summaryrefslogtreecommitdiff
path: root/views
diff options
context:
space:
mode:
Diffstat (limited to 'views')
-rw-r--r--views/batch.haml51
-rw-r--r--views/details.haml12
-rw-r--r--views/help.haml68
-rw-r--r--views/info.haml5
-rw-r--r--views/layout.haml40
-rw-r--r--views/model_details.haml266
-rw-r--r--views/neighbors.haml2
-rw-r--r--views/predict.haml22
-rw-r--r--views/prediction.haml19
-rw-r--r--views/style.scss21
10 files changed, 353 insertions, 153 deletions
diff --git a/views/batch.haml b/views/batch.haml
index c5dd2f4..fb317c9 100644
--- a/views/batch.haml
+++ b/views/batch.haml
@@ -1,15 +1,47 @@
:javascript
+ $(document).ready(function(){
+ $('[data-toggle="popover"]').popover();
+ $('.modal').on('hidden.bs.modal', function () {
+ $(this).removeData('bs.modal');
+ });
+ $('.modal').on('show.bs.modal', function(e){
+ var button = $(e.relatedTarget);
+ var modal = $(this);
+ modal.find('.modal-content').load(button.data("remote"));
+ });
+ });
function progress(value,id) {
var percent = Math.round(value);
var bar = document.getElementById("bar_"+id);
+ var est = document.getElementById("est_"+id);
var prog = document.getElementById("progress_"+id);
bar.style.width = value + '%';
if (percent == 100){
prog.style.display = "none";
+ est.style.display = "none";
};
};
+ function remaining(id,tasktime,type) {
+ var est = document.getElementById("est_"+id);
+ var now = new Date().getTime();
+ if ( type == "true" ){
+ var approximate = new Date(tasktime*1000 + #{@compounds_size*1000});
+ } else {
+ var approximate = new Date(tasktime*1000 + #{@compounds_size*100});
+ }
+ var remain = approximate - now;
+ var minutes = Math.floor((remain % (1000 * 60 * 60)) / (1000 * 60));
+ var seconds = Math.floor((remain % (1000 * 60)) / 1000);
+ if ( minutes <= 0 && seconds <= 0 ) {
+ var newtime = "0m " + "00s ";
+ } else {
+ var newtime = minutes + "m " + seconds + "s ";
+ }
+ est.innerHTML = newtime;
+ };
+
var HttpClient = function() {
this.get = function(aUrl, aCallback) {
var anHttpRequest = new XMLHttpRequest();
@@ -58,9 +90,9 @@
$('#data-container_'+id).show();
$('#pager_'+id).show();
$('#pager_'+id).pagination({
- dataSource: '#{to("/prediction/task/?predictions=")}' + task_id + '&model=' + model_id ,
+ dataSource: '#{to("/prediction/task/?predictions=")}' + task_id,
locator: 'prediction',
- totalNumber: #{@compounds.size},
+ totalNumber: '#{@compounds_size}',
pageSize: 1,
showPageNumbers: true,
showGoInput: true,
@@ -106,15 +138,18 @@
%a.btn.btn-outline-info.btn-sm.disabled{:id => "detailsbutton_#{idx}", :data=>{:toggle=>"collapse"}, :href=>"javascript:void(0)", :onclick=>"pagePredictions('#{task}','#{model}','#{idx}')"}
%span.fa.fa-caret-right
Details
- %a.btn.btn-outline-info.btn-sm.disabled{:id => "downbutton_#{idx}", :href=>"#{to("/predict/csv/#{task}/#{model}/#{@filename}")}", :title=>"download"}
+ %a.btn.btn-outline-info.btn-sm.disabled{:id => "downbutton_#{idx}", :href=>"#{to("/predict/batch/download?tid=#{task}")}", :title=>"download"}
%span.fa.fa-download
CSV
%div{:id=>"progress_#{idx}", :style=>"width:100%;height:3px;position:relative;background-color:#ccc;"}
%div{:id=>"bar_#{idx}", :style=>"background-color: #4CAF50;width:10px;height:3px;position:absolute;"}
+ %p{:id=>"est_#{idx}"}
+ waiting ...
