summaryrefslogtreecommitdiff
diff options
context:
space:
mode:
authorhelma@in-silico.ch <helma@in-silico.ch>2018-10-05 17:06:46 +0200
committerhelma@in-silico.ch <helma@in-silico.ch>2018-10-05 17:06:46 +0200
commite718cf76f32fb29d6c7c3732ec82f35b0da49122 (patch)
treed72323ef501ed3122a11fbca9e2bb8b653e29f23
parentea0864ae89d57839177c850e3b473f0aa5987474 (diff)
sdf import, csv files with id column
-rw-r--r--lib/compound.rb3
-rw-r--r--lib/dataset.rb237
-rw-r--r--test/data/input_53.csv54
-rw-r--r--test/data/input_53.tsv54
-rw-r--r--test/dataset.rb52
-rw-r--r--test/setup.rb6
6 files changed, 389 insertions, 17 deletions
diff --git a/lib/compound.rb b/lib/compound.rb
index e8f6bc4..d80f579 100644
--- a/lib/compound.rb
+++ b/lib/compound.rb
@@ -319,7 +319,8 @@ module OpenTox
obconversion.read_string obmol, identifier
case output_format
when /smi|can|inchi/
- obconversion.write_string(obmol).gsub(/\s/,'').chomp
+ #obconversion.write_string(obmol).gsub(/\s/,'').chomp
+ obconversion.write_string(obmol).split(/\s/).first
when /sdf/
# TODO: find disconnected structures
# strip_salts
diff --git a/lib/dataset.rb b/lib/dataset.rb
index 4e504de..17c30d5 100644
--- a/lib/dataset.rb
+++ b/lib/dataset.rb
@@ -1,5 +1,6 @@
require 'csv'
require 'tempfile'
+require 'digest/md5'
module OpenTox
@@ -7,6 +8,7 @@ module OpenTox
class Dataset
field :data_entries, type: Hash, default: {}
+ field :md5, type: String
# Readers
@@ -104,6 +106,7 @@ module OpenTox
# Convert dataset to csv format including compound smiles as first column, other column headers are feature names
# @return [String]
+ # TODO original_id
def to_csv(inchi=false)
CSV.generate() do |csv|
compound = substances.first.is_a? Compound
@@ -152,28 +155,120 @@ module OpenTox
# Parsers
- # Create a dataset from file (csv,sdf,...)
- # @param filename [String]
- # @return [String] dataset uri
- # TODO
- #def self.from_sdf_file
- #end
+ # Create a dataset from PubChem Assay
+ # @param [File]
+ # @return [OpenTox::Dataset]
+ def self.from_pubchem aid
+ csv = RestClientWrapper.get "https://pubchem.ncbi.nlm.nih.gov/rest/pug/assay/aid/#{aid}/CSV"
+ table = CSV.read csv
+ puts table
+=begin
+ dataset = self.new(:source => file, :name => name, :md5 => md5)
+ dataset.parse_table table, accept_empty_values
+ else
+ puts csv
+i = 0
+activities = []
+File.readlines(ARGV[0]).each do |line|
+ if i > 2
+ tokens = line.split ","
+ p line if tokens[1].empty?
+ activities << [tokens[1],tokens[3]]
+ end
+ i += 1
+end
+
+puts "SMILES,Activity"
+activities.each_slice(100) do |slice| # get SMILES in chunks
+ sids = slice.collect{|e| e[0]}
+ smiles = `curl https://pubchem.ncbi.nlm.nih.gov/rest/pug/compound/cid/#{sids.join(",")}/property/CanonicalSMILES/TXT`.split("\n")
+ abort("Could not get SMILES for all SIDs from PubChem") unless sids.size == smiles.size
+ smiles.each_with_index do |smi,i|
+ act = slice[i]
+ puts [smi.chomp,act[1]].join(",")
+ end
+end
+=end
+ end
+
+ # Create a dataset from SDF file
+ # @param [File]
+ # @return [OpenTox::Dataset]
+ def self.from_sdf_file file
+ md5 = Digest::MD5.hexdigest(File.read(file)) # use hash to identify identical files
+ dataset = self.find_by(:md5 => md5)
+ if dataset
+ $logger.debug "Skipping import of #{file}, it is already in the database (id: #{dataset.id})."
