diff options
author | rautenberg <rautenberg@in-silico.ch> | 2012-05-07 17:48:06 +0200 |
---|---|---|
committer | rautenberg <rautenberg@in-silico.ch> | 2012-05-07 17:48:06 +0200 |
commit | d6f9c38c44fd6b7e41eca1f57451cc452cc4eec7 (patch) | |
tree | 23131e2f6a4d48f1af444a406479edd71d47c9bd | |
parent | e55a25e9fb0c91a581f898ce894a27e8bdd3d780 (diff) | |
parent | 6f25a7f04863b4fc6dccab59d690695371f1f0c7 (diff) |
29 files changed, 55 insertions, 23373 deletions
@@ -2,3 +2,4 @@ .bundle Gemfile.lock pkg/* +*~ diff --git a/ChangeLog b/ChangeLog new file mode 100644 index 0000000..08d2402 --- /dev/null +++ b/ChangeLog @@ -0,0 +1,2 @@ +v0.0.3 2012-05-07 +* switch from v0.0.2pre to v0.0.3 diff --git a/Gemfile.lock b/Gemfile.lock new file mode 100644 index 0000000..bc16a1b --- /dev/null +++ b/Gemfile.lock @@ -0,0 +1,30 @@ +PATH + remote: . + specs: + opentox-client (0.0.2pre) + bundler + open4 + rdf + rdf-raptor + rest-client + +GEM + remote: http://rubygems.org/ + specs: + addressable (2.2.7) + ffi (1.0.11) + mime-types (1.17.2) + open4 (1.3.0) + rdf (0.3.5) + addressable (>= 2.2.6) + rdf-raptor (0.4.1) + ffi (>= 1.0) + rdf (~> 0.3.0) + rest-client (1.6.7) + mime-types (>= 1.16) + +PLATFORMS + ruby + +DEPENDENCIES + opentox-client! @@ -0,0 +1 @@ +0.0.3 diff --git a/lib/opentox.rb b/lib/opentox.rb index 187eb08..6ce439d 100644 --- a/lib/opentox.rb +++ b/lib/opentox.rb @@ -111,6 +111,7 @@ module OpenTox end def create service_uri, subjectid=nil + #uri = uri(SecureRandom.uuid) uri = RestClientWrapper.post(service_uri, {}, {:accept => 'text/uri-list', :subjectid => subjectid}) URI.task?(service_uri) ? from_uri(uri, subjectid, false) : from_uri(uri, subjectid) end diff --git a/lib/policy.rb b/lib/policy.rb index 56a90b7..3e7c143 100644 --- a/lib/policy.rb +++ b/lib/policy.rb @@ -58,7 +58,7 @@ module OpenTox when "guest", "anonymous" then "default_guest_policy" else "default_policy" end - xml = File.read(File.join(File.dirname(__FILE__), "templates/#{template}.xml")) + xml = get_xml_template(template) self.load_xml(xml) datestring = Time.now.strftime("%Y-%m-%d-%H-%M-%S-x") + rand(1000).to_s @@ -78,6 +78,10 @@ module OpenTox return true end + def get_xml_template(template) + File.read(File.join(File.dirname(__FILE__), "templates/#{template}.xml")) + end + #loads a xml template def load_xml(xml) rexml = REXML::Document.new(xml) @@ -247,19 +251,22 @@ module OpenTox end # helper method sets value and type to opentox LDAP Distinguished Name (DN) of a user + # @param [String]Username set a username into LDAP DN def set_ot_user(username) self.value = "uid=#{username},ou=people,dc=opentox,dc=org" self.type = "LDAPUsers" true end + # @param [String]Username set a groupname into LDAP DN def set_ot_group(groupname) self.value = "cn=#{groupname},ou=groups,dc=opentox,dc=org" self.type = "LDAPGroups" true end - #rule inside a policy + # policyrule + # sets the permission for REST actions (GET, POST, PUT, DELETE) of a specific URI to allow/deny/nil class Rule attr_accessor :name, :uri, :get, :post, :put, :delete, :read, :readwrite @@ -293,14 +300,18 @@ module OpenTox @put = check_value(value, @put) end + # read getter method def read return true if @get == "allow" && (@put == "deny" || !@put) && (@post == "deny" || !@post) end + # readwrite getter method def readwrite return true if @get == "allow" && @put == "allow" && @post == "allow" end + # Set(true case) or remove read(GET=allow) permissions. + # @param [Boolean]value (true,false) def read=(value) if value @get = "allow"; @put = nil; @post = nil @@ -309,6 +320,8 @@ module OpenTox end end + # Set(true case) or remove readwrite(GET=allow,POST=allow,PUT=allow) permissions. + # @param [Boolean]value (true,false) def readwrite=(value) if value @get = "allow"; @put = "allow"; @post = "allow" @@ -324,6 +337,8 @@ module OpenTox end end + # Subject of a policy + # name(subjectname), type('LDAPUsers' or 'LDAPGroups'), value(LDAP DN e.G.:'uid=guest,ou=people,dc=opentox,dc=org') class Subject attr_accessor :name, :type, :value diff --git a/lib/rest-client-wrapper.rb b/lib/rest-client-wrapper.rb index 479d5a5..3071432 100644 --- a/lib/rest-client-wrapper.rb +++ b/lib/rest-client-wrapper.rb @@ -18,7 +18,8 @@ module OpenTox # check input @subjectid = headers[:subjectid] ? headers[:subjectid] : nil bad_request_error "Invalid URI: '#{uri}'" unless URI.valid? uri - not_found_error "URI '#{uri}' not found." unless URI.accessible?(uri, @subjectid) unless URI.ssl?(uri) + #TODO fix for internal installations + #not_found_error "URI '#{uri}' not found." unless URI.accessible?(uri, @subjectid) unless URI.ssl?(uri) bad_request_error "Headers are not a hash: #{headers.inspect}" unless headers==nil or headers.is_a?(Hash) # make sure that no header parameters are set in the payload [:accept,:content_type,:subjectid].each do |header| diff --git a/opentox-client.gemspec b/opentox-client.gemspec index a51fdc6..455e73e 100644 --- a/opentox-client.gemspec +++ b/opentox-client.gemspec @@ -3,7 +3,7 @@ $:.push File.expand_path("../lib", __FILE__) Gem::Specification.new do |s| s.name = "opentox-client" - s.version = "0.0.2pre" + s.version = "0.0.3" s.authors = ["Christoph Helma, Martin Guetlein, Andreas Maunz, Micha Rautenberg, David Vorgrimmler"] s.email = ["helma@in-silico.ch"] s.homepage = "http://github.com/opentox/opentox-client" diff --git a/test/authorization.rb b/test/authorization.rb deleted file mode 100644 index e446ff7..0000000 --- a/test/authorization.rb +++ /dev/null @@ -1,107 +0,0 @@ -require 'test/unit' -$LOAD_PATH << File.join(File.dirname(__FILE__),'..','lib') -require File.expand_path(File.join(File.dirname(__FILE__),'..','lib','opentox-client.rb')) -TEST_URI = "http://only_a_test/test/" + rand(1000000).to_s -AA ||= "https://opensso.in-silico.ch" -AA_USER = "guest" -AA_PASS = "guest" -@@subjectid = OpenTox::Authorization.authenticate(AA_USER,AA_PASS) - -class TestOpenToxAuthorizationBasic < Test::Unit::TestCase - - def test_01_server - assert_equal(AA, OpenTox::Authorization.server) - end - - def test_02_get_token - assert_not_nil @@subjectid - end - - def test_03_is_valid_token - tok = login - assert_not_nil tok - assert OpenTox::Authorization.is_token_valid(tok) - logout(tok) - end - - def test_04_logout - tok = login - assert logout(tok) - assert_equal false, OpenTox::Authorization.is_token_valid(tok) - end - - def test_05_list_policies - assert_kind_of Array, OpenTox::Authorization.list_policies(@@subjectid) - end - -end - -class TestOpenToxAuthorizationLDAP < Test::Unit::TestCase - - def test_01_list_user_groups - assert_kind_of Array, OpenTox::Authorization.list_user_groups(AA_USER, @@subjectid) - end - - def test_02_get_user - assert_equal AA_USER, OpenTox::Authorization.get_user(@@subjectid) - end - -end - -class TestOpenToxAuthorizationLDAP < Test::Unit::TestCase - - def test_01_create_check_delete_default_policies - res = OpenTox::Authorization.send_policy(TEST_URI, @@subjectid) - assert res - assert OpenTox::Authorization.uri_has_policy(TEST_URI, @@subjectid) - policies = OpenTox::Authorization.list_uri_policies(TEST_URI, @@subjectid) - assert_kind_of Array, policies - policies.each do |policy| - assert OpenTox::Authorization.delete_policy(policy, @@subjectid) - end - assert_equal false, OpenTox::Authorization.uri_has_policy(TEST_URI, @@subjectid) - end - - def test_02_check_policy_rules - tok_anonymous = OpenTox::Authorization.authenticate("anonymous","anonymous") - assert_not_nil tok_anonymous - res = OpenTox::Authorization.send_policy(TEST_URI, @@subjectid) - assert res - assert OpenTox::Authorization.uri_has_policy(TEST_URI, @@subjectid) - owner_rights = {"GET" => true, "POST" => true, "PUT" => true, "DELETE" => true} - groupmember_rights = {"GET" => true, "POST" => nil, "PUT" => nil, "DELETE" => nil} - owner_rights.each do |request, right| - assert_equal right, OpenTox::Authorization.authorize(TEST_URI, request, @@subjectid), "#{AA_USER} requests #{request} to #{TEST_URI}" - end - groupmember_rights.each do |request, r| - assert_equal r, OpenTox::Authorization.authorize(TEST_URI, request, tok_anonymous), "anonymous requests #{request} to #{TEST_URI}" - end - - policies = OpenTox::Authorization.list_uri_policies(TEST_URI, @@subjectid) - assert_kind_of Array, policies - policies.each do |policy| - assert OpenTox::Authorization.delete_policy(policy, @@subjectid) - end - logout(tok_anonymous) - end - - def test_03_check_different_uris - res = OpenTox::Authorization.send_policy(TEST_URI, @@subjectid) - assert OpenTox::Authorization.uri_has_policy(TEST_URI, @@subjectid) - assert OpenTox::Authorization.authorize(TEST_URI, "GET", @@subjectid), "GET request" - policies = OpenTox::Authorization.list_uri_policies(TEST_URI, @@subjectid) - policies.each do |policy| - assert OpenTox::Authorization.delete_policy(policy, @@subjectid) - end - - end -end - - -def logout (token) - OpenTox::Authorization.logout(token) -end - -def login - OpenTox::Authorization.authenticate(AA_USER,AA_PASS) -end diff --git a/test/compound.rb b/test/compound.rb deleted file mode 100644 index da77480..0000000 --- a/test/compound.rb +++ /dev/null @@ -1,52 +0,0 @@ -require 'test/unit' -$LOAD_PATH << File.join(File.dirname(__FILE__),'..','lib') -require File.join File.dirname(__FILE__),'..','lib','opentox-client.rb' - -class CompoundTest < Test::Unit::TestCase - - def setup - @service_uri = "http://ot-dev.in-silico.ch/compound" - end - - def test_compound_from_smiles_0 - c = OpenTox::Compound.from_smiles @service_uri, "F[B-](F)(F)F.[Na+]" - assert_equal "InChI=1S/BF4.Na/c2-1(3,4)5;/q-1;+1", c.to_inchi - assert_equal "[Na+].F[B-](F)(F)F", c.to_smiles # still does not work on 64bit machines - end - - def test_compound_from_smiles_1 - c = OpenTox::Compound.from_smiles @service_uri, "CC(=O)CC(C)C#N" - assert_equal "InChI=1S/C6H9NO/c1-5(4-7)3-6(2)8/h5H,3H2,1-2H3", c.to_inchi - assert_equal "CC(CC(=O)C)C#N", c.to_smiles - end - - def test_compound_from_name - c = OpenTox::Compound.from_name @service_uri, "Benzene" - assert_equal "InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H", c.to_inchi - assert_equal "c1ccccc1", c.to_smiles - end - - def test_compound_from_smiles_2 - c = OpenTox::Compound.from_smiles @service_uri, "N#[N+]C1=CC=CC=C1.F[B-](F)(F)F" - assert_equal "InChI=1S/C6H5N2.BF4/c7-8-6-4-2-1-3-5-6;2-1(3,4)5/h1-5H;/q+1;-1", c.to_inchi - assert_equal "N#[N+]c1ccccc1.F[B-](F)(F)F", c.to_smiles - end - - def test_compound_from_inchi - c = OpenTox::Compound.from_inchi @service_uri, "InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H" - assert_equal "c1ccccc1", c.to_smiles - end - - def test_compound_ambit - c = OpenTox::Compound.new "http://apps.ideaconsult.net:8080/ambit2/compound/144036" - assert_equal "InChI=1S/C6H11NO2/c1-3-5-6(4-2)7(8)9/h5H,3-4H2,1-2H3", c.to_inchi - assert_equal "CCC=C(CC)[N+](=O)[O-]", c.to_smiles - end - -=begin - def test_match_hits - c = OpenTox::Compound.from_smiles @service_uri, "N=C=C1CCC(=F=FO)C1" - assert_equal ({"FF"=>2, "CC"=>10, "C"=>6, "C1CCCC1"=>10, "C=C"=>2}), c.match_hits(['CC','F=F','C','C=C','FF','C1CCCC1','OO']) - end -=end -end diff --git a/test/data/CPDBAS_v5c_1547_29Apr2008part.sdf b/test/data/CPDBAS_v5c_1547_29Apr2008part.sdf deleted file mode 100644 index d7eb740..0000000 --- a/test/data/CPDBAS_v5c_1547_29Apr2008part.sdf +++ /dev/null @@ -1,13553 +0,0 @@ -
-
-
- 14 16 0 0 0 0 0 0 0 0 1 V2000
- 7.3615 -3.7543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 6.2131 -3.0918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.2131 -1.7594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.0573 -1.0969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9089 -1.7594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9089 -3.0918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.0573 -3.7543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6428 -3.5041 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.8624 -2.4219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5374 -2.2894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.0748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.7803 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.1054 -0.1325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6428 -1.3471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 1 0 0 0 0
- 2 7 2 0 0 0 0
- 3 4 2 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 2 0 0 0 0
- 5 14 1 0 0 0 0
- 6 7 1 0 0 0 0
- 6 8 1 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 9 14 1 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 2 0 0 0 0
- 12 13 1 0 0 0 0
- 13 14 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20001
-
-> <DSSTox_CID>
-1
-
-> <DSSTox_Generic_SID>
-20001
-
-> <DSSTox_FileID>
-1_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C11H9N3
-
-> <STRUCTURE_MolecularWeight>
-183.2122
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-A-alpha-C
-
-> <TestSubstance_CASRN>
-26148-68-5
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-blank
-
-> <STRUCTURE_ChemicalName_IUPAC>
-9H-pyrido[2,3-b]indol-2-amine
-
-> <STRUCTURE_SMILES>
-NC1C=CC2=C(N=1)NC3=CC=CC=C23
-
-> <STRUCTURE_Parent_SMILES>
-NC1C=CC2=C(N=1)NC3=CC=CC=C23
-
-> <STRUCTURE_InChI>
-InChI=1/C11H9N3/c12-10-6-5-8-7-3-1-2-4-9(7)13-11(8)14-10/h1-6H,(H3,12,13,14)/f/h13H,12H2
-
-> <STRUCTURE_InChIKey>
-FJTNLJLPLJDTRM-DXMPFREMCP
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-blank
-
-> <TD50_Rat_mmol>
-blank
-
-> <ActivityScore_CPDBAS_Rat>
-blank
-
-> <TD50_Rat_Note>
-blank
-
-> <TargetSites_Rat_Male>
-blank
-
-> <TargetSites_Rat_Female>
-blank
-
-> <TargetSites_Rat_BothSexes>
-blank
-
-> <ActivityOutcome_CPDBAS_Rat>
-blank
-
-> <TD50_Mouse_mg>
-49.8
-
-> <TD50_Mouse_mmol>
-0.271815959854202
-
-> <ActivityScore_CPDBAS_Mouse>
-35
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Mouse_Male>
-liver; vascular system
-
-> <TargetSites_Mouse_Female>
-liver; vascular system
-
-> <TargetSites_Mouse_BothSexes>
-blank
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <TD50_Hamster_mg>
-blank
-
-> <TD50_Hamster_mmol>
-blank
-
-> <ActivityScore_CPDBAS_Hamster>
-blank
-
-> <TD50_Hamster_Note>
-blank
-
-> <TargetSites_Hamster_Male>
-blank
-
-> <TargetSites_Hamster_Female>
-blank
-
-> <TargetSites_Hamster_BothSexes>
-blank
-
-> <ActivityOutcome_CPDBAS_Hamster>
-blank
-
-> <TD50_Dog_mg>
-blank
-
-> <TargetSites_Dog>
-blank
-
-> <TD50_Rhesus_mg>
-blank
-
-> <TargetSites_Rhesus>
-blank
-
-> <TD50_Cynomolgus_mg>
-blank
-
-> <TargetSites_Cynomolgus>
-blank
-
-> <TD50_Dog_Primates_Note>
-blank
-
-> <ActivityOutcome_CPDBAS_Dog_Primates>
-blank
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active
-
-> <Note_CPDBAS>
-blank
-
-> <NTP_TechnicalReport>
-blank
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/A-alpha-C.html
-
-$$$$
-
-
-
- 11 10 0 0 0 0 0 0 0 0 2 V2000
- 3.4800 -1.1526 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4800 -2.4613 0.0000 N 0 5 0 0 0 0 0 0 0 0 0 0
- 2.3349 -3.1008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3349 -0.4610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1749 -2.4613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1749 -1.1526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.1344 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.8110 -1.1526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3349 -4.4392 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.4359 -2.2159 0.0000 K 0 3 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 4 1 0 0 0 0
- 1 7 2 0 0 0 0
- 1 8 2 0 0 0 0
- 2 3 1 0 0 0 0
- 3 9 2 0 0 0 0
- 3 5 1 0 0 0 0
- 4 6 1 0 0 0 0
- 5 6 2 0 0 0 0
- 6 10 1 0 0 0 0
-M CHG 2 2 -1 11 1
-M END
-> <DSSTox_RID>
-40770
-
-> <DSSTox_CID>
-10606
-
-> <DSSTox_Generic_SID>
-30606
-
-> <DSSTox_FileID>
-2_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C4H4KNO4S
-
-> <STRUCTURE_MolecularWeight>
-201.2422
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-salt K
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Acesulfame-K
-
-> <TestSubstance_CASRN>
-55589-62-3
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-parent [33665-90-6]
-
-> <STRUCTURE_ChemicalName_IUPAC>
-potassium 6-methyl-4-oxo-4H-1,2,3-oxathiazin-3-ide 2,2-dioxide
-
-> <STRUCTURE_SMILES>
-O=S([N-]C1=O)(OC(C)=C1)=O.[K+]
-
-> <STRUCTURE_Parent_SMILES>
-O=S(NC1=O)(OC(C)=C1)=O
-
-> <STRUCTURE_InChI>
-InChI=1/C4H5NO4S.K/c1-3-2-4(6)5-10(7,8)9-3;/h2H,1H3,(H,5,6);/q;+1/p-1/fC4H4NO4S.K/q-1;m
-
-> <STRUCTURE_InChIKey>
-WBZFUFAFFUEMEI-COHKJUPYCC
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-mouse
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive
-
-> <Note_CPDBAS>
-Mouse added v5a; chemical added v5a
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ACESULFAME-K.html
-
-$$$$
-
-
-
- 3 2 0 0 0 0 0 0 0 0 1 V2000
- 2.3030 -0.6656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1515 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.6656 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20002
-
-> <DSSTox_CID>
-2
-
-> <DSSTox_Generic_SID>
-39224
-
-> <DSSTox_FileID>
-3_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C2H4O
-
-> <STRUCTURE_MolecularWeight>
-44.0526
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Acetaldehyde
-
-> <TestSubstance_CASRN>
-75-07-0
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-acetaldehyde
-
-> <STRUCTURE_SMILES>
-CC=O
-
-> <STRUCTURE_Parent_SMILES>
-CC=O
-
-> <STRUCTURE_InChI>
-InChI=1/C2H4O/c1-2-3/h2H,1H3
-
-> <STRUCTURE_InChIKey>
-IKHGUXGNUITLKF-UHFFFAOYAB
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; hamster
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <TD50_Rat_mg>
-153
-
-> <TD50_Rat_mmol>
-3.4731207692622
-
-> <ActivityScore_CPDBAS_Rat>
-20
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Rat_Male>
-nasal cavity
-
-> <TargetSites_Rat_Female>
-nasal cavity
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <TD50_Hamster_mg>
-565
-
-> <TD50_Hamster_mmol>
-12.8255766969486
-
-> <ActivityScore_CPDBAS_Hamster>
-1
-
-> <TD50_Hamster_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Hamster_Male>
-nasal cavity; oral cavity
-
-> <TargetSites_Hamster_Female>
-oral cavity
-
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active; multispecies active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ACETALDEHYDE.html
-
-$$$$
-
-
-
- 7 6 0 0 0 0 0 0 0 0 1 V2000
- 5.7637 -1.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6110 -1.3314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4582 -1.9942 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3055 -1.3314 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3055 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1527 -1.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.3314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 6 1 0 0 0 0
- 6 7 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20003
-
-> <DSSTox_CID>
-3
-
-> <DSSTox_Generic_SID>
-39225
-
-> <DSSTox_FileID>
-4_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C4H8N2O
-
-> <STRUCTURE_MolecularWeight>
-100.12
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Acetaldehyde methylformylhydrazone
-
-> <TestSubstance_CASRN>
-16568-02-8
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-N'-[(1E)-ethylidene]-N-methylformic hydrazide
-
-> <STRUCTURE_SMILES>
-CC=NN(C)C=O
-
-> <STRUCTURE_Parent_SMILES>
-CC=NN(C)C=O
-
-> <STRUCTURE_InChI>
-InChI=1/C4H8N2O/c1-3-5-6(2)4-7/h3-4H,1-2H3/b5-3+
-
-> <STRUCTURE_InChIKey>
-IMAGWKUTFZRWSB-HWKANZROBR
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <TD50_Mouse_mg>
-2.51
-
-> <TD50_Mouse_mmol>
-2.50699161006792E-02
-
-> <ActivityScore_CPDBAS_Mouse>
-46
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Mouse_Male>
-lung; preputial gland
-
-> <TargetSites_Mouse_Female>
-clitoral gland; lung; stomach
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ACETALDEHYDE%20METHYLFORMYLHYDRAZONE.html
-
-$$$$
-
-
-
- 4 3 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1513 -0.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3061 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4575 -0.6638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 3 4 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20004
-
-> <DSSTox_CID>
-4
-
-> <DSSTox_Generic_SID>
-20004
-
-> <DSSTox_FileID>
-5_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C2H5NO
-
-> <STRUCTURE_MolecularWeight>
-59.0672
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Acetaldoxime
-
-> <TestSubstance_CASRN>
-107-29-9
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-(1E)-acetaldehyde oxime
-
-> <STRUCTURE_SMILES>
-CC=NO
-
-> <STRUCTURE_Parent_SMILES>
-CC=NO
-
-> <STRUCTURE_InChI>
-InChI=1/C2H5NO/c1-2-3-4/h2,4H,1H3/b3-2+
-
-> <STRUCTURE_InChIKey>
-FZENGILVLUJGJX-NSCUHMNNBP
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ACETALDOXIME.html
-
-$$$$
-
-
-
- 4 3 0 0 0 0 0 0 0 0 1 V2000
- 1.9950 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3292 -1.1518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9950 -2.3037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.1518 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 4 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20005
-
-> <DSSTox_CID>
-5
-
-> <DSSTox_Generic_SID>
-20005
-
-> <DSSTox_FileID>
-6_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C2H5NO
-
-> <STRUCTURE_MolecularWeight>
-59.0672
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Acetamide
-
-> <TestSubstance_CASRN>
-60-35-5
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-acetamide
-
-> <STRUCTURE_SMILES>
-CC(=O)N
-
-> <STRUCTURE_Parent_SMILES>
-CC(=O)N
-
-> <STRUCTURE_InChI>
-InChI=1/C2H5NO/c1-2(3)4/h1H3,(H2,3,4)/f/h3H2
-
-> <STRUCTURE_InChIKey>
-DLFVBJFMPXGRIB-ZZOWFUDICC
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <TD50_Rat_mg>
-180
-
-> <TD50_Rat_mmol>
-3.04737654739009
-
-> <ActivityScore_CPDBAS_Rat>
-21
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Rat_Male>
-liver
-
-> <TargetSites_Rat_Female>
-liver
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <TD50_Mouse_mg>
-3010
-
-> <TD50_Mouse_mmol>
-50.9589078202454
-
-> <ActivityScore_CPDBAS_Mouse>
-9
-
-> <TargetSites_Mouse_Male>
-hematopoietic system
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active; multispecies active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ACETAMIDE.html
-
-$$$$
-
-
-
- 11 11 0 0 0 0 0 0 0 0 1 V2000
- 3.8512 -1.8702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.9346 -2.8163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.5407 -0.5987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.1522 -2.2102 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.6410 -2.4689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.2397 -0.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.0983 -1.2862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.2936 -1.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7583 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3919 -1.6114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.8575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 1 3 1 0 0 0 0
- 1 4 1 0 0 0 0
- 2 5 1 0 0 0 0
- 3 6 2 0 0 0 0
- 4 7 1 0 0 0 0
- 5 8 2 0 0 0 0
- 6 8 1 0 0 0 0
- 7 9 1 0 0 0 0
- 7 10 2 0 0 0 0
- 8 11 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20006
-
-> <DSSTox_CID>
-6
-
-> <DSSTox_Generic_SID>
-20006
-
-> <DSSTox_FileID>
-7_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C8H9NO2
-
-> <STRUCTURE_MolecularWeight>
-151.1626
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Acetaminophen
-
-> <TestSubstance_CASRN>
-103-90-2
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-N-(4-hydroxyphenyl)acetamide
-
-> <STRUCTURE_SMILES>
-C1(=CC=C(C=C1)O)NC(C)=O
-
-> <STRUCTURE_Parent_SMILES>
-C1(=CC=C(C=C1)O)NC(C)=O
-
-> <STRUCTURE_InChI>
-InChI=1/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10)/f/h9H
-
-> <STRUCTURE_InChIKey>
-RZVAJINKPMORJF-BGGKNDAXCW
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <TD50_Rat_mg>
-495
-
-> <TD50_Rat_mmol>
-3.27461951567385
-
-> <ActivityScore_CPDBAS_Rat>
-20
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Rat_Male>
-liver; urinary bladder
-
-> <TargetSites_Rat_Female>
-liver; urinary bladder
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <TD50_Mouse_mg>
-1620
-
-> <TD50_Mouse_mmol>
-10.7169365967508
-
-> <ActivityScore_CPDBAS_Mouse>
-17
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Mouse_Male>
-liver
-
-> <TargetSites_Mouse_Female>
-liver
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active; multispecies active
-
-> <NTP_TechnicalReport>
-TR 394; final call in CPDB differs due to additional data
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ACETAMINOPHEN.html
-
-$$$$
-
-
-
- 22 23 0 0 0 0 0 0 0 0 1 V2000
- 5.1434 -4.1211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9933 -3.4609 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 2.8432 -2.7900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3224 -4.6110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9913 -4.6110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3311 -5.7610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9913 -6.9111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3224 -6.9111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9933 -5.7610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3311 -8.0718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9913 -9.2219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -8.0718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6642 -2.3002 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9953 -2.3002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.6555 -3.4609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.6555 -1.1501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9866 -1.1501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.6575 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.9780 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.6489 -1.1501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.9780 -2.3002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.6575 -2.3002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 2 0 0 0 0
- 2 4 1 0 0 0 0
- 2 13 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 9 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 7 8 1 0 0 0 0
- 7 10 1 0 0 0 0
- 8 9 2 0 0 0 0
- 10 11 2 0 0 0 0
- 10 12 1 0 0 0 0
- 13 14 1 0 0 0 0
- 14 15 2 0 0 0 0
- 14 16 1 0 0 0 0
- 16 17 1 0 0 0 0
- 17 18 1 0 0 0 0
- 17 22 1 0 0 0 0
- 18 19 1 0 0 0 0
- 19 20 1 0 0 0 0
- 20 21 1 0 0 0 0
- 21 22 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20007
-
-> <DSSTox_CID>
-7
-
-> <DSSTox_Generic_SID>
-20007
-
-> <DSSTox_FileID>
-8_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C15H20N2O4S
-
-> <STRUCTURE_MolecularWeight>
-324.3953
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Acetohexamide
-
-> <TestSubstance_CASRN>
-968-81-0
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-4-acetyl-N-[(cyclohexylamino)carbonyl]benzenesulfonamide
-
-> <STRUCTURE_SMILES>
-O=S(=O)(C1=CC=C(C=C1)C(=O)C)NC(=O)NC2CCCCC2
-
-> <STRUCTURE_Parent_SMILES>
-O=S(=O)(C1=CC=C(C=C1)C(=O)C)NC(=O)NC2CCCCC2
-
-> <STRUCTURE_InChI>
-InChI=1/C15H20N2O4S/c1-11(18)12-7-9-14(10-8-12)22(20,21)17-15(19)16-13-5-3-2-4-6-13/h7-10,13H,2-6H2,1H3,(H2,16,17,19)/f/h16-17H
-
-> <STRUCTURE_InChIKey>
-VGZSUPCWNCWDAN-XQMQJMAZCC
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive; multispecies inactive
-
-> <NTP_TechnicalReport>
-TR 050
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ACETOHEXAMIDE.html
-
-$$$$
-
-
-
- 18 19 0 0 0 0 0 0 0 0 2 V2000
- 11.1272 -2.0879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 11.1272 -0.7492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.2816 -2.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.9727 -2.7511 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 8.8182 -2.0879 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 7.6760 -2.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.5286 -4.0652 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 6.2268 -4.3477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.5636 -3.1932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.4601 -2.2107 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 4.2372 -3.0581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3529 -4.0407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.1370 -3.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.2721 -2.1861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.5740 -1.9037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.2896 -1.2896 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.6335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.6335 0.0000 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 3 1 0 0 0 0
- 1 4 2 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 6 10 1 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 2 0 0 0 0
- 9 10 1 0 0 0 0
- 9 11 1 0 0 0 0
- 11 12 2 0 0 0 0
- 11 15 1 0 0 0 0
- 12 13 1 0 0 0 0
- 13 14 2 0 0 0 0
- 14 15 1 0 0 0 0
- 14 16 1 0 0 0 0
- 16 17 2 0 0 0 0
- 16 18 1 0 0 0 0
-M CHG 2 16 1 18 -1
-M END
-> <DSSTox_RID>
-20008
-
-> <DSSTox_CID>
-8
-
-> <DSSTox_Generic_SID>
-20008
-
-> <DSSTox_FileID>
-9_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C10H10N4O3S
-
-> <STRUCTURE_MolecularWeight>
-266.274
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Acetone[4-(5-nitro-2-furyl)-2-thiazolyl] hydrazone
-
-> <TestSubstance_CASRN>
-18523-69-8
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-propan-2-one [5-(5-nitrofuran-2-yl)-1,3-thiazol-2-yl]hydrazone
-
-> <STRUCTURE_SMILES>
-C(/C)(C)=N\NC1=NC=C(S1)C2=CC=C(O2)[N+](=O)[O-]
-
-> <STRUCTURE_Parent_SMILES>
-C(/C)(C)=N\NC1=NC=C(S1)C2=CC=C(O2)[N+](=O)[O-]
-
-> <STRUCTURE_InChI>
-InChI=1/C10H10N4O3S/c1-6(2)12-13-10-11-5-8(18-10)7-3-4-9(17-7)14(15)16/h3-5H,1-2H3,(H,11,13)/f/h13H
-
-> <STRUCTURE_InChIKey>
-CUWVNOSSZYUJAE-NDKGDYFDCK
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <TD50_Rat_mg>
-6.05
-
-> <TD50_Rat_mmol>
-2.27209566086062E-02
-
-> <ActivityScore_CPDBAS_Rat>
-43
-
-> <TargetSites_Rat_Female>
-stomach
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ACETONE[4-(5-NITRO-2-FURYL)-2-THIAZOLYL]HYDRAZONE.html
-
-$$$$
-
-
-
- 3 2 0 0 0 0 0 0 0 0 1 V2000
- 2.6600 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3300 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 3 0 0 0 0
-M END
-> <DSSTox_RID>
-20009
-
-> <DSSTox_CID>
-9
-
-> <DSSTox_Generic_SID>
-20009
-
-> <DSSTox_FileID>
-10_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C2H3N
-
-> <STRUCTURE_MolecularWeight>
-41.0519
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Acetonitrile
-
-> <TestSubstance_CASRN>
-75-05-8
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-acetonitrile
-
-> <STRUCTURE_SMILES>
-CC#N
-
-> <STRUCTURE_Parent_SMILES>
-CC#N
-
-> <STRUCTURE_InChI>
-InChI=1/C2H3N/c1-2-3/h1H3
-
-> <STRUCTURE_InChIKey>
-WEVYAHXRMPXWCK-UHFFFAOYAJ
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive; multispecies inactive
-
-> <NTP_TechnicalReport>
-TR 447
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ACETONITRILE.html
-
-$$$$
-
-
-
- 5 4 0 0 0 0 0 0 0 0 1 V2000
- 3.4567 -1.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3056 -1.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1511 -1.9945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.3308 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3056 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 5 1 0 0 0 0
- 3 4 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20010
-
-> <DSSTox_CID>
-10
-
-> <DSSTox_Generic_SID>
-20010
-
-> <DSSTox_FileID>
-11_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C3H7NO
-
-> <STRUCTURE_MolecularWeight>
-73.0938
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Acetoxime
-
-> <TestSubstance_CASRN>
-127-06-0
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-propan-2-one oxime
-
-> <STRUCTURE_SMILES>
-CC(=NO)C
-