- # increase interval timer for large datasets
- - ctimer = ((@compounds.size/1000) == 0 ? 1000 : ((@compounds.size/1000)*1000))
+ - ctimer = ((@compounds_size/1000) == 0 ? 1000 : ((@compounds_size/1000)*1000))
:javascript
var timer = #{ctimer};
+ var tasktime = #{task.generation_time.to_i};
$(document).ready(function(){
// check button class before execute a task
if (#{idx} > 0){
@@ -122,12 +157,18 @@
var button = document.getElementById("detailsbutton_#{idx-1}");
if(!button.classList.contains('disabled')){
renderTask('#{task}','#{model}',#{idx});
+ remaining(#{idx},tasktime);
}
}, timer );
}else{
markers[#{idx}] = setInterval(function(){
renderTask('#{task}','#{model}',#{idx});
+ remaining(#{idx},tasktime,#{m.classification?});
}, timer );
};
});
- #data-container.card.d-none{:id=>idx}
+ #data-container.card.d-none.table-responsive{:id=>idx}
+%div.modal.fade{:id=>"details", :tabindex=>"-1", :role=>"dialog"}
+ %div.modal-dialog.modal-lg{:role=>"document"}
+ %div.modal-content
+
diff --git a/views/details.haml b/views/details.haml
index be4948a..abf7518 100644
--- a/views/details.haml
+++ b/views/details.haml
@@ -6,7 +6,7 @@
%button.close{ :type=>" button", data: { dismiss:"modal"}} &times;
%h3
Names and synonyms:
- %p= @compound.svg
+ %p= embedded_svg(@compound.svg, :title=>"x")
%p
%b="SMILES:"
%p= @smiles
@@ -14,6 +14,11 @@
%b="InChI:"
%p= @inchi
%br
+ - cid = @compound.cid
+ - if cid
+ %b="CID:"
+ %p= cid
+ %br
%b="Names:"
%p{:style=>"padding-left:0.5em;"}
- if @names !~ /^no names/i
@@ -23,6 +28,9 @@
%hr
%p{:style=>"padding-left:0.5em;"}
/ pubchem link
- %a.btn.btn-primary{:href=>"http://aop.in-silico.ch/", :title=>"Link opens in new window.", :alt=>"pubchem read across", :rel=>"external"} PubChem read across
+ - if cid
+ %a.btn.btn-primary{:href=>"http://aop.in-silico.ch/cid/#{cid}", :title=>"Link opens in new window.", :alt=>"pubchem read across", :rel=>"external"} PubChem read across
+ - else
+ %a.btn.btn-primary{:href=>"http://aop.in-silico.ch/", :title=>"Link opens in new window.", :alt=>"pubchem read across", :rel=>"external"} PubChem read across
%i (experimental)
%br
diff --git a/views/help.haml b/views/help.haml
new file mode 100644
index 0000000..84be516
--- /dev/null
+++ b/views/help.haml
@@ -0,0 +1,68 @@
+%div.card.bg-light
+ %div.card-body
+ %h3 How to use batch prediction
+
+ %p
+ You have two options to format your comma or tab sperated spreadsheet for batch predictions:
+
+ %br
+ %p
+ %div.row
+ %div.col-md-6
+ %strong Option 1:
+ %br
+ A spreadsheet with a single column and a header. The header should specify the input format (SMILES or InChI are accepted).
+ %div.col-md-6
+ %table.help
+ %tr.row
+ %th.col-md-12
+ SMILES
+ %tr.row
+ %td.col-md-12
+ C1ccccc1NN
+ %tr.row
+ %td.col-md-12
+ Cc1ccc(cc1\N=C=O)/N=C=O
+ %tr.row
+ %td.col-md-12
+ OC(=O)c1ccc(cc1)C(=O)O
+ %tr.row
+ %td.col-md-12
+ ="..."