+ else
+ $logger.debug "Parsing #{file}."
+ table = nil
+ read_result = false
+ sdf = ""
+ dataset = self.new(:source => file, :name => name, :md5 => md5)
+ original_id = NominalFeature.find_or_create_by(:name => "original_id")
+
+ feature_name = ""
+ compound = nil
+ features = {}
+
+ File.readlines(file).each do |line|
+ if line.match %r{\$\$\$\$}
+ sdf << line
+ id = sdf.split("\n").first.chomp
+ compound = Compound.from_sdf sdf
+ dataset.add compound, original_id, id
+ features.each { |f,v| dataset.add compound, f, v }
+ sdf = ""
+ features = {}
+ elsif line.match /^>\s+</
+ feature_name = line.match(/^>\s+<(.*)>/)[1]
+ read_result = true
+ else
+ if read_result
+ value = line.chomp
+ if value.numeric?
+ feature = NumericFeature.find_or_create_by(:name => feature_name)
+ value = value.to_f
+ else
+ feature = NominalFeature.find_or_create_by(:name => feature_name)
+ end
+ features[feature] = value
+ #p compound.smiles, feature.name, value
+ read_result = false
+ else
+ sdf << line
+ end
+ end
+ end
+ end
+ dataset
+
+ end
# Create a dataset from CSV file
# @param [File]
# @param [TrueClass,FalseClass] accept or reject empty values
# @return [OpenTox::Dataset]
def self.from_csv_file file, accept_empty_values=false
- source = file
- name = File.basename(file,".*")
- dataset = self.find_by(:source => source, :name => name)
+ md5 = Digest::MD5.hexdigest(File.read(file)) # use hash to identify identical files
+ dataset = self.find_by(:md5 => md5)
if dataset
$logger.debug "Skipping import of #{file}, it is already in the database (id: #{dataset.id})."
else
$logger.debug "Parsing #{file}."
- table = CSV.read file, :skip_blanks => true, :encoding => 'windows-1251:utf-8'
- dataset = self.new(:source => source, :name => name)
- dataset.parse_table table, accept_empty_values
+ table = nil
+ [",","\t",";"].each do |sep| # guess CSV separator
+ if File.readlines(file).first.match(/#{sep}/)
+ table = CSV.read file, :col_sep => sep, :skip_blanks => true, :encoding => 'windows-1251:utf-8'
+ break
+ end
+ end
+ if table
+ dataset = self.new(:source => file, :name => name, :md5 => md5)
+ dataset.parse_table table, accept_empty_values
+ else
+ bad_request_error "#{file} is not a valid CSV/TSV file. Could not find "," ";" or TAB as column separator."
+ end
end
dataset
end
@@ -187,10 +282,18 @@ module OpenTox
# features
feature_names = table.shift.collect{|f| f.strip}
warnings << "Duplicated features in table header." unless feature_names.size == feature_names.uniq.size
- compound_format = feature_names.shift.strip
+
+ original_id = nil
+ if feature_names[0] =~ /ID/i # check ID column
+ feature_names.shift
+ original_id = NominalFeature.find_or_create_by(:name => "original_id")
+ end
+
+ compound_format = feature_names.shift
bad_request_error "#{compound_format} is not a supported compound format. Accepted formats: SMILES, InChI." unless compound_format =~ /SMILES|InChI/i
numeric = []
features = []
+
# guess feature types
feature_names.each_with_index do |f,i|
metadata = {:name => f}
@@ -213,6 +316,7 @@ module OpenTox
all_substances = []
table.each_with_index do |vals,i|
+ original_id_value = vals.shift.strip if original_id
identifier = vals.shift.strip
warn "No feature values for compound at line #{i+2} of #{source}." if vals.compact.empty? and !accept_empty_values
begin
@@ -239,6 +343,8 @@ module OpenTox
next
end
+ add substance, original_id, original_id_value if original_id
+
vals.each_with_index do |v,j|
if v.blank?
warn "Empty value for compound '#{identifier}' and feature '#{feature_names[i]}'."