-> <STRUCTURE_Parent_SMILES>
-CC(=NO)C
-
-> <STRUCTURE_InChI>
-InChI=1/C3H7NO/c1-3(2)4-5/h5H,1-2H3
-
-> <STRUCTURE_InChIKey>
-PXAJQJMDEXJWFB-UHFFFAOYAK
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <TD50_Rat_mg>
-12.1
-
-> <TD50_Rat_mmol>
-0.165540716175654
-
-> <ActivityScore_CPDBAS_Rat>
-34
-
-> <TargetSites_Rat_Male>
-liver
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ACETOXIME.html
-
-$$$$
-
-
-
- 16 17 0 0 0 0 0 0 0 0 1 V2000
- 1.1551 -0.6716 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9126 -2.6594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9126 -3.9935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.1751 -2.2475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 8.1751 -4.4054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 8.9541 -3.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7575 -1.9968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7575 -4.6561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4563 -0.6716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3012 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6024 -2.6594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6024 -3.9935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4563 -1.9968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3012 -2.6594 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1551 -1.9968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.6594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 15 2 0 0 0 0
- 2 3 2 0 0 0 0
- 2 4 1 0 0 0 0
- 2 7 1 0 0 0 0
- 3 5 1 0 0 0 0
- 3 8 1 0 0 0 0
- 4 6 1 0 0 0 0
- 5 6 1 0 0 0 0
- 7 11 2 0 0 0 0
- 8 12 2 0 0 0 0
- 9 13 1 0 0 0 0
- 9 10 2 0 0 0 0
- 11 12 1 0 0 0 0
- 11 13 1 0 0 0 0
- 13 14 1 0 0 0 0
- 14 15 1 0 0 0 0
- 15 16 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20011
-
-> <DSSTox_CID>
-11
-
-> <DSSTox_Generic_SID>
-39226
-
-> <DSSTox_FileID>
-12_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C12H12O4
-
-> <STRUCTURE_MolecularWeight>
-220.2213
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-1'-Acetoxysafrole
-
-> <TestSubstance_CASRN>
-34627-78-6
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-1-(1,3-benzodioxol-5-yl)prop-2-en-1-yl acetate
-
-> <STRUCTURE_SMILES>
-O=C(C)OC(C2=CC1=C(C=C2)OCO1)C=C
-
-> <STRUCTURE_Parent_SMILES>
-O=C(C)OC(C2=CC1=C(C=C2)OCO1)C=C
-
-> <STRUCTURE_InChI>
-InChI=1/C12H12O4/c1-3-10(16-8(2)13)9-4-5-11-12(6-9)15-7-14-11/h3-6,10H,1,7H2,2H3
-
-> <STRUCTURE_InChIKey>
-TXUCQVJZBXYDKH-UHFFFAOYAY
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-25
-
-> <TD50_Rat_mmol>
-0.113522170652884
-
-> <ActivityScore_CPDBAS_Rat>
-35
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Rat_Male>
-stomach
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/1'-ACETOXYSAFROLE.html
-
-$$$$
-
-
-
- 13 13 0 0 0 0 0 0 0 0 1 V2000
- 2.6636 -2.3090 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9977 -1.1588 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6659 -1.1588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9953 -2.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6526 -1.1588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9844 -1.1588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.6503 -2.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9844 -3.4592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6526 -3.4592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9820 -2.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.6479 -3.4592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 6 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 5 2 0 0 0 0
- 6 7 2 0 0 0 0
- 6 11 1 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 2 0 0 0 0
- 9 10 1 0 0 0 0
- 9 12 1 0 0 0 0
- 10 11 2 0 0 0 0
- 12 13 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20012
-
-> <DSSTox_CID>
-12
-
-> <DSSTox_Generic_SID>
-20012
-
-> <DSSTox_FileID>
-13_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C9H12N2O2
-
-> <STRUCTURE_MolecularWeight>
-180.206
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-N'-Acetyl-4-(hydroxymethyl) phenylhydrazine
-
-> <TestSubstance_CASRN>
-65734-38-5
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-N'-[4-(hydroxymethyl)phenyl]acetohydrazide
-
-> <STRUCTURE_SMILES>
-N(NC(C)=O)C1=CC=C(C=C1)CO
-
-> <STRUCTURE_Parent_SMILES>
-N(NC(C)=O)C1=CC=C(C=C1)CO
-
-> <STRUCTURE_InChI>
-InChI=1/C9H12N2O2/c1-7(13)10-11-9-4-2-8(6-12)3-5-9/h2-5,11-12H,6H2,1H3,(H,10,13)/f/h10H
-
-> <STRUCTURE_InChIKey>
-UFFJUAYKLIGSJF-KZFATGLACR
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-mouse
-
-> <TD50_Mouse_mg>
-241
-
-> <TD50_Mouse_mmol>
-1.33735835654751
-
-> <ActivityScore_CPDBAS_Mouse>
-27
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Mouse_Male>
-lung; vascular system
-
-> <TargetSites_Mouse_Female>
-lung; vascular system
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/N'-ACETYL-4-(HYDROXYMETHYL)PHENYLHYDRAZINE.html
-
-$$$$
-
-
-
- 13 13 0 0 0 0 0 0 0 0 1 V2000
- 3.4560 -1.9979 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3040 -1.3292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1520 -1.9979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1520 -3.3271 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6000 -1.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7520 -1.9979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9040 -1.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0560 -1.9979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0560 -3.3271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9040 -3.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7520 -3.3271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 6 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 5 2 0 0 0 0
- 6 7 1 0 0 0 0
- 6 13 2 0 0 0 0
- 7 8 2 0 0 0 0
- 7 12 1 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20013
-
-> <DSSTox_CID>
-13
-
-> <DSSTox_Generic_SID>
-20013
-
-> <DSSTox_FileID>
-14_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C8H9N3O2
-
-> <STRUCTURE_MolecularWeight>
-179.178
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-1-Acetyl-2-isonicotinoylhydrazine
-
-> <TestSubstance_CASRN>
-1078-38-2
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-N'-acetylpyridine-4-carbohydrazide
-
-> <STRUCTURE_SMILES>
-N(NC(C)=O)C(C1=CC=NC=C1)=O
-
-> <STRUCTURE_Parent_SMILES>
-N(NC(C)=O)C(C1=CC=NC=C1)=O
-
-> <STRUCTURE_InChI>
-InChI=1/C8H9N3O2/c1-6(12)10-11-8(13)7-2-4-9-5-3-7/h2-5H,1H3,(H,10,12)(H,11,13)/f/h10-11H
-
-> <STRUCTURE_InChIKey>
-CVBGNAKQQUWBQV-PZWAIHAUCF
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-mouse
-
-> <TD50_Mouse_mg>
-330
-
-> <TD50_Mouse_mmol>
-1.84174396410274
-
-> <ActivityScore_CPDBAS_Mouse>
-25
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Mouse_Male>
-lung
-
-> <TargetSites_Mouse_Female>
-lung
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/1-ACETYL-2-ISONICOTINOYLHYDRAZINE.html
-
-$$$$
-
-
-
- 12 12 0 0 0 0 0 0 0 0 1 V2000
- 1.9922 -4.6067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6563 -3.4580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9922 -2.3033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6563 -1.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9922 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9905 -1.1547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6546 -2.3033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9905 -3.4580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9827 -2.3033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6641 -2.3033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.4580 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 8 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 10 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 6 1 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 2 0 0 0 0
- 7 9 1 0 0 0 0
- 10 11 2 0 0 0 0
- 10 12 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20014
-
-> <DSSTox_CID>
-14
-
-> <DSSTox_Generic_SID>
-20014
-
-> <DSSTox_FileID>
-15_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C8H8O4
-
-> <STRUCTURE_MolecularWeight>
-168.1488
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-3-Acetyl-6-methyl-2,4-pyrandione
-
-> <TestSubstance_CASRN>
-520-45-6
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-tautomers
-
-> <STRUCTURE_ChemicalName_IUPAC>
-3-acetyl-6-methyl-2H-pyran-2,4(3H)-dione
-
-> <STRUCTURE_SMILES>
-O=C1C(C(=O)OC(=C1)C)C(=O)C
-
-> <STRUCTURE_Parent_SMILES>
-O=C1C(C(=O)OC(=C1)C)C(=O)C
-
-> <STRUCTURE_InChI>
-InChI=1/C8H8O4/c1-4-3-6(10)7(5(2)9)8(11)12-4/h3,7H,1-2H3
-
-> <STRUCTURE_InChIKey>
-PGRHXDWITVMQBC-UHFFFAOYAH
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-mouse
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/3-ACETYL-6-METHYL-2,4-PYRANDIONE.html
-
-$$$$
-
-
-
- 11 11 0 0 0 0 0 0 0 0 1 V2000
- 3.9907 -2.3079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6605 -2.3079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9953 -1.1573 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6651 -1.1573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.3079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6558 -1.1573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9860 -1.1573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.6511 -2.3079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9860 -3.4586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6558 -3.4586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 7 2 0 0 0 0
- 1 11 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 6 2 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 2 0 0 0 0
- 9 10 1 0 0 0 0
- 10 11 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20015
-
-> <DSSTox_CID>
-15
-
-> <DSSTox_Generic_SID>
-20015
-
-> <DSSTox_FileID>
-16_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C8H10N2O
-
-> <STRUCTURE_MolecularWeight>
-150.1778
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-1-Acetyl-2-phenylhydrazine
-
-> <TestSubstance_CASRN>
-114-83-0
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-N'-phenylacetohydrazide
-
-> <STRUCTURE_SMILES>
-C1(NNC(C)=O)=CC=CC=C1
-
-> <STRUCTURE_Parent_SMILES>
-C1(NNC(C)=O)=CC=CC=C1
-
-> <STRUCTURE_InChI>
-InChI=1/C8H10N2O/c1-7(11)9-10-8-5-3-2-4-6-8/h2-6,10H,1H3,(H,9,11)/f/h9H
-
-> <STRUCTURE_InChIKey>
-UICBCXONCUFSOI-BGGKNDAXCP
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Mouse_mg>
-51.2
-
-> <TD50_Mouse_mmol>
-0.34092921856626
-
-> <ActivityScore_CPDBAS_Mouse>
-34
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Mouse_Male>
-vascular system
-
-> <TargetSites_Mouse_Female>
-vascular system
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/1-ACETYL-2-PHENYLHYDRAZINE.html
-
-$$$$
-
-
-
- 16 17 0 0 0 0 0 0 0 0 1 V2000
- 1.9954 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3269 -1.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.1473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9954 -2.3046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3223 -2.3046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9907 -1.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3176 -1.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9861 -2.3046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3176 -3.4520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9907 -3.4520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3130 -2.3046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9814 -1.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.3083 -1.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.9768 -2.3046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.3083 -3.4520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9814 -3.4520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 2 0 0 0 0
- 5 10 1 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 2 0 0 0 0
- 8 9 1 0 0 0 0
- 8 11 1 0 0 0 0
- 9 10 2 0 0 0 0
- 11 12 2 0 0 0 0
- 11 16 1 0 0 0 0
- 12 13 1 0 0 0 0
- 13 14 2 0 0 0 0
- 14 15 1 0 0 0 0
- 15 16 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20016
-
-> <DSSTox_CID>
-16
-
-> <DSSTox_Generic_SID>
-39243
-
-> <DSSTox_FileID>
-17_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C14H13NO
-
-> <STRUCTURE_MolecularWeight>
-211.2628
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-4-Acetylaminobiphenyl
-
-> <TestSubstance_CASRN>
-4075-79-0
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-N-biphenyl-4-ylacetamide
-
-> <STRUCTURE_SMILES>
-CC(=O)NC1=CC=C(C=C1)C2=CC=CC=C2
-
-> <STRUCTURE_Parent_SMILES>
-CC(=O)NC1=CC=C(C=C1)C2=CC=CC=C2
-
-> <STRUCTURE_InChI>
-InChI=1/C14H13NO/c1-11(16)15-14-9-7-13(8-10-14)12-5-3-2-4-6-12/h2-10H,1H3,(H,15,16)/f/h15H
-
-> <STRUCTURE_InChIKey>
-SVLDILRDQOVJED-YAQRNVERCM
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <TD50_Rat_mg>
-1.18
-
-> <TD50_Rat_mmol>
-5.58546038393887E-03
-
-> <ActivityScore_CPDBAS_Rat>
-49
-
-> <TargetSites_Rat_Female>
-mammary gland
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/4-ACETYLAMINOBIPHENYL.html
-
-$$$$
-
-
-
- 17 19 0 0 0 0 0 0 0 0 1 V2000
- 8.3884 -2.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.7257 -3.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.3884 -4.6052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.3920 -3.4560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7293 -2.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.3955 -2.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.5064 -3.2883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.2900 -2.7514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0737 -3.2883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.5081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.1426 -1.1828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3505 -0.6459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.4326 -1.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.7328 -1.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.3955 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7293 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.3920 -1.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 2 0 0 0 0
- 5 17 1 0 0 0 0
- 6 7 1 0 0 0 0
- 6 14 1 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 2 0 0 0 0
- 8 13 1 0 0 0 0
- 9 10 1 0 0 0 0
- 10 11 2 0 0 0 0
- 11 12 1 0 0 0 0
- 12 13 2 0 0 0 0
- 13 14 1 0 0 0 0
- 14 15 2 0 0 0 0
- 15 16 1 0 0 0 0
- 16 17 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20017
-
-> <DSSTox_CID>
-17
-
-> <DSSTox_Generic_SID>
-20017
-
-> <DSSTox_FileID>
-18_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C15H13NO
-
-> <STRUCTURE_MolecularWeight>
-223.2738
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-1-Acetylaminofluorene
-
-> <TestSubstance_CASRN>
-28314-03-6
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-N-9H-fluoren-1-ylacetamide
-
-> <STRUCTURE_SMILES>
-CC(=O)NC1=C2CC3=CC=CC=C3C2=CC=C1
-
-> <STRUCTURE_Parent_SMILES>
-CC(=O)NC1=C2CC3=CC=CC=C3C2=CC=C1
-
-> <STRUCTURE_InChI>
-InChI=1/C15H13NO/c1-10(17)16-15-8-4-7-13-12-6-3-2-5-11(12)9-14(13)15/h2-8H,9H2,1H3,(H,16,17)/f/h16H
-
-> <STRUCTURE_InChIKey>
-POECHIXSIXBYKI-WYUMXYHSCQ
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/1-ACETYLAMINOFLUORENE.html
-
-$$$$
-
-
-
- 17 19 0 0 0 0 0 0 0 0 1 V2000
- 5.7640 -1.7698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.0213 -1.3540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.8046 -2.4275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.1296 -2.2921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.6712 -1.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.8878 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.5629 -0.1451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.0213 -3.5106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7640 -3.0948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6035 -3.7621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4526 -3.0948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4526 -1.7698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6035 -1.1025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3017 -3.7621 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1509 -3.0948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.7621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1509 -1.7698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 9 1 0 0 0 0
- 1 13 2 0 0 0 0
- 2 3 2 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 2 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 2 0 0 0 0
- 11 14 1 0 0 0 0
- 12 13 1 0 0 0 0
- 14 15 1 0 0 0 0
- 15 16 1 0 0 0 0
- 15 17 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20018
-
-> <DSSTox_CID>
-18
-
-> <DSSTox_Generic_SID>
-39227
-
-> <DSSTox_FileID>
-19_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C15H13NO
-
-> <STRUCTURE_MolecularWeight>
-223.2698
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-2-Acetylaminofluorene
-
-> <TestSubstance_CASRN>
-53-96-3
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-N-9H-fluoren-2-ylacetamide
-
-> <STRUCTURE_SMILES>
-C12C3=C(C=CC=C3)CC1=CC(=CC=2)NC(C)=O
-
-> <STRUCTURE_Parent_SMILES>
-C12C3=C(C=CC=C3)CC1=CC(=CC=2)NC(C)=O
-
-> <STRUCTURE_InChI>
-InChI=1/C15H13NO/c1-10(17)16-13-6-7-15-12(9-13)8-11-4-2-3-5-14(11)15/h2-7,9H,8H2,1H3,(H,16,17)/f/h16H
-
-> <STRUCTURE_InChIKey>
-CZIHNRWJTSTCEX-WYUMXYHSCF
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse; hamster; rhesus
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-1.22
-
-> <TD50_Rat_mmol>
-5.46424102140101E-03
-
-> <ActivityScore_CPDBAS_Rat>
-49
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Rat_Male>
-liver; mammary gland; skin
-
-> <TargetSites_Rat_Female>
-liver; mammary gland; skin
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <TD50_Mouse_mg>
-7.59
-
-> <TD50_Mouse_mmol>
-3.39947453708473E-02
-
-> <ActivityScore_CPDBAS_Mouse>
-45
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test; greater than ten-fold variation among TD50 values for positive results
-
-> <TargetSites_Mouse_Male>
-liver; urinary bladder
-
-> <TargetSites_Mouse_Female>
-liver; urinary bladder
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <TD50_Hamster_mg>
-17.4
-
-> <TD50_Hamster_mmol>
-7.79326178462112E-02
-
-> <ActivityScore_CPDBAS_Hamster>
-53
-
-> <TargetSites_Hamster_Male>
-liver
-
-> <TargetSites_Hamster_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-> <TargetSites_Rhesus>
-no positive results
-
-> <TD50_Dog_Primates_Note>
-no positive results for Rhesus
-
-> <ActivityOutcome_CPDBAS_Dog_Primates>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active; multispecies active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/2-ACETYLAMINOFLUORENE.html
-
-$$$$
-
-
-
- 17 19 0 0 0 0 0 0 0 0 1 V2000
- 2.3012 -3.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.2905 -4.8819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.7528 -6.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.5342 -7.1688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.8533 -7.0326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3981 -5.8139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6167 -4.7385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.4266 -5.9572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1542 -4.6525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.6596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1542 -1.9929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3012 -2.6596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4553 -1.9929 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4553 -0.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3012 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6023 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 9 1 0 0 0 0
- 1 13 2 0 0 0 0
- 2 3 2 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 2 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 2 0 0 0 0
- 12 13 1 0 0 0 0
- 13 14 1 0 0 0 0
- 14 15 1 0 0 0 0
- 15 16 1 0 0 0 0
- 15 17 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20019
-
-> <DSSTox_CID>
-19
-
-> <DSSTox_Generic_SID>
-20019
-
-> <DSSTox_FileID>
-20_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C15H13NO
-
-> <STRUCTURE_MolecularWeight>
-223.2698
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-4-Acetylaminofluorene
-
-> <TestSubstance_CASRN>
-28322-02-3
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-N-9H-fluoren-4-ylacetamide
-
-> <STRUCTURE_SMILES>
-C12C3=C(C=CC=C3)CC1=CC=CC=2NC(C)=O
-
-> <STRUCTURE_Parent_SMILES>
-C12C3=C(C=CC=C3)CC1=CC=CC=2NC(C)=O
-
-> <STRUCTURE_InChI>
-InChI=1/C15H13NO/c1-10(17)16-14-8-4-6-12-9-11-5-2-3-7-13(11)15(12)14/h2-8H,9H2,1H3,(H,16,17)/f/h16H
-
-> <STRUCTURE_InChIKey>
-PHPWISAFHNEMSR-WYUMXYHSCU
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/4-ACETYLAMINOFLUORENE.html
-
-$$$$
-
-
-
- 14 14 0 0 0 0 0 0 0 0 1 V2000
- 5.7595 -0.6749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7595 -1.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6224 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6224 -2.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4853 -0.6749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4853 -1.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9335 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0891 -0.6564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2447 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0891 -1.9876 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3112 -2.6625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1556 -1.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1556 -0.6564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 3 2 0 0 0 0
- 1 7 1 0 0 0 0
- 2 4 2 0 0 0 0
- 3 5 1 0 0 0 0
- 4 6 1 0 0 0 0
- 5 6 2 0 0 0 0
- 6 11 1 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 2 0 0 0 0
- 8 10 1 0 0 0 0
- 11 12 1 0 0 0 0
- 12 13 1 0 0 0 0
- 12 14 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20020
-
-> <DSSTox_CID>
-20
-
-> <DSSTox_Generic_SID>
-20020
-
-> <DSSTox_FileID>
-21_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C10H11NO3
-
-> <STRUCTURE_MolecularWeight>
-193.1992
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-4-Acetylaminophenylacetic acid
-
-> <TestSubstance_CASRN>
-18699-02-0
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-[4-(acetylamino)phenyl]acetic acid
-
-> <STRUCTURE_SMILES>
-O=C(O)Cc1ccc(cc1)NC(C)=O
-
-> <STRUCTURE_Parent_SMILES>
-O=C(O)Cc1ccc(cc1)NC(C)=O
-
-> <STRUCTURE_InChI>
-InChI=1/C10H11NO3/c1-7(12)11-9-4-2-8(3-5-9)6-10(13)14/h2-5H,6H2,1H3,(H,11,12)(H,13,14)/f/h11,13H
-
-> <STRUCTURE_InChIKey>
-MROJXXOCABQVEF-KZZMUEETCP
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive; multispecies inactive
-
-> <Note_CPDBAS>
-Rat added v2a; Mouse added v2a
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/4-ACETYLAMINOPHENYLACETIC%20ACID.html
-
-$$$$
-
-
-
- 10 9 0 0 1 0 0 0 0 0 1 V2000
- 2.3100 -1.9854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4651 -1.3307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3100 -3.3213 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4651 -3.9920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4651 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4651 -5.3227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6148 -1.9854 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.9854 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1710 -1.3307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6148 -3.3213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 3 1 1 0 0 0
- 1 9 1 0 0 0 0
- 2 5 2 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 6 2 0 0 0 0
- 4 10 1 0 0 0 0
- 8 9 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20021
-
-> <DSSTox_CID>
-21
-
-> <DSSTox_Generic_SID>
-20021
-
-> <DSSTox_FileID>
-22_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C5H9NO3S
-
-> <STRUCTURE_MolecularWeight>
-163.1949
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-N-acetylcysteine
-
-> <TestSubstance_CASRN>
-616-91-1
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-stereochem
-
-> <STRUCTURE_ChemicalName_IUPAC>
-N-acetyl-L-cysteine
-
-> <STRUCTURE_SMILES>
-CC(=O)N[C@@H](CS)C(=O)O
-
-> <STRUCTURE_Parent_SMILES>
-CC(=O)N[C@@H](CS)C(=O)O
-
-> <STRUCTURE_InChI>
-InChI=1/C5H9NO3S/c1-3(7)6-4(2-10)5(8)9/h4,10H,2H2,1H3,(H,6,7)(H,8,9)/t4-/m0/s1/f/h6,8H
-
-> <STRUCTURE_InChIKey>
-PWKSKIMOESPYIA-JVBVHTJODB
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <Note_CPDBAS>
-Rat added v2a
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/N-ACETYLCYSTEINE.html
-
-$$$$
-
-
-
- 24 25 0 0 0 0 0 0 0 0 2 V2000
- 11.5157 -1.9922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3641 -1.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3641 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2126 -1.9922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2126 -3.3280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0610 -3.9959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9094 -3.3280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9094 -1.9922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0610 -1.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7578 -1.3358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6063 -1.9922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6063 -3.3280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4547 -3.9959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3031 -3.3280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3031 -1.9922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4547 -1.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4547 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1516 -3.9959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.4837 -2.8444 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
- 1.8195 -5.1475 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -4.6523 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3641 -3.9959 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 10.3641 -5.3203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 11.5157 -3.3280 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 9 1 0 0 0 0
- 5 6 1 0 0 0 0
- 5 22 1 0 0 0 0
- 6 7 2 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 2 0 0 0 0
- 8 10 1 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 2 0 0 0 0
- 11 16 1 0 0 0 0
- 12 13 1 0 0 0 0
- 13 14 2 0 0 0 0
- 14 15 1 0 0 0 0
- 14 18 1 0 0 0 0
- 15 16 2 0 0 0 0
- 16 17 1 0 0 0 0
- 18 19 1 0 0 0 0
- 18 20 1 0 0 0 0
- 18 21 1 0 0 0 0
- 22 23 2 0 0 0 0
- 22 24 1 0 0 0 0
-M CHG 2 22 1 24 -1
-M END
-> <DSSTox_RID>
-20022
-
-> <DSSTox_CID>
-22
-
-> <DSSTox_Generic_SID>
-20022
-
-> <DSSTox_FileID>
-23_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C14H7ClF3NO5
-
-> <STRUCTURE_MolecularWeight>
-361.6573
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Acifluorfen
-
-> <TestSubstance_CASRN>
-50594-66-6
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-5-{[2-chloro-4-(trifluoromethyl)phenyl]oxy}-2-nitrobenzoic acid
-
-> <STRUCTURE_SMILES>
-OC(=O)C1=C(C=CC(=C1)OC2=CC=C(C=C2Cl)C(F)(F)F)[N+](=O)[O-]
-
-> <STRUCTURE_Parent_SMILES>
-OC(=O)C1=C(C=CC(=C1)OC2=CC=C(C=C2Cl)C(F)(F)F)[N+](=O)[O-]
-
-> <STRUCTURE_InChI>
-InChI=1/C14H7ClF3NO5/c15-10-5-7(14(16,17)18)1-4-12(10)24-8-2-3-11(19(22)23)9(6-8)13(20)21/h1-6H,(H,20,21)/f/h20H
-
-> <STRUCTURE_InChIKey>
-NUFNQYOELLVIPL-UYBDAZJACV
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-mouse
-
-> <TD50_Mouse_mg>
-141
-
-> <TD50_Mouse_mmol>
-0.389871848293951
-
-> <ActivityScore_CPDBAS_Mouse>
-33
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Mouse_Male>
-liver; stomach
-
-> <TargetSites_Mouse_Female>
-liver; stomach
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ACIFLUORFEN.html
-
-$$$$
-
-
-
- 4 3 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1513 -0.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3061 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4575 -0.6638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20023
-
-> <DSSTox_CID>
-23
-
-> <DSSTox_Generic_SID>
-20023
-
-> <DSSTox_FileID>
-24_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C3H4O
-
-> <STRUCTURE_MolecularWeight>
-56.0633
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Acrolein
-
-> <TestSubstance_CASRN>
-107-02-8
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-acrylaldehyde
-
-> <STRUCTURE_SMILES>
-C=CC=O
-
-> <STRUCTURE_Parent_SMILES>
-C=CC=O
-
-> <STRUCTURE_InChI>
-InChI=1/C3H4O/c1-2-3-4/h2-3H,1H2
-
-> <STRUCTURE_InChIKey>
-HGINCPLSRVDWNT-UHFFFAOYAQ
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive; multispecies inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ACROLEIN.html
-
-$$$$
-
-
-
- 9 8 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -1.9953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1520 -2.6588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3040 -1.9953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3040 -0.6635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1520 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.6635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4560 -2.6588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6080 -1.9953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6080 -0.6635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 7 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 1 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20024
-
-> <DSSTox_CID>
-24
-
-> <DSSTox_Generic_SID>
-20024
-
-> <DSSTox_FileID>
-25_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C7H14O2
-
-> <STRUCTURE_MolecularWeight>
-130.1864
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Acrolein diethylacetal
-
-> <TestSubstance_CASRN>
-3054-95-3
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-3,3-bis(ethyloxy)prop-1-ene
-
-> <STRUCTURE_SMILES>
-C=CC(OCC)OCC
-
-> <STRUCTURE_Parent_SMILES>
-C=CC(OCC)OCC
-
-> <STRUCTURE_InChI>
-InChI=1/C7H14O2/c1-4-7(8-5-2)9-6-3/h4,7H,1,5-6H2,2-3H3
-
-> <STRUCTURE_InChIKey>
-MCIPQLOKVXSHTD-UHFFFAOYAI
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ACROLEIN%20DIETHYLACETAL.html
-
-$$$$
-
-
-
- 5 4 0 0 0 0 0 0 0 0 1 V2000
- 4.6099 -0.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4575 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3050 -0.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1525 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.6638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 2 0 0 0 0
- 4 5 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20025
-
-> <DSSTox_CID>
-25
-
-> <DSSTox_Generic_SID>
-20025
-
-> <DSSTox_FileID>
-26_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C3H5NO
-
-> <STRUCTURE_MolecularWeight>
-71.0786
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Acrolein oxime
-
-> <TestSubstance_CASRN>
-5314-33-0
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-(1E)-prop-2-enal oxime
-
-> <STRUCTURE_SMILES>
-C=C/C=N/O
-
-> <STRUCTURE_Parent_SMILES>
-C=C/C=N/O
-
-> <STRUCTURE_InChI>
-InChI=1/C3H5NO/c1-2-3-4-5/h2-3,5H,1H2/b4-3+
-
-> <STRUCTURE_InChIKey>
-KMNIXISXZFPRDC-ONEGZZNKBI
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ACROLEIN%20OXIME.html
-
-$$$$
-
-
-
- 24 27 0 0 0 0 0 0 0 0 1 V2000