+ %br
+ %p
+ %div.row
+ %div.col-md-6
+ %strong Option 2:
+ %br
+ A spreadsheet with two columns and a header. The first column may contain an arbitrary ID,
+ the second column the compound structure (as SMILES or InChI).
+ The header consists of "ID" followed by the input format (SMILES or InChI).
+ %div.col-md-6
+ %table.help
+ %tr.row
+ %th.col-md-4
+ ID
+ %th.col-md-8
+ SMILES
+ %tr.row
+ %td.col-md-4
+ 2735
+ %td.col-md-8
+ C1ccccc1NN
+ %tr.row
+ %td.col-md-4
+ A2
+ %td.col-md-8
+ O=C(OCCCC)C1=CC=CC=C1C(OCCCC)=O
+ %tr.row
+ %td.col-md-4
+ 82 B-6 304663
+ %td.col-md-8
+ CC(C)(C)C1=CC2(C=C(C1=O)C(C)(C)C)CCC(=O)O2
+ %tr.row
+ %td.col-md-4
+ ="..."
+ %td.col-md-8
+ ="..."
+ %br
diff --git a/views/info.haml b/views/info.haml
index d8b93f9..148d53f 100644
--- a/views/info.haml
+++ b/views/info.haml
@@ -1,2 +1,3 @@
-%div.info
- We are rebuilding the models. It will take a while, please be patient and reload the page in some time.
+%div.card.border-warning.mb-3
+ %div.card-body
+ We are rebuilding the models. It will take a while, please be patient and reload the page in some time.
diff --git a/views/layout.haml b/views/layout.haml
index 1d95ae2..3304c69 100644
--- a/views/layout.haml
+++ b/views/layout.haml
@@ -24,20 +24,14 @@
%div.row.align-items-center
%div.col-3
%a.card-link{:href=> "https://in-silico.ch/", :rel=>"external"}
- %img{:src=>"/images/IST_logo_s.png", :alt=>"logo", :width=>"100px", :heigth=>"100px"}
- %a.card-link{:href=> "https://openrisknet.org/", :rel=>"external"}
- %img{:src=>"/images/orn-logo.jpg", :alt=>"orn-logo", :width=>"100px", :heigth=>"100px"}
- %div.col-6
+ %img{:src=>"/images/IST_logo_s.png", :alt=>"logo", :width=>"120px"}
+ %div.col-7
%h1 lazar toxicity predictions
- %div.col-3
- %a{:href=>"https://twitter.com/intent/tweet?source=http%3A%2F%2Flazar.in-silico.ch&text=http%3A%2F%2Flazar.in-silico.ch", :rel=>"external", :title=>"Tweet"}
- %span.fa.fa-2x.fa-twitter-square
- %a{:href=>"https://plus.google.com/share?url=http%3A%2F%2Flazar.in-silico.ch", :rel=>"external", :title=>"Share on Google+"}
- %span.fa.fa-2x.fa-google-plus-square
- %a{:href=>"http://www.linkedin.com/shareArticle?mini=true&url=http%3A%2F%2Flazar.in-silico.ch&title=&summary=&source=http%3A%2F%2Flazar.in-silico.ch", :rel=>"external", :title=>"Share on LinkedIn"}
- %span.fa.fa-2x.fa-linkedin-square
- %a{:href=>"https://www.facebook.com/sharer/sharer.php?u=http%3A%2F%2Flazar.in-silico.ch&title=&summary=&source=http%3A%2F%2Flazar.in-silico.ch", :rel=>"external", :title=>"Share on Facebook"}
- %span.fa.fa-2x.fa-facebook-square
+ %div.col-2
+ %h5
+ %a.text-right{:href=>"https://nano-lazar.in-silico.ch", :rel=>"external"}
+ nano-lazar
+ %span.fa.fa-xs.fa-external-link
%div.container-fluid
%topline.alert
%p
@@ -54,7 +48,12 @@
%a{ :href=>"https://doi.org/10.3389/fphar.2013.00038", :rel=>"external"}
%img{ :src=>"https://zenodo.org/badge/DOI/10.3389/zenodo.10.3389.svg", :alt=>"DOI"}
in scientific publications.