@@ -294,4 +400,109 @@ module OpenTox
end
+ class Batch
+
+ include OpenTox
+ include Mongoid::Document
+ include Mongoid::Timestamps
+ store_in collection: "batch"
+ field :name, type: String
+ field :source, type: String
+ field :identifiers, type: Array
+ field :ids, type: Array
+ field :compounds, type: Array
+ field :warnings, type: Array, default: []
+
+ def self.from_csv_file file
+ source = file
+ name = File.basename(file,".*")
+ batch = self.find_by(:source => source, :name => name)
+ if batch
+ $logger.debug "Skipping import of #{file}, it is already in the database (id: #{batch.id})."
+ else
+ $logger.debug "Parsing #{file}."
+ # check delimiter
+ line = File.readlines(file).first
+ if line.match(/\t/)
+ table = CSV.read file, :col_sep => "\t", :skip_blanks => true, :encoding => 'windows-1251:utf-8'
+ else
+ table = CSV.read file, :skip_blanks => true, :encoding => 'windows-1251:utf-8'
+ end
+ batch = self.new(:source => source, :name => name, :identifiers => [], :ids => [], :compounds => [])
+
+ # original IDs
+ if table[0][0] =~ /ID/i
+ @original_ids = table.collect{|row| row.shift}
+ @original_ids.shift
+ end
+
+ # features
+ feature_names = table.shift.collect{|f| f.strip}
+ warnings << "Duplicated features in table header." unless feature_names.size == feature_names.uniq.size
+ compound_format = feature_names.shift.strip
+ unless compound_format =~ /SMILES|InChI/i
+ File.delete file
+ bad_request_error "'#{compound_format}' is not a supported compound format in the header. " \
+ "Accepted formats: SMILES, InChI. Please take a look on the help page."
+ end
+ numeric = []
+ features = []
+ # guess feature types
+ feature_names.each_with_index do |f,i|
+ metadata = {:name => f}
+ values = table.collect{|row| val=row[i+1].to_s.strip; val.blank? ? nil : val }.uniq.compact
+ types = values.collect{|v| v.numeric? ? true : false}.uniq
+ feature = nil
+ if values.size == 0 # empty feature
+ elsif values.size > 5 and types.size == 1 and types.first == true # 5 max classes
+ numeric[i] = true
+ feature = NumericFeature.find_or_create_by(metadata)
+ else
+ metadata["accept_values"] = values
+ numeric[i] = false
+ feature = NominalFeature.find_or_create_by(metadata)
+ end
+ features << feature if feature
+ end
+
+ table.each_with_index do |vals,i|
+ identifier = vals.shift.strip.gsub(/^'|'$/,"")
+ begin
+ case compound_format
+ when /SMILES/i
+ compound = OpenTox::Compound.from_smiles(identifier)
+ when /InChI/i
+ compound = OpenTox::Compound.from_inchi(identifier)
+ end
+ rescue
+ compound = nil
+ end
+ # collect only for present compounds
+ unless compound.nil?
+ batch.identifiers << identifier
+ batch.compounds << compound.id
+ batch.ids << @original_ids[i] if @original_ids
+ else
+ batch.warnings << "Cannot parse #{compound_format} compound '#{identifier}' at line #{i+2} of #{source}."
+ end
+ end
+ batch.compounds.duplicates.each do |duplicate|
+ $logger.debug "Duplicates found in #{name}."