- 6.9100 -5.0061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7600 -5.6730 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6099 -5.0061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4598 -5.6730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3001 -5.0061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1501 -5.6730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -5.0061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3001 -3.6821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4598 -3.0153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6099 -3.6821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7600 -3.0153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7600 -1.6816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6099 -1.0148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4598 -1.6816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.7498 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.4604 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4598 -7.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6099 -7.6735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7600 -7.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9100 -7.6735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9100 -8.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7600 -9.6644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6099 -8.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3001 -7.6735 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 1 0 0 0 0
- 2 19 1 0 0 0 0
- 3 4 2 0 0 0 0
- 3 10 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 17 1 0 0 0 0
- 5 6 1 0 0 0 0
- 5 8 2 0 0 0 0
- 6 7 1 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 9 14 1 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 2 0 0 0 0
- 12 13 1 0 0 0 0
- 13 14 1 0 0 0 0
- 13 15 1 0 0 0 0
- 13 16 1 0 0 0 0
- 17 18 1 0 0 0 0
- 17 24 2 0 0 0 0
- 18 19 2 0 0 0 0
- 18 23 1 0 0 0 0
- 19 20 1 0 0 0 0
- 20 21 2 0 0 0 0
- 21 22 1 0 0 0 0
- 22 23 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20026
-
-> <DSSTox_CID>
-26
-
-> <DSSTox_Generic_SID>
-20026
-
-> <DSSTox_FileID>
-27_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C20H19NO3
-
-> <STRUCTURE_MolecularWeight>
-321.3698
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Acronycine
-
-> <TestSubstance_CASRN>
-7008-42-6
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-3,3,12-trimethyl-6-(methyloxy)-3,12-dihydro-7H-pyrano[2,3-c]acridin-7-one
-
-> <STRUCTURE_SMILES>
-CN1C2=C(C(OC)=CC3=C2C=CC(O3)(C)C)C(C4=C1C=CC=C4)=O
-
-> <STRUCTURE_Parent_SMILES>
-CN1C2=C(C(OC)=CC3=C2C=CC(O3)(C)C)C(C4=C1C=CC=C4)=O
-
-> <STRUCTURE_InChI>
-InChI=1/C20H19NO3/c1-20(2)10-9-13-15(24-20)11-16(23-4)17-18(13)21(3)14-8-6-5-7-12(14)19(17)22/h5-11H,1-4H3
-
-> <STRUCTURE_InChIKey>
-SMPZPKRDRQOOHT-UHFFFAOYAD
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <TD50_Rat_mg>
-0.505
-
-> <TD50_Rat_mmol>
-1.57139843258452E-03
-
-> <ActivityScore_CPDBAS_Rat>
-55
-
-> <TD50_Rat_Note>
-positive test results only by intraperitoneal or intravenous injection; TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Rat_Male>
-bone; peritoneal cavity
-
-> <TargetSites_Rat_Female>
-mammary gland; peritoneal cavity
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-NTP bioassay inadequate
-
-> <TargetSites_Mouse_Male>
-NTP bioassay inadequate
-
-> <TargetSites_Mouse_Female>
-NTP bioassay inadequate
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inconclusive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active
-
-> <NTP_TechnicalReport>
-TR 49
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ACRONYCINE.html
-
-$$$$
-
-
-
- 5 4 0 0 0 0 0 0 0 0 1 V2000
- 3.4567 -1.9945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3056 -1.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3056 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1511 -1.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 4 1 0 0 0 0
- 4 5 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20027
-
-> <DSSTox_CID>
-27
-
-> <DSSTox_Generic_SID>
-20027
-
-> <DSSTox_FileID>
-28_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C3H5NO
-
-> <STRUCTURE_MolecularWeight>
-71.0779
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Acrylamide
-
-> <TestSubstance_CASRN>
-79-06-1
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-acrylamide
-
-> <STRUCTURE_SMILES>
-NC(=O)C=C
-
-> <STRUCTURE_Parent_SMILES>
-NC(=O)C=C
-
-> <STRUCTURE_InChI>
-InChI=1/C3H5NO/c1-2-3(4)5/h2H,1H2,(H2,4,5)/f/h4H2
-
-> <STRUCTURE_InChIKey>
-HRPVXLWXLXDGHG-LGEMBHMGCJ
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <TD50_Rat_mg>
-3.75
-
-> <TD50_Rat_mmol>
-0.052759015108775
-
-> <ActivityScore_CPDBAS_Rat>
-39
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Rat_Male>
-nervous system; peritoneal cavity; thyroid gland
-
-> <TargetSites_Rat_Female>
-clitoral gland; mammary gland; nervous system; oral cavity; thyroid gland; uterus
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active
-
-> <Note_CPDBAS>
-TD50_Rat modified v3a
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ACRYLAMIDE.html
-
-$$$$
-
-
-
- 5 4 0 0 0 0 0 0 0 0 1 V2000
- 3.4567 -1.9945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3056 -1.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3056 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1511 -1.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 4 1 0 0 0 0
- 4 5 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20028
-
-> <DSSTox_CID>
-28
-
-> <DSSTox_Generic_SID>
-39229
-
-> <DSSTox_FileID>
-29_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C3H4O2
-
-> <STRUCTURE_MolecularWeight>
-72.0627
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Acrylic acid
-
-> <TestSubstance_CASRN>
-79-10-7
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-acrylic acid
-
-> <STRUCTURE_SMILES>
-OC(=O)C=C
-
-> <STRUCTURE_Parent_SMILES>
-OC(=O)C=C
-
-> <STRUCTURE_InChI>
-InChI=1/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5)/f/h4H
-
-> <STRUCTURE_InChIKey>
-NIXOWILDQLNWCW-JLSKMEETCA
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ACRYLIC%20ACID.html
-
-$$$$
-
-
-
- 4 3 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6652 -1.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9956 -1.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3260 -1.1508 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 3 0 0 0 0
-M END
-> <DSSTox_RID>
-20029
-
-> <DSSTox_CID>
-29
-
-> <DSSTox_Generic_SID>
-20029
-
-> <DSSTox_FileID>
-30_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C3H3N
-
-> <STRUCTURE_MolecularWeight>
-53.0626
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Acrylonitrile
-
-> <TestSubstance_CASRN>
-107-13-1
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-acrylonitrile
-
-> <STRUCTURE_SMILES>
-C=CC#N
-
-> <STRUCTURE_Parent_SMILES>
-C=CC#N
-
-> <STRUCTURE_InChI>
-InChI=1/C3H3N/c1-2-3-4/h2H,1H2
-
-> <STRUCTURE_InChIKey>
-NLHHRLWOUZZQLW-UHFFFAOYAG
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-16.9
-
-> <TD50_Rat_mmol>
-0.318491743714028
-
-> <ActivityScore_CPDBAS_Rat>
-31
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test; greater than ten-fold variation among TD50 values for positive results
-
-> <TargetSites_Rat_Male>
-ear Zymbals gland; nervous system; oral cavity; small intestine; stomach
-
-> <TargetSites_Rat_Female>
-ear Zymbals gland; mammary gland; nasal cavity; nervous system; oral cavity; small intestine; stomach
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <TD50_Mouse_mg>
-6.32
-
-> <TD50_Mouse_mmol>
-0.119104604749861
-
-> <ActivityScore_CPDBAS_Mouse>
-39
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Mouse_Male>
-harderian gland; stomach
-
-> <TargetSites_Mouse_Female>
-harderian gland; stomach
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active
-
-> <Note_CPDBAS>
-Mouse added v5a
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ACRYLONITRILE.html
-
-$$$$
-
-
-
- 93 99 0 0 1 0 0 0 0 0 1 V2000
- 11.4975 -12.9190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 11.4975 -14.1106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.5218 -12.3337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.4523 -12.3337 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 10.4523 -14.7168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 12.5218 -14.7168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.5218 -11.1421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 13.5670 -12.9190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.4279 -12.9190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.4279 -14.1106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 13.5670 -14.1106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.5218 -15.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 13.5670 -10.5359 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 11.4975 -10.5359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 14.5914 -12.3337 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 8.3827 -12.3337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.3827 -14.7168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 14.5914 -14.7168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 8.3827 -11.1421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3584 -12.9190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3584 -14.1106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.3827 -15.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3584 -10.5359 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 9.4279 -10.5359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 13.5670 -9.2816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.4800 -8.6545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 14.6332 -8.6545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.4800 -3.8046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 11.4139 -9.2816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 14.6332 -7.4211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 15.7411 -9.2607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 16.7654 -8.6754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 16.7654 -7.4838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 17.8734 -2.9893 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 18.2496 -1.8396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 18.8350 -3.7001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 19.4412 -1.8396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 19.8175 -2.9893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 19.8593 -4.2854 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 18.8350 -5.0798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 17.8316 -5.6860 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 19.8802 -5.6860 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 19.8802 -6.8776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 20.9045 -5.0798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 18.8350 -7.4838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 17.8316 -6.8776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 18.8350 -8.6754 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 19.8802 -9.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 17.8316 -9.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 17.8316 -10.4523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 18.8350 -11.0585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 16.7654 -11.0585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3584 -9.2816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.4454 -8.6545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.2923 -8.6545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.4454 -3.8046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 9.5116 -9.2816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.2923 -7.4211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.1634 -9.2607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.1391 -8.6754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.1391 -7.4838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.0312 -2.9893 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6549 -1.8396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0695 -3.7001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.4633 -1.8396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1079 -2.9893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0661 -4.2854 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0695 -5.0798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.0939 -5.6860 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0243 -5.6860 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0243 -6.8776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -5.0798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0695 -7.4838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.0939 -6.8776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0695 -8.6754 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0243 -9.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.0939 -9.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.0939 -10.4523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0695 -11.0585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.1391 -11.0585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 14.6750 -3.8046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 13.5879 -3.1566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 14.6750 -5.0589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 13.5879 -1.9023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.4800 -1.2752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 14.6750 -1.2752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.4800 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.2505 -3.8046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3375 -3.1566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.2505 -5.0589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3375 -1.9023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.2505 -1.2752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.4454 -1.2752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 3 1 0 0 0 0
- 1 4 2 0 0 0 0
- 2 5 1 0 0 0 0
- 2 6 2 0 0 0 0
- 3 7 1 0 0 0 0
- 3 8 2 0 0 0 0
- 4 9 1 0 0 0 0
- 5 10 1 0 0 0 0
- 6 11 1 0 0 0 0
- 6 12 1 0 0 0 0
- 7 13 1 0 0 0 0
- 7 14 2 0 0 0 0
- 8 15 1 0 0 0 0
- 8 11 1 0 0 0 0
- 9 16 2 0 0 0 0
- 9 10 1 0 0 0 0
- 10 17 2 0 0 0 0
- 11 18 2 0 0 0 0
- 25 13 1 6 0 0 0
- 16 19 1 0 0 0 0
- 16 20 1 0 0 0 0
- 17 21 1 0 0 0 0
- 17 22 1 0 0 0 0
- 19 23 1 0 0 0 0
- 19 24 2 0 0 0 0
- 20 21 2 0 0 0 0
- 53 23 1 1 0 0 0
- 25 26 1 0 0 0 0
- 25 27 1 0 0 0 0
- 26 28 1 0 0 0 0
- 26 29 2 0 0 0 0
- 27 30 1 1 0 0 0
- 27 31 1 0 0 0 0
- 82 28 1 6 0 0 0
- 31 32 1 0 0 0 0
- 32 33 2 0 0 0 0
- 32 49 1 0 0 0 0
- 34 35 1 0 0 0 0
- 34 36 1 0 0 0 0
- 34 81 1 0 0 0 0
- 35 37 1 0 0 0 0
- 36 38 1 0 0 0 0
- 36 39 1 6 0 0 0
- 36 40 1 0 0 0 0
- 37 38 1 0 0 0 0
- 40 41 2 0 0 0 0
- 40 42 1 0 0 0 0
- 42 43 1 0 0 0 0
- 42 44 1 0 0 0 0
- 43 45 1 0 0 0 0
- 45 46 2 0 0 0 0
- 45 47 1 0 0 0 0
- 47 48 1 0 0 0 0
- 47 49 1 0 0 0 0
- 49 50 1 1 0 0 0
- 50 51 1 0 0 0 0
- 50 52 1 0 0 0 0
- 53 54 1 0 0 0 0
- 53 55 1 0 0 0 0
- 54 56 1 0 0 0 0
- 54 57 2 0 0 0 0
- 55 58 1 6 0 0 0
- 55 59 1 0 0 0 0
- 89 56 1 1 0 0 0
- 59 60 1 0 0 0 0
- 60 61 2 0 0 0 0
- 60 77 1 0 0 0 0
- 62 63 1 0 0 0 0
- 62 64 1 0 0 0 0
- 62 88 1 0 0 0 0
- 63 65 1 0 0 0 0
- 64 66 1 0 0 0 0
- 64 67 1 1 0 0 0
- 64 68 1 0 0 0 0
- 65 66 1 0 0 0 0
- 68 69 2 0 0 0 0
- 68 70 1 0 0 0 0
- 70 71 1 0 0 0 0
- 70 72 1 0 0 0 0
- 71 73 1 0 0 0 0
- 73 74 2 0 0 0 0
- 73 75 1 0 0 0 0
- 75 76 1 0 0 0 0
- 75 77 1 0 0 0 0
- 77 78 1 6 0 0 0
- 78 79 1 0 0 0 0
- 78 80 1 0 0 0 0
- 81 82 1 0 0 0 0
- 81 83 2 0 0 0 0
- 82 84 1 0 0 0 0
- 84 85 1 0 0 0 0
- 84 86 1 6 0 0 0
- 85 87 1 0 0 0 0
- 88 89 1 0 0 0 0
- 88 90 2 0 0 0 0
- 89 91 1 0 0 0 0
- 91 92 1 0 0 0 0
- 91 93 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20030
-
-> <DSSTox_CID>
-30
-
-> <DSSTox_Generic_SID>
-20030
-
-> <DSSTox_FileID>
-31_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C63H88N12O16
-
-> <STRUCTURE_MolecularWeight>
-1269.4436
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-representative component in mixture
-
-> <TestSubstance_ChemicalName>
-Actinomycin C
-
-> <TestSubstance_CASRN>
-8052-16-2
-
-> <TestSubstance_Description>
-mixture or formulation
-
-> <ChemicalNote>
-mixture of actinomycin C1 [50-76-0] (10%), actinomycin C2 [2612-14-8] (45%), and actinomycin C3 [6156-47-4] (45%), structure shown C2, stereochem
-
-> <STRUCTURE_ChemicalName_IUPAC>
-2-amino-4,6-dimethyl-3-oxo-N~9~-[(6S,9R,10S,13R,18aS)-2,5,9-trimethyl-6,13-bis(1-methylethyl)-1,4,7,11,14-pentaoxohexadecahydro-1H-pyrrolo[2,1-i][1,4,7,10,13]oxatetraazacyclohexadecin-10-yl]-N~1~-{(6S,9R,10S,13R,18aS)-2,5,9-trimethyl-6-(1-methylethyl)
-
-> <STRUCTURE_SMILES>
-O=C(N[C@@H]([C@H](OC([C@@H]5[C@@H](C)C)=O)C)C(N[C@H]([C@@H](C)CC)C(N4CCC[C@@](C(N(C)CC(N5C)=O)=O)4[H])=O)=O)C(C(C(OC2=C(C)C=C3)=C(C)C1=O)=NC2=C3C(N[C@@H]([C@H](OC([C@@H]7[C@H](C)C)=O)C)C(N[C@H](C(C)C)C(N6CCC[C@@](C(N(C)CC(N7C)=O)=O)6[H])=O)=O)=O)=C1N
-
-> <STRUCTURE_Parent_SMILES>
-O=C(N[C@@H]([C@H](OC([C@@H]5[C@@H](C)C)=O)C)C(N[C@H]([C@@H](C)CC)C(N4CCC[C@@](C(N(C)CC(N5C)=O)=O)4[H])=O)=O)C(C(C(OC2=C(C)C=C3)=C(C)C1=O)=NC2=C3C(N[C@@H]([C@H](OC([C@@H]7[C@H](C)C)=O)C)C(N[C@H](C(C)C)C(N6CCC[C@@](C(N(C)CC(N7C)=O)=O)6[H])=O)=O)=O)=C1N
-
-> <STRUCTURE_InChI>
-InChI=1/C63H88N12O16/c1-17-31(8)44-61(86)75-25-19-21-38(75)59(84)71(14)27-40(77)73(16)50(30(6)7)63(88)90-35(12)46(57(82)67-44)69-55(80)41-42(64)51(78)33(10)53-48(41)65-47-36(23-22-32(9)52(47)91-53)54(79)68-45-34(11)89-62(87)49(29(4)5)72(15)39(76)26-70(13)58(83)37-20-18-24-74(37)60(85)43(28(2)3)66-56(45)81/h22-23,28-31,34-35,37-38,43-46,49-50H,17-21,24-27,64H2,1-16H3,(H,66,81)(H,67,82)(H,68,79)(H,69,80)/t31-,34+,35+,37-,38-,43+,44+,45-,46-,49-,50-/m0/s1/f/h66-69H
-
-> <STRUCTURE_InChIKey>
-QCXJFISCRQIYID-IFORFJDKDU
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ACTINOMYCIN%20C.html
-
-$$$$
-
-
-
- 92 98 0 0 1 0 0 0 0 0 1 V2000
- 11.5534 -11.4484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 11.5534 -12.6457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.5827 -10.8602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.5031 -10.8602 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 10.5031 -13.2549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 12.5827 -13.2549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.5827 -9.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 13.6330 -11.4484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.4738 -11.4484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.4738 -12.6457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 13.6330 -12.6457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.5827 -14.4523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 13.6330 -9.0537 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 11.5534 -9.0537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 14.6623 -10.8602 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 8.4235 -10.8602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.4235 -13.2549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 14.6623 -13.2549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 8.4235 -9.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3942 -11.4484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3942 -12.6457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.4235 -14.4523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3942 -9.0537 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 9.4738 -9.0537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 13.6330 -7.7933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.5407 -7.1631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 14.7043 -7.1631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.5407 -2.2897 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 11.4694 -7.7933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 14.7043 -5.9238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 15.8177 -7.7723 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 16.8470 -7.1841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 16.8470 -5.9868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 13.5280 -1.8065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 13.5280 -0.6092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 15.6706 -2.3947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 17.9603 -1.4704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 15.6706 -3.5921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 18.3384 -0.3151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 18.9266 -2.1846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 19.5358 -0.3151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 19.9139 -1.4704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.4777 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 14.5573 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 19.9559 -2.7728 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 18.9266 -3.5711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 17.9183 -4.1802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 19.9769 -4.1802 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 19.9769 -5.3776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 21.0062 -3.5711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 18.9266 -5.9868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 17.9183 -5.3776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 18.9266 -7.1841 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 19.9769 -7.7723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 17.9183 -7.7723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 17.9183 -8.9697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 18.9266 -9.5788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 16.8470 -9.5788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3942 -7.7933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.4865 -7.1631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.3229 -7.1631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.4865 -2.2897 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 9.5578 -7.7933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.3229 -5.9238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.1885 -7.7723 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.1592 -7.1841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.1592 -5.9868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 7.4992 -1.8065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.4992 -0.6092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3566 -2.3947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.0459 -1.4704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3566 -3.5921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6678 -0.3151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0796 -2.1846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.4704 -0.3151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1133 -1.4704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.5285 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.4489 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0713 -2.7728 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0796 -3.5711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.1089 -4.1802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0293 -4.1802 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0293 -5.3776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.5711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0796 -5.9868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.1089 -5.3776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0796 -7.1841 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0293 -7.7723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.1089 -7.7723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.1089 -8.9697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0796 -9.5788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.1592 -9.5788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 3 1 0 0 0 0
- 1 4 2 0 0 0 0
- 2 5 1 0 0 0 0
- 2 6 2 0 0 0 0
- 3 7 1 0 0 0 0
- 3 8 2 0 0 0 0
- 4 9 1 0 0 0 0
- 5 10 1 0 0 0 0
- 6 11 1 0 0 0 0
- 6 12 1 0 0 0 0
- 7 13 1 0 0 0 0
- 7 14 2 0 0 0 0
- 8 15 1 0 0 0 0
- 8 11 1 0 0 0 0
- 9 16 2 0 0 0 0
- 9 10 1 0 0 0 0
- 10 17 2 0 0 0 0
- 11 18 2 0 0 0 0
- 25 13 1 6 0 0 0
- 16 19 1 0 0 0 0
- 16 20 1 0 0 0 0
- 17 21 1 0 0 0 0
- 17 22 1 0 0 0 0
- 19 23 1 0 0 0 0
- 19 24 2 0 0 0 0
- 20 21 2 0 0 0 0
- 59 23 1 1 0 0 0
- 25 26 1 0 0 0 0
- 25 27 1 0 0 0 0
- 26 28 1 0 0 0 0
- 26 29 2 0 0 0 0
- 27 30 1 1 0 0 0
- 27 31 1 0 0 0 0
- 28 34 1 0 0 0 0
- 31 32 1 0 0 0 0
- 32 33 2 0 0 0 0
- 32 55 1 0 0 0 0
- 34 35 1 6 0 0 0
- 34 36 1 0 0 0 0
- 35 43 1 0 0 0 0
- 35 44 1 0 0 0 0
- 36 37 1 0 0 0 0
- 36 38 2 0 0 0 0
- 37 39 1 0 0 0 0
- 37 40 1 0 0 0 0
- 39 41 1 0 0 0 0
- 40 42 1 0 0 0 0
- 40 45 1 6 0 0 0
- 40 46 1 0 0 0 0
- 41 42 1 0 0 0 0
- 46 47 2 0 0 0 0
- 46 48 1 0 0 0 0
- 48 49 1 0 0 0 0
- 48 50 1 0 0 0 0
- 49 51 1 0 0 0 0
- 51 52 2 0 0 0 0
- 51 53 1 0 0 0 0
- 53 54 1 0 0 0 0
- 53 55 1 0 0 0 0
- 55 56 1 1 0 0 0
- 56 57 1 0 0 0 0
- 56 58 1 0 0 0 0
- 59 60 1 0 0 0 0
- 59 61 1 0 0 0 0
- 60 62 1 0 0 0 0
- 60 63 2 0 0 0 0
- 61 64 1 6 0 0 0
- 61 65 1 0 0 0 0
- 62 68 1 0 0 0 0
- 65 66 1 0 0 0 0
- 66 67 2 0 0 0 0
- 66 89 1 0 0 0 0
- 68 69 1 1 0 0 0
- 68 70 1 0 0 0 0
- 69 77 1 0 0 0 0
- 69 78 1 0 0 0 0
- 70 71 1 0 0 0 0
- 70 72 2 0 0 0 0
- 71 73 1 0 0 0 0
- 71 74 1 0 0 0 0
- 73 75 1 0 0 0 0
- 74 76 1 0 0 0 0
- 74 79 1 1 0 0 0
- 74 80 1 0 0 0 0
- 75 76 1 0 0 0 0
- 80 81 2 0 0 0 0
- 80 82 1 0 0 0 0
- 82 83 1 0 0 0 0
- 82 84 1 0 0 0 0
- 83 85 1 0 0 0 0
- 85 86 2 0 0 0 0
- 85 87 1 0 0 0 0
- 87 88 1 0 0 0 0
- 87 89 1 0 0 0 0
- 89 90 1 6 0 0 0
- 90 91 1 0 0 0 0
- 90 92 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20031
-
-> <DSSTox_CID>
-31
-
-> <DSSTox_Generic_SID>
-20031
-
-> <DSSTox_FileID>
-32_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C62H86N12O16
-
-> <STRUCTURE_MolecularWeight>
-1255.417
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Actinomycin D
-
-> <TestSubstance_CASRN>
-50-76-0
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-stereochem
-
-> <STRUCTURE_ChemicalName_IUPAC>
-2-amino-4,6-dimethyl-3-oxo-N,N'-bis[(6S,9R,10S,13R,18aS)-2,5,9-trimethyl-6,13-bis(1-methylethyl)-1,4,7,11,14-pentaoxohexadecahydro-1H-pyrrolo[2,1-i][1,4,7,10,13]oxatetraazacyclohexadecin-10-yl]-3H-phenoxazine-1,9-dicarboxamide
-
-> <STRUCTURE_SMILES>
-C12C(OC3=C(N=1)C(=CC=C3C)C(N[C@@H]4C(N[C@@H](C(N5[C@@H](CCC5)C(N(CC(N([C@H](C(O[C@H]4C)=O)C(C)C)C)=O)C)=O)=O)C(C)C)=O)=O)=C(C(C(=C2C(N[C@@H]6C(N[C@@H](C(N7[C@@H](CCC7)C(N(CC(N([C@H](C(O[C@H]6C)=O)C(C)C)C)=O)C)=O)=O)C(C)C)=O)=O)N)=O)C
-
-> <STRUCTURE_Parent_SMILES>
-C12C(OC3=C(N=1)C(=CC=C3C)C(N[C@@H]4C(N[C@@H](C(N5[C@@H](CCC5)C(N(CC(N([C@H](C(O[C@H]4C)=O)C(C)C)C)=O)C)=O)=O)C(C)C)=O)=O)=C(C(C(=C2C(N[C@@H]6C(N[C@@H](C(N7[C@@H](CCC7)C(N(CC(N([C@H](C(O[C@H]6C)=O)C(C)C)C)=O)C)=O)=O)C(C)C)=O)=O)N)=O)C
-
-> <STRUCTURE_InChI>
-InChI=1/C62H86N12O16/c1-27(2)42-59(84)73-23-17-19-36(73)57(82)69(13)25-38(75)71(15)48(29(5)6)61(86)88-33(11)44(55(80)65-42)67-53(78)35-22-21-31(9)51-46(35)64-47-40(41(63)50(77)32(10)52(47)90-51)54(79)68-45-34(12)89-62(87)49(30(7)8)72(16)39(76)26-70(14)58(83)37-20-18-24-74(37)60(85)43(28(3)4)66-56(45)81/h21-22,27-30,33-34,36-37,42-45,48-49H,17-20,23-26,63H2,1-16H3,(H,65,80)(H,66,81)(H,67,78)(H,68,79)/t33-,34-,36+,37+,42-,43-,44+,45+,48+,49+/m1/s1/f/h65-68H
-
-> <STRUCTURE_InChIKey>
-RJURFGZVJUQBHK-HQANWYOLDQ
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <TD50_Rat_mg>
-0.00111
-
-> <TD50_Rat_mmol>
-8.84168367960606E-07
-
-> <ActivityScore_CPDBAS_Rat>
-88
-
-> <TD50_Rat_Note>
-positive test results only by intraperitoneal or intravenous injection; TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Rat_Male>
-peritoneal cavity
-
-> <TargetSites_Rat_Female>
-peritoneal cavity
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex active
-
-> <Note_CPDBAS>
-TD50_Rat_Note modified v5a
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ACTINOMYCIN%20D.html
-
-$$$$
-
-
-
- 10 9 0 0 0 0 0 0 0 0 1 V2000
- 8.0713 -1.9936 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9171 -1.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9171 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7629 -1.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6087 -1.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4626 -1.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3084 -1.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1542 -1.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1542 -3.3254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.3318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 2 0 0 0 0
- 8 10 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20032
-
-> <DSSTox_CID>
-32
-
-> <DSSTox_Generic_SID>
-20032
-
-> <DSSTox_FileID>
-33_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C6H12N2O2
-
-> <STRUCTURE_MolecularWeight>
-144.1717
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Adipamide
-
-> <TestSubstance_CASRN>
-628-94-4
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-hexanediamide
-
-> <STRUCTURE_SMILES>
-NC(=O)CCCCC(=O)N
-
-> <STRUCTURE_Parent_SMILES>
-NC(=O)CCCCC(=O)N
-
-> <STRUCTURE_InChI>
-InChI=1/C6H12N2O2/c7-5(9)3-1-2-4-6(8)10/h1-4H2,(H2,7,9)(H2,8,10)/f/h7-8H2
-
-> <STRUCTURE_InChIKey>
-GVNWZKBFMFUVNX-UNXFWZPKCL
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive; multispecies inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ADIPAMIDE.html
-
-$$$$
-
-
-
- 18 19 0 0 0 0 0 0 0 0 2 V2000
- 3.2537 -3.5906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.2537 -2.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.4062 -1.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.4062 -4.2555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.1011 -4.2555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9682 -0.2748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6649 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.1011 -1.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.1525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8866 -2.1366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7006 -3.5817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 7.0038 -3.8654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.5587 -2.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.6687 -2.7129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.7733 -1.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.5446 -5.0800 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 6.7644 -6.1527 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 8.8656 -5.2130 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 5 1 0 0 0 0
- 1 4 2 0 0 0 0
- 2 3 2 0 0 0 0
- 2 8 1 0 0 0 0
- 3 13 1 0 0 0 0
- 6 7 1 0 0 0 0
- 6 8 1 0 0 0 0
- 7 9 2 0 0 0 0
- 8 10 2 0 0 0 0
- 9 10 1 0 0 0 0
- 11 12 1 0 0 0 0
- 11 13 1 0 0 0 0
- 12 14 2 0 0 0 0
- 12 16 1 0 0 0 0
- 13 15 2 0 0 0 0
- 14 15 1 0 0 0 0
- 16 17 1 0 0 0 0
- 16 18 2 0 0 0 0
-M CHG 2 16 1 17 -1
-M END
-> <DSSTox_RID>
-20033
-
-> <DSSTox_CID>
-33
-
-> <DSSTox_Generic_SID>
-20033
-
-> <DSSTox_FileID>
-34_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C11H8N2O5
-
-> <STRUCTURE_MolecularWeight>
-248.1916
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-AF-2
-
-> <TestSubstance_CASRN>
-3688-53-7
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-stereochem
-
-> <STRUCTURE_ChemicalName_IUPAC>
-(2Z)-2-(furan-2-yl)-3-(5-nitrofuran-2-yl)prop-2-enamide
-
-> <STRUCTURE_SMILES>
-O=C(N)\C(C2=CC=CO2)=C/C1=CC=C([N+]([O-])=O)O1
-
-> <STRUCTURE_Parent_SMILES>
-O=C(N)\C(C2=CC=CO2)=C/C1=CC=C([N+]([O-])=O)O1
-
-> <STRUCTURE_InChI>
-InChI=1/C11H8N2O5/c12-11(14)8(9-2-1-5-17-9)6-7-3-4-10(18-7)13(15)16/h1-6H,(H2,12,14)/b8-6-/f/h12H2
-
-> <STRUCTURE_InChIKey>
-LYAHJFZLDZDIOH-SDXKRDFODJ
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse; hamster
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-29.4
-
-> <TD50_Rat_mmol>
-0.118456869612026
-
-> <ActivityScore_CPDBAS_Rat>
-35
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test; greater than ten-fold variation among TD50 values for positive results
-
-> <TargetSites_Rat_Male>
-mammary gland
-
-> <TargetSites_Rat_Female>
-mammary gland