-
+ %a{:href=>"https://twitter.com/intent/tweet?source=http%3A%2F%2Flazar.in-silico.ch&text=https%3A%2F%2Flazar.in-silico.ch", :rel=>"external", :title=>"Tweet"}
+ %span.fa.fa-twitter-square
+ %a{:href=>"http://www.linkedin.com/shareArticle?mini=true&url=https%3A%2F%2Flazar.in-silico.ch&title=&summary=&source=https%3A%2F%2Flazar.in-silico.ch", :rel=>"external", :title=>"Share on LinkedIn"}
+ %span.fa.fa-linkedin-square
+ %a{:href=>"https://www.facebook.com/sharer/sharer.php?u=https%3A%2F%2Flazar.in-silico.ch&title=&summary=&source=https%3A%2F%2Flazar.in-silico.ch", :rel=>"external", :title=>"Share on Facebook"}
+ %span.fa.fa-facebook-square
= yield
@@ -67,6 +66,19 @@
%a{:href => 'http://www.in-silico.ch', :rel => "external"} <i style="font-family: serife">in silico</i> toxicology gmbh 2004 - #{Time.now.year.to_s}
|
%a{:href => to("/license"), :rel => "external"} GPL3 License
+ %supporters.row
+ %div.card-body.text-center
+ %div.card-title
+ Financial support by
+ %div.card-text
+ %a{:href=>"http://www.bfr.bund.de/de/start.html", :rel=>"external"}
+ %img{:src=>"/images/bfr_logo.gif"}
+ %a{:href=>"http://www.opentox.org/", :rel=>"external"}
+ %img{:src=>"/images/ot_logo.png"}
+ %a{:href=>"https://enanomapper.net/", :rel=>"external"}
+ %img{:src=>"/images/enm_logo.png"}
+ %a{:href=>"https://www.researchgate.net/institution/Nestle_SA/department/Nestle_Research_Center", :rel=>"external"}
+ %img{:src=>"/images/nestec.jpg"}
#back-top{:style => "z-index:100;position:fixed;bottom:1%;right:1%;"}
%a{:href => "", :style=>"text:decoration:none;color:#ccc;"}
diff --git a/views/model_details.haml b/views/model_details.haml
index 5417a48..8691325 100644
--- a/views/model_details.haml
+++ b/views/model_details.haml
@@ -9,9 +9,8 @@
= "Type:\t"
= type
%br
- - training_dataset = OpenTox::Dataset.find model.model.training_dataset_id
= "Training compounds:\t"
- = training_dataset.data_entries.size
+ = data_entries.count/3
%br
= "Training dataset:\t"
%a{:href=>"#{to("/predict/dataset/#{training_dataset.name}")}"}
@@ -20,134 +19,157 @@
%div.card.bg-light
%div.card-body
%h6.card-title Algorithms:
- Similarity:
- %a{:href=> "http://www.rubydoc.info/gems/lazar/OpenTox%2F#{model.model.algorithms["similarity"]["method"].sub("::", "%2F")}", :rel=>"external"}
- = model.model.algorithms["similarity"]["method"]
- = ", min: #{model.model.algorithms["similarity"]["min"]}"
- %br
- Prediction:
- - if model.model.algorithms["prediction"]["method"] !~ /Caret/
- %a{:href=>"http://www.rubydoc.info/gems/lazar/OpenTox%2F#{model.model.algorithms["prediction"]["method"].sub("::","%2f")}", :rel=>"external"}
- = model.model.algorithms["prediction"]["method"]
- - else
- %a{:href=>"http://www.rubydoc.info/gems/lazar/OpenTox/Algorithm/Caret", :rel=>"external"}
- = model.model.algorithms["prediction"]["method"]
+ %p.card-text
+ Similarity:
+ %a.card-link{:href=> "http://www.rubydoc.info/gems/lazar/OpenTox%2F#{model.model.algorithms["similarity"]["method"].sub("::", "%2F")}", :rel=>"external"}
+ = model.model.algorithms["similarity"]["method"]
+ = ", min: #{model.model.algorithms["similarity"]["min"]}"
+ %br
+ Prediction:
+ - if model.model.algorithms["prediction"]["method"] !~ /Caret/
+ %a.card-link{:href=>"http://www.rubydoc.info/gems/lazar/OpenTox%2F#{model.model.algorithms["prediction"]["method"].sub("::","%2f")}", :rel=>"external"}
+ = model.model.algorithms["prediction"]["method"]
+ - else
+ %a.card-link{:href=>"http://www.rubydoc.info/gems/lazar/OpenTox/Algorithm/Caret", :rel=>"external"}
+ = model.model.algorithms["prediction"]["method"]
- %br
- Descriptors:
- = model.model.algorithms["descriptors"]["method"]+","
- = model.model.algorithms["descriptors"]["type"]
+ %br
+ Descriptors:
+ = model.model.algorithms["descriptors"]["method"]+","
+ = model.model.algorithms["descriptors"]["type"]
%div.card.bg-light
%div.card-body
- if type == "Classification"
- %h6.card-title Independent crossvalidations:
+ %h6.card-text Independent crossvalidations:
- else
- %h6.card-title Independent crossvalidations (-log10 transformed):
- %div.row{:id=>"validations#{model.id}"}
- - crossvalidations.each do |cv|
- %span.col-4
- = "Num folds:\t"
- = cv.folds
- %br
- = "Num instances:\t"
- = cv.nr_instances
- %br
- = "Num unpredicted"
- = cv.nr_unpredicted
- - if model.classification?
- %br
- = "Accuracy:\t"
- = cv.accuracy.round(3) if cv.accuracy
- %br
- = "Weighted accuracy:\t"
- = cv.weighted_accuracy.round(3) if cv.weighted_accuracy
- - if cv.true_rate
- %br
- = "True positive rate:\t"
- = cv.true_rate[cv.accept_values[0]].round(3)
- %br
- = "True negative rate:\t"
- = cv.true_rate[cv.accept_values[1]].round(3)
- - if cv.predictivity
- %br
- = "Positive predictive value:\t"
- = cv.predictivity[cv.accept_values[0]].round(3)
- %br
- = "Negative predictive value:\t"
- = cv.predictivity[cv.accept_values[1]].round(3)
- %p
- - ["confusion_matrix", "weighted_confusion_matrix"].each_with_index do |matrix,idx|
- %b= (idx == 0 ? "Confusion Matrix" : "Weighted Confusion Matrix")
- %div.table-responsive
- %table.table.table-sm.table-borderless
- %tbody
- %tr
- %td
- %td
- %td
- %b actual
- %td
- %td
- %tr
- %td
- %td
- %td active
- %td inactive
- -#%td total
- %tr
- %td
- %b predicted
- %td active
- %td
- =( idx == 1 ? cv.send(matrix)[0][0].round(3) : cv.send(matrix)[0][0])
- %td
- =( idx == 1 ? cv.send(matrix)[0][1].round(3) : cv.send(matrix)[0][1])
- -#%td
- =cv.confusion_matrix[0][0]+cv.confusion_matrix[0][1]
- %tr
- %td
- %td inactive
- %td
- =( idx == 1 ? cv.send(matrix)[1][0].round(3) : cv.send(matrix)[1][0])
- %td
- =( idx == 1 ? cv.send(matrix)[1][1].round(3) : cv.send(matrix)[1][1])
- -#%td
- =cv.confusion_matrix[1][0]+cv.confusion_matrix[1][1]
- -#%tr
- %td
- %td total
- %td
- =cv.confusion_matrix[0][0]+cv.confusion_matrix[1][0]
- %td
- =cv.confusion_matrix[0][1]+cv.confusion_matrix[1][1]
- %td
- -#= "Confusion Matrix:\t"
- -#= cv.confusion_matrix
+ %h6.card-text Independent crossvalidations (-log10 transformed):
+ - crossvalidations.each_with_index do |cv,idx|
+ %div.card.bg-light
+ %div.card-body
+ %h6.card-title= "Nr.#{idx+1} | Num folds:#{cv.folds}"
+ %p.card-text
+ / predictions nr
+ %div.row
+ %div.col-6
+ %h6
+ Predictions number:
+ - cv.nr_predictions.each do |key,value|
+ %div.row
+ %div.col
+ %h6
+ = key
+ %div.col
+ = value
+ - if model.classification?