+ dup = Compound.find duplicate
+ positions = []
+ batch.compounds.each_with_index do |co,i|
+ c = Compound.find co
+ if !c.blank? and c.inchi and c.inchi == dup.inchi
+ positions << i+1
+ end
+ end
+ batch.warnings << "Duplicate compound at ID #{positions.join(' and ')}."
+ end
+ batch.save
+ end
+ batch
+ end
+
+ end
+
end
diff --git a/test/data/input_53.csv b/test/data/input_53.csv
new file mode 100644
index 0000000..b213027
--- /dev/null
+++ b/test/data/input_53.csv
@@ -0,0 +1,54 @@
+ID,SMILES
+123-30-8,Oc1ccc(N)cc1
+68391-25-3,OC(COc1ccccc1)CNc2ccc(cc2)Cc3ccc(N)cc3
+62-53-3,Nc1ccccc1
+123-98-8,O=C(CCCCCCCC(=O)Cl)Cl
+106-51-4,O=C1C=CC(=O)C=C1
+7144-65-2,O(c1ccccc1c2ccccc2)CC3OC3
+3130-19-6,O=C(OCC1CCC2OC2(C1))CCCCC(=O)OCC3CCC4OC4(C3)
+140-95-4,O=C(NCO)NCO
+2778-42-9,O=C=NC(c1cccc(c1)C(N=C=O)(C)C)(C)C
+593-60-2,C=CBr
+75-25-2,C(Br)(Br)Br
+1852-16-0,O=C(C=C)NCOCCCC
+107-58-4,O=C(C=C)NC(C)(C)C
+592-35-8,O=C(OCCCC)N
+2426-08-6,O(CCCC)CC1OC1
+79-07-2,O=C(N)CCl
+110-75-8,O(C=C)CCCl
+67-66-3,C(Cl)(Cl)Cl
+26172-55-4,O=C1C=C(Cl)SN1C
+598-09-4,O1CC1(C)CCl
+2556-36-7,O=C=NC1CCC(N=C=O)CC1
+3271-22-5,n1c(nc(nc1OC)c2ccc3ccc4cccc5ccc2c3c45)OC
+2680-03-7,O=C(C=C)N(C)C
+13036-41-4,O=C(C=C)NCOCC
+556-52-5,OCC1OC1
+2530-83-8,O(CCC[Si](OC)(OC)OC)CC1OC1
+106-90-1,O=C(OCC1OC1)C=C
+26761-45-5,O=C(OCC1OC1)C(C)(C)CCCCCC
+122-60-1,O(c1ccccc1)CC2OC2
+2210-79-9,O(c1ccccc1C)CC2OC2
+2461-15-6,O(CC1OC1)CC(CC)CCCC
+75-02-5,FC=C
+98-01-1,O=Cc1occc1
+111-30-8,O=CCCCC=O
+107-22-2,O=CC=O
+78-84-2,O=CC(C)C
+11087-88-0,O=C(OCCCCCC(C)C)CCCCCCCC1OC1(CCCCCCCC)
+3644-11-9,O=C(C=C)NCOC
+1187-59-3,O=C(C=C)NC
+54208-63-8,O(c1ccccc1Cc3ccccc3(OCC2OC2))CC4OC4
+110-26-9,O=C(C=C)NCNC(=O)C=C
+1208-52-2,Nc1ccc(cc1)Cc2ccccc2(N)
+71033-08-4,O(c1ccc(cc1)C(c3ccc(OCC(OCC2OC2)COCCCC)cc3)(C)C)CC(OCC4OC4)COCCCC
+5165-97-9,O=C(C=C)NC(C)(C)CS(=O)(=O)O
+34813-62-2,O=C=NCCCC(C)CN=C=O
+16669-59-3,O=C(C=C)NCOCC(C)C
+80-48-8,O=S(=O)(OC)c1ccc(cc1)C
+2386-87-0,O=C(OCC1CCC2OC2(C1))C3CCC4OC4(C3)
+104-49-4,O=C=Nc1ccc(N=C=O)cc1
+103-71-9,O=C=Nc1ccccc1
+111-19-3,O=C(CCCCCCCCC(=O)Cl)Cl
+7320-37-8,O1CC1CCCCCCCCCCCCCC
+2451-62-9,O=C1N(C(=O)N(C(=O)N1CC2OC2)CC3OC3)CC4OC4
diff --git a/test/data/input_53.tsv b/test/data/input_53.tsv
new file mode 100644