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <TD50_Mouse_mg>
-131
-
-> <TD50_Mouse_mmol>
-0.527818024461747
-
-> <ActivityScore_CPDBAS_Mouse>
-31
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test; greater than ten-fold variation among TD50 values for positive results
-
-> <TargetSites_Mouse_Male>
-stomach
-
-> <TargetSites_Mouse_Female>
-stomach
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <TD50_Hamster_mg>
-164
-
-> <TD50_Hamster_mmol>
-0.660779816883408
-
-> <ActivityScore_CPDBAS_Hamster>
-30
-
-> <TD50_Hamster_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Hamster_Male>
-esophagus; stomach
-
-> <TargetSites_Hamster_Female>
-stomach
-
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active; multispecies active
-
-> <Note_CPDBAS>
-structure modified v5b
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/AF-2.html
-
-$$$$
-
-
-
- 25 29 0 0 1 0 0 0 0 0 1 V2000
- 5.7454 -4.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.5929 -3.9863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.5929 -2.6604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4403 -1.9931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.2878 -2.6604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.2878 -3.9863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4403 -4.6535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1352 -4.6535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.2999 -1.7678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.0451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.8458 -0.5546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.1630 -0.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7454 -1.9931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.8980 -2.6604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.8980 -3.9863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.8859 -4.8788 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3399 -6.0921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.0227 -5.9534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.4768 -7.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.4647 -8.0592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.6172 -7.3919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6969 -5.8148 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 8.6658 -6.2307 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7454 -0.6673 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.8980 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 15 2 0 0 0 0
- 1 18 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 13 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 12 1 0 0 0 0
- 5 6 1 0 0 0 0
- 5 9 1 0 0 0 0
- 6 7 1 0 0 0 0
- 6 8 2 0 0 0 0
- 9 10 1 6 0 0 0
- 9 11 1 0 0 0 0
- 11 12 1 0 0 0 0
- 13 14 2 0 0 0 0
- 13 24 1 0 0 0 0
- 14 15 1 0 0 0 0
- 15 16 1 0 0 0 0
- 16 17 1 0 0 0 0
- 17 18 1 0 0 0 0
- 17 21 1 0 0 0 0
- 17 23 1 1 0 0 0
- 18 19 1 0 0 0 0
- 18 22 1 6 0 0 0
- 19 20 2 0 0 0 0
- 20 21 1 0 0 0 0
- 24 25 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20034
-
-> <DSSTox_CID>
-34
-
-> <DSSTox_Generic_SID>
-20034
-
-> <DSSTox_FileID>
-35_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C17H14O6
-
-> <STRUCTURE_MolecularWeight>
-314.294
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Aflatoxicol
-
-> <TestSubstance_CASRN>
-29611-03-8
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-stereochem
-
-> <STRUCTURE_ChemicalName_IUPAC>
-(1R,6aS,9aS)-1-hydroxy-4-(methyloxy)-2,3,6a,9a-tetrahydrocyclopenta[c]furo[3',2':4,5]furo[2,3-h]chromen-11(1H)-one
-
-> <STRUCTURE_SMILES>
-O=C(O2)C([C@@H](CC3)O)=C3C1=C2C4=C(O[C@@]5([H])[C@]([H])4C=CO5)C=C1OC
-
-> <STRUCTURE_Parent_SMILES>
-O=C(O2)C([C@@H](CC3)O)=C3C1=C2C4=C(O[C@@]5([H])[C@]([H])4C=CO5)C=C1OC
-
-> <STRUCTURE_InChI>
-InChI=1/C17H14O6/c1-20-10-6-11-14(8-4-5-21-17(8)22-11)15-13(10)7-2-3-9(18)12(7)16(19)23-15/h4-6,8-9,17-18H,2-3H2,1H3/t8-,9+,17-/m0/s1
-
-> <STRUCTURE_InChIKey>
-WYIWLDSPNDMZIT-BTKFHORUBM
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-0.00247
-
-> <TD50_Rat_mmol>
-7.85888372033828E-06
-
-> <ActivityScore_CPDBAS_Rat>
-78
-
-> <TargetSites_Rat_Male>
-liver
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/AFLATOXICOL.html
-
-$$$$
-
-
-
- 23 27 0 0 0 0 0 0 0 0 1 V2000
- 5.4986 -3.3221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.3531 -3.9918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.1987 -3.3221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0444 -3.9918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0444 -5.3224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.1987 -5.9833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.3531 -5.3224 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.1987 -7.3139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.7843 -5.7277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.3701 -6.9966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -4.6527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.7843 -3.5776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.1987 -1.9915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.3531 -1.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.4986 -1.9915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.7675 -1.5861 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 7.5430 -2.6612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.7675 -3.7362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.5430 -4.8113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.8119 -4.3971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.8119 -3.0665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0444 -1.3306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0444 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 1 15 1 0 0 0 0
- 1 18 1 0 0 0 0
- 2 3 1 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 13 2 0 0 0 0
- 4 5 2 0 0 0 0
- 4 12 1 0 0 0 0
- 5 6 1 0 0 0 0
- 5 9 1 0 0 0 0
- 6 7 1 0 0 0 0
- 6 8 2 0 0 0 0
- 9 10 2 0 0 0 0
- 9 11 1 0 0 0 0
- 11 12 1 0 0 0 0
- 13 14 1 0 0 0 0
- 13 22 1 0 0 0 0
- 14 15 2 0 0 0 0
- 15 16 1 0 0 0 0
- 16 17 1 0 0 0 0
- 17 18 1 0 0 0 0
- 17 21 1 0 0 0 0
- 18 19 1 0 0 0 0
- 19 20 2 0 0 0 0
- 20 21 1 0 0 0 0
- 22 23 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20035
-
-> <DSSTox_CID>
-35
-
-> <DSSTox_Generic_SID>
-20035
-
-> <DSSTox_FileID>
-36_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C17H12O6
-
-> <STRUCTURE_MolecularWeight>
-312.2736
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Aflatoxin B1
-
-> <TestSubstance_CASRN>
-1162-65-8
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-4-(methyloxy)-2,3,6a,9a-tetrahydrocyclopenta[c]furo[3',2':4,5]furo[2,3-h]chromene-1,11-dione
-
-> <STRUCTURE_SMILES>
-C12=C3C(C4=C(C(O3)=O)C(=O)CC4)=C(C=C1OC5C2C=CO5)OC
-
-> <STRUCTURE_Parent_SMILES>
-C12=C3C(C4=C(C(O3)=O)C(=O)CC4)=C(C=C1OC5C2C=CO5)OC
-
-> <STRUCTURE_InChI>
-InChI=1/C17H12O6/c1-20-10-6-11-14(8-4-5-21-17(8)22-11)15-13(10)7-2-3-9(18)12(7)16(19)23-15/h4-6,8,17H,2-3H2,1H3
-
-> <STRUCTURE_InChIKey>
-OQIQSTLJSLGHID-UHFFFAOYAB
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse; rhesus; cynomolgus; tree shrew
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-0.0032
-
-> <TD50_Rat_mmol>
-1.02474240537785E-05
-
-> <ActivityScore_CPDBAS_Rat>
-77
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test; harmonic mean of TD50 includes a value for upper 99% confidence limit from study with 100% tumor incidence but no lifetable; greater than ten-fold variation among TD50 values for positive results
-
-> <TargetSites_Rat_Male>
-kidney; large intestine; liver
-
-> <TargetSites_Rat_Female>
-large intestine; liver
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <TD50_Rhesus_mg>
-0.0082
-
-> <TargetSites_Rhesus>
-gall bladder; liver; vascular system
-
-> <TD50_Cynomolgus_mg>
-0.0201
-
-> <TargetSites_Cynomolgus>
-gall bladder; liver; vascular system
-
-> <TD50_Dog_Primates_Note>
-Tree Shrew (TD50=0.0269; Target Sites=liver)
-
-> <ActivityOutcome_CPDBAS_Dog_Primates>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active; multispecies active
-
-> <Note_CPDBAS>
-TD50_Rat_Note modified v5a
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/AFLATOXIN%20B1.html
-
-$$$$
-
-
-
- 24 28 0 0 0 0 0 0 0 0 1 V2000
- 6.7674 -1.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.7674 -3.3293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.6244 -1.3335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.4723 -3.3202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.6244 -3.9915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.4723 -2.0048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3202 -3.9824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3202 -5.3251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0593 -5.7333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.2791 -4.6537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.6244 -5.3251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9195 -1.3335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0593 -3.5742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.4814 -5.9873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0181 -4.2546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.6244 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 9.0716 -2.0048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.9392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.2610 -2.5038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9195 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9195 -3.9915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.7947 -6.0054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 9.0716 -3.3202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9558 -5.3432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 1 3 1 0 0 0 0
- 1 12 1 0 0 0 0
- 2 5 1 0 0 0 0
- 2 21 1 0 0 0 0
- 3 6 1 0 0 0 0
- 3 16 2 0 0 0 0
- 4 6 1 0 0 0 0
- 4 7 1 0 0 0 0
- 4 5 2 0 0 0 0
- 5 11 1 0 0 0 0
- 7 8 2 0 0 0 0
- 7 13 1 0 0 0 0
- 8 9 1 0 0 0 0
- 8 14 1 0 0 0 0
- 9 10 1 0 0 0 0
- 10 13 1 0 0 0 0
- 10 15 1 0 0 0 0
- 11 14 2 0 0 0 0
- 11 22 1 0 0 0 0
- 12 17 1 0 0 0 0
- 12 20 2 0 0 0 0
- 13 19 1 0 0 0 0
- 15 18 1 0 0 0 0
- 17 23 1 0 0 0 0
- 18 19 2 0 0 0 0
- 21 23 1 0 0 0 0
- 22 24 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20036
-
-> <DSSTox_CID>
-36
-
-> <DSSTox_Generic_SID>
-20036
-
-> <DSSTox_FileID>
-37_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C17H12O7
-
-> <STRUCTURE_MolecularWeight>
-328.273
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-representative component in mixture
-
-> <TestSubstance_ChemicalName>
-Aflatoxin, crude
-
-> <TestSubstance_CASRN>
-1402-68-2
-
-> <TestSubstance_Description>
-mixture or formulation
-
-> <ChemicalNote>
-mixture of aflatoxins, structure shown G1 [1165-39-5]
-
-> <STRUCTURE_ChemicalName_IUPAC>
-5-(methyloxy)-3,4,7a,10a-tetrahydro-1H,12H-furo[3',2':4,5]furo[2,3-h]pyrano[3,4-c]chromene-1,12-dione
-
-> <STRUCTURE_SMILES>
-O=C1C(C(OCC5)=O)=C5C(C(OC)=C4)=C(C2=C4OC3C2C=CO3)O1
-
-> <STRUCTURE_Parent_SMILES>
-O=C1C(C(OCC5)=O)=C5C(C(OC)=C4)=C(C2=C4OC3C2C=CO3)O1
-
-> <STRUCTURE_InChI>
-InChI=1/C17H12O7/c1-20-9-6-10-12(8-3-5-22-17(8)23-10)14-11(9)7-2-4-21-15(18)13(7)16(19)24-14/h3,5-6,8,17H,2,4H2,1H3
-
-> <STRUCTURE_InChIKey>
-XWIYFDMXXLINPU-UHFFFAOYAD
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <TD50_Rat_mg>
-0.00299
-
-> <ActivityScore_CPDBAS_Rat>
-50
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test; TD50_Rat_mmol was not calculated for this mixture, but Activiity Score is assigned value of "50" to indicate active
-
-> <TargetSites_Rat_Male>
-liver
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <TD50_Mouse_mg>
-0.343
-
-> <ActivityScore_CPDBAS_Mouse>
-50
-
-> <TargetSites_Mouse_Male>
-hematopoietic system
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multispecies active
-
-> <Note_CPDBAS>
-TD50_Rat_mmol and TD50_Mouse_mmol conversions from mg values not provided due substance being a mixture
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/AFLATOXIN,%20CRUDE.html
-
-$$$$
-
-
-
- 0 0 0 0 0 0 0 0 0 0 1 V2000
-M END
-> <DSSTox_RID>
-20037
-
-> <DSSTox_Generic_SID>
-20037
-
-> <DSSTox_FileID>
-38_CPDBAS_v5c
-
-> <STRUCTURE_ChemicalType>
-no structure
-
-> <STRUCTURE_Shown>
-no structure
-
-> <TestSubstance_ChemicalName>
-Agar
-
-> <TestSubstance_CASRN>
-9002-18-0
-
-> <TestSubstance_Description>
-mixture or formulation
-
-> <STRUCTURE_InChI>
-InChI=1//
-
-> <STRUCTURE_InChIKey>
-MOSFIJXAXDLOML-UHFFFAOYAM
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive; multispecies inactive
-
-> <NTP_TechnicalReport>
-TR 230
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/AGAR.html
-
-$$$$
-
-
-
- 15 15 0 0 0 0 0 0 0 0 1 V2000
- 5.7597 -2.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1706 -2.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7597 -0.7148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6306 -2.7038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4807 -2.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.7038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3101 -2.7038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6306 -0.0414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2094 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3592 -0.6526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9096 -2.7245 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4807 -0.7148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1706 -0.7148 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9096 -0.0104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0802 -0.6837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 3 1 0 0 0 0
- 1 4 2 0 0 0 0
- 1 11 1 0 0 0 0
- 2 7 1 0 0 0 0
- 2 6 2 0 0 0 0
- 2 13 1 0 0 0 0
- 3 8 2 0 0 0 0
- 3 14 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 7 1 0 0 0 0
- 5 12 2 0 0 0 0
- 8 12 1 0 0 0 0
- 9 15 1 0 0 0 0
- 9 10 2 0 0 0 0
- 14 15 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20038
-
-> <DSSTox_CID>
-38
-
-> <DSSTox_Generic_SID>
-20038
-
-> <DSSTox_FileID>
-39_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C11H11ClO3
-
-> <STRUCTURE_MolecularWeight>
-226.6562
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Alclofenac
-
-> <TestSubstance_CASRN>
-22131-79-9
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-[3-chloro-4-(prop-2-en-1-yloxy)phenyl]acetic acid
-
-> <STRUCTURE_SMILES>
-C1(OCC=C)=CC=C(CC(=O)O)C=C1Cl
-
-> <STRUCTURE_Parent_SMILES>
-C1(OCC=C)=CC=C(CC(=O)O)C=C1Cl
-
-> <STRUCTURE_InChI>
-InChI=1/C11H11ClO3/c1-2-5-15-10-4-3-8(6-9(10)12)7-11(13)14/h2-4,6H,1,5,7H2,(H,13,14)/f/h13H
-
-> <STRUCTURE_InChIKey>
-ARHWPKZXBHOEEE-NDKGDYFDCL
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive
-
-> <Note_CPDBAS>
-Rat added v2a
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ALCLOFENAC.html
-
-$$$$
-
-
-
- 12 11 0 0 0 0 0 0 0 0 1 V2000
- 0.8456 -0.6672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9938 -1.3343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.1497 -1.9938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.2978 -1.3343 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.4537 -1.9938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.6019 -1.3343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.6019 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 7.7578 -1.9938 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 7.7578 -3.3281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3343 -2.4825 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6609 -0.1784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 1 0 0 0 0
- 2 10 1 0 0 0 0
- 2 12 1 0 0 0 0
- 3 4 2 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 6 8 1 0 0 0 0
- 8 9 1 0 0 0 0
- 10 11 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20039
-
-> <DSSTox_CID>
-39
-
-> <DSSTox_Generic_SID>
-39223
-
-> <DSSTox_FileID>
-40_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C7H14N2O2S
-
-> <STRUCTURE_MolecularWeight>
-190.2633
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Aldicarb
-
-> <TestSubstance_CASRN>
-116-06-3
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-(1E)-2-methyl-2-(methylthio)propanal O-[(methylamino)carbonyl]oxime
-
-> <STRUCTURE_SMILES>
-CC(C=NOC(=O)NC)(SC)C
-
-> <STRUCTURE_Parent_SMILES>
-CC(C=NOC(=O)NC)(SC)C
-
-> <STRUCTURE_InChI>
-InChI=1/C7H14N2O2S/c1-7(2,12-4)5-9-11-6(10)8-3/h5H,1-4H3,(H,8,10)/b9-5+/f/h8H
-
-> <STRUCTURE_InChIKey>
-QGLZXHRNAYXIBU-RVKZGWQMDN
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive; multispecies inactive
-
-> <NTP_TechnicalReport>
-TR 136
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ALDICARB.html
-
-$$$$
-
-
-
- 18 21 0 0 0 0 0 0 0 0 1 V2000
- 4.3850 -2.1587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.2104 -2.1095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.1821 -0.9164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.1845 -3.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3567 -1.7958 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 2.5400 -3.2473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9188 -2.6568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.8869 -3.2473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3887 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 5.0615 -0.3260 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6126 -4.2128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.1501 -2.7798 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3653 -3.6962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.6052 -4.8340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.7073 -2.0726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.2657 -4.4404 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 4.5449 -5.2337 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 3 1 0 0 0 0
- 1 4 1 0 0 0 0
- 1 5 1 0 0 0 0
- 2 6 1 0 0 0 0
- 2 7 1 0 0 0 0
- 3 8 1 0 0 0 0
- 3 9 1 0 0 0 0
- 3 10 1 0 0 0 0
- 4 11 2 0 0 0 0
- 4 12 1 0 0 0 0
- 6 13 1 0 0 0 0
- 6 8 1 0 0 0 0
- 7 14 1 0 0 0 0
- 7 15 1 0 0 0 0
- 8 16 1 0 0 0 0
- 8 11 1 0 0 0 0
- 11 17 1 0 0 0 0
- 13 18 1 0 0 0 0
- 13 14 1 0 0 0 0
- 15 18 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20040
-
-> <DSSTox_CID>
-40
-
-> <DSSTox_Generic_SID>
-20040
-
-> <DSSTox_FileID>
-41_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C12H8Cl6
-
-> <STRUCTURE_MolecularWeight>
-364.9099
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Aldrin
-
-> <TestSubstance_CASRN>
-309-00-2
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-stereochem
-
-> <STRUCTURE_ChemicalName_IUPAC>
-1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-1,4:5,8-dimethanonaphthalene
-
-> <STRUCTURE_SMILES>
-ClC(C(Cl)(Cl)C43Cl)(C(Cl)=C4Cl)C1C3C2C=CC1C2
-
-> <STRUCTURE_Parent_SMILES>
-ClC(C(Cl)(Cl)C43Cl)(C(Cl)=C4Cl)C1C3C2C=CC1C2
-
-> <STRUCTURE_InChI>
-InChI=1/C12H8Cl6/c13-8-9(14)11(16)7-5-2-1-4(3-5)6(7)10(8,15)12(11,17)18/h1-2,4-7H,3H2
-
-> <STRUCTURE_InChIKey>
-QBYJBZPUGVGKQQ-UHFFFAOYAT
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <TD50_Mouse_mg>
-1.27
-
-> <TD50_Mouse_mmol>
-3.48031116722237E-03
-
-> <ActivityScore_CPDBAS_Mouse>
-56
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Mouse_Male>
-liver
-
-> <TargetSites_Mouse_BothSexes>
-liver
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <NTP_TechnicalReport>
-TR 21; final call in CPDB differs due to additional data
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ALDRIN.html
-
-$$$$
-
-
-
- 23 22 0 0 0 0 0 0 0 0 2 V2000
- 13.2448 -7.3111 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0
- 12.6753 -2.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.6753 -3.9867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 11.5230 -1.9867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 11.5230 -4.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3707 -2.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3707 -3.9867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 11.5230 -5.9867 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 12.8475 -5.9867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 10.1853 -5.9867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 11.5230 -7.3111 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 6.9138 -0.6622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7615 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.6622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1523 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3046 -0.6622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4569 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6092 -0.6622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0661 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2184 -0.6622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3707 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 11.5230 -0.6622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.6753 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2 3 1 0 0 0 0
- 2 4 2 0 0 0 0
- 3 5 2 0 0 0 0
- 4 6 1 0 0 0 0
- 4 22 1 0 0 0 0
- 5 7 1 0 0 0 0
- 5 8 1 0 0 0 0
- 6 7 2 0 0 0 0
- 8 9 2 0 0 0 0
- 8 10 2 0 0 0 0
- 8 11 1 0 0 0 0
- 12 13 1 0 0 0 0
- 12 19 1 0 0 0 0
- 13 18 1 0 0 0 0
- 14 15 1 0 0 0 0
- 15 16 1 0 0 0 0
- 16 17 1 0 0 0 0
- 17 18 1 0 0 0 0
- 19 20 1 0 0 0 0
- 20 21 1 0 0 0 0
- 21 22 1 0 0 0 0
- 22 23 1 0 0 0 0
-M CHG 2 1 1 11 -1
-M END
-> <DSSTox_RID>
-20041
-
-> <DSSTox_CID>
-41
-
-> <DSSTox_Generic_SID>
-20041
-
-> <DSSTox_FileID>
-42_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C18H29NaO3S
-
-> <STRUCTURE_MolecularWeight>
-348.4758
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-salt Na
-
-> <STRUCTURE_Shown>
-representative isomer in mixture
-
-> <TestSubstance_ChemicalName>
-Alkylbenzenesulfonate, linear
-
-> <TestSubstance_CASRN>
-42615-29-2
-
-> <TestSubstance_Description>
-mixture or formulation
-
-> <ChemicalNote>
-mixture of C10-13 alkylbenzenesulfonates average 11.6; with phenyl attachment varying in apprpx equal amounts between C-2,3,4,5 or 6; structure shown C12 attached at C2
-
-> <STRUCTURE_ChemicalName_IUPAC>
-sodium 4-(dodecan-2-yl)benzenesulfonate
-
-> <STRUCTURE_SMILES>
-O=S(C1=CC=C(C(C)CCCCCCCCCC)C=C1)([O-])=O.[Na+]
-
-> <STRUCTURE_Parent_SMILES>
-O=S(C1=CC=C(C(C)CCCCCCCCCC)C=C1)(O)=O
-
-> <STRUCTURE_InChI>
-InChI=1/C18H30O3S.Na/c1-3-4-5-6-7-8-9-10-11-16(2)17-12-14-18(15-13-17)22(19,20)21;/h12-16H,3-11H2,1-2H3,(H,19,20,21);/q;+1/p-1/fC18H29O3S.Na/q-1;m
-
-> <STRUCTURE_InChIKey>
-GHRHULTYHYEOQB-MFZBKVKLCJ
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive
-
-> <Note_CPDBAS>
-structure modified v5b
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ALKYLBENZENESULFONATE,%20LINEAR.html
-
-$$$$
-
-
-
- 14 13 0 0 0 0 0 0 0 0 2 V2000
- 0.0000 -1.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1547 -0.4949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3093 -1.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4640 -0.4949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6186 -1.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7733 -0.4949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9152 -1.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0699 -0.4949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2245 -1.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3792 -0.4949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 11.5338 -1.1547 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 12.2063 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.8740 -2.3093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.6885 -1.8271 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 1 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 1 0 0 0 0
- 11 13 1 0 0 0 0
- 11 14 1 0 0 0 0
-M CHG 2 11 1 14 -1
-M END
-> <DSSTox_RID>
-20042
-
-> <DSSTox_CID>
-42
-
-> <DSSTox_Generic_SID>
-20042
-
-> <DSSTox_FileID>
-43_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C12H27NO
-
-> <STRUCTURE_MolecularWeight>
-201.3489
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-representative isomer in mixture
-
-> <TestSubstance_ChemicalName>
-Alkyldimethylamine oxides, commercial grade
-
-> <TestSubstance_CASRN>
-NOCAS
-
-> <TestSubstance_Description>
-mixture or formulation
-
-> <ChemicalNote>
-mixture, C10-16 [70592-80-2], C12-18 [68955-55-5], C12-16 [68439-70-3], C14-18 [68390-99-8], structure shown C-12
-
-> <STRUCTURE_ChemicalName_IUPAC>
-decyl(dimethyl)amine oxide
-
-> <STRUCTURE_SMILES>
-[O-][N+](C)(C)CCCCCCCCCC
-
-> <STRUCTURE_Parent_SMILES>
-[O-][N+](C)(C)CCCCCCCCCC
-
-> <STRUCTURE_InChI>
-InChI=1/C12H27NO/c1-4-5-6-7-8-9-10-11-12-13(2,3)14/h4-12H2,1-3H3
-
-> <STRUCTURE_InChIKey>
-ZRKZFNZPJKEWPC-UHFFFAOYAU
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ALKYLDIMETHYLAMINE%20OXIDES,%20COMMERCIAL%20GRADE.html
-
-$$$$
-
-
-
- 11 11 0 0 0 0 0 0 0 0 1 V2000
- 4.2744 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.2901 -0.8879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4278 -2.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.2095 -2.7532 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3216 -1.7621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.9066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9892 -0.6126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 4.5773 -2.8771 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7336 -2.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7336 -0.8810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.8831 -2.8771 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 2 0 0 0 0
- 5 7 1 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 9 11 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20043
-
-> <DSSTox_CID>
-43
-
-> <DSSTox_Generic_SID>
-20043
-
-> <DSSTox_FileID>
-44_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C4H6N4O3
-
-> <STRUCTURE_MolecularWeight>
-158.1164
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Allantoin
-
-> <TestSubstance_CASRN>
-97-59-6
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-1-(2,5-dioxoimidazolidin-4-yl)urea
-
-> <STRUCTURE_SMILES>
-O=C1C(NC(=O)N1)NC(=O)N
-
-> <STRUCTURE_Parent_SMILES>
-O=C1C(NC(=O)N1)NC(=O)N
-
-> <STRUCTURE_InChI>
-InChI=1/C4H6N4O3/c5-3(10)6-1-2(9)8-4(11)7-1/h1H,(H3,5,6,10)(H2,7,8,9,11)/f/h6-8H,5H2
-
-> <STRUCTURE_InChIKey>
-POJWUDADGALRAB-BANUENCFCI
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ALLANTOIN.html
-
-$$$$
-
-
-
- 4 3 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1513 -0.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3061 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4575 -0.6638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20044
-
-> <DSSTox_CID>
-44
-
-> <DSSTox_Generic_SID>
-20044
-
-> <DSSTox_FileID>
-45_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C3H6O
-
-> <STRUCTURE_MolecularWeight>
-58.0791
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Allyl alcohol
-
-> <TestSubstance_CASRN>
-107-18-6
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-prop-2-en-1-ol
-
-> <STRUCTURE_SMILES>
-C=CCO
-
-> <STRUCTURE_Parent_SMILES>
-C=CCO
-
-> <STRUCTURE_InChI>
-InChI=1/C3H6O/c1-2-3-4/h2,4H,1,3H2
-
-> <STRUCTURE_InChIKey>
-XXROGKLTLUQVRX-UHFFFAOYAC
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive
-
-> <Note_CPDBAS>
-Mutagenicity_SAL_CPDB added v3a
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ALLYL%20ALCOHOL.html
-
-$$$$
-
-
-
- 4 3 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1513 -0.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3061 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4575 -0.6638 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20045
-
-> <DSSTox_CID>
-45
-
-> <DSSTox_Generic_SID>
-39231
-
-> <DSSTox_FileID>
-46_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C3H5Cl
-
-> <STRUCTURE_MolecularWeight>
-76.5248
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Allyl chloride
-
-> <TestSubstance_CASRN>
-107-05-1
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-3-chloroprop-1-ene
-
-> <STRUCTURE_SMILES>
-C=CCCl
-
-> <STRUCTURE_Parent_SMILES>
-C=CCCl
-
-> <STRUCTURE_InChI>
-InChI=1/C3H5Cl/c1-2-3-4/h2H,1,3H2
-
-> <STRUCTURE_InChIKey>
-OSDWBNJEKMUWAV-UHFFFAOYAQ
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-NTP bioassay inadequate
-
-> <TargetSites_Rat_Male>
-NTP bioassay inadequate
-
-> <TargetSites_Rat_Female>
-NTP bioassay inadequate
-
-> <ActivityOutcome_CPDBAS_Rat>
-inconclusive
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive
-
-> <NTP_TechnicalReport>
-TR 73
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ALLYL%20CHLORIDE.html
-
-$$$$
-
-
-
- 8 8 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -1.8149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1485 -1.1485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3041 -1.8149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4526 -1.1485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6082 -1.8149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7567 -1.1485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.4231 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.0895 -1.1485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 1 0 0 0 0
- 6 8 1 0 0 0 0
- 7 8 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20046
-
-> <DSSTox_CID>
-46
-
-> <DSSTox_Generic_SID>
-39232
-
-> <DSSTox_FileID>
-47_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C6H10O2
-
-> <STRUCTURE_MolecularWeight>
-114.1424
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Allyl glycidyl ether
-
-> <TestSubstance_CASRN>
-106-92-3
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-2-[(allyloxy)methyl]oxirane
-
-> <STRUCTURE_SMILES>
-C=CCOCC1CO1
-
-> <STRUCTURE_Parent_SMILES>
-C=CCOCC1CO1
-
-> <STRUCTURE_InChI>
-InChI=1/C6H10O2/c1-2-3-7-4-6-5-8-6/h2,6H,1,3-5H2
-
-> <STRUCTURE_InChIKey>
-LSWYGACWGAICNM-UHFFFAOYAR
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <TD50_Mouse_mg>
-182
-
-> <TD50_Mouse_mmol>
-1.59449950237598
-
-> <ActivityScore_CPDBAS_Mouse>
-26
-
-> <TargetSites_Mouse_Male>
-nasal cavity
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <NTP_TechnicalReport>
-TR 376
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ALLYL%20GLYCIDYL%20ETHER.html
-
-$$$$
-
-
-
- 6 5 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -0.6684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1525 -1.3311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3050 -0.6684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4575 -1.3311 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6099 -0.6684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7624 0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 5 6 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20047
-
-> <DSSTox_CID>
-47
-
-> <DSSTox_Generic_SID>
-20047
-
-> <DSSTox_FileID>
-48_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C4H5NS
-
-> <STRUCTURE_MolecularWeight>
-99.1542
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Allyl isothiocyanate
-
-> <TestSubstance_CASRN>
-57-06-7
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-3-isothiocyanatoprop-1-ene
-
-> <STRUCTURE_SMILES>
-C=CCN=C=S
-
-> <STRUCTURE_Parent_SMILES>
-C=CCN=C=S
-
-> <STRUCTURE_InChI>
-InChI=1/C4H5NS/c1-2-3-5-4-6/h2H,1,3H2
-
-> <STRUCTURE_InChIKey>
-ZOJBYZNEUISWFT-UHFFFAOYAS
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-96
-
-> <TD50_Rat_mmol>
-0.968188942072045
-
-> <ActivityScore_CPDBAS_Rat>
-26
-
-> <TargetSites_Rat_Male>
-urinary bladder
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <NTP_TechnicalReport>
-TR 234
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ALLYL%20ISOTHIOCYANATE.html
-
-$$$$
-
-
-
- 10 9 0 0 0 0 0 0 0 0 1 V2000