+ %hr
+ %div.row
+ / accuracy
+ %div.col-6
+ %h6
+ Accuracy:
+ - cv.accuracy.each do |key, value|
+ %div.row
+ %div.col
+ %h6
+ = key
+ %div.col
+ = value.signif(3)
+ %hr
+ / matrixes
+ %div.row
+ - cv.confusion_matrix.each do |key,matrix|
+ %div.col-4
+ %h6
+ Confusion Matrix:
+ %i= key
%br
- %br
- /= "Confidence plot:"
- /%p.plot
- / %img{:src=>"confp#{cv.id}.svg"}
+ %table.table.table-sm.table-borderless.col-4
+ %tbody
+ %tr
+ %td
+ %td
+ %td
+ %h6 actual
+ %td
+ %tr
+ %td
+ %td
+ %td active
+ %td inactive
+ %tr
+ %td
+ %h6 predicted
+ %td active
+ %td
+ = matrix[0][0]
+ %td
+ = matrix[0][1]
+ %tr
+ %td
+ %td inactive
+ %td
+ = matrix[1][0]
+ %td
+ = matrix[1][1]
+ %br
- if model.regression?
- %br
- %a{:href=>"https://en.wikipedia.org/wiki/Root-mean-square_deviation", :rel=>"external"} RMSE:
- = cv.rmse.round(3) if cv.rmse
- %br
- %a{:href=>"https://en.wikipedia.org/wiki/Mean_absolute_error", :rel=>"external"} MAE:
- = cv.mae.round(3) if cv.mae
- %br
- %a{:href=>"https://en.wikipedia.org/wiki/Coefficient_of_determination", :rel=>"external"}= "R"+"<sup>2</sup>"+":"
- = cv.r_squared.round(3) if cv.r_squared
- %br
- /= "Confidence plot:"
- /%p.plot
- / %img{:src=>"/confp#{cv.id}.svg"}
- /%br
- /= "Correlation plot"
- /%p.plot
- / %img{:src=>"/corrp#{cv.id}.svg"}
-
+ %hr
+ %div.row
+ %div.col
+ %h6
+ %a.card-link{:href=>"https://en.wikipedia.org/wiki/Root-mean-square_deviation", :rel=>"external"}
+ RMSE:
+ - cv.rmse.each do |key,value|
+ %div.row
+ %div.col
+ %h6
+ = key
+ %div.col
+ = value.signif(3)
+ %div.col
+ %h6
+ %a.card-link{:href=>"https://en.wikipedia.org/wiki/Mean_absolute_error", :rel=>"external"}
+ MAE:
+ - cv.mae.each do |key,value|
+ %div.row
+ %div.col
+ %h6
+ = key
+ %div.col
+ = value.signif(3)
+ %div.col
+ %h6
+ %a.card-link{:href=>"https://en.wikipedia.org/wiki/Coefficient_of_determination", :rel=>"external"}= "R"+"<sup>2</sup>"+":"
+ - cv.r_squared.each do |key,value|
+ %div.row
+ %div.col
+ %h6.card-title
+ = key
+ %div.col
+ = value.signif(3)
+ %hr
+ %div.row
+ %div.col
+ %h6
+ Within prediction interval:
+ - cv.within_prediction_interval.each do |key,value|
+ %div.row
+ %div.col
+ %h6
+ = key
+ %div.col
+ = value
+ %div.col
+ %h6
+ Out of prediction interval:
+ - cv.out_of_prediction_interval.each do |key,value|
+ %div.row
+ %div.col
+ %h6
+ = key
+ %div.col
+ = value
%div.card.bg-light
%div.card-body
%h6.card-title QMRF:
