diff options
author | gebele <gebele@in-silico.ch> | 2017-06-09 11:08:45 +0000 |
---|---|---|
committer | gebele <gebele@in-silico.ch> | 2017-06-09 11:08:45 +0000 |
commit | 710031f953429c6e1a76aff4984ee76f7a1ee485 (patch) | |
tree | b56de76f91500ba72edfb22396dfe9547616eeaa | |
parent | 9aa5203dd375225996c1efe4be1a4324ddc6cda7 (diff) |
added addressable gem to avoid URI::InvalidURIError
-rw-r--r-- | lazar.gemspec | 1 | ||||
-rw-r--r-- | lib/lazar.rb | 1 | ||||
-rw-r--r-- | lib/overwrite.rb | 2 | ||||
-rw-r--r-- | lib/rest-client-wrapper.rb | 1 | ||||
-rw-r--r-- | test/compound.rb | 4 |
5 files changed, 7 insertions, 2 deletions
diff --git a/lazar.gemspec b/lazar.gemspec index 90f1cf2..3c704c8 100644 --- a/lazar.gemspec +++ b/lazar.gemspec @@ -20,6 +20,7 @@ Gem::Specification.new do |s| # specify any dependencies here; for example: s.add_runtime_dependency 'bundler' s.add_runtime_dependency 'rest-client' + s.add_runtime_dependency 'addressable' s.add_runtime_dependency 'nokogiri' s.add_runtime_dependency 'rserve-client' s.add_runtime_dependency 'mongoid' diff --git a/lib/lazar.rb b/lib/lazar.rb index a756742..fff5598 100644 --- a/lib/lazar.rb +++ b/lib/lazar.rb @@ -1,6 +1,7 @@ require 'rubygems' require "bundler/setup" require "rest-client" +require 'addressable' require 'yaml' require 'json' require 'logger' diff --git a/lib/overwrite.rb b/lib/overwrite.rb index 91bc9e1..89e57a0 100644 --- a/lib/overwrite.rb +++ b/lib/overwrite.rb @@ -197,7 +197,7 @@ module URI # @param [String] # @return [TrueClass,FalseClass] def self.valid? uri - u = URI.parse(uri) + u = Addressable::URI.parse(uri) u.scheme!=nil and u.host!=nil rescue URI::InvalidURIError false diff --git a/lib/rest-client-wrapper.rb b/lib/rest-client-wrapper.rb index f76a296..c9fd40f 100644 --- a/lib/rest-client-wrapper.rb +++ b/lib/rest-client-wrapper.rb @@ -26,6 +26,7 @@ module OpenTox define_singleton_method method do |uri,payload={},headers={},waiting_task=nil| + uri = Addressable::URI.encode(uri) # check input bad_request_error "Headers are not a hash: #{headers.inspect} for #{uri}." unless headers==nil or headers.is_a?(Hash) headers[:subjectid] ||= @@subjectid diff --git a/test/compound.rb b/test/compound.rb index bdfb749..c4e6161 100644 --- a/test/compound.rb +++ b/test/compound.rb @@ -61,7 +61,9 @@ print c.sdf def test_chemblid c = OpenTox::Compound.from_inchi "InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H" - assert_equal "CHEMBL277500", c.chemblid + assert_equal "CHEMBL1531487", c.chemblid + c = OpenTox::Compound.from_smiles "OC[C@](c1onc(n1)c1ncn2c1CN(C)C(=O)c1c2cccc1Cl)(O)C" + assert_equal "CHEMBL145418", c.chemblid end def test_sdf_storage |