- 4.6087 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6087 -1.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7629 -1.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9171 -1.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9171 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0713 -1.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4626 -1.9936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3084 -1.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1542 -1.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 6 1 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20048
-
-> <DSSTox_CID>
-48
-
-> <DSSTox_Generic_SID>
-39233
-
-> <DSSTox_FileID>
-49_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C8H14O2
-
-> <STRUCTURE_MolecularWeight>
-142.1956
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Allyl isovalerate
-
-> <TestSubstance_CASRN>
-2835-39-4
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-allyl 3-methylbutanoate
-
-> <STRUCTURE_SMILES>
-O=C(CC(C)C)OCC=C
-
-> <STRUCTURE_Parent_SMILES>
-O=C(CC(C)C)OCC=C
-
-> <STRUCTURE_InChI>
-InChI=1/C8H14O2/c1-4-5-10-8(9)6-7(2)3/h4,7H,1,5-6H2,2-3H3
-
-> <STRUCTURE_InChIKey>
-HOMAGVUCNZNWBC-UHFFFAOYAF
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <TD50_Rat_mg>
-123
-
-> <TD50_Rat_mmol>
-0.865005668248525
-
-> <ActivityScore_CPDBAS_Rat>
-26
-
-> <TargetSites_Rat_Male>
-hematopoietic system
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <TD50_Mouse_mg>
-62.8
-
-> <TD50_Mouse_mmol>
-0.441645170455345
-
-> <ActivityScore_CPDBAS_Mouse>
-32
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-hematopoietic system
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex active; multispecies active
-
-> <NTP_TechnicalReport>
-TR 253
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ALLYL%20ISOVALERATE.html
-
-$$$$
-
-
-
- 9 8 0 0 0 0 0 0 0 0 1 V2000
- 4.6080 -1.9953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4560 -2.6588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3040 -1.9953 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3040 -0.6635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4560 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1520 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1520 -2.6588 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.9953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6080 -0.6635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 9 2 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 7 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 6 2 0 0 0 0
- 7 8 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20049
-
-> <DSSTox_CID>
-49
-
-> <DSSTox_Generic_SID>
-20049
-
-> <DSSTox_FileID>
-50_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C4H7N3O2
-
-> <STRUCTURE_MolecularWeight>
-129.1182
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-1-Allyl-1-nitrosourea
-
-> <TestSubstance_CASRN>
-760-56-5
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-1-nitroso-1-prop-2-en-1-ylurea
-
-> <STRUCTURE_SMILES>
-NC(=O)N(CC=C)N=O
-
-> <STRUCTURE_Parent_SMILES>
-NC(=O)N(CC=C)N=O
-
-> <STRUCTURE_InChI>
-InChI=1/C4H7N3O2/c1-2-3-7(6-9)4(5)8/h2H,1,3H2,(H2,5,8)/f/h5H2
-
-> <STRUCTURE_InChIKey>
-WBBDVRPSJSJSPC-GLFQYTTQCA
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <TD50_Rat_mg>
-0.341
-
-> <TD50_Rat_mmol>
-2.64099096796579E-03
-
-> <ActivityScore_CPDBAS_Rat>
-52
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Rat_Male>
-large intestine; lung; stomach
-
-> <TargetSites_Rat_Female>
-mammary gland; stomach; uterus
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/1-ALLYL-1-NITROSOUREA.html
-
-$$$$
-
-
-
- 7 5 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -0.6636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1521 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3042 -0.6636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4563 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6084 -0.6636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.5945 -1.9954 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 2.9263 -1.9954 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 6 7 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20050
-
-> <DSSTox_CID>
-50
-
-> <DSSTox_Generic_SID>
-20050
-
-> <DSSTox_FileID>
-51_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C3H9ClN2
-
-> <STRUCTURE_MolecularWeight>
-108.5705
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-complex HCl
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Allylhydrazine.HCl
-
-> <TestSubstance_CASRN>
-52207-83-7
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-parent [7422-78-8]
-
-> <STRUCTURE_ChemicalName_IUPAC>
-prop-2-en-1-ylhydrazine hydrochloride
-
-> <STRUCTURE_SMILES>
-C=CCNN.HCl
-
-> <STRUCTURE_Parent_SMILES>
-C=CCNN
-
-> <STRUCTURE_InChI>
-InChI=1/C3H8N2.ClH/c1-2-3-5-4;/h2,5H,1,3-4H2;1H
-
-> <STRUCTURE_InChIKey>
-PWGPATVPEGLIAN-UHFFFAOYAO
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-mouse
-
-> <TD50_Mouse_mg>
-34.2
-
-> <TD50_Mouse_mmol>
-0.315002694101989
-
-> <ActivityScore_CPDBAS_Mouse>
-34
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Mouse_Male>
-lung
-
-> <TargetSites_Mouse_Female>
-lung; vascular system
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ALLYLHYDRAZINE.HCl.html
-
-$$$$
-
-
-
- 12 8 0 0 0 0 0 0 0 0 2 V2000
- 5.3200 -2.6600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3200 -1.3300 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3200 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9900 -1.3300 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 6.6500 -1.3300 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 1.3300 -2.6600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3300 -1.3300 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3300 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.3300 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 2.6600 -1.3300 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 3.3250 -3.9900 0.0000 Al 0 1 0 0 0 0 0 0 0 0 0 0
- 1.9950 -3.9900 0.0000 K 0 3 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 2 0 0 0 0
- 2 4 1 0 0 0 0
- 2 5 1 0 0 0 0
- 6 7 2 0 0 0 0
- 7 8 2 0 0 0 0
- 7 9 1 0 0 0 0
- 7 10 1 0 0 0 0
-M CHG 6 4 -1 5 -1 9 -1 10 -1 11 3 12 1
-M END
-> <DSSTox_RID>
-20051
-
-> <DSSTox_CID>
-51
-
-> <DSSTox_Generic_SID>
-39234
-
-> <DSSTox_FileID>
-52_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-AlKO8S2
-
-> <STRUCTURE_MolecularWeight>
-258.18674
-
-> <STRUCTURE_ChemicalType>
-inorganic
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Aluminum potassium sulfate
-
-> <TestSubstance_CASRN>
-10043-67-1
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-aluminum potassium sulfate
-
-> <STRUCTURE_SMILES>
-O=S(=O)([O-])[O-].O=S(=O)([O-])[O-].[Al+3].[K+]
-
-> <STRUCTURE_InChI>
-InChI=1/Al.K.2H2O4S/c;;2*1-5(2,3)4/h;;2*(H2,1,2,3,4)/q+3;+1;;/p-4/fAl.K.2O4S/q2m;2*-2
-
-> <STRUCTURE_InChIKey>
-GRLPQNLYRHEGIJ-MHPHYJPNCZ
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive; multispecies inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ALUMINUM%20POTASSIUM%20SULFATE.html
-
-$$$$
-
-
-
- 19 21 0 0 0 0 0 0 0 0 1 V2000
- 3.4588 -5.3212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4588 -3.9909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6036 -3.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7566 -3.9909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9095 -3.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9095 -1.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7566 -1.3303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6036 -1.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4588 -1.3303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4588 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3059 -1.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3059 -3.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1529 -3.9909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1529 -1.3303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7566 0.0000 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0624 -3.9909 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7566 -5.3212 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 12 1 0 0 0 0
- 3 4 2 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 19 1 0 0 0 0
- 5 6 2 0 0 0 0
- 5 18 1 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 2 0 0 0 0
- 7 17 1 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 9 11 1 0 0 0 0
- 11 12 2 0 0 0 0
- 11 16 1 0 0 0 0
- 12 13 1 0 0 0 0
- 13 14 2 0 0 0 0
- 14 15 1 0 0 0 0
- 15 16 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20052
-
-> <DSSTox_CID>
-52
-
-> <DSSTox_Generic_SID>
-39235
-
-> <DSSTox_FileID>
-53_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C14H7Br2NO2
-
-> <STRUCTURE_MolecularWeight>
-381.0189
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-1-Amino-2,4-dibromoanthraquinone
-
-> <TestSubstance_CASRN>
-81-49-2
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-1-amino-2,4-dibromo-9,10-anthraquinone
-
-> <STRUCTURE_SMILES>
-O=C1C2=C(C(=CC(=C2C(=O)C3=C1C=CC=C3)Br)Br)N
-
-> <STRUCTURE_Parent_SMILES>
-O=C1C2=C(C(=CC(=C2C(=O)C3=C1C=CC=C3)Br)Br)N
-
-> <STRUCTURE_InChI>
-InChI=1/C14H7Br2NO2/c15-8-5-9(16)12(17)11-10(8)13(18)6-3-1-2-4-7(6)14(11)19/h1-5H,17H2
-
-> <STRUCTURE_InChIKey>
-ZINRVIQBCHAZMM-UHFFFAOYAC
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-46
-
-> <TD50_Rat_mmol>
-0.120728919221592
-
-> <ActivityScore_CPDBAS_Rat>
-35
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Rat_Male>
-kidney; large intestine; liver; urinary bladder
-
-> <TargetSites_Rat_Female>
-kidney; large intestine; liver; urinary bladder
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <TD50_Mouse_mg>
-477
-
-> <TD50_Mouse_mmol>
-1.25190640149347
-
-> <ActivityScore_CPDBAS_Mouse>
-27
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Mouse_Male>
-liver; lung; stomach
-
-> <TargetSites_Mouse_Female>
-liver; lung; stomach
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active; multispecies active
-
-> <NTP_TechnicalReport>
-TR 383
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/1-AMINO-2,4-DIBROMOANTHRAQUINONE.html
-
-$$$$
-
-
-
- 14 14 0 0 0 0 0 0 0 0 1 V2000
- 5.9919 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3210 -1.1555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9919 -2.3110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3210 -3.4572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9977 -3.4572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3268 -2.3110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9977 -1.1555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9942 -2.3110 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3326 -3.4572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9942 -4.6127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.4572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3245 -2.3110 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9861 -3.4572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.3187 -3.4572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 12 1 0 0 0 0
- 4 5 2 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 6 8 1 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 9 11 1 0 0 0 0
- 12 13 1 0 0 0 0
- 13 14 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20053
-
-> <DSSTox_CID>
-53
-
-> <DSSTox_Generic_SID>
-20053
-
-> <DSSTox_FileID>
-54_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C10H14N2O2
-
-> <STRUCTURE_MolecularWeight>
-194.2304
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-3-Amino-4-ethoxyacetanilide
-
-> <TestSubstance_CASRN>
-17026-81-2
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-N-[3-amino-4-(ethyloxy)phenyl]acetamide
-
-> <STRUCTURE_SMILES>
-NC1=C(C=CC(=C1)NC(=O)C)OCC
-
-> <STRUCTURE_Parent_SMILES>
-NC1=C(C=CC(=C1)NC(=O)C)OCC
-
-> <STRUCTURE_InChI>
-InChI=1/C10H14N2O2/c1-3-14-10-5-4-8(6-9(10)11)12-7(2)13/h4-6H,3,11H2,1-2H3,(H,12,13)/f/h12H
-
-> <STRUCTURE_InChIKey>
-XTXFAVHDQCHWCS-XWKXFZRBCV
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <TD50_Mouse_mg>
-2070
-
-> <TD50_Mouse_mmol>
-10.6574460022736
-
-> <ActivityScore_CPDBAS_Mouse>
-17
-
-> <TargetSites_Mouse_Male>
-thyroid gland
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <NTP_TechnicalReport>
-TR 112
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/3-AMINO-4-ETHOXYACETANILIDE.html
-
-$$$$
-
-
-
- 18 19 0 0 0 0 0 0 0 0 1 V2000
- 3.6099 -7.5422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.1990 -6.2771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.0854 -5.2860 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.4149 -5.4310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9548 -4.2143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.2763 -4.0773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0579 -5.1490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.5180 -6.3658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.1965 -6.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.9637 -3.3199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.8114 -3.9887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6591 -3.3199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6591 -1.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.8114 -1.3296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.9637 -1.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.8114 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.8195 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3296 -3.8195 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 11 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 9 2 0 0 0 0
- 5 6 2 0 0 0 0
- 5 10 1 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 2 0 0 0 0
- 8 9 1 0 0 0 0
- 10 11 2 0 0 0 0
- 10 15 1 0 0 0 0
- 11 12 1 0 0 0 0
- 12 13 2 0 0 0 0
- 13 14 1 0 0 0 0
- 14 15 2 0 0 0 0
- 14 16 1 0 0 0 0
- 17 18 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20054
-
-> <DSSTox_CID>
-54
-
-> <DSSTox_Generic_SID>
-20054
-
-> <DSSTox_FileID>
-55_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C14H15ClN2
-
-> <STRUCTURE_MolecularWeight>
-246.7353
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-complex HCl
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-3-Amino-9-ethylcarbazole.HCl
-
-> <TestSubstance_CASRN>
-6109-97-3
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-parent [132-32-1]
-
-> <STRUCTURE_ChemicalName_IUPAC>
-9-ethyl-9H-carbazol-3-amine hydrochloride
-
-> <STRUCTURE_SMILES>
-CCN1(C2C(=CC=CC=2)C3=C1C=CC(=C3)N).[H]Cl
-
-> <STRUCTURE_Parent_SMILES>
-CCN1(C2C(=CC=CC=2)C3=C1C=CC(=C3)N)
-
-> <STRUCTURE_InChI>
-InChI=1/C14H14N2.ClH/c1-2-16-13-6-4-3-5-11(13)12-9-10(15)7-8-14(12)16;/h3-9H,2,15H2,1H3;1H
-
-> <STRUCTURE_InChIKey>
-UUYSTZWIFZYHRM-UHFFFAOYAB
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-57.2
-
-> <TD50_Rat_mmol>
-0.231827387487725
-
-> <ActivityScore_CPDBAS_Rat>
-32
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Rat_Male>
-ear Zymbals gland; liver; skin
-
-> <TargetSites_Rat_Female>
-ear Zymbals gland; liver; uterus
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <TD50_Mouse_mg>
-38.6
-
-> <TD50_Mouse_mmol>
-0.156442957290667
-
-> <ActivityScore_CPDBAS_Mouse>
-37
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Mouse_Male>
-liver
-
-> <TargetSites_Mouse_Female>
-liver
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active; multispecies active
-
-> <NTP_TechnicalReport>
-TR 93
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/3-AMINO-9-ETHYLCARBAZOLE.HCl.html
-
-$$$$
-
-
-
- 16 18 0 0 0 0 0 0 0 0 1 V2000
- 2.8854 -1.7137 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0066 -2.7097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.1011 -2.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6584 -3.8595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9547 -3.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0066 -5.0166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.0312 -4.3575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3168 -1.7137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6738 -2.7097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6738 -5.0166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.2469 -3.8155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.8595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.3934 -2.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3235 -4.5991 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6145 -0.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3475 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 3 1 0 0 0 0
- 1 15 1 0 0 0 0
- 2 4 2 0 0 0 0
- 2 9 1 0 0 0 0
- 3 5 2 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 6 1 0 0 0 0
- 5 7 1 0 0 0 0
- 6 10 2 0 0 0 0
- 7 11 2 0 0 0 0
- 8 13 2 0 0 0 0
- 9 12 2 0 0 0 0
- 10 12 1 0 0 0 0
- 11 13 1 0 0 0 0
- 11 14 1 0 0 0 0
- 15 16 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20055
-
-> <DSSTox_CID>
-55
-
-> <DSSTox_Generic_SID>
-20055
-
-> <DSSTox_FileID>
-56_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C14H15N2
-
-> <STRUCTURE_MolecularWeight>
-210.2744
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-representative component in mixture
-
-> <TestSubstance_ChemicalName>
-3-Amino-9-ethylcarbazole mixture
-
-> <TestSubstance_CASRN>
-NOCAS
-
-> <TestSubstance_Description>
-mixture or formulation
-
-> <ChemicalNote>
-mixture, structure shown 3-Amino-9-ethylcarbazole [132-32-1]
-
-> <STRUCTURE_ChemicalName_IUPAC>
-9-ethyl-9H-carbazol-3-amine
-
-> <STRUCTURE_SMILES>
-CCN1(C2C(=CC=CC=2)C3=C1C=CC(=C3)N)
-
-> <STRUCTURE_Parent_SMILES>
-CCN1(C2C(=CC=CC=2)C3=C1C=CC(=C3)N)
-
-> <STRUCTURE_InChI>
-InChI=1/C14H14N2/c1-2-16-13-6-4-3-5-11(13)12-9-10(15)7-8-14(12)16/h3-9H,2,15H2,1H3
-
-> <STRUCTURE_InChIKey>
-OXEUETBFKVCRNP-UHFFFAOYAV
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-26.4
-
-> <ActivityScore_CPDBAS_Rat>
-50
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test; TD50_Rat_mmol was not calculated for this mixture, but Activiity Score is assigned value of "50" to indicate active
-
-> <TargetSites_Rat_Male>
-ear Zymbals gland; liver; skin
-
-> <TargetSites_Rat_Female>
-ear Zymbals gland
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <TD50_Mouse_mg>
-38
-
-> <ActivityScore_CPDBAS_Mouse>
-50
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Mouse_Male>
-liver
-
-> <TargetSites_Mouse_Female>
-liver
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active; multispecies active
-
-> <Note_CPDBAS>
-TD50_Rat_mmol and TD50_Mouse_mmol conversions from mg values not provided due substance being a mixture
-
-> <NTP_TechnicalReport>
-TR 93
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/3-AMINO-9-ETHYLCARBAZOLE%20MIXTURE.html
-
-$$$$
-
-
-
- 20 21 0 0 0 0 0 0 0 0 1 V2000
- 14.3944 -3.3539 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 13.1277 -2.9365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.8542 -1.6410 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 12.1345 -3.8289 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 10.8822 -3.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.8026 -4.2032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 8.7230 -3.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.4563 -3.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.4775 -2.9365 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 5.2108 -3.3539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.2176 -2.4615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.9509 -2.8789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9720 -1.9864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6621 -2.2599 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.1084 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8925 -0.1152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.1016 -0.6621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.2531 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 9.1405 -2.1592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.4648 -2.1592 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 2 0 0 0 0
- 5 20 1 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 1 0 0 0 0
- 7 19 2 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 1 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 1 0 0 0 0
- 12 13 1 0 0 0 0
- 13 14 2 0 0 0 0
- 13 17 1 0 0 0 0
- 14 15 1 0 0 0 0
- 15 16 1 0 0 0 0
- 16 17 2 0 0 0 0
- 17 18 1 0 0 0 0
- 19 20 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20056
-
-> <DSSTox_CID>
-56
-
-> <DSSTox_Generic_SID>
-39236
-
-> <DSSTox_FileID>
-57_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C9H14N8S3
-
-> <STRUCTURE_MolecularWeight>
-330.4561
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-3-Amino-4-[2-[(2-guanidinothiazol-4-yl)methylthio], ethylamino]-1,2,5-thiadiazole
-
-> <TestSubstance_CASRN>
-78441-84-6
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-BL-6341
-
-> <STRUCTURE_ChemicalName_IUPAC>
-1-{4-[({2-[(4-amino-1,2,5-thiadiazol-3-yl)amino]ethyl}sulfanyl)methyl]-1,3-thiazol-2-yl}guanidine
-
-> <STRUCTURE_SMILES>
-N=C(N)NC1=NC(CSCCNC2=NSN=C2N)=CS1
-
-> <STRUCTURE_Parent_SMILES>
-N=C(N)NC1=NC(CSCCNC2=NSN=C2N)=CS1
-
-> <STRUCTURE_InChI>
-InChI=1/C9H14N8S3/c10-6-7(17-20-16-6)13-1-2-18-3-5-4-19-9(14-5)15-8(11)12/h4H,1-3H2,(H2,10,16)(H,13,17)(H4,11,12,14,15)/f/h11,13,15H,10,12H2
-
-> <STRUCTURE_InChIKey>
-MOMKQYRYLQUFMV-GVMYFUFNCD
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <TD50_Rat_mg>
-4990
-
-> <TD50_Rat_mmol>
-15.1003416187506
-
-> <ActivityScore_CPDBAS_Rat>
-14
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Rat_Male>
-stomach
-
-> <TargetSites_Rat_Female>
-stomach
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex active
-
-> <Note_CPDBAS>
-Rat added v2a; CPDB lists HCl complex in some instances in tables but referenced study for this chemical does not specify HCl complex - parent is assumed correct
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/3-AMINO-4-[2-[(2-GUANIDINOTHIAZOL-4-YL)METHYLTHIO].html
-
-$$$$
-
-
-
- 18 20 0 0 0 0 0 0 0 0 1 V2000
- 4.6526 -4.6047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9902 -3.4555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6526 -2.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9853 -2.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.6477 -1.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9853 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6526 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9902 -1.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6575 -1.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9951 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9951 -2.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6575 -3.4555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9951 -4.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6624 -4.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.4555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6624 -2.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9804 -1.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.6477 -3.4555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 12 1 0 0 0 0
- 3 4 2 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 18 1 0 0 0 0
- 5 6 2 0 0 0 0
- 5 17 1 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 2 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 9 11 1 0 0 0 0
- 11 12 2 0 0 0 0
- 11 16 1 0 0 0 0
- 12 13 1 0 0 0 0
- 13 14 2 0 0 0 0
- 14 15 1 0 0 0 0
- 15 16 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20057
-
-> <DSSTox_CID>
-57
-
-> <DSSTox_Generic_SID>
-20057
-
-> <DSSTox_FileID>
-58_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C15H11NO2
-
-> <STRUCTURE_MolecularWeight>
-237.2533
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-1-Amino-2-methylanthraquinone
-
-> <TestSubstance_CASRN>
-82-28-0
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-C.I. 60700
-
-> <STRUCTURE_ChemicalName_IUPAC>
-1-amino-2-methylanthracene-9,10-dione
-
-> <STRUCTURE_SMILES>
-O=C1C2=C(C(=CC=C2C(=O)C3=C1C=CC=C3)C)N
-
-> <STRUCTURE_Parent_SMILES>
-O=C1C2=C(C(=CC=C2C(=O)C3=C1C=CC=C3)C)N
-
-> <STRUCTURE_InChI>
-InChI=1/C15H11NO2/c1-8-6-7-11-12(13(8)16)15(18)10-5-3-2-4-9(10)14(11)17/h2-7H,16H2,1H3
-
-> <STRUCTURE_InChIKey>
-ZLCUIOWQYBYEBG-UHFFFAOYAP
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-59.2
-
-> <TD50_Rat_mmol>
-0.249522345948402
-
-> <ActivityScore_CPDBAS_Rat>
-32
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Rat_Male>
-kidney; liver
-
-> <TargetSites_Rat_Female>
-liver
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <TD50_Mouse_mg>
-174
-
-> <TD50_Mouse_mmol>
-0.733393381672668
-
-> <ActivityScore_CPDBAS_Mouse>
-30
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-liver
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active; multispecies active
-
-> <NTP_TechnicalReport>
-TR 111
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/1-AMINO-2-METHYLANTHRAQUINONE.html
-
-$$$$
-
-
-
- 14 15 0 0 0 0 0 0 0 0 2 V2000
- 2.3652 -3.2915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1511 -2.7519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.2950 -1.4299 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.5900 -1.1511 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.2555 -2.3022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.5865 -2.4461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.4768 -1.4569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.6908 -1.9965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.5469 -3.3184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.2430 -3.5972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.8419 -1.3310 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 7.8419 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 8.9931 -1.9965 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.4174 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 5 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 14 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 1 0 0 0 0
- 6 10 2 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 2 0 0 0 0
- 8 11 1 0 0 0 0
- 9 10 1 0 0 0 0
- 11 12 2 0 0 0 0
- 11 13 1 0 0 0 0
-M CHG 2 11 1 13 -1
-M END
-> <DSSTox_RID>
-20058
-
-> <DSSTox_CID>
-58
-
-> <DSSTox_Generic_SID>
-20058
-
-> <DSSTox_FileID>
-59_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C6H4N4O4
-
-> <STRUCTURE_MolecularWeight>
-196.122
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-2-Amino-5-(5-nitro-2-furyl)-1,3,4-oxadiazole
-
-> <TestSubstance_CASRN>
-3775-55-1
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-5-(5-nitrofuran-2-yl)-1,3,4-oxadiazol-2-amine
-
-> <STRUCTURE_SMILES>
-O1C(=NN=C1C2OC(=CC=2)[N+](=O)[O-])N
-
-> <STRUCTURE_Parent_SMILES>
-O1C(=NN=C1C2OC(=CC=2)[N+](=O)[O-])N
-
-> <STRUCTURE_InChI>
-InChI=1/C6H4N4O4/c7-6-9-8-5(14-6)3-1-2-4(13-3)10(11)12/h1-2H,(H2,7,9)/f/h7H2
-
-> <STRUCTURE_InChIKey>
-VTWQUFUBSCXPOW-IAUQMDSZCD
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <TD50_Rat_mg>
-3.67
-
-> <TD50_Rat_mmol>
-1.87128420065062E-02
-
-> <ActivityScore_CPDBAS_Rat>
-44
-
-> <TargetSites_Rat_Female>
-kidney; lung; mammary gland; stomach
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/2-AMINO-5-(5-NITRO-2-FURYL)-1,3,4-OXADIAZOLE.html
-
-$$$$
-
-
-
- 14 15 0 0 0 0 0 0 0 0 2 V2000
- 8.4233 -3.5294 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 7.5389 -2.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.2248 -2.6870 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 5.6857 -1.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.3970 -1.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4957 -2.1985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.2743 -1.4320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0698 -1.9626 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.1877 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 0.9266 -3.2767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.5523 -0.1348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.8579 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.6713 -0.5981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 7.8168 -1.2551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 1 0 0 0 0
- 2 14 2 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 13 2 0 0 0 0
- 5 6 1 0 0 0 0
- 5 12 2 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 1 0 0 0 0
- 7 11 2 0 0 0 0
- 8 9 1 0 0 0 0
- 8 10 2 0 0 0 0
- 11 12 1 0 0 0 0
- 13 14 1 0 0 0 0
-M CHG 2 8 1 9 -1
-M END
-> <DSSTox_RID>
-20059
-
-> <DSSTox_CID>
-59
-
-> <DSSTox_Generic_SID>
-20059
-
-> <DSSTox_FileID>
-60_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C6H4N4O3S
-
-> <STRUCTURE_MolecularWeight>
-212.1826
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-2-Amino-5-(5-nitro-2-furyl)-1,3,4-thiadiazole
-
-> <TestSubstance_CASRN>
-712-68-5
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-5-(5-nitrofuran-2-yl)-1,3,4-thiadiazol-2-amine
-
-> <STRUCTURE_SMILES>
-NC1=NN=C(C2=CC=C([N+]([O-])=O)O2)S1
-
-> <STRUCTURE_Parent_SMILES>
-NC1=NN=C(C2=CC=C([N+]([O-])=O)O2)S1
-
-> <STRUCTURE_InChI>
-InChI=1/C6H4N4O3S/c7-6-9-8-5(14-6)3-1-2-4(13-3)10(11)12/h1-2H,(H2,7,9)/f/h7H2
-
-> <STRUCTURE_InChIKey>
-SXZZHGJWUBJKHH-IAUQMDSZCG
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <TD50_Rat_mg>
-0.662
-
-> <TD50_Rat_mmol>
-3.11995422810353E-03
-
-> <ActivityScore_CPDBAS_Rat>
-52
-
-> <TargetSites_Rat_Female>
-kidney; lung; mammary gland; stomach
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/2-AMINO-5-(5-NITRO-2-FURYL)-1,3,4-THIADIAZOLE.html
-
-$$$$
-
-
-
- 14 15 0 0 0 0 0 0 0 0 2 V2000
- 5.7002 -2.7618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.4855 -1.6853 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 7.7473 -2.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.7473 -3.4236 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 6.4855 -3.8383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.8238 -1.3147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 4.3678 -2.7618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.5825 -3.8383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3207 -3.4236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3207 -2.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.5825 -1.6853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.2442 -1.3147 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.7912 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 1.4471 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 5 2 0 0 0 0
- 1 7 1 0 0 0 0
- 2 3 2 0 0 0 0
- 3 4 1 0 0 0 0
- 3 6 1 0 0 0 0
- 4 5 1 0 0 0 0
- 7 8 2 0 0 0 0
- 7 11 1 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 10 11 1 0 0 0 0
- 10 12 1 0 0 0 0
- 12 13 1 0 0 0 0
- 12 14 2 0 0 0 0
-M CHG 2 12 1 13 -1
-M END
-> <DSSTox_RID>
-20060
-
-> <DSSTox_CID>
-60
-
-> <DSSTox_Generic_SID>
-39237
-
-> <DSSTox_FileID>
-61_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C7H5N3O3S
-
-> <STRUCTURE_MolecularWeight>
-211.1948
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-2-Amino-4-(5-nitro-2-furyl)thiazole
-
-> <TestSubstance_CASRN>
-38514-71-5
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-4-(5-nitrofuran-2-yl)-1,3-thiazol-2-amine
-
-> <STRUCTURE_SMILES>
-NC1=NC(C2=CC=C([N+]([O-])=O)O2)=CS1
-
-> <STRUCTURE_Parent_SMILES>
-NC1=NC(C2=CC=C([N+]([O-])=O)O2)=CS1
-
-> <STRUCTURE_InChI>
-InChI=1/C7H5N3O3S/c8-7-9-4(3-14-7)5-1-2-6(13-5)10(11)12/h1-3H,(H2,8,9)/f/h8H2
-
-> <STRUCTURE_InChIKey>
-ZAVLMIGIVYJYMU-FSHFIPFOCT
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-5.85
-
-> <TD50_Rat_mmol>
-2.76995456327523E-02
-
-> <ActivityScore_CPDBAS_Rat>
-42
-
-> <TargetSites_Rat_Female>
-stomach; urinary bladder
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <TD50_Mouse_mg>
-7.87
-
-> <TD50_Mouse_mmol>
-3.72641750649164E-02
-
-> <ActivityScore_CPDBAS_Mouse>
-44
-
-> <TargetSites_Mouse_Female>
-stomach