index 0000000..c46fdd4
--- /dev/null
+++ b/test/data/input_53.tsv
@@ -0,0 +1,54 @@
+Id Smiles
+123-30-8 Oc1ccc(N)cc1
+68391-25-3 OC(COc1ccccc1)CNc2ccc(cc2)Cc3ccc(N)cc3
+62-53-3 Nc1ccccc1
+123-98-8 O=C(CCCCCCCC(=O)Cl)Cl
+106-51-4 O=C1C=CC(=O)C=C1
+7144-65-2 O(c1ccccc1c2ccccc2)CC3OC3
+3130-19-6 O=C(OCC1CCC2OC2(C1))CCCCC(=O)OCC3CCC4OC4(C3)
+140-95-4 O=C(NCO)NCO
+2778-42-9 O=C=NC(c1cccc(c1)C(N=C=O)(C)C)(C)C
+593-60-2 C=CBr
+75-25-2 C(Br)(Br)Br
+1852-16-0 O=C(C=C)NCOCCCC
+107-58-4 O=C(C=C)NC(C)(C)C
+592-35-8 O=C(OCCCC)N
+2426-08-6 O(CCCC)CC1OC1
+79-07-2 O=C(N)CCl
+110-75-8 O(C=C)CCCl
+67-66-3 C(Cl)(Cl)Cl
+26172-55-4 O=C1C=C(Cl)SN1C
+598-09-4 O1CC1(C)CCl
+2556-36-7 O=C=NC1CCC(N=C=O)CC1
+3271-22-5 n1c(nc(nc1OC)c2ccc3ccc4cccc5ccc2c3c45)OC
+2680-03-7 O=C(C=C)N(C)C
+13036-41-4 O=C(C=C)NCOCC
+556-52-5 OCC1OC1
+2530-83-8 O(CCC[Si](OC)(OC)OC)CC1OC1
+106-90-1 O=C(OCC1OC1)C=C
+26761-45-5 O=C(OCC1OC1)C(C)(C)CCCCCC
+122-60-1 O(c1ccccc1)CC2OC2
+2210-79-9 O(c1ccccc1C)CC2OC2
+2461-15-6 O(CC1OC1)CC(CC)CCCC
+75-02-5 FC=C
+98-01-1 O=Cc1occc1
+111-30-8 O=CCCCC=O
+107-22-2 O=CC=O
+78-84-2 O=CC(C)C
+11087-88-0 O=C(OCCCCCC(C)C)CCCCCCCC1OC1(CCCCCCCC)
+3644-11-9 O=C(C=C)NCOC
+1187-59-3 O=C(C=C)NC
+54208-63-8 O(c1ccccc1Cc3ccccc3(OCC2OC2))CC4OC4
+110-26-9 O=C(C=C)NCNC(=O)C=C
+1208-52-2 Nc1ccc(cc1)Cc2ccccc2(N)
+71033-08-4 O(c1ccc(cc1)C(c3ccc(OCC(OCC2OC2)COCCCC)cc3)(C)C)CC(OCC4OC4)COCCCC
+5165-97-9 O=C(C=C)NC(C)(C)CS(=O)(=O)O
+34813-62-2 O=C=NCCCC(C)CN=C=O
+16669-59-3 O=C(C=C)NCOCC(C)C
+80-48-8 O=S(=O)(OC)c1ccc(cc1)C
+2386-87-0 O=C(OCC1CCC2OC2(C1))C3CCC4OC4(C3)
+104-49-4 O=C=Nc1ccc(N=C=O)cc1
+103-71-9 O=C=Nc1ccccc1
+111-19-3 O=C(CCCCCCCCC(=O)Cl)Cl
+7320-37-8 O1CC1CCCCCCCCCCCCCC
+2451-62-9 O=C1N(C(=O)N(C(=O)N1CC2OC2)CC3OC3)CC4OC4
diff --git a/test/dataset.rb b/test/dataset.rb
index 055a029..11a4697 100644
--- a/test/dataset.rb
+++ b/test/dataset.rb
@@ -1,6 +1,21 @@
+# batch class
+
require_relative "setup.rb"
class DatasetTest < MiniTest::Test
+
+ # TODO
+ def test_from_pubchem
+ d = Dataset.from_pubchem 1190
+ end
+
+ def test_merge
+ skip "TODO"
+ end
+
+ def test_to_sdf
+ skip "TODO"
+ end
# basics
@@ -21,6 +36,34 @@ class DatasetTest < MiniTest::Test
# real datasets
+ def test_upload_csv_with_id
