diff options
author | Christoph Helma <helma@in-silico.ch> | 2015-08-13 18:57:11 +0200 |
---|---|---|
committer | Christoph Helma <helma@in-silico.ch> | 2015-08-13 18:57:11 +0200 |
commit | d0850e2983a219da214a67190fe881c7650f532f (patch) | |
tree | a917334a1a70823dc979a27e453b2598e98c8027 /test/dataset-long.rb | |
parent | 6ab86c253ba0eb79b9e6a20effa2d18626accf2b (diff) |
majority of tests working
Diffstat (limited to 'test/dataset-long.rb')
-rw-r--r-- | test/dataset-long.rb | 13 |
1 files changed, 7 insertions, 6 deletions
diff --git a/test/dataset-long.rb b/test/dataset-long.rb index 50ae8fc..5463079 100644 --- a/test/dataset-long.rb +++ b/test/dataset-long.rb @@ -77,13 +77,11 @@ class DatasetLongTest < MiniTest::Test assert_equal csv.size-1, d.compounds.size assert_equal csv.first.size-1, d.features.size assert_equal csv.size-1, d.data_entries.size - # TODO: check if warning is correct: - # Duplicate compound InChI=1S/C5H4N4S/c10-5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H2,6,7,8,9,10) at rows 1357, 2235 - #assert_empty d.warnings + assert_empty d.warnings # 493 COC1=C(C=C(C(=C1)Cl)OC)Cl,1 c = d.compounds[491] - assert_equal c.smiles, "COc1cc(c(cc1Cl)OC)Cl" - assert_equal d[c.id,d.features.first.id], 1 + assert_equal c.smiles, "COc1cc(Cl)c(cc1Cl)OC" + assert_equal d.data_entries[491][0], "1" d.delete end @@ -98,8 +96,11 @@ class DatasetLongTest < MiniTest::Test t = Time.now assert_equal d.features.size, d2.features.size csv = CSV.read f + csv.delete_at(248) # remove entry with InChi segfault csv.shift # remove header - assert_equal csv.size, d2.compounds.size + refute_empty d2.warnings + assert_match /249/, d2.warnings.join + assert_equal csv.size, d2.compounds.size assert_equal csv.first.size-1, d2.features.size d2.compounds.each_with_index do |compound,i| row = csv[i] |