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multispecies active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/2-AMINO-4-(5-NITRO-2-FURYL)THIAZOLE.html
-
-$$$$
-
-
-
- 16 17 0 0 0 0 0 0 0 0 2 V2000
- 0.0000 -7.5449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.4042 -6.3035 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.7130 -6.3035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.1172 -7.5449 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0586 -8.3148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0586 -9.6236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.4829 -5.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.8109 -5.2545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.8310 -3.9649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.7637 -2.6561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9859 -2.1846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.8135 -3.2047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.1014 -4.3017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.3227 -0.9239 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 7.5930 -0.5870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3988 0.0000 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 5 1 0 0 0 0
- 2 3 2 0 0 0 0
- 3 4 1 0 0 0 0
- 3 7 1 0 0 0 0
- 4 5 2 0 0 0 0
- 5 6 1 0 0 0 0
- 7 8 2 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 1 0 0 0 0
- 9 13 2 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 2 0 0 0 0
- 11 14 1 0 0 0 0
- 12 13 1 0 0 0 0
- 14 15 2 0 0 0 0
- 14 16 1 0 0 0 0
-M CHG 2 14 1 16 -1
-M END
-> <DSSTox_RID>
-20061
-
-> <DSSTox_CID>
-61
-
-> <DSSTox_Generic_SID>
-20061
-
-> <DSSTox_FileID>
-62_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C8H6N4O4
-
-> <STRUCTURE_MolecularWeight>
-222.1598
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-trans-5-Amino-3[2-(5-nitro-2-furyl)vinyl]-1,2,4-oxadiazole
-
-> <TestSubstance_CASRN>
-28754-68-9
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-stereochem
-
-> <STRUCTURE_ChemicalName_IUPAC>
-3-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-1,2,4-oxadiazol-5-amine
-
-> <STRUCTURE_SMILES>
-NC1=NC(/C=C/C2=CC=C([N+]([O-])=O)O2)=NO1
-
-> <STRUCTURE_Parent_SMILES>
-NC1=NC(/C=C/C2=CC=C([N+]([O-])=O)O2)=NO1
-
-> <STRUCTURE_InChI>
-InChI=1/C8H6N4O4/c9-8-10-6(11-16-8)3-1-5-2-4-7(15-5)12(13)14/h1-4H,(H2,9,10,11)/b3-1+/f/h9H2
-
-> <STRUCTURE_InChIKey>
-RMZNNIOKNRDECR-OYGOROAMDP
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-mouse
-
-> <TD50_Mouse_mg>
-112
-
-> <TD50_Mouse_mmol>
-0.504141613379198
-
-> <ActivityScore_CPDBAS_Mouse>
-32
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Mouse_Male>
-hematopoietic system; stomach
-
-> <TargetSites_Mouse_Female>
-hematopoietic system; stomach
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/trans-5-AMINO-3[2-(5-NITRO-2-FURYL)VINYL]-1,2,4-OX.html
-
-$$$$
-
-
-
- 11 11 0 0 0 0 0 0 0 0 2 V2000
- 0.0000 -3.4525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6642 -2.3037 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 1.9925 -2.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6567 -1.1488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9910 -1.1488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6552 -2.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9910 -3.4525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6567 -3.4525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9835 -2.3037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6552 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.1488 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 11 1 0 0 0 0
- 3 4 2 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 2 0 0 0 0
- 5 10 1 0 0 0 0
- 6 7 1 0 0 0 0
- 6 9 1 0 0 0 0
- 7 8 2 0 0 0 0
-M CHG 2 2 1 11 -1
-M END
-> <DSSTox_RID>
-20062
-
-> <DSSTox_CID>
-62
-
-> <DSSTox_Generic_SID>
-20062
-
-> <DSSTox_FileID>
-63_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C6H6N2O3
-
-> <STRUCTURE_MolecularWeight>
-154.1234
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-2-Amino-4-nitrophenol
-
-> <TestSubstance_CASRN>
-99-57-0
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-2-amino-4-nitrophenol
-
-> <STRUCTURE_SMILES>
-O=[N+](C1=CC(=C(C=C1)O)N)[O-]
-
-> <STRUCTURE_Parent_SMILES>
-O=[N+](C1=CC(=C(C=C1)O)N)[O-]
-
-> <STRUCTURE_InChI>
-InChI=1/C6H6N2O3/c7-5-3-4(8(10)11)1-2-6(5)9/h1-3,9H,7H2
-
-> <STRUCTURE_InChIKey>
-VLZVIIYRNMWPSN-UHFFFAOYAN
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-839
-
-> <TD50_Rat_mmol>
-5.44368992638366
-
-> <ActivityScore_CPDBAS_Rat>
-18
-
-> <TargetSites_Rat_Male>
-kidney
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <NTP_TechnicalReport>
-TR 339
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/2-AMINO-4-NITROPHENOL.html
-
-$$$$
-
-
-
- 11 11 0 0 0 0 0 0 0 0 2 V2000
- 0.0000 -3.4525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6642 -2.3037 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 1.9925 -2.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6567 -1.1488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9910 -1.1488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6552 -2.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9910 -3.4525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6567 -3.4525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9835 -2.3037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6552 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.1488 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 11 1 0 0 0 0
- 3 4 2 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 2 0 0 0 0
- 5 10 1 0 0 0 0
- 6 7 1 0 0 0 0
- 6 9 1 0 0 0 0
- 7 8 2 0 0 0 0
-M CHG 2 2 1 11 -1
-M END
-> <DSSTox_RID>
-20063
-
-> <DSSTox_CID>
-63
-
-> <DSSTox_Generic_SID>
-20063
-
-> <DSSTox_FileID>
-64_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C6H6N2O3
-
-> <STRUCTURE_MolecularWeight>
-154.1234
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-2-Amino-5-nitrophenol
-
-> <TestSubstance_CASRN>
-121-88-0
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-2-amino-5-nitrophenol
-
-> <STRUCTURE_SMILES>
-O=[N+](C1=CC(=C(C=C1)N)O)[O-]
-
-> <STRUCTURE_Parent_SMILES>
-O=[N+](C1=CC(=C(C=C1)N)O)[O-]
-
-> <STRUCTURE_InChI>
-InChI=1/C6H6N2O3/c7-5-2-1-4(8(10)11)3-6(5)9/h1-3,9H,7H2
-
-> <STRUCTURE_InChIKey>
-DOPJTDJKZNWLRB-UHFFFAOYAU
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-111
-
-> <TD50_Rat_mmol>
-0.720202123752785
-
-> <ActivityScore_CPDBAS_Rat>
-27
-
-> <TargetSites_Rat_Male>
-pancreas
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <NTP_TechnicalReport>
-TR 334
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/2-AMINO-5-NITROPHENOL.html
-
-$$$$
-
-
-
- 11 11 0 0 0 0 0 0 0 0 2 V2000
- 1.9968 -4.6079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6577 -3.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9968 -2.3039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6577 -1.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9889 -1.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6544 -2.3039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9889 -3.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6544 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6656 -2.3039 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.4583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.1543 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 9 1 0 0 0 0
- 4 5 2 0 0 0 0
- 5 6 1 0 0 0 0
- 5 8 1 0 0 0 0
- 6 7 2 0 0 0 0
- 9 10 2 0 0 0 0
- 9 11 1 0 0 0 0
-M CHG 2 9 1 11 -1
-M END
-> <DSSTox_RID>
-20064
-
-> <DSSTox_CID>
-64
-
-> <DSSTox_Generic_SID>
-20064
-
-> <DSSTox_FileID>
-65_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C6H6N2O3
-
-> <STRUCTURE_MolecularWeight>
-154.1234
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-4-Amino-2-nitrophenol
-
-> <TestSubstance_CASRN>
-119-34-6
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-4-amino-2-nitrophenol
-
-> <STRUCTURE_SMILES>
-OC1=C(C=C(C=C1)N)[N+](=O)[O-]
-
-> <STRUCTURE_Parent_SMILES>
-OC1=C(C=C(C=C1)N)[N+](=O)[O-]
-
-> <STRUCTURE_InChI>
-InChI=1/C6H6N2O3/c7-4-1-2-6(9)5(3-4)8(10)11/h1-3,9H,7H2
-
-> <STRUCTURE_InChIKey>
-WHODQVWERNSQEO-UHFFFAOYAM
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-309
-
-> <TD50_Rat_mmol>
-2.00488699314965
-
-> <ActivityScore_CPDBAS_Rat>
-23
-
-> <TargetSites_Rat_Male>
-urinary bladder
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <NTP_TechnicalReport>
-TR 94
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/4-AMINO-2-NITROPHENOL.html
-
-$$$$
-
-
-
- 15 16 0 0 0 0 0 0 0 0 2 V2000
- 3.1238 -1.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3406 -2.2222 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0747 -1.8124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0747 -0.4827 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3406 -0.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.5956 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 4.4535 -1.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.1184 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.4480 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.1129 -1.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.4480 -2.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.1184 -2.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.4426 -1.1475 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 9.1074 0.0000 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 9.1074 -2.3042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 5 2 0 0 0 0
- 1 7 1 0 0 0 0
- 2 3 2 0 0 0 0
- 3 4 1 0 0 0 0
- 3 6 1 0 0 0 0
- 4 5 1 0 0 0 0
- 7 8 2 0 0 0 0
- 7 12 1 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 10 11 1 0 0 0 0
- 10 13 1 0 0 0 0
- 11 12 2 0 0 0 0
- 13 14 1 0 0 0 0
- 13 15 2 0 0 0 0
-M CHG 2 13 1 14 -1
-M END
-> <DSSTox_RID>
-20065
-
-> <DSSTox_CID>
-65
-
-> <DSSTox_Generic_SID>
-39238
-
-> <DSSTox_FileID>
-66_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C9H7N3O2S
-
-> <STRUCTURE_MolecularWeight>
-221.2332
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-2-Amino-4-(p-nitrophenyl)thiazole
-
-> <TestSubstance_CASRN>
-2104-09-8
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-4-(4-nitrophenyl)-1,3-thiazol-2-amine
-
-> <STRUCTURE_SMILES>
-NC1=NC(C2=CC=C([N+]([O-])=O)C=C2)=CS1
-
-> <STRUCTURE_Parent_SMILES>
-NC1=NC(C2=CC=C([N+]([O-])=O)C=C2)=CS1
-
-> <STRUCTURE_InChI>
-InChI=1/C9H7N3O2S/c10-9-11-8(5-15-9)6-1-3-7(4-2-6)12(13)14/h1-5H,(H2,10,11)/f/h10H2
-
-> <STRUCTURE_InChIKey>
-RIKJWJIWXCUKQV-GIMVELNWCN
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-mouse
-
-> <TD50_Mouse_mg>
-9.95
-
-> <TD50_Mouse_mmol>
-4.49751664759177E-02
-
-> <ActivityScore_CPDBAS_Mouse>
-43
-
-> <TargetSites_Mouse_Female>
-hematopoietic system
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/2-AMINO-4-(p-NITROPHENYL)THIAZOLE.html
-
-$$$$
-
-
-
- 9 9 0 0 0 0 0 0 0 0 2 V2000
- 5.1188 -0.2969 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.4533 -1.4486 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 3.1225 -1.4486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3393 -2.5236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0749 -2.1141 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0749 -0.7832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3393 -0.3737 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.1188 -2.6003 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 9 1 0 0 0 0
- 3 4 2 0 0 0 0
- 3 7 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 2 0 0 0 0
- 6 7 1 0 0 0 0
- 6 8 1 0 0 0 0
-M CHG 2 2 1 9 -1
-M END
-> <DSSTox_RID>
-20066
-
-> <DSSTox_CID>
-66
-
-> <DSSTox_Generic_SID>
-20066
-
-> <DSSTox_FileID>
-67_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C3H3N3O2S
-
-> <STRUCTURE_MolecularWeight>
-145.1398
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-2-Amino-5-nitrothiazole
-
-> <TestSubstance_CASRN>
-121-66-4
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-5-nitro-1,3-thiazol-2-amine
-
-> <STRUCTURE_SMILES>
-O=[N+](C1=CN=C(S1)N)[O-]
-
-> <STRUCTURE_Parent_SMILES>
-O=[N+](C1=CN=C(S1)N)[O-]
-
-> <STRUCTURE_InChI>
-InChI=1/C3H3N3O2S/c4-3-5-1-2(9-3)6(7)8/h1H,(H2,4,5)/f/h4H2
-
-> <STRUCTURE_InChIKey>
-MIHADVKEHAFNPG-LGEMBHMGCP
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-44.6
-
-> <TD50_Rat_mmol>
-0.307289937012453
-
-> <ActivityScore_CPDBAS_Rat>
-31
-
-> <TargetSites_Rat_Male>
-no positive results; NTP assigned level of evidence positive
-
-> <TargetSites_Rat_Female>
-kidney; lung; mammary gland
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active
-
-> <Note_CPDBAS>
-TargetSites_Rat_Male modified v3a
-
-> <NTP_TechnicalReport>
-TR 53; final call in CPDB differs due to additional data; NTP-assigned level of evidence of carcinogenicity is "positive" in male rat; noting that "these experiments were particularly difficult to evaluate".
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/2-AMINO-5-NITROTHIAZOLE.html
-
-$$$$
-
-
-
- 16 16 0 0 0 0 0 0 0 0 1 V2000
- 3.1225 -2.3401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3401 -3.4212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0740 -3.0087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.7911 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0740 -1.6786 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3401 -1.2661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.7526 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.4526 -2.3401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.1212 -1.1878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.4513 -1.1878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.1128 -2.3401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.4513 -3.4924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.1212 -3.4924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.5493 -5.2563 0.0000 Mg 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6944 -5.9178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3970 -5.9178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 6 1 0 0 0 0
- 1 8 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 5 2 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 8 9 1 0 0 0 0
- 8 13 2 0 0 0 0
- 9 10 2 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 2 0 0 0 0
- 12 13 1 0 0 0 0
- 14 15 1 0 0 0 0
- 14 16 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20067
-
-> <DSSTox_CID>
-67
-
-> <DSSTox_Generic_SID>
-20067
-
-> <DSSTox_FileID>
-68_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C9H10MgN2O4
-
-> <STRUCTURE_MolecularWeight>
-234.494
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-complex Mg(OH)2
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-2-Amino-5-phenyl-2-oxazolin-4-one + Mg(OH)2
-
-> <TestSubstance_CASRN>
-18968-99-5
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-parent [2152-34-3]
-
-> <STRUCTURE_ChemicalName_IUPAC>
-2-amino-5-phenyl-1,3-oxazol-4(5H)-one - dihydroxymagnesium (1:1)
-
-> <STRUCTURE_SMILES>
-NC1=NC(C(C2=CC=CC=C2)O1)=O.O[Mg]O
-
-> <STRUCTURE_Parent_SMILES>
-NC1=NC(C(C2=CC=CC=C2)O1)=O
-
-> <STRUCTURE_InChI>
-InChI=1/C9H8N2O2.Mg.2H2O/c10-9-11-8(12)7(13-9)6-4-2-1-3-5-6;;;/h1-5,7H,(H2,10,11,12);;2*1H2/q;+2;;/p-2/fC9H8N2O2.Mg.2HO/h10H2;;2*1h/q;m;2*-1/rC9H8N2O2.H2MgO2/c10-9-11-8(12)7(13-9)6-4-2-1-3-5-6;2-1-3/h1-5,7H,(H2,10,11,12);2-3H/f/h10H2;
-
-> <STRUCTURE_InChIKey>
-JOPOQPCBCUIPFX-VWMXNRJTCY
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/2-AMINO-5-PHENYL-2-OXAZOLIN-4-ONE%20+%20Mg(OH)2.html
-
-$$$$
-
-
-
- 17 19 0 0 0 0 0 0 0 0 1 V2000
- 3.3283 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9907 -1.1493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3283 -2.2987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9954 -2.2987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3329 -3.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9954 -4.6053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3283 -4.6053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9907 -3.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3236 -3.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9861 -4.6053 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9861 -2.2987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3236 -1.1493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9861 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3190 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9814 -1.1493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3190 -2.2987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.4560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 12 1 0 0 0 0
- 3 4 2 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 2 0 0 0 0
- 5 17 1 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 2 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 9 11 1 0 0 0 0
- 11 12 2 0 0 0 0
- 11 16 1 0 0 0 0
- 12 13 1 0 0 0 0
- 13 14 2 0 0 0 0
- 14 15 1 0 0 0 0
- 15 16 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20068
-
-> <DSSTox_CID>
-68
-
-> <DSSTox_Generic_SID>
-20068
-
-> <DSSTox_FileID>
-69_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C14H9NO2
-
-> <STRUCTURE_MolecularWeight>
-223.2268
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-2-Aminoanthraquinone
-
-> <TestSubstance_CASRN>
-117-79-3
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-2-amino-9,10-anthraquinone
-
-> <STRUCTURE_SMILES>
-O=C1C2=CC(=CC=C2C(=O)C3=C1C=CC=C3)N
-
-> <STRUCTURE_Parent_SMILES>
-O=C1C2=CC(=CC=C2C(=O)C3=C1C=CC=C3)N
-
-> <STRUCTURE_InChI>
-InChI=1/C14H9NO2/c15-8-5-6-11-12(7-8)14(17)10-4-2-1-3-9(10)13(11)16/h1-7H,15H2
-
-> <STRUCTURE_InChIKey>
-XOGPDSATLSAZEK-UHFFFAOYAH
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-101
-
-> <TD50_Rat_mmol>
-0.452454633583423
-
-> <ActivityScore_CPDBAS_Rat>
-29
-
-> <TargetSites_Rat_Male>
-liver
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <TD50_Mouse_mg>
-1190
-
-> <TD50_Mouse_mmol>
-5.33090112835914
-
-> <ActivityScore_CPDBAS_Mouse>
-20
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Mouse_Male>
-liver
-
-> <TargetSites_Mouse_Female>
-hematopoietic system; liver
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active; multispecies active
-
-> <NTP_TechnicalReport>
-TR 144
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/2-AMINOANTHRAQUINONE.html
-
-$$$$
-
-
-
- 17 18 0 0 0 0 0 0 0 0 1 V2000
- 2.6631 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9948 -1.1570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6631 -2.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9948 -3.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6683 -3.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6683 -1.1570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9896 -2.3040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6579 -3.4610 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9844 -3.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.6527 -2.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9793 -2.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.6475 -3.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9793 -4.6080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.6527 -4.6080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.9741 -3.4610 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 8.6475 -1.1570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 2 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 8 9 2 0 0 0 0
- 9 10 1 0 0 0 0
- 10 11 2 0 0 0 0
- 10 15 1 0 0 0 0
- 11 12 1 0 0 0 0
- 12 13 2 0 0 0 0
- 12 17 1 0 0 0 0
- 13 14 1 0 0 0 0
- 13 16 1 0 0 0 0
- 14 15 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20069
-
-> <DSSTox_CID>
-69
-
-> <DSSTox_Generic_SID>
-20069
-
-> <DSSTox_FileID>
-70_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C14H15N3
-
-> <STRUCTURE_MolecularWeight>
-225.289
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-o-Aminoazotoluene
-
-> <TestSubstance_CASRN>
-97-56-3
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-2-methyl-4-[(E)-(2-methylphenyl)diazenyl]aniline
-
-> <STRUCTURE_SMILES>
-CC1=C(C=CC=C1)/N=N/C2=CC(=C(C=C2)N)C
-
-> <STRUCTURE_Parent_SMILES>
-CC1=C(C=CC=C1)/N=N/C2=CC(=C(C=C2)N)C
-
-> <STRUCTURE_InChI>
-InChI=1/C14H15N3/c1-10-5-3-4-6-14(10)17-16-12-7-8-13(15)11(2)9-12/h3-9H,15H2,1-2H3/b17-16+
-
-> <STRUCTURE_InChIKey>
-PFRYFZZSECNQOL-WUKNDPDIBU
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-4.04
-
-> <TD50_Rat_mmol>
-1.79325222270062E-02
-
-> <ActivityScore_CPDBAS_Rat>
-44
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Rat_Male>
-liver
-
-> <TargetSites_Rat_Female>
-liver
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/o-AMINOAZOTOLUENE.html
-
-$$$$
-
-
-
- 9 8 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1544 -0.6620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1544 -1.9939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3088 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4632 -0.6620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6095 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7639 -0.6620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9183 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0727 -0.6620 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20070
-
-> <DSSTox_CID>
-70
-
-> <DSSTox_Generic_SID>
-20070
-
-> <DSSTox_FileID>
-71_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C6H13NO2
-
-> <STRUCTURE_MolecularWeight>
-131.1742
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-6-Aminocaproic acid
-
-> <TestSubstance_CASRN>
-60-32-2
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-6-aminohexanoic acid
-
-> <STRUCTURE_SMILES>
-OC(=O)CCCCCN
-
-> <STRUCTURE_Parent_SMILES>
-OC(=O)CCCCCN
-
-> <STRUCTURE_InChI>
-InChI=1/C6H13NO2/c7-5-3-1-2-4-6(8)9/h1-5,7H2,(H,8,9)/f/h8H
-
-> <STRUCTURE_InChIKey>
-SLXKOJJOQWFEFD-FZOZFQFYCD
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/6-AMINOCAPROIC%20ACID.html
-
-$$$$
-
-
-
- 13 14 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -1.1562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3316 -1.1562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9935 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3251 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9869 -1.1562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3251 -2.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9935 -2.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3186 -1.1562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9804 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3120 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9739 -1.1562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3120 -2.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9804 -2.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 5 6 1 0 0 0 0
- 5 8 1 0 0 0 0
- 6 7 2 0 0 0 0
- 8 9 2 0 0 0 0
- 8 13 1 0 0 0 0
- 9 10 1 0 0 0 0
- 10 11 2 0 0 0 0
- 11 12 1 0 0 0 0
- 12 13 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20071
-
-> <DSSTox_CID>
-71
-
-> <DSSTox_Generic_SID>
-20071
-
-> <DSSTox_FileID>
-72_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C12H11N
-
-> <STRUCTURE_MolecularWeight>
-169.2224
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-4-Aminodiphenyl
-
-> <TestSubstance_CASRN>
-92-67-1
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-biphenyl-4-amine
-
-> <STRUCTURE_SMILES>
-NC1=CC=C(C=C1)C2=CC=CC=C2
-
-> <STRUCTURE_Parent_SMILES>
-NC1=CC=C(C=C1)C2=CC=CC=C2
-
-> <STRUCTURE_InChI>
-InChI=1/C12H11N/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,13H2
-
-> <STRUCTURE_InChIKey>
-DMVOXQPQNTYEKQ-UHFFFAOYAX
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Mouse_mg>
-2.1
-
-> <TD50_Mouse_mmol>
-1.24097046253924E-02
-
-> <ActivityScore_CPDBAS_Mouse>
-50
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Mouse_Male>
-liver; urinary bladder
-
-> <TargetSites_Mouse_Female>
-liver; urinary bladder
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/4-AMINODIPHENYL.html
-
-$$$$
-
-
-
- 15 15 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -1.1502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3339 -1.1502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9969 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3308 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9937 -1.1502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3308 -2.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9969 -2.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3276 -1.1502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9906 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3245 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9875 -1.1502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3245 -2.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9906 -2.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3308 -3.6343 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6567 -3.6343 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 5 6 1 0 0 0 0
- 5 8 1 0 0 0 0
- 6 7 2 0 0 0 0
- 8 9 2 0 0 0 0
- 8 13 1 0 0 0 0
- 9 10 1 0 0 0 0
- 10 11 2 0 0 0 0
- 11 12 1 0 0 0 0
- 12 13 2 0 0 0 0
- 14 15 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20072
-
-> <DSSTox_CID>
-72
-
-> <DSSTox_Generic_SID>
-20072
-
-> <DSSTox_FileID>
-73_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C12H12ClN
-
-> <STRUCTURE_MolecularWeight>
-205.6865
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-complex HCl
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-4-Aminodiphenyl.HCl
-
-> <TestSubstance_CASRN>
-2113-61-3
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-parent [92-67-1]
-
-> <STRUCTURE_ChemicalName_IUPAC>
-biphenyl-4-amine hydrochloride
-
-> <STRUCTURE_SMILES>
-NC1(=CC=C(C=C1)C2=CC=CC=C2).[H]Cl
-
-> <STRUCTURE_Parent_SMILES>
-NC1(=CC=C(C=C1)C2=CC=CC=C2)
-
-> <STRUCTURE_InChI>
-InChI=1/C12H11N.ClH/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;/h1-9H,13H2;1H
-
-> <STRUCTURE_InChIKey>
-GUHXYHYUBFCYGJ-UHFFFAOYAT
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-0.98
-
-> <TD50_Rat_mmol>
-4.76453243163747E-03
-
-> <ActivityScore_CPDBAS_Rat>
-50
-
-> <TargetSites_Rat_Female>
-mammary gland
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/4-AMINODIPHENYL.HCl.html
-
-$$$$
-
-
-
- 14 16 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -2.8880 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0775 -2.1037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.2943 -2.6461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3645 -1.8618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6692 -2.1404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3363 -0.9896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.6630 -0.9896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3301 -2.1404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.6630 -3.2912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3363 -3.2912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.4420 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.2326 -0.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0158 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.9382 -0.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 14 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 12 2 0 0 0 0
- 5 6 2 0 0 0 0
- 5 10 1 0 0 0 0
- 6 7 1 0 0 0 0
- 6 11 1 0 0 0 0
- 7 8 2 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 11 12 1 0 0 0 0
- 12 13 1 0 0 0 0
- 13 14 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20073
-
-> <DSSTox_CID>
-73
-
-> <DSSTox_Generic_SID>
-39239
-
-> <DSSTox_FileID>
-74_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C12H9NO
-
-> <STRUCTURE_MolecularWeight>
-183.2092
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-2-Aminodiphenylene oxide
-
-> <TestSubstance_CASRN>
-3693-22-9
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-dibenzo[b,d]furan-2-amine
-
-> <STRUCTURE_SMILES>
-NC3=CC1=C(C=C3)OC2=C1C=CC=C2
-
-> <STRUCTURE_Parent_SMILES>
-NC3=CC1=C(C=C3)OC2=C1C=CC=C2
-
-> <STRUCTURE_InChI>
-InChI=1/C12H9NO/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12/h1-7H,13H2
-
-> <STRUCTURE_InChIKey>
-FFYZMBQLAYDJIG-UHFFFAOYAK
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-mouse
-
-> <TD50_Mouse_mg>
-4.24
-
-> <TD50_Mouse_mmol>
-0.023142942603319
-
-> <ActivityScore_CPDBAS_Mouse>
-47
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test; harmonic mean of TD50 includes a value for upper 99% confidence limit from study with 100% tumor incidence but no lifetable
-
-> <TargetSites_Mouse_Male>
-liver; urinary bladder
-
-> <TargetSites_Mouse_Female>
-liver
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/2-AMINODIPHENYLENE%20OXIDE.html
-
-$$$$
-
-
-
- 12 12 0 0 0 0 0 0 0 0 1 V2000
- 4.0663 -4.2139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.6134 -2.9635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3039 -2.7322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.7568 -1.4818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.0663 -1.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.9228 -2.2694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.5241 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3039 -4.0613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1519 -4.7259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -4.0613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.7322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1519 -2.0676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 8 1 0 0 0 0
- 3 12 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 2 0 0 0 0
- 5 7 1 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 1 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20074
-
-> <DSSTox_CID>
-74
-
-> <DSSTox_Generic_SID>
-20074
-
-> <DSSTox_FileID>
-75_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C9H17NO2
-
-> <STRUCTURE_MolecularWeight>
-171.2388
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-1-(Aminomethyl)cyclohexaneacetic acid
-
-> <TestSubstance_CASRN>
-60142-96-3
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-[1-(aminomethyl)cyclohexyl]acetic acid
-
-> <STRUCTURE_SMILES>
-NCC1(CC(=O)O)CCCCC1
-
-> <STRUCTURE_Parent_SMILES>
-NCC1(CC(=O)O)CCCCC1
-
-> <STRUCTURE_InChI>
-InChI=1/C9H17NO2/c10-7-9(6-8(11)12)4-2-1-3-5-9/h1-7,10H2,(H,11,12)/f/h11H
-
-> <STRUCTURE_InChIKey>
-UGJMXCAKCUNAIE-WXRBYKJCCG
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <TD50_Rat_mg>
-5850
-
-> <TD50_Rat_mmol>
-34.1628182397914
-
-> <ActivityScore_CPDBAS_Rat>
-10
-
-> <TargetSites_Rat_Male>
-pancreas
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <Note_CPDBAS>
-Rat added v3a
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/1-(AMINOMETHYL)CYCLOHEXANEACETIC%20ACID.html
-
-$$$$
-
-
-
- 19 18 0 0 0 0 0 0 0 0 1 V2000
- 1.3251 -5.7158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3129 -4.5673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9543 -2.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.2829 -3.4365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.2829 -1.1396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9666 -3.4365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9666 -1.1396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3129 -2.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9543 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3129 -6.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9666 -5.7158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9877 -4.5673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9666 -8.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -5.7158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 7.4827 -6.6964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.1133 -5.3448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 7.4827 -5.3448 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 8.8343 -5.3448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 7.4827 -3.9754 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 12 1 0 0 0 0