diff --git a/views/neighbors.haml b/views/neighbors.haml
index f9d2691..c4f3b94 100644
--- a/views/neighbors.haml
+++ b/views/neighbors.haml
@@ -37,7 +37,7 @@
- c = Compound.find(neighbor)
%td
%a.btn.btn-link{:href => "#details#{j+1}", data: { toggle: "modal", remote: to("/prediction/#{CGI.escape(c.id.to_s)}/details"), :id=>"link#{j+1}#{count}"}}
- = c.svg
+ = embedded_svg(c.svg, :title=>"click for details")
%td
%p= c.smiles
diff --git a/views/predict.haml b/views/predict.haml
index d23f26a..d525b33 100644
--- a/views/predict.haml
+++ b/views/predict.haml
@@ -1,6 +1,7 @@
%link{ :href=>"/jsme/jsa.css", :rel=>"stylesheet", :property=>"stylesheet"}
%script{:src=>"/jsme/jsme.nocache.js"}
:javascript
+ // GET request
var HttpClient = function() {
this.get = function(aUrl, aCallback) {
var anHttpRequest = new XMLHttpRequest();
@@ -23,6 +24,7 @@
}
});*/
+ // get and check input
function getInput(){
identifier = document.getElementById("identifier").value.trim();
fileselect = document.getElementById("fileselect").value;
@@ -34,6 +36,8 @@
};
return 0;
};
+
+ // display wait animation
function showcircle() {
switch (getInput()){
case 0:
@@ -64,6 +68,8 @@
};
return false;
};
+
+ // check if a file was selected for upload
function checkfile() {
var fileinput = document.getElementById("fileselect");
if(fileinput.value != "") {
@@ -73,6 +79,8 @@
alert("Please select a file (csv).");
return false;
};
+
+ // check if a smiles string was entered
function checksmiles () {
getsmiles();
if (document.form.identifier.value == "") {
@@ -83,6 +91,8 @@
};
return true;
};
+
+ // check if a model was selected
function checkboxes () {
var checked = false;
$('input[type="checkbox"]').each(function() {
@@ -97,6 +107,8 @@
};
return true;
};
+
+ // display jsme editor with option
function jsmeOnLoad() {
jsmeApplet = new JSApplet.JSME("appletContainer", "380px", "340px", {
//optional parameters
@@ -104,12 +116,15 @@
});
document.JME = jsmeApplet;
};
+
+ // get and take smiles from jsme editor for input field
function getsmiles() {
if (document.JME.smiles() != '') {
document.form.identifier.value = document.JME.smiles() ;
};
};
+ // show model details
function loadDetails(id) {
button = document.getElementById("link"+id);
span = button.childNodes[1];
@@ -133,6 +148,7 @@
});
}
}
+
// whole site content needs to be in one form. Input and checkboxes are proofed by js functions.
