diff options
Diffstat (limited to 'test/dataset-long.rb')
-rw-r--r-- | test/dataset-long.rb | 116 |
1 files changed, 116 insertions, 0 deletions
diff --git a/test/dataset-long.rb b/test/dataset-long.rb new file mode 100644 index 0000000..50ae8fc --- /dev/null +++ b/test/dataset-long.rb @@ -0,0 +1,116 @@ +require_relative "setup.rb" + +class DatasetLongTest < MiniTest::Test + + def test_01_upload_epafhm + f = File.join DATA_DIR, "EPAFHM.csv" + d = OpenTox::Dataset.from_csv_file f + csv = CSV.read f + assert_equal csv.size-1, d.compounds.size + assert_equal csv.first.size-1, d.features.size + assert_equal csv.size-1, d.data_entries.size + d.delete + end + +=begin +# TODO catch OpenBabel segfaults and identify/remove cause + def test_02_upload_multicell + duplicates = [ + "http://localhost:8082/compound/InChI=1S/C6HCl5O/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H", + "http://localhost:8082/compound/InChI=1S/C12H8Cl6O/c13-8-9(14)11(16)5-3-1-2(6-7(3)19-6)4(5)10(8,15)12(11,17)18/h2-7H,1H2", + "http://localhost:8082/compound/InChI=1S/C2HCl3/c3-1-2(4)5/h1H", + "http://localhost:8082/compound/InChI=1S/C4H5Cl/c1-3-4(2)5/h3H,1-2H2", + "http://localhost:8082/compound/InChI=1S/C4H7Cl/c1-4(2)3-5/h1,3H2,2H3", + "http://localhost:8082/compound/InChI=1S/C8H14O4/c1-5-4-8(11-6(2)9)12-7(3)10-5/h5,7-8H,4H2,1-3H3", + "http://localhost:8082/compound/InChI=1S/C19H30O5/c1-3-5-7-20-8-9-21-10-11-22-14-17-13-19-18(23-15-24-19)12-16(17)6-4-2/h12-13H,3-11,14-15H2,1-2H3", + ] + errors = ['O=P(H)(OC)OC', 'C=CCNN.HCl' ] + f = File.join DATA_DIR, "multi_cell_call.csv" + d = OpenTox::Dataset.from_csv_file f + csv = CSV.read f + assert_equal true, d.features.first.nominal + assert_nil d["index"] + assert_equal csv.size-1-errors.size, d.compounds.size + assert_equal csv.first.size-1, d.features.size + assert_equal csv.size-1-errors.size, d.data_entries.size + p d.warnings + (duplicates+errors).each do |uri| + assert d.warnings.grep %r{#{uri}} + end + d.delete + end +=end + + def test_03_upload_isscan + f = File.join DATA_DIR, "ISSCAN-multi.csv" + d = OpenTox::Dataset.from_csv_file f + csv = CSV.read f + assert_equal csv.size-1, d.compounds.size + assert_equal csv.first.size-1, d.features.size + assert_equal csv.size-1, d.data_entries.size + d.delete + #assert_equal false, URI.accessible?(d.uri) + end + + def test_04_simultanous_upload + threads = [] + 3.times do |t| + threads << Thread.new(t) do |up| + d = OpenTox::Dataset.from_csv_file "#{DATA_DIR}/hamster_carcinogenicity.csv" + assert_equal OpenTox::Dataset, d.class + assert_equal 1, d.features.size + assert_equal 85, d.compounds.size + assert_equal 85, d.data_entries.size + csv = CSV.read("#{DATA_DIR}/hamster_carcinogenicity.csv") + csv.shift + assert_equal csv.collect{|r| r[1]}, d.data_entries.flatten + d.delete + end + end + threads.each {|aThread| aThread.join} + end + + def test_05_upload_kazius + f = File.join DATA_DIR, "kazius.csv" + d = OpenTox::Dataset.from_csv_file f + csv = CSV.read f + assert_equal csv.size-1, d.compounds.size + assert_equal csv.first.size-1, d.features.size + assert_equal csv.size-1, d.data_entries.size + # TODO: check if warning is correct: + # Duplicate compound InChI=1S/C5H4N4S/c10-5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H2,6,7,8,9,10) at rows 1357, 2235 + #assert_empty d.warnings + # 493 COC1=C(C=C(C(=C1)Cl)OC)Cl,1 + c = d.compounds[491] + assert_equal c.smiles, "COc1cc(c(cc1Cl)OC)Cl" + assert_equal d[c.id,d.features.first.id], 1 + d.delete + end + + def test_upload_feature_dataset + t = Time.now + f = File.join DATA_DIR, "rat_feature_dataset.csv" + d = Dataset.from_csv_file f + assert_equal 458, d.features.size + d.save + p "Upload: #{Time.now-t}" + d2 = Dataset.find d.id + t = Time.now + assert_equal d.features.size, d2.features.size + csv = CSV.read f + csv.shift # remove header + assert_equal csv.size, d2.compounds.size + assert_equal csv.first.size-1, d2.features.size + d2.compounds.each_with_index do |compound,i| + row = csv[i] + row.shift # remove compound + assert_equal row, d2.data_entries[i] + end + p "Dowload: #{Time.now-t}" + d2.delete + assert_raises Mongoid::Errors::DocumentNotFound do + Dataset.find d.id + end + end + +end |