- 1 14 1 0 0 0 0
- 2 6 1 0 0 0 0
- 2 11 1 0 0 0 0
- 2 12 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 5 2 0 0 0 0
- 4 6 2 0 0 0 0
- 5 7 1 0 0 0 0
- 5 9 1 0 0 0 0
- 6 8 1 0 0 0 0
- 7 8 2 0 0 0 0
- 10 11 1 0 0 0 0
- 10 13 1 0 0 0 0
- 15 17 1 0 0 0 0
- 16 17 1 0 0 0 0
- 17 18 2 0 0 0 0
- 17 19 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20075
-
-> <DSSTox_CID>
-75
-
-> <DSSTox_Generic_SID>
-20075
-
-> <DSSTox_FileID>
-76_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C10H18N2O6S
-
-> <STRUCTURE_MolecularWeight>
-294.3247
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-complex H2SO4
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-2,2'-[(4-Aminophenyl)imino]bisethanol sulfate
-
-> <TestSubstance_CASRN>
-54381-16-7
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-parent [7575-35-1]
-
-> <STRUCTURE_ChemicalName_IUPAC>
-2,2'-[(4-aminophenyl)imino]diethanol sulfate (salt)
-
-> <STRUCTURE_SMILES>
-OS(O)(=O)=O.OCCN(CCO)c1ccc(N)cc1
-
-> <STRUCTURE_Parent_SMILES>
-OCCN(CCO)c1ccc(N)cc1
-
-> <STRUCTURE_InChI>
-InChI=1/C10H16N2O2.H2O4S/c11-9-1-3-10(4-2-9)12(5-7-13)6-8-14;1-5(2,3)4/h1-4,13-14H,5-8,11H2;(H2,1,2,3,4)/f/h;1-2H
-
-> <STRUCTURE_InChIKey>
-KMCFMEHSEWDYKG-ATDHBCBACR
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive
-
-> <Note_CPDBAS>
-Rat added v2a
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/2,2'-[(4-AMINOPHENYL)IMINO]BISETHANOL%20SULFATE.html
-
-$$$$
-
-
-
- 6 6 0 0 0 0 0 0 0 0 1 V2000
- 1.3304 -1.0738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.1104 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3767 -0.4086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3767 -1.7390 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.1104 -2.1509 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.0738 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 5 2 0 0 0 0
- 1 6 1 0 0 0 0
- 2 3 2 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20076
-
-> <DSSTox_CID>
-76
-
-> <DSSTox_Generic_SID>
-20076
-
-> <DSSTox_FileID>
-77_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C2H4N4
-
-> <STRUCTURE_MolecularWeight>
-84.08
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-3-Aminotriazole
-
-> <TestSubstance_CASRN>
-61-82-5
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-tautomers
-
-> <STRUCTURE_ChemicalName_IUPAC>
-1H-1,2,4-triazol-3-amine
-
-> <STRUCTURE_SMILES>
-C1(N=CNN=1)N
-
-> <STRUCTURE_Parent_SMILES>
-C1(N=CNN=1)N
-
-> <STRUCTURE_InChI>
-InChI=1/C2H4N4/c3-2-4-1-5-6-2/h1H,(H3,3,4,5,6)/f/h5H,3H2
-
-> <STRUCTURE_InChIKey>
-KLSJWNVTNUYHDU-YPUDGCQOCD
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse; hamster
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <TD50_Rat_mg>
-9.94
-
-> <TD50_Rat_mmol>
-0.118220742150333
-
-> <ActivityScore_CPDBAS_Rat>
-35
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Rat_Male>
-thyroid gland
-
-> <TargetSites_Rat_Female>
-pituitary gland; thyroid gland
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <TD50_Mouse_mg>
-25.3
-
-> <TD50_Mouse_mmol>
-0.300903901046622
-
-> <ActivityScore_CPDBAS_Mouse>
-34
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Mouse_Male>
-liver
-
-> <TargetSites_Mouse_Female>
-liver
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityScore_CPDBAS_Hamster>
-0
-
-> <TD50_Hamster_Note>
-no positive results
-
-> <TargetSites_Hamster_Male>
-no positive results
-
-> <TargetSites_Hamster_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active; multispecies active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/3-AMINOTRIAZOLE.html
-
-$$$$
-
-
-
- 14 13 0 0 0 0 0 0 0 0 1 V2000
- 1.1352 -1.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.2703 -2.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4055 -1.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.5680 -2.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7032 -1.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.8383 -2.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9735 -1.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.1086 -2.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.2712 -1.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 11.4063 -2.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.5415 -1.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1352 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.0241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 13.6766 -2.0241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 13 1 0 0 0 0
- 1 12 2 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 1 0 0 0 0
- 10 11 1 0 0 0 0
- 11 14 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20077
-
-> <DSSTox_CID>
-77
-
-> <DSSTox_Generic_SID>
-20077
-
-> <DSSTox_FileID>
-78_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C11H23NO2
-
-> <STRUCTURE_MolecularWeight>
-201.3058
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-11-Aminoundecanoic acid
-
-> <TestSubstance_CASRN>
-2432-99-7
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-11-aminoundecanoic acid
-
-> <STRUCTURE_SMILES>
-OC(=O)CCCCCCCCCCN
-
-> <STRUCTURE_Parent_SMILES>
-OC(=O)CCCCCCCCCCN
-
-> <STRUCTURE_InChI>
-InChI=1/C11H23NO2/c12-10-8-6-4-2-1-3-5-7-9-11(13)14/h1-10,12H2,(H,13,14)/f/h13H
-
-> <STRUCTURE_InChIKey>
-GUOSQNAUYHMCRU-NDKGDYFDCZ
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <TD50_Rat_mg>
-1100
-
-> <TD50_Rat_mmol>
-5.46432343231044
-
-> <ActivityScore_CPDBAS_Rat>
-18
-
-> <TargetSites_Rat_Male>
-liver; urinary bladder
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active
-
-> <NTP_TechnicalReport>
-TR 216
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/11-AMINOUNDECANOIC%20ACID.html
-
-$$$$
-
-
-
- 6 4 0 0 0 0 0 0 0 0 2 V2000
- 2.6600 -2.6600 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6600 -1.3320 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 1.3280 -1.3320 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6600 0.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9880 -1.3320 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.3320 0.0000 Cl 0 5 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 1 0 0 0 0
- 2 4 1 0 0 0 0
- 2 5 1 0 0 0 0
-M CHG 2 2 1 6 -1
-M END
-> <DSSTox_RID>
-20078
-
-> <DSSTox_CID>
-78
-
-> <DSSTox_Generic_SID>
-20078
-
-> <DSSTox_FileID>
-79_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-H4ClN
-
-> <STRUCTURE_MolecularWeight>
-53.4915
-
-> <STRUCTURE_ChemicalType>
-inorganic
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Ammonium chloride
-
-> <TestSubstance_CASRN>
-12125-02-9
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-ammonium chloride
-
-> <STRUCTURE_SMILES>
-[H][N+]([H])([H])[H].[Cl-]
-
-> <STRUCTURE_InChI>
-InChI=1/ClH.H3N/h1H;1H3/fCl.H4N/h1h;1H/q-1;+1
-
-> <STRUCTURE_InChIKey>
-NLXLAEXVIDQMFP-DWOZJLMICO
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-mouse
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/AMMONIUM%20CHLORIDE.html
-
-$$$$
-
-
-
- 15 12 0 0 0 0 0 0 0 0 2 V2000
- 2.3011 -1.9952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3011 -3.3253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1505 -3.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.3253 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 1.1505 -5.3204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.6312 -1.9952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.2963 -3.1457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.6312 -4.2963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.6264 -3.1457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3011 -0.6651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4583 0.0000 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 1.1505 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.9710 -1.9952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.7932 -6.6506 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 1.4631 -6.6506 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 6 1 0 0 0 0
- 1 10 1 0 0 0 0
- 1 13 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 5 2 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 1 0 0 0 0
- 7 9 2 0 0 0 0
- 10 11 1 0 0 0 0
- 10 12 2 0 0 0 0
-M CHG 4 4 -1 11 -1 14 1 15 1
-M END
-> <DSSTox_RID>
-20079
-
-> <DSSTox_CID>
-79
-
-> <DSSTox_Generic_SID>
-20079
-
-> <DSSTox_FileID>
-80_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C6H14N2O7
-
-> <STRUCTURE_MolecularWeight>
-226.1858
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-complex 2NH4
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Ammonium citrate
-
-> <TestSubstance_CASRN>
-3012-65-5
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-parent [77-92-9]
-
-> <STRUCTURE_ChemicalName_IUPAC>
-diammonium 2-(carboxymethyl)-2-hydroxybutanedioate
-
-> <STRUCTURE_SMILES>
-C(CC([O-])=O)(CC(O)=O)(C([O-])=O)O.[N+].[N+]
-
-> <STRUCTURE_Parent_SMILES>
-C(CC(O)=O)(CC(O)=O)(C(O)=O)O
-
-> <STRUCTURE_InChI>
-InChI=1/C6H8O7.2H3N/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);2*1H3/fC6H6O7.2H4N/h7H;2*1H/q-2;2*+1
-
-> <STRUCTURE_InChIKey>
-YXVFQADLFFNVDS-JYGIMERMCP
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/AMMONIUM%20CITRATE.html
-
-$$$$
-
-
-
- 2 0 0 0 0 0 0 0 0 0 2 V2000
- 10.0000 0.0000 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.3600 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
-M CHG 2 1 1 2 -1
-M END
-> <DSSTox_RID>
-20080
-
-> <DSSTox_CID>
-80
-
-> <DSSTox_Generic_SID>
-20080
-
-> <DSSTox_FileID>
-81_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-H5NO
-
-> <STRUCTURE_MolecularWeight>
-35.0458
-
-> <STRUCTURE_ChemicalType>
-inorganic
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Ammonium hydroxide
-
-> <TestSubstance_CASRN>
-1336-21-6
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-ammonium hydroxide
-
-> <STRUCTURE_SMILES>
-[N+].[O-]
-
-> <STRUCTURE_InChI>
-InChI=1/H3N.H2O/h1H3;1H2/fH4N.HO/h1H;1h/q+1;-1
-
-> <STRUCTURE_InChIKey>
-VHUUQVKOLVNVRT-QBBVKLOVCT
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-mouse
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/AMMONIUM%20HYDROXIDE.html
-
-$$$$
-
-
-
- 16 16 0 0 0 0 0 0 0 0 1 V2000
- 3.1752 -3.9923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.3269 -3.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.3269 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.4787 -1.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.4787 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.6305 -2.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 6.6305 -3.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.7823 -3.9923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.4787 -3.9923 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.0195 -2.2257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.1635 -1.2140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8560 -1.4397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.3969 -2.6927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.4202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.8756 -0.7471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.5604 -0.5214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 9 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 10 1 0 0 0 0
- 3 15 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 6 1 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 2 0 0 0 0
- 7 9 1 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 1 0 0 0 0
- 12 13 1 0 0 0 0
- 12 14 1 0 0 0 0
- 15 16 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20081
-
-> <DSSTox_CID>
-81
-
-> <DSSTox_Generic_SID>
-20081
-
-> <DSSTox_FileID>
-82_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C11H18N2O3
-
-> <STRUCTURE_MolecularWeight>
-226.2748
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Amobarbital
-
-> <TestSubstance_CASRN>
-57-43-2
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-5-ethyl-5-(3-methylbutyl)pyrimidine-2,4,6(1H,3H,5H)-trione
-
-> <STRUCTURE_SMILES>
-N1C(=O)C(CC)(CCC(C)C)C(=O)NC1=O
-
-> <STRUCTURE_Parent_SMILES>
-N1C(=O)C(CC)(CCC(C)C)C(=O)NC1=O
-
-> <STRUCTURE_InChI>
-InChI=1/C11H18N2O3/c1-4-11(6-5-7(2)3)8(14)12-10(16)13-9(11)15/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16)/f/h12-13H
-
-> <STRUCTURE_InChIKey>
-VIROVYVQCGLCII-BAINRFMOCW
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/AMOBARBITAL.html
-
-$$$$
-
-
-
- 25 24 0 0 0 0 0 0 0 0 1 V2000
- 1.3247 -4.6461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3247 -3.3214 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.3214 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6591 -3.3214 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3247 -1.9967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.1331 -2.6591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9837 -1.9967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9837 -0.6623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.1331 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.2922 -0.6623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.2922 -1.9967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.4415 -2.6591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.5908 -1.9967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.5908 -0.6623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 9.7402 -2.6591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.1331 -6.6428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9837 -5.9805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9837 -4.6461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.1331 -3.9837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.2922 -4.6461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.2922 -5.9805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.4415 -6.6428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.5908 -5.9805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.5908 -4.6461 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 9.7402 -6.6428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 4 1 0 0 0 0
- 2 5 2 0 0 0 0
- 6 7 2 0 0 0 0
- 6 11 1 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 2 0 0 0 0
- 9 10 1 0 0 0 0
- 10 11 2 0 0 0 0
- 11 12 1 0 0 0 0
- 12 13 1 0 0 0 0
- 13 14 1 0 0 0 0
- 13 15 1 0 0 0 0
- 16 17 2 0 0 0 0
- 16 21 1 0 0 0 0
- 17 18 1 0 0 0 0
- 18 19 2 0 0 0 0
- 19 20 1 0 0 0 0
- 20 21 2 0 0 0 0
- 21 22 1 0 0 0 0
- 22 23 1 0 0 0 0
- 23 24 1 0 0 0 0
- 23 25 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20082
-
-> <DSSTox_CID>
-82
-
-> <DSSTox_Generic_SID>
-20082
-
-> <DSSTox_FileID>
-83_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C18H28N2O4S
-
-> <STRUCTURE_MolecularWeight>
-368.4909
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-complex bis H2SO4
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-dl-Amphetamine sulfate
-
-> <TestSubstance_CASRN>
-60-13-9
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-racemic mixture of L- [51-62-7] and D- [51-63-8], parent [300-62-9], structure shown without stereochem
-
-> <STRUCTURE_ChemicalName_IUPAC>
-1-phenylpropan-2-amine sulfate (2:1)
-
-> <STRUCTURE_SMILES>
-O=S(O)(O)=O.C1(=CC=CC=C1CC(N)C).C2=CC=CC=C2CC(N)C
-
-> <STRUCTURE_Parent_SMILES>
-C1=CC=CC=C1CC(N)C
-
-> <STRUCTURE_InChI>
-InChI=1/2C9H13N.H2O4S/c2*1-8(10)7-9-5-3-2-4-6-9;1-5(2,3)4/h2*2-6,8H,7,10H2,1H3;(H2,1,2,3,4)/f/h;;1-2H
-
-> <STRUCTURE_InChIKey>
-PYHRZPFZZDCOPH-IPLSSONACD
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive; multispecies inactive
-
-> <NTP_TechnicalReport>
-TR 387
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/dl-AMPHETAMINE%20SULFATE.html
-
-$$$$
-
-
-
- 29 28 0 0 1 0 0 0 0 0 1 V2000
- 7.0899 -2.6689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.4012 -3.9801 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 8.4012 -2.6689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.0899 -3.9801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.6776 -4.3979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.4667 -3.3303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.6776 -2.2627 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 8.4244 -1.3228 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 7.0783 -1.3228 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7439 -2.6573 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 11.6038 -2.6573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 11.6038 -4.0033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.0837 -5.6743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 11.3834 -5.9528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 9.1902 -6.6606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.1384 -4.9432 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.2976 -0.6498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.2976 -1.9843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1372 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1372 -2.6573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.6498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.9843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4463 -2.6573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4463 -3.9801 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6067 -1.9843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6067 -0.6498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0232 -7.1248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9727 -7.0783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.7132 -7.1712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 3 1 0 0 0 0
- 1 4 1 0 0 0 0
- 1 9 1 6 0 0 0
- 1 10 1 1 0 0 0
- 2 4 1 0 0 0 0
- 2 5 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 7 1 0 0 0 0
- 3 8 1 6 0 0 0
- 4 16 2 0 0 0 0
- 5 6 1 0 0 0 0
- 5 13 1 6 0 0 0
- 6 7 1 0 0 0 0
- 6 11 1 0 0 0 0
- 6 12 1 0 0 0 0
- 10 25 1 0 0 0 0
- 13 14 2 0 0 0 0
- 13 15 1 0 0 0 0
- 17 18 1 0 0 0 0
- 17 19 2 0 0 0 0
- 18 20 2 0 0 0 0
- 18 23 1 0 0 0 0
- 19 21 1 0 0 0 0
- 20 22 1 0 0 0 0
- 21 22 2 0 0 0 0
- 23 24 1 6 0 0 0
- 23 25 1 0 0 0 0
- 25 26 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20083
-
-> <DSSTox_CID>
-83
-
-> <DSSTox_Generic_SID>
-20083
-
-> <DSSTox_FileID>
-84_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C16H25N3O7S
-
-> <STRUCTURE_MolecularWeight>
-403.4506
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-complex 3H2O
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Ampicillin trihydrate
-
-> <TestSubstance_CASRN>
-7177-48-2
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-stereochem; parent [69-53-4]
-
-> <STRUCTURE_ChemicalName_IUPAC>
-(2S,5R,6R)-6-{[(2R)-2-amino-2-phenylacetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid trihydrate
-
-> <STRUCTURE_SMILES>
-[H][C@@]12[C@]([H])(NC([C@H](N)C3=CC=CC=C3)=O)C(N1[C@@H]([C@@](O)=O)C(C)(C)S2)=O.O.O.O
-
-> <STRUCTURE_Parent_SMILES>
-[H][C@@]12[C@]([H])(NC([C@H](N)C3=CC=CC=C3)=O)C(N1[C@@H]([C@@](O)=O)C(C)(C)S2)=O
-
-> <STRUCTURE_InChI>
-InChI=1/C16H19N3O4S.3H2O/c1-16(2)11(15(22)23)19-13(21)10(14(19)24-16)18-12(20)9(17)8-6-4-3-5-7-8;;;/h3-7,9-11,14H,17H2,1-2H3,(H,18,20)(H,22,23);3*1H2/t9-,10-,11+,14-;;;/m1.../s1/f/h18,22H;;;
-
-> <STRUCTURE_InChIKey>
-RXDALBZNGVATNY-FQLIROBNDT
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive; multispecies inactive
-
-> <Note_CPDBAS>
-structure modified v5b
-
-> <NTP_TechnicalReport>
-TR 318
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/AMPICILLIN%20TRIHYDRATE.html
-
-$$$$
-
-
-
- 11 10 0 0 0 0 0 0 0 0 1 V2000
- 1.1536 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3071 -0.6696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3071 -2.0006 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4607 -2.6621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6062 -2.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7598 -2.6621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9133 -2.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0669 -2.6621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1536 -2.6621 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.0006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4607 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 11 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 9 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 1 0 0 0 0
- 9 10 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20084
-
-> <DSSTox_CID>
-84
-
-> <DSSTox_Generic_SID>
-20084
-
-> <DSSTox_FileID>
-85_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C6H13N3O2
-
-> <STRUCTURE_MolecularWeight>
-159.1876
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-1-Amyl-1-nitrosourea
-
-> <TestSubstance_CASRN>
-10589-74-9
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-1-nitroso-1-pentylurea
-
-> <STRUCTURE_SMILES>
-O=C(N(CCCCC)N=O)N
-
-> <STRUCTURE_Parent_SMILES>
-O=C(N(CCCCC)N=O)N
-
-> <STRUCTURE_InChI>
-InChI=1/C6H13N3O2/c1-2-3-4-5-9(8-11)6(7)10/h2-5H2,1H3,(H2,7,10)/f/h7H2
-
-> <STRUCTURE_InChIKey>
-YYTNAQDGJQPZFU-IAUQMDSZCI
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <TD50_Rat_mg>
-0.555
-
-> <TD50_Rat_mmol>
-3.48645246237772E-03
-
-> <ActivityScore_CPDBAS_Rat>
-51
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Rat_Male>
-hematopoietic system; lung; stomach
-
-> <TargetSites_Rat_Female>
-hematopoietic system; lung; mammary gland; stomach; uterus
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active
-
-> <Note_CPDBAS>
-TD50_Rat modified v5a
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/1-AMYL-1-NITROSOUREA.html
-
-$$$$
-
-
-
- 0 0 0 0 0 0 0 0 0 0 1 V2000
-M END
-> <DSSTox_RID>
-20085
-
-> <DSSTox_Generic_SID>
-20085
-
-> <DSSTox_FileID>
-86_CPDBAS_v5c
-
-> <STRUCTURE_ChemicalType>
-no structure
-
-> <STRUCTURE_Shown>
-no structure
-
-> <TestSubstance_ChemicalName>
-Amylopectin sulfate
-
-> <TestSubstance_CASRN>
-9047-13-6
-
-> <TestSubstance_Description>
-macromolecule
-
-> <ChemicalNote>
-non-linear polymer of glucose (Merck - amylopectic)
-
-> <STRUCTURE_InChI>
-InChI=1//
-
-> <STRUCTURE_InChIKey>
-MOSFIJXAXDLOML-UHFFFAOYAM
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <TD50_Rat_mg>
-283
-
-> <ActivityScore_CPDBAS_Rat>
-50
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test; TD50_Rat_mmol was not calculated for this mixture, but Activiity Score is assigned value of "50" to indicate active
-
-> <TargetSites_Rat_Male>
-large intestine
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <Note_CPDBAS>
-TD50_Rat_mmol and TD50_Mouse_mmol conversions from mg values not provided due substance being a mixture
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/AMYLOPECTIN%20SULFATE.html
-
-$$$$
-
-
-
- 11 11 0 0 0 0 0 0 0 0 1 V2000
- 0.6773 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.1753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6640 -2.3241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9921 -2.3241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6561 -1.1753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9842 -1.1753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6482 -2.3241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9842 -3.4729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6561 -3.4729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9763 -2.3241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.6403 -3.4729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 9 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 7 8 1 0 0 0 0
- 7 10 1 0 0 0 0
- 8 9 2 0 0 0 0
- 10 11 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20086
-
-> <DSSTox_CID>
-86
-
-> <DSSTox_Generic_SID>
-20086
-
-> <DSSTox_FileID>
-87_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C10H12O
-
-> <STRUCTURE_MolecularWeight>
-148.2017
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-representative isomer in mixture
-
-> <TestSubstance_ChemicalName>
-Anethole
-
-> <TestSubstance_CASRN>
-104-46-1
-
-> <TestSubstance_Description>
-mixture or formulation
-
-> <ChemicalNote>
-mixture of Z [25679-28-1], E [4180-23-8] isomers, structure shown Z, stereochem
-
-> <STRUCTURE_ChemicalName_IUPAC>
-1-(methyloxy)-4-[(1Z)-prop-1-en-1-yl]benzene
-
-> <STRUCTURE_SMILES>
-CC=CC1=CC=C(C=C1)OC
-
-> <STRUCTURE_Parent_SMILES>
-CC=CC1=CC=C(C=C1)OC
-
-> <STRUCTURE_InChI>
-InChI=1/C10H12O/c1-3-4-9-5-7-10(11-2)8-6-9/h3-8H,1-2H3/b4-3-
-
-> <STRUCTURE_InChIKey>
-RUVINXPYWBROJD-ARJAWSKDBC
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ANETHOLE.html
-
-$$$$
-
-
-
- 11 11 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3316 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9934 -1.1561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3249 -1.1561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9867 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3183 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9801 -1.1561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3183 -2.3043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9867 -2.3043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3116 -1.1561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9734 -2.3043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 9 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 7 8 1 0 0 0 0
- 7 10 1 0 0 0 0
- 8 9 2 0 0 0 0
- 10 11 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20087
-
-> <DSSTox_CID>
-87
-
-> <DSSTox_Generic_SID>
-20087
-
-> <DSSTox_FileID>
-88_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C10H12O
-
-> <STRUCTURE_MolecularWeight>
-148.2017
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-trans-Anethole
-
-> <TestSubstance_CASRN>
-4180-23-8
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-stereochem
-
-> <STRUCTURE_ChemicalName_IUPAC>
-1-(methyloxy)-4-[(1E)-prop-1-en-1-yl]benzene
-
-> <STRUCTURE_SMILES>
-C/C=C/C1=CC=C(C=C1)OC
-
-> <STRUCTURE_Parent_SMILES>
-C/C=C/C1=CC=C(C=C1)OC
-
-> <STRUCTURE_InChI>
-InChI=1/C10H12O/c1-3-4-9-5-7-10(11-2)8-6-9/h3-8H,1-2H3/b4-3+
-
-> <STRUCTURE_InChIKey>
-RUVINXPYWBROJD-ONEGZZNKBR
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/trans-ANETHOLE.html
-
-$$$$
-
-
-
- 17 18 0 0 1 0 0 0 0 0 1 V2000
- 3.5180 -1.6894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.5813 -0.9143 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9254 -2.9615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.6745 -1.6894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.2571 -2.9615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9962 -1.6894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.3403 -3.7465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.1403 -4.0347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.2559 -1.2820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.2522 -2.1863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9776 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.7689 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3937 -2.9615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.6658 -3.3788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.9378 -3.7962 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 9.0732 -2.1068 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 8.2484 -4.6310 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 1 0 0 0
- 1 3 1 0 0 0 0
- 1 9 1 0 0 0 0
- 2 4 1 0 0 0 0
- 3 5 1 0 0 0 0
- 3 8 1 1 0 0 0
- 4 5 1 0 0 0 0
- 4 6 1 6 0 0 0
- 5 7 1 6 0 0 0
- 6 13 1 0 0 0 0
- 7 13 1 0 0 0 0
- 9 10 1 0 0 0 0
- 9 11 1 1 0 0 0
- 10 12 1 0 0 0 0
- 13 14 1 6 0 0 0
- 14 15 1 0 0 0 0
- 14 16 1 0 0 0 0
- 14 17 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20088
-
-> <DSSTox_CID>
-88
-
-> <DSSTox_Generic_SID>
-20088
-
-> <DSSTox_FileID>
-89_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C8H11Cl3O6
-
-> <STRUCTURE_MolecularWeight>
-309.52834
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Anhydroglucochloral
-
-> <TestSubstance_CASRN>
-15879-93-3
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-Chlorlose-alpha, stereochem
-
-> <STRUCTURE_ChemicalName_IUPAC>
-1,2-O-[(1R)-2,2,2-trichloroethylidene]-alpha-D-glucofuranose
-
-> <STRUCTURE_SMILES>
-O[C@H]1[C@@H]([C@H](O)CO)O[C@H]2[C@@H]1O[C@@H]([C@@](Cl)(Cl)Cl)O2
-
-> <STRUCTURE_Parent_SMILES>
-O[C@H]1[C@@H]([C@H](O)CO)O[C@H]2[C@@H]1O[C@@H]([C@@](Cl)(Cl)Cl)O2
-
-> <STRUCTURE_InChI>
-InChI=1/C8H11Cl3O6/c9-8(10,11)7-16-5-3(14)4(2(13)1-12)15-6(5)17-7/h2-7,12-14H,1H2/t2-,3+,4-,5-,6-,7-/m1/s1
-
-> <STRUCTURE_InChIKey>
-OJYGBLRPYBAHRT-IPQSZEQABF
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-mouse
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive
-
-> <Note_CPDBAS>
-structure modified v5b
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ANHYDROGLUCOCHLORAL.html
-
-$$$$
-
-
-
- 16 17 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -3.9909 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1529 -3.3297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1529 -1.9995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3058 -1.3303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4587 -1.9995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4587 -3.3297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3058 -3.9909 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6036 -3.9909 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7565 -3.3297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7565 -1.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9094 -1.3303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0623 -1.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0623 -3.3297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9094 -3.9909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9094 -5.3211 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3058 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 16 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 6 8 1 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 9 14 1 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 2 0 0 0 0
- 12 13 1 0 0 0 0
- 13 14 2 0 0 0 0
- 14 15 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20089
-
-> <DSSTox_CID>
-89
-
-> <DSSTox_Generic_SID>
-20089
-
-> <DSSTox_FileID>
-90_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C9H5Cl3N4
-
-> <STRUCTURE_MolecularWeight>
-275.5218
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Anilazine
-
-> <TestSubstance_CASRN>
-101-05-3
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine
-
-> <STRUCTURE_SMILES>
-ClC1=NC(=NC(=N1)NC2=CC=CC=C2Cl)Cl
-
-> <STRUCTURE_Parent_SMILES>
-ClC1=NC(=NC(=N1)NC2=CC=CC=C2Cl)Cl
-
-> <STRUCTURE_InChI>
-InChI=1/C9H5Cl3N4/c10-5-3-1-2-4-6(5)13-9-15-7(11)14-8(12)16-9/h1-4H,(H,13,14,15,16)/f/h13H
-
-> <STRUCTURE_InChIKey>
-IMHBYKMAHXWHRP-NDKGDYFDCD
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive; multispecies inactive
-
-> <NTP_TechnicalReport>
-TR 104
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ANILAZINE.html
-
-$$$$
-
-
-
- 7 7 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -1.1496 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3292 -1.1496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9958 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3250 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9916 -1.1496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3250 -2.3032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9958 -2.3032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20090
-
-> <DSSTox_CID>
-90
-
-> <DSSTox_Generic_SID>
-20090
-
-> <DSSTox_FileID>
-91_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C6H7N
-
-> <STRUCTURE_MolecularWeight>
-93.1265
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Aniline
-
-> <TestSubstance_CASRN>
-62-53-3
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-aniline
-
-> <STRUCTURE_SMILES>
-NC1=CC=CC=C1
-
-> <STRUCTURE_Parent_SMILES>
-NC1=CC=CC=C1
-
-> <STRUCTURE_InChI>
-InChI=1/C6H7N/c7-6-4-2-1-3-5-6/h1-5H,7H2
-
