h3 How to use batch prediction + + %p + You have two options to format your comma or tab sperated spreadsheet for batch predictions: + + %br + %p + %div.row + %div.col-md-6 + %strong Option 1: + %br + A spreadsheet with a single column and a header. The header should specify the input format (SMILES or InChI are accepted). + %div.col-md-6 + %table.help + %tr.row + %th.col-md-12 + SMILES + %tr.row + %td.col-md-12 + C1ccccc1NN + %tr.row + %td.col-md-12 + Cc1ccc(cc1\N=C=O)/N=C=O + %tr.row + %td.col-md-12 + OC(=O)c1ccc(cc1)C(=O)O + %tr.row + %td.col-md-12 + ="..." + %br + %p + %div.row + %div.col-md-6 + %strong Option 2: + %br + A spreadsheet with two columns and a header. The first column may contain an arbitrary ID, + the second column the compound structure (as SMILES or InChI). + The header consists of "ID" followed by the input format (SMILES or InChI). + %div.col-md-6 + %table.help + %tr.row + %th.col-md-4 + ID + %th.col-md-8 + SMILES + %tr.row + %td.col-md-4 + 2735 + %td.col-md-8 + C1ccccc1NN + %tr.row + %td.col-md-4 + A2 + %td.col-md-8 + O=C(OCCCC)C1=CC=CC=C1C(OCCCC)=O + %tr.row + %td.col-md-4 + 82 B-6 304663 + %td.col-md-8 + CC(C)(C)C1=CC2(C=C(C1=O)C(C)(C)C)CCC(=O)O2 + %tr.row + %td.col-md-4 + ="..." + %td.col-md-8 + ="..." + %br |