%form{:name => "form", :action => to('/predict'), :method => "post", :enctype => "multipart/form-data", :onsubmit => "return !!(showcircle())" }
%fieldset#top.card.bg-light
@@ -147,11 +163,13 @@
%a{:href => "http://en.wikipedia.org/wiki/Simplified_molecular_input_line_entry_specification", :rel => "external"} SMILES
string:
%input.form-control{:type => 'text', :name => 'identifier', :id => 'identifier'}
- %p{:style=>"display:none;"}
+ %p{:style=>("display:none;" unless ENV["BATCH_MODE"].to_boolean)}
%label{:for=>"fileselect"}
or upload a CSV file for batch predictions:
%br
- %input.form-control-file{:type=>"file", :name=> "fileselect", :id=>"fileselect", :accept=>"text/csv"}
+ %span.btn.btn-file{:style=>"background-color:white;"}
+ %input.form-control-file{:type=>"file", :name=> "fileselect", :id=>"fileselect", :accept=>"text/csv"}
+ %a.btn.btn-warning{:href => to("/help"), :rel => "external", :style=>"margin-left: 1em;"} Help
%fieldset#middle.card.bg-light
#models.card-body
diff --git a/views/prediction.haml b/views/prediction.haml
index 47e83fa..2a315f9 100644
--- a/views/prediction.haml
+++ b/views/prediction.haml
@@ -16,14 +16,14 @@
New Prediction
%div.card.bg-light
%div.card-body
- %h3.card-title Prediction Results:
+ %h3.card-title Prediction:
%div.table-responsive
%table.table.table-bordered{:id=>"overview"}
%tbody
%tr
%td.align-items-center{:id=>"compound"}
%a.btn.btn-link{:href => "#details0", data: { toggle: "modal", remote: to("/prediction/#{@compound.id}/details"), :id=>"link01"}}
- = @compound.svg
+ = embedded_svg(@compound.svg, :title=>"click for details")
%p= @compound.smiles
- @model_types = {}
- @dbhit = {}
@@ -71,9 +71,9 @@
%br
= (type == "Regression") ? "#{prediction[:value].delog10.signif(3)} (#{unit})</br>#{@compound.mmol_to_mg(prediction[:value].delog10).signif(3)} #{(unit =~ /\b(mmol\/L)\b/) ? "(mg/L)" : "(mg/kg_bw/day)"}" : prediction[:value]
- / show prediction interval or probability
+ / show prediction interval or probability
+ - if type == "Regression"
%p
- - if type == "Regression"
%b 95% Prediction interval:
- interval = (prediction[:prediction_interval].nil? ? nil : prediction[:prediction_interval])
/ prediction interval popover
@@ -82,7 +82,12 @@
= interval.nil? ? "--" : "#{interval[1].delog10.signif(3)} - #{interval[0].delog10.signif(3)} (#{unit})"
%br
= "#{@compound.mmol_to_mg(interval[1].delog10).signif(3)} - #{@compound.mmol_to_mg(interval[0].delog10).signif(3)} #{(unit =~ /\b(mmol\/L)\b/) ? "(mg/L)" : "(mg/kg_bw/day)"}" if !interval.nil?
- - else
+ %p
+ %b Confidence:
+ %br
+ = prediction[:confidence]
+ - else
+ %p
%b Probability:
/ probability popover
%a.btn.fa.fa-info-circle{:href=>"javascript:void(0)", :title=>"Pobability", :tabindex=>"0", data: {trigger:"focus", toggle:"popover", placement:"left", html:"true", content:"Probability that the prediction belongs to one of the given classes."}}
@@ -92,6 +97,10 @@
- if prediction[:probabilities].size == 2
%br
= "#{prediction[:probabilities].keys[1]}: #{prediction[:probabilities].values[1].signif(3)}"
+ %p
+ %b Confidence:
+ %br
+ = prediction[:confidence]
/ show warnings and info
%p
diff --git a/views/style.scss b/views/style.scss
index 5d47872..01b5147 100644
--- a/views/style.scss
+++ b/views/style.scss
@@ -72,3 +72,24 @@ ul.share-buttons{
table-layout: fixed;
width: 100%;
}
+.help table, .help th, .help td {
+ background-color: white;
+ border: 1px solid black;
+ border-bottom: none;
+ width: 100%;
+}
+.help th, .help td {
+ padding: 10px;
+ text-align: left;
+}
+/*img.supporters {
+ width: 150px;
+ height: 150px;
+}*/
+supporters{
+ background-color: #fff;
+ img{
+ width: 200px;
+ margin: 1em;
+ }
+}