+ d = Dataset.from_csv_file "#{DATA_DIR}/input_53.csv"
+ assert_equal 53, d.compounds.size
+ assert_equal 1, d.features.size
+ f = d.features[0]
+ assert_equal "original_id", f.name
+ assert_equal ["123-30-8"], d.values(d.compounds.first,f)
+ end
+
+ def test_upload_tsv_with_id
+ d = Dataset.from_csv_file "#{DATA_DIR}/input_53.tsv"
+ assert_equal 53, d.compounds.size
+ assert_equal 1, d.features.size
+ assert_equal 1, d.features.size
+ f = d.features[0]
+ assert_equal "original_id", f.name
+ assert_equal ["123-30-8"], d.values(d.compounds.first,f)
+ end
+
+ def test_upload_sdf
+ #d = Dataset.from_sdf_file "#{DATA_DIR}/cas_4337.sdf"
+ d = Dataset.from_sdf_file "#{DATA_DIR}/PA.sdf"
+ assert_equal Compound.from_smiles("C[C@H]1C(=O)O[C@@H]2CCN3[C@@H]2C(=CC3)COC(=O)[C@]([C@]1(C)O)(C)O").smiles, d.compounds.first.smiles
+ f = Feature.find_by(:name => "original_id")
+ assert_equal 35, d.features.size
+ assert_equal ["9415"], d.values(d.compounds.first,f)
+ end
+
def test_upload_hamster
d = Dataset.from_csv_file "#{DATA_DIR}/hamster_carcinogenicity.csv"
assert_equal Dataset, d.class
@@ -103,6 +146,15 @@ class DatasetTest < MiniTest::Test
d.delete
end
+ def test_multiple_uploads
+ datasets = []
+ 2.times do
+ d = Dataset.from_csv_file("#{DATA_DIR}/hamster_carcinogenicity.csv")
+ datasets << d
+ end
+ assert_equal datasets[0],datasets[1]
+ end
+
# batch predictions
def test_create_without_features_smiles_and_inchi
diff --git a/test/setup.rb b/test/setup.rb
index 4a11aa0..c4c04cb 100644
--- a/test/setup.rb
+++ b/test/setup.rb
@@ -5,8 +5,8 @@ require_relative '../lib/lazar.rb'
include OpenTox
#$mongo.database.drop
#$gridfs = $mongo.database.fs # recreate GridFS indexes
-PhysChem.descriptors
+#PhysChem.descriptors
TEST_DIR ||= File.expand_path(File.dirname(__FILE__))
DATA_DIR ||= File.join(TEST_DIR,"data")
-training_dataset = Dataset.where(:name => "Protein Corona Fingerprinting Predicts the Cellular Interaction of Gold and Silver Nanoparticles").first
-Import::Enanomapper.import unless training_dataset
+#training_dataset = Dataset.where(:name => "Protein Corona Fingerprinting Predicts the Cellular Interaction of Gold and Silver Nanoparticles").first
+#Import::Enanomapper.import unless training_dataset