-> <STRUCTURE_InChIKey>
-PAYRUJLWNCNPSJ-UHFFFAOYAP
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ANILINE.html
-
-$$$$
-
-
-
- 9 8 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -1.1525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3279 -1.1525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9939 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3219 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9878 -1.1525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3219 -2.3050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9939 -2.3050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3279 -3.6329 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6599 -3.6329 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 8 9 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20091
-
-> <DSSTox_CID>
-91
-
-> <DSSTox_Generic_SID>
-20091
-
-> <DSSTox_FileID>
-92_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C6H8ClN
-
-> <STRUCTURE_MolecularWeight>
-129.5874
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-complex HCl
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Aniline.HCl
-
-> <TestSubstance_CASRN>
-142-04-1
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-parent [62-53-3]
-
-> <STRUCTURE_ChemicalName_IUPAC>
-aniline hydrochloride
-
-> <STRUCTURE_SMILES>
-NC1=CC=CC=C1[H]Cl
-
-> <STRUCTURE_Parent_SMILES>
-NC1=CC=CC=C1
-
-> <STRUCTURE_InChI>
-InChI=1/C6H7N.ClH/c7-6-4-2-1-3-5-6;/h1-5H,7H2;1H
-
-> <STRUCTURE_InChIKey>
-MMCPOSDMTGQNKG-UHFFFAOYAJ
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <TD50_Rat_mg>
-269
-
-> <TD50_Rat_mmol>
-2.07581909969642
-
-> <ActivityScore_CPDBAS_Rat>
-22
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test; greater than ten-fold variation among TD50 values for positive results
-
-> <TargetSites_Rat_Male>
-peritoneal cavity; spleen; vascular system
-
-> <TargetSites_Rat_Female>
-peritoneal cavity
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active
-
-> <NTP_TechnicalReport>
-TR 130
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ANILINE.HCl.html
-
-$$$$
-
-
-
- 11 10 0 0 0 0 0 0 0 0 1 V2000
- 1.9960 -2.3024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6614 -1.1536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9921 -1.1536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6574 -2.3024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9921 -3.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6614 -3.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9960 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6653 -2.3024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.5988 -4.7867 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 2.9247 -4.7867 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 1 6 1 0 0 0 0
- 1 8 1 0 0 0 0
- 2 3 1 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 2 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 2 0 0 0 0
- 8 9 1 0 0 0 0
- 10 11 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20092
-
-> <DSSTox_CID>
-92
-
-> <DSSTox_Generic_SID>
-20092
-
-> <DSSTox_FileID>
-93_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C7H10ClNO
-
-> <STRUCTURE_MolecularWeight>
-159.6134
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-complex HCl
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-o-Anisidine.HCl
-
-> <TestSubstance_CASRN>
-134-29-2
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-parent [90-04-0]
-
-> <STRUCTURE_ChemicalName_IUPAC>
-2-methoxyaniline hydrochloride
-
-> <STRUCTURE_SMILES>
-C1(=C(C=CC=C1)N)OC.[H]Cl
-
-> <STRUCTURE_Parent_SMILES>
-C1(=C(C=CC=C1)N)OC
-
-> <STRUCTURE_InChI>
-InChI=1/C7H9NO.ClH/c1-9-7-5-3-2-4-6(7)8;/h2-5H,8H2,1H3;1H
-
-> <STRUCTURE_InChIKey>
-XCZCWGVXRBJCCD-UHFFFAOYAX
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-29.7
-
-> <TD50_Rat_mmol>
-0.186074602758916
-
-> <ActivityScore_CPDBAS_Rat>
-33
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Rat_Male>
-kidney; thyroid gland; urinary bladder
-
-> <TargetSites_Rat_Female>
-urinary bladder
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <TD50_Mouse_mg>
-966
-
-> <TD50_Mouse_mmol>
-6.0521234432698
-
-> <ActivityScore_CPDBAS_Mouse>
-19
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Mouse_Male>
-urinary bladder
-
-> <TargetSites_Mouse_Female>
-urinary bladder
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active; multispecies active
-
-> <NTP_TechnicalReport>
-TR 89
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/o-ANISIDINE.HCl.html
-
-$$$$
-
-
-
- 11 10 0 0 0 0 0 0 0 0 1 V2000
- 1.9927 -1.1489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6569 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9913 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6555 -1.1489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9839 -1.1489 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9913 -2.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6569 -2.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6642 -1.1489 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3936 -3.6322 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 3.7220 -3.6322 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 1 7 1 0 0 0 0
- 1 8 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 2 0 0 0 0
- 4 5 1 0 0 0 0
- 4 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 8 9 1 0 0 0 0
- 10 11 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20093
-
-> <DSSTox_CID>
-93
-
-> <DSSTox_Generic_SID>
-20093
-
-> <DSSTox_FileID>
-94_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C7H10ClNO
-
-> <STRUCTURE_MolecularWeight>
-159.6134
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-complex HCl
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-p-Anisidine.HCl
-
-> <TestSubstance_CASRN>
-20265-97-8
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-parent [104-94-9]
-
-> <STRUCTURE_ChemicalName_IUPAC>
-4-(methyloxy)aniline hydrochloride
-
-> <STRUCTURE_SMILES>
-C1(=CC=C(N)C=C1)OC.[H]Cl
-
-> <STRUCTURE_Parent_SMILES>
-C1(=CC=C(N)C=C1)OC
-
-> <STRUCTURE_InChI>
-InChI=1/C7H9NO.ClH/c1-9-7-4-2-6(8)3-5-7;/h2-5H,8H2,1H3;1H
-
-> <STRUCTURE_InChIKey>
-VQYJLACQFYZHCO-UHFFFAOYAH
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive; multispecies inactive
-
-> <NTP_TechnicalReport>
-TR 116
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/p-ANISIDINE.HCl.html
-
-$$$$
-
-
-
- 10 10 0 0 0 0 0 0 0 0 1 V2000
- 2.6582 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9971 -1.1499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6582 -2.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9971 -3.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6657 -3.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6657 -1.1499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9896 -2.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6553 -1.1499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6553 -3.4542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 2 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 8 9 2 0 0 0 0
- 8 10 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20094
-
-> <DSSTox_CID>
-94
-
-> <DSSTox_Generic_SID>
-20094
-
-> <DSSTox_FileID>
-95_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C7H7NO2
-
-> <STRUCTURE_MolecularWeight>
-137.136
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Anthranilic acid
-
-> <TestSubstance_CASRN>
-118-92-3
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-2-aminobenzoic acid
-
-> <STRUCTURE_SMILES>
-NC1=C(C=CC=C1)C(=O)O
-
-> <STRUCTURE_Parent_SMILES>
-NC1=C(C=CC=C1)C(=O)O
-
-> <STRUCTURE_InChI>
-InChI=1/C7H7NO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,8H2,(H,9,10)/f/h9H
-
-> <STRUCTURE_InChIKey>
-RWZYAGGXGHYGMB-BGGKNDAXCO
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <ActivityScore_CPDBAS_Rat>
-0
-
-> <TD50_Rat_Note>
-no positive results
-
-> <TargetSites_Rat_Male>
-no positive results
-
-> <TargetSites_Rat_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Rat>
-inactive
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive; multispecies inactive
-
-> <NTP_TechnicalReport>
-TR 36
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ANTHRANILIC%20ACID.html
-
-$$$$
-
-
-
- 16 18 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -4.6544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1503 -3.9895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3006 -4.6544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4576 -3.9895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6079 -4.6544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6079 -5.9842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4576 -6.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3006 -5.9842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4576 -2.6597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6079 -1.9947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3006 -1.9947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1503 -2.6597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.9947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.6649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1503 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3006 -0.6649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 12 1 0 0 0 0
- 3 4 2 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 9 1 0 0 0 0
- 5 6 2 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 2 0 0 0 0
- 9 10 2 0 0 0 0
- 9 11 1 0 0 0 0
- 11 12 2 0 0 0 0
- 11 16 1 0 0 0 0
- 12 13 1 0 0 0 0
- 13 14 2 0 0 0 0
- 14 15 1 0 0 0 0
- 15 16 2 0 0 0 0
-M END
-> <DSSTox_RID>
-20095
-
-> <DSSTox_CID>
-95
-
-> <DSSTox_Generic_SID>
-20095
-
-> <DSSTox_FileID>
-96_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C14H8O2
-
-> <STRUCTURE_MolecularWeight>
-208.2121
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-9,10-Anthraquinone
-
-> <TestSubstance_CASRN>
-84-65-1
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-9,10-anthraquinone
-
-> <STRUCTURE_SMILES>
-O=C1C2=C(C=CC=C2)C(=O)C3=C1C=CC=C3
-
-> <STRUCTURE_Parent_SMILES>
-O=C1C2=C(C=CC=C2)C(=O)C3=C1C=CC=C3
-
-> <STRUCTURE_InChI>
-InChI=1/C14H8O2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-8H
-
-> <STRUCTURE_InChIKey>
-RZVHIXYEVGDQDX-UHFFFAOYAA
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TD50_Mouse_Note>
-no positive results
-
-> <TargetSites_Mouse_Male>
-no positive results
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-inactive
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/9,10-ANTHRAQUINONE.html
-
-$$$$
-
-
-
- 33 30 0 0 0 0 0 0 0 0 2 V2000
- 12.0104 -4.5373 0.0000 K 0 3 0 0 0 0 0 0 0 0 0 0
- 2.4492 -4.9297 0.0000 K 0 3 0 0 0 0 0 0 0 0 0 0
- 15.6998 -6.7352 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 14.6637 -7.5987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 13.3920 -6.7352 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 8.4779 -0.6908 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3004 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.1543 -0.6908 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3079 -7.7086 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1461 -7.0178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -7.7086 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 9.8281 -7.8813 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.7994 -7.7086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.0287 -3.2342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.4055 -4.4902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.7414 -3.2185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3379 -5.2123 0.0000 Sb 0 0 0 0 0 0 0 0 0 0 0 0
- 4.3175 -4.4431 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.3018 -5.9816 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 4.7100 -7.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.3898 -5.9816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9973 -7.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9598 -3.2813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2472 -3.2342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.5987 -4.5373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 9.6868 -4.4588 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 8.5250 -5.1966 0.0000 Sb 0 0 0 0 0 0 0 0 0 0 0 0
- 7.4574 -5.9659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 7.8656 -7.1905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.5612 -5.9659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 9.1530 -7.1905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.1107 -2.4649 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.6738 -2.1352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 1 0 0 0 0
- 9 10 1 0 0 0 0
- 10 11 1 0 0 0 0
- 12 31 2 0 0 0 0
- 13 20 2 0 0 0 0
- 14 15 1 0 0 0 0
- 14 16 1 0 0 0 0
- 14 23 1 0 0 0 0
- 15 17 1 0 0 0 0
- 16 18 1 0 0 0 0
- 16 33 2 0 0 0 0
- 17 18 1 0 0 0 0
- 17 21 1 0 0 0 0
- 19 20 1 0 0 0 0
- 20 22 1 0 0 0 0
- 21 22 1 0 0 0 0
- 22 29 1 0 0 0 0
- 23 24 1 0 0 0 0
- 23 25 1 0 0 0 0
- 24 26 1 0 0 0 0
- 24 32 2 0 0 0 0
- 25 27 1 0 0 0 0
- 27 28 1 0 0 0 0
- 27 30 1 0 0 0 0
- 28 29 1 0 0 0 0
- 29 31 1 0 0 0 0
- 30 31 1 0 0 0 0
-M CHG 4 1 1 2 1 19 -1 26 -1
-M END
-> <DSSTox_RID>
-20096
-
-> <DSSTox_CID>
-96
-
-> <DSSTox_Generic_SID>
-39240
-
-> <DSSTox_FileID>
-97_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C8H10K2O15Sb2
-
-> <STRUCTURE_MolecularWeight>
-667.8726
-
-> <STRUCTURE_ChemicalType>
-organometallic
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Antimony potassium tartrate
-
-> <TestSubstance_CASRN>
-28300-74-5
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-dipotassium 5,11-dioxo-2,6,8,12,13,14-hexaoxa-1,7-distibatricyclo[8.2.1.1~4,7~]tetradecane-3,9-dicarboxylate trihydrate
-
-> <STRUCTURE_SMILES>
-[K+].[K+].[O-]C(=O)C2O[Sb]3OC(C(O[Sb]1OC(=O)C2O1)C([O-])=O)C(=O)O3.O.O.O
-
-> <STRUCTURE_InChI>
-InChI=1/2C4H4O6.2K.3H2O.2Sb/c2*5-1(3(7)8)2(6)4(9)10;;;;;;;/h2*1-2H,(H,7,8)(H,9,10);;;3*1H2;;/q2*-2;2*+1;;;;2*+3/p-4/f2C4H2O6.2K.3H2O.2Sb/q2*-4;2m;;;;2m/rC8H6O12Sb2.2K.3H2O/c9-5(10)1-3-7(13)19-22(17-3)16-2(6(11)12)4-8(14)20-21(15-1)18-4;;;;;/h1-4H,(H,9,10)(H,11,12);;;3*1H2/q;2*+1;;;/p-2/fC8H4O12Sb2.2K.3H2O/q-2;2m;;;
-
-> <STRUCTURE_InChIKey>
-WBTCZEPSIIFINA-DYFLWLNICK
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-mouse
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-inactive
-
-> <ActivityScore_CPDBAS_Mouse>
-0
-
-> <TargetSites_Mouse_BothSexes>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-inactive
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-inactive
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ANTIMONY%20POTASSIUM%20TARTRATE.html
-
-$$$$
-
-
-
- 21 21 0 0 0 0 0 0 0 0 1 V2000
- 8.0682 -5.1439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0682 -3.8092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9285 -3.1493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7737 -3.8092 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6190 -3.1493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4642 -3.8092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3095 -3.1493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3095 -1.8146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4642 -1.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6190 -1.8146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1547 -1.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.4799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.8146 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.4949 -2.2945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2230 -3.1493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3777 -3.8092 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3777 -5.1439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 11.5325 -3.1493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 12.6872 -3.8092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 13.8420 -3.1493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 14.9967 -3.8092 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 1 0 0 0 0
- 2 15 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 2 0 0 0 0
- 5 10 1 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 2 0 0 0 0
- 8 9 1 0 0 0 0
- 8 11 1 0 0 0 0
- 9 10 2 0 0 0 0
- 11 12 1 0 0 0 0
- 11 13 1 0 0 0 0
- 11 14 1 0 0 0 0
- 15 16 1 0 0 0 0
- 16 17 2 0 0 0 0
- 16 18 1 0 0 0 0
- 18 19 1 0 0 0 0
- 19 20 1 0 0 0 0
- 20 21 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20097
-
-> <DSSTox_CID>
-97
-
-> <DSSTox_Generic_SID>
-20097
-
-> <DSSTox_FileID>
-98_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C15H23ClO4S
-
-> <STRUCTURE_MolecularWeight>
-334.8587
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-parent
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Aramite
-
-> <TestSubstance_CASRN>
-140-57-8
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <STRUCTURE_ChemicalName_IUPAC>
-2-chloroethyl 2-{[4-(1,1-dimethylethyl)phenyl]oxy}-1-methylethyl sulfite
-
-> <STRUCTURE_SMILES>
-CC(COC1=CC=C(C=C1)C(C)(C)C)OS(=O)OCCCl
-
-> <STRUCTURE_Parent_SMILES>
-CC(COC1=CC=C(C=C1)C(C)(C)C)OS(=O)OCCCl
-
-> <STRUCTURE_InChI>
-InChI=1/C15H23ClO4S/c1-12(20-21(17)19-10-9-16)11-18-14-7-5-13(6-8-14)15(2,3)4/h5-8,12H,9-11H2,1-4H3
-
-> <STRUCTURE_InChIKey>
-YKFRAOGHWKADFJ-UHFFFAOYAL
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat; mouse
-
-> <TD50_Rat_mg>
-96.7
-
-> <TD50_Rat_mmol>
-0.288778520611828
-
-> <ActivityScore_CPDBAS_Rat>
-31
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Rat_BothSexes>
-liver
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <TD50_Mouse_mg>
-158
-
-> <TD50_Mouse_mmol>
-0.471840809272687
-
-> <ActivityScore_CPDBAS_Mouse>
-32
-
-> <TargetSites_Mouse_Male>
-liver
-
-> <TargetSites_Mouse_Female>
-no positive results
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multispecies active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ARAMITE.html
-
-$$$$
-
-
-
- 13 12 0 0 0 0 0 0 0 0 1 V2000
- 4.6515 -2.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3171 -1.1556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.6482 -1.1556 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3137 -2.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.6482 -3.4594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3171 -3.4594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3137 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3278 -2.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6622 -3.4594 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3278 -4.6077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6622 -1.1556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.3477 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3311 -2.3477 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 6 2 0 0 0 0
- 1 8 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 7 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 1 0 0 0 0
- 8 9 1 0 0 0 0
- 8 11 2 0 0 0 0
- 9 10 1 0 0 0 0
- 12 13 1 0 0 0 0
-M END
-> <DSSTox_RID>
-20098
-
-> <DSSTox_CID>
-98
-
-> <DSSTox_Generic_SID>
-20098
-
-> <DSSTox_FileID>
-99_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C8H14ClNO2
-
-> <STRUCTURE_MolecularWeight>
-191.6571
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-complex HCl
-
-> <STRUCTURE_Shown>
-tested chemical
-
-> <TestSubstance_ChemicalName>
-Arecoline.HCl
-
-> <TestSubstance_CASRN>
-61-94-9
-
-> <TestSubstance_Description>
-single chemical compound
-
-> <ChemicalNote>
-parent [63-75-2]
-
-> <STRUCTURE_ChemicalName_IUPAC>
-methyl 1-methyl-1,2,5,6-tetrahydropyridine-3-carboxylate hydrochloride
-
-> <STRUCTURE_SMILES>
-O=C(OC)C1=CCCN(C)C1.[H]Cl
-
-> <STRUCTURE_Parent_SMILES>
-O=C(OC)C1=CCCN(C)C1
-
-> <STRUCTURE_InChI>
-InChI=1/C8H13NO2.ClH/c1-9-5-3-4-7(6-9)8(10)11-2;/h4H,3,5-6H2,1-2H3;1H
-
-> <STRUCTURE_InChIKey>
-LQSWCSYIDIBGRR-UHFFFAOYAO
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-mouse
-
-> <TD50_Mouse_mg>
-39.5
-
-> <TD50_Mouse_mmol>
-0.206097243462413
-
-> <ActivityScore_CPDBAS_Mouse>
-36
-
-> <TD50_Mouse_Note>
-TD50 is harmonic mean of more than one positive test
-
-> <TargetSites_Mouse_Male>
-lung; stomach; vascular system
-
-> <TargetSites_Mouse_Female>
-lung; vascular system
-
-> <ActivityOutcome_CPDBAS_Mouse>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisite active; multisex active
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ARECOLINE.HCl.html
-
-$$$$
-
-
-
- 26 28 0 0 0 0 0 0 0 0 2 V2000
- 4.6012 -5.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9551 -4.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4264 -7.5675 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 4.6012 -3.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6530 -4.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9032 -3.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.5493 -4.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9551 -1.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9032 -5.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0069 -3.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6530 -1.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0069 -5.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.3564 -0.7636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.1244 -7.5675 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 2.2516 -0.7636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.0725 -8.6933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3089 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.8416 -4.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.7147 -5.3648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.5258 -6.2361 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 6.5493 -1.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.4975 -5.3648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 7.8416 -1.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.4975 -3.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.7897 -5.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.4949 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 3 1 0 0 0 0
- 1 9 2 0 0 0 0
- 2 4 2 0 0 0 0
- 2 5 1 0 0 0 0
- 3 14 1 0 0 0 0
- 3 16 2 0 0 0 0
- 4 8 1 0 0 0 0
- 4 6 1 0 0 0 0
- 5 10 2 0 0 0 0
- 5 12 1 0 0 0 0
- 6 7 2 0 0 0 0
- 6 21 1 0 0 0 0
- 7 9 1 0 0 0 0
- 7 18 1 0 0 0 0
- 8 13 1 0 0 0 0
- 8 11 2 0 0 0 0
- 10 11 1 0 0 0 0
- 11 15 1 0 0 0 0
- 12 19 2 0 0 0 0
- 12 20 1 0 0 0 0
- 13 17 1 0 0 0 0
- 15 17 1 0 0 0 0
- 18 22 1 0 0 0 0
- 18 24 2 0 0 0 0
- 21 23 2 0 0 0 0
- 22 25 1 0 0 0 0
- 23 24 1 0 0 0 0
-M CHG 4 3 1 14 -1 20 -1 26 1
-M END
-> <DSSTox_RID>
-20099
-
-> <DSSTox_CID>
-99
-
-> <DSSTox_Generic_SID>
-20099
-
-> <DSSTox_FileID>
-100_CPDBAS_v5c
-
-> <STRUCTURE_Formula>
-C17H10NNaO7
-
-> <STRUCTURE_MolecularWeight>
-363.2536
-
-> <STRUCTURE_ChemicalType>
-defined organic
-
-> <STRUCTURE_TestedForm_DefinedOrganic>
-salt Na
-
-> <STRUCTURE_Shown>
-representative component in mixture
-
-> <TestSubstance_ChemicalName>
-Aristolochic acid, sodium salt (77% AA I, 21% AA II)
-
-> <TestSubstance_CASRN>
-10190-99-5
-
-> <TestSubstance_Description>
-mixture or formulation
-
-> <ChemicalNote>
-structure shown AA I, parent [313-67-7]; AA II 6-Nitrophenanthro(3,4-d)-1,3-dioxole-5-carboxylic acid, sodium salt, AA II parent [475-80-9]
-
-> <STRUCTURE_ChemicalName_IUPAC>
-sodium 8-(methyloxy)-6-nitrophenanthro[3,4-d][1,3]dioxole-5-carboxylate
-
-> <STRUCTURE_SMILES>
-[O-][N+](C1=CC(C(OC)=CC=C4)=C4C2=C1C(C([O-])=O)=CC3=C2OCO3)=O.[Na+]
-
-> <STRUCTURE_Parent_SMILES>
-[O-][N+](C1=CC(C(OC)=CC=C4)=C4C2=C1C(C(O)=O)=CC3=C2OCO3)=O
-
-> <STRUCTURE_InChI>
-InChI=1/C17H11NO7.Na/c1-23-12-4-2-3-8-9(12)5-11(18(21)22)14-10(17(19)20)6-13-16(15(8)14)25-7-24-13;/h2-6H,7H2,1H3,(H,19,20);/q;+1/p-1/fC17H10NO7.Na/q-1;m
-
-> <STRUCTURE_InChIKey>
-BQVOPWJSBBMGBR-KEMNOBITCY
-
-> <StudyType>
-Carcinogenicity
-
-> <Endpoint>
-TD50; Tumor Target Sites
-
-> <Species>
-rat
-
-> <ActivityOutcome_CPDBAS_Mutagenicity>
-active
-
-> <TD50_Rat_mg>
-0.0141
-
-> <ActivityScore_CPDBAS_Rat>
-50
-
-> <TD50_Rat_Note>
-TD50 is harmonic mean of more than one positive test; TD50_Rat_mmol was not calculated for this mixture, but Activiity Score is assigned value of "50" to indicate active
-
-> <TargetSites_Rat_Male>
-stomach
-
-> <TargetSites_Rat_Female>
-stomach
-
-> <ActivityOutcome_CPDBAS_Rat>
-active
-
-> <ActivityOutcome_CPDBAS_SingleCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall>
-active
-
-> <ActivityOutcome_CPDBAS_MultiCellCall_Details>
-multisex active
-
-> <Note_CPDBAS>
-kidney and urinary bladder were additional target sites but experiments too short to meet the inclusion rules of the CPDB; Rat added v2a; Mutagenicity_SAL_CPDB added v3a; TD50_Rat_mmol conversion from mg value not provided due to substance being a mixture
-
-> <ChemicalPage_URL>
-http://potency.berkeley.edu/chempages/ARISTOLOCHIC%20ACID,%20SODIUM%20SALT%20(77%25%20AA%20I,%2021%25%20AA%20I.html
-
-$$$$
diff --git a/test/data/EPAFHM.csv b/test/data/EPAFHM.csv deleted file mode 100644 index 9092abc..0000000 --- a/test/data/EPAFHM.csv +++ /dev/null @@ -1,618 +0,0 @@ -"STRUCTURE_SMILES","LC50_mmol" -"C1=CC(C=O)=CC(OC)=C1OCCCCCC",1.13E-02 -"C1(OC)=C([N+]([O-])=O)C(C=O)=CC(Br)=C1O",2.66E-01 -"CCCCCCCCOC(=O)C1=CC=CC(C(=O)OCCCCCCCC)=C1", -"C1=CC(Cl)=CC=C1OC2=C([N+](=O)[O-])C=CC=C2",7.69E-03 -"CC1=C(NC=O)C=CC=C1Cl",2.75E-01 -"CCCCOC(=O)C1=CC=CC(C(=O)OCCCC)=C1",3.23E-03 -"C(C1=CC=CC=C1)(C2=CC=CC=C2)(O)C#C",5.33E-02 -"CCCSCCSCCC",4.22E-02 -"CCCCCCCCOC(=O)C1=CC=C(C(=O)OCCCCCCCC)C=C1", -"OCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCOC(=O)C2=CC=CC=C2C(=O)OCCCCO", -"CCCSCCCCSCCC",1.45E-02 -"C1([N+](=O)[O-])=CC=C(C)C=C1OP(=O)(OC2=C([N+](=O)[O-])C=CC(C)=C2)OC3=C([N+]([O-])=O)C=CC(C)=C3", -"C1=C([N+]([O-])=O)C=CC=C1P(=O)(C2=CC([N+](=O)[O-])=CC=C2)C3=CC([N+](=O)[O-])=CC=C3", -"ClCCOC(=O)NC1CCCCC1",1.70E-01 -"O=C1C(C2=CC=CC=C2)(C(=O)NC(=O)N1)CC",2.08E+00 -"OC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-]",5.92E-02 -"NC(=O)OCC",5.88E+01 -"[O-]C(C1=CC=CC=C1O)=O.[Na+]",1.25E+01 -"C1=CC=CC=C1C(=O)N",5.46E+00 -"CC[N+](CC)(CC)CC1(=CC=CC=C1).[Cl-]",7.07E-01 -"CN(C)N",1.31E-01 -"CC(C(C(NC([O-])=N1)=O)(C1=O)CC)CCC.[Na+]",1.99E-01 -"N1C(=O)C(CC)(CCC(C)C)C(=O)NC1=O",3.77E-01 -"O=C1C2=C(N=CN2C)N(C(=O)N1C)C",7.78E-01 -"C1=CC=C2C(=C1)C(=O)C(C)=CC2=O",6.39E-04 -"OC1=C(Cl)C(Cl)=C(Cl)C=C1Cl",4.44E-03 -"OC1=CC(C)=C(Cl)C=C1",3.84E-02 -"[H]Cl.C1=CC=CC=C1CC2=NCCN2",1.80E+00 -"O=S(O)(O)=O.C1(=CC=CC=C1CC(N)C).C2=CC=CC=C2CC(N)C",7.82E-02 -"O(CC)CC",3.45E+01 -"O=C2N5[C@@]3([H])[C@@]1([H])[C@](C[C@]4([H])N(C7)CC[C@]34C6=C5C=CC=C6)([H])C7=CCO[C@]([H])1C2.O=C9N%12[C@@]%10([H])[C@@]8([H])[C@](C[C@]%11([H])N(C%14)CC[C@]%10%11C%13=C%12C=CC=C%13)([H])C%14=CCO[C@]([H])8C9.O=S(O)(O)=O",1.11E-03 -"NC1=CC=CC=C1",1.13E+00 -"O=C(OC1=C2C(=CC=C1)C=CC=C2)NC",4.35E-02 -"CCO",3.19E+02 -"C1(=NC=CC=C1C2CCCN2C).OS(O)(=O)=O",5.30E-02 -"C1(O)=CC=CC=C1C(=O)N",7.36E-01 -"O=C1NC(=O)NC=C1", -"CCCCCC=O",1.75E-01 -"O=C1OC2=CC=CC=C2C(O)=C1CC3=C(O)C4=CC=CC=C4OC3=O",1.52E-02 -"C1(C=O)=CC=C(OC2=CC=CC=C2)C=C1",2.32E-02 -"CO",9.17E+02 -"OC(C)C",1.44E+02 -"CC(=O)C",1.23E+02 -"ClC(Cl)Cl",5.92E-01 -"CS(=O)C",4.35E+02 -"ClC(C(Cl)(Cl)Cl)(Cl)Cl",6.00E-03 -"OC1=C(C=C(C(=C1CC2=C(C(=CC(=C2Cl)Cl)Cl)O)Cl)Cl)Cl",5.16E-05 -"C1=CC(=CC=C1N)C(=O)CC",9.79E-01 -"OCCC",7.57E+01 -"CCCCO",2.33E+01 -"CCCCCO",5.36E+00 -"C1=CC=CC=C1",2.25E-01 -"CC(Cl)(Cl)Cl",3.55E-01 -"[S-]C1=NC(C(C(C)CCC)(CC)C(N1)=O)=O.[Na+]",9.91E-02 -"CC#N",4.01E+01 -"CC=O",7.67E-01 -"ClCCl",3.89E+00 -"IC(I)I",7.42E-03 -"[N+](C)(C)(C)C.[Cl-]",4.22E+00 -"CC(C)(C)O",8.65E+01 -"C(F)(F)(F)CO",1.19E+00 -"CC(=O)C(C)(C)C",8.69E-01 -"ClC(C(Cl)Cl)(Cl)Cl",3.72E-02 -"CC1(C)NC(=O)NC1=O",1.29E+02 -"CCC(O)(C)CC",6.58E+00 -"C#CC(O)(C)CC",1.24E+01 -"C1CCCC(C#C)(O)C1",2.06E+00 -"CCCCOCCOP(=O)(OCCOCCCC)OCCOCCCC",2.81E-02 -"OCC(C)C",1.93E+01 -"CC(Cl)CCl",1.12E+00 -"NCC(N)C",1.36E+01 -"CC(O)CC",4.95E+01 -"CCC(=O)C",4.47E+01 -"OC(C)CN",3.36E+01 -"ClC(CCl)Cl",6.12E-01 -"ClC(=CCl)Cl",3.36E-01 -"CC(=O)OC",4.82E+00 -"ClC(C(Cl)Cl)Cl",1.21E-01 -"C1(C)(C)CCCC(C)=C1C=CC(C)=O",2.65E-02 -"ClC1=C(O)C(Cl)=CC(=C1)C(C2=CC(Cl)=C(O)C(=C2)Cl)(C)C",3.63E-03 -"C(C1C=CC(=CC=1)O)(CC)(C)C",1.58E-02 -"C1CC(CCC1(N)C)C(C)(N)C",3.83E-01 -"ClC(Cl)C1=C(Cl)C=CC=C1Cl",4.22E-03 -"C1=CC=C2C=CC=C3C2=C1CC3",1.12E-02 -"CC1=CNC2=C1C=CC=C2",6.74E-02 -"O=C([C@](C(C=C4OC)=C(C=C4OC)OC3)([H])[C@]3([H])O2)C(C=C5)=C2C1=C5O[C@@H]([C@@](C)=C)C1",1.32E-05 -"O=C2C1=NC3=C(C=C(C)C(C)=C3)N(C[C@H](O)[C@H](O)[C@H](O)CO)C1=NC(N2)=O", -"C1=CC=CC=C1OC(=O)C2=CC=CC=C2C(=O)OC3=CC=CC=C3",2.51E-04 -"O=C1C2=C(C=CC=C2)C(=O)C3=C1C=CC=C3", -"CCOC(=O)C1=CC=CC=C1C(=O)OCC",1.43E-01 -"C1=CC=C(C(=O)OCCCC)C(=C1)C(=O)OCCCC",3.5900E-03 -"CCC1=C(Br)C(Br)=C(Br)C(Br)=C1Br", -"O=C1C2=C(C=CC=C2)N=NN1CSP(=S)(OC)OC",2.02E-04 -"C1=CC=CC=C1NC(=O)C2=C(O)C=CC=C2",1.85E-02 -"Cl\C(Cl)=C(Cl)/C(Cl)=C(Cl)\Cl",3.45E-04 -"OC1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl",9.12E-04 -"OC1=C(C=C(C=C1Cl)Cl)Cl",2.48E-02 -"OC1=CC(C(F)(F)F)=C([N+]([O-])=O)C=C1",4.41E-02 -"C1(N)=CC=CC=C1C(=O)N",2.90E+00 -"OC1=C([N+]([O-])=O)C=CC=C1",1.15E+00 -"OC1=C(C=C(C=C1C(CC)C)[N+](=O)[O-])[N+](=O)[O-]",2.23E-03 -"O=CC1=CC=CC=C1O",1.88E-02 -"OC1=CC=CC2=CC=CC=C12",3.21E-02 -"OC1=C(C=CC=C1)C2=CC=CC=C2",3.61E-02 -"C12C(=O)C3=C(OC=1C=CC=C2)C=CC=C3", -"BrC1=C(O)C(C=O)=CC(Br)=C1",3.04E-03 -"C1=C2C(=CC=C1)C=CC=C2",4.79E-02 -"N1=CC=CC2=C1C=CC=C2",6.02E-01 -"CCN(CC)C1CCCCC1",1.38E-01 -"CCN(CC)C1=CC=CC=C1",1.10E-01 -"OCCN(CC)C1=CC(C)=CC=C1",2.95E-01 -"C1CCCCC1C2CCCCC2", -"C1=CC=CC=C1C(=O)CC(=O)C",6.78E-03 -"C1=CC(N)=CC=C1C(=O)OCC",2.16E-01 -"O1COC2=CC=C(/C=C/C=C/C(=O)N3CCCCC3)C=C12",2.75E-02 -"C1(C=O)=C(O)C=C(O)C=C1",9.50E-02 -"CC1=C(C)C=CC=C1",1.54E-01 -"OC1=C(C)C=CC=C1",1.29E-01 -"ClC1=C(C=CC=C1)Cl",6.40E-02 -"NC1=C(Cl)C=CC=C1",4.50E-02 -"CC1=C(F)C=CC=C1",1.76E-01 -"OC1=CC=CC=C1Cl",8.87E-02 -"CC1=C(C=CC(=C1)C)C",6.42E-02 -"CC1=CC(Cl)=C(Cl)C=C1",1.81E-02 -"NC1=CC(Cl)=C(Cl)C=C1",4.67E-02 -"C=C(C)C(=O)OCC=C",7.85E-03 -"BrCC(Br)CO",3.26E-01 -"CC(C=O)CC",1.16E-01 -"ClCC(Cl)CCl",3.91E-01 -"CCC(=O)CC",1.79E+01 -"CCC(C)=NO",9.68E+00 -"OCCN(C(C)C)C(C)C",1.38E+00 -"NC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1",8.08E-02 -"OC1=CC=C(Cl)C=C1CC2=CC(Cl)=CC=C2O",1.15E-03 -"C[N+](C1=CC=CC=C1)(C)C.[I-]",9.24E-01 -"C(C1=CC=C(O)C=C1)(C)(C)C",3.43E-02 -"C1=CC=CC=C1C(C)C",5.26E-02 -"C1=CC=CC=C1C(=O)C",1.35E+00 -"O=[N+](C1=CC=CC=C1)[O-]",9.67E-01 -"C1=C(C(=O)C)C=C(N)C=C1",2.83E+00 -"CC1=CC([N+](=O)[O-])=CC=C1",1.87E-01 -"CN(C)C1=CC=C(C)C=C1",3.62E-01 -"O=[N+](C1=CC=C(C=C1)N)[O-]",9.05E-01 -"OC1=CC=C([N+](=O)[O-])C=C1",3.22E-01 -"CN(C)C1=CC=C(C=O)C=C1",3.06E-01 -"[O-][N+](=O)C1=CC=C([N+]([O-])=O)C=C1",4.22E-03 -"CCN(CCO)CC",1.52E+01 -"CCC1=CC=CC=C1",9.89E-02 -"NCC1=CC=CC=C1",9.52E-01 -"O=CC1=CC=CC=C1",9.30E-02 -"C1=CC=C(NC)C=C1",9.33E-01 -"ON=C1CCCCC1",1.84E+00 -"N1=C(C#N)C=CC=C1",6.97E+00 -"N1=C(CC)C=CC=C1",3.86E+00 -"CC1(C)OCC(CO)O1",1.26E+02 -"C1N2CN3CN(C2)CN1C3",3.55E+02 -"C1=CC=CC=C1OC2=CC=CC=C2",2.35E-02 -"CCNC1=CC(C)=CC=C1",3.66E-01 -"CCCN(CCC)CCC",3.55E-01 -"OCCN(CCO)CCO",7.91E+01 -"C1=CC=CC=C1CCC(C)(C)O",4.04E-01 -"C1=CC(C)=CC=C1SSC2=CC=C(C)C=C2", -"OCCN1CCNCC1",4.92E+01 -"CN(C)CC1=CC=CC=C1",2.80E-01 -"C1(=CC=C(C=C1)O)NC(C)=O",5.39E+00 -"NC1=CC=C(CCCC)C=C1",6.80E-02 -"CCCCCCCCCC1=CC=C(O)C=C1",6.35E-04 -"NC1=CC=C(CCCCCCCCCCCC)C=C1", -"CCC(CCCC)CO",2.17E-01 -"ClC1=CC=C(C=O)C=C1",1.56E-02 -"N1=C(C)C=CC(CC)=C1",6.69E-01 -"CC(=O)CCCN(CC)CC",2.14E+00 -"CCOC(=O)CC(=O)OCC",9.18E-02 -"OC1=C(C)C=C(C)C=C1",1.36E-01 -"CCCCOC(=O)C=CC(=O)OCCCC",2.76E-03 -"CCCCOC(=O)CCCCC(=O)OCCCC",1.41E-02 -"NC1=CC=C(Br)C=C1",2.76E-01 -"CC1=CC=C(C)C=C1",8.35E-02 -"OC1=CC=C(C)C=C1",1.53E-01 -"NC1=CC=C(C=C1)Cl",2.46E-01 -"OC1=CC=C(Cl)C=C1",4.75E-02 -"NC1=CC=C(C)C=C1",1.49E+00 -"C=CC(=O)OCC(C)C",1.64E-02 -"BrCCC",5.47E-01 -"C=CC=O",3.03E-04 -"ClCCCl",1.37E+00 -"ClCCO",6.67E-01 -"CCCN",5.21E+00 -"CCC#N",2.76E+01 -"ClCC#N",1.78E-02 -"NCCN",3.66E+00 -"C=CCO",5.51E-03 -"C(O)C#C",2.64E-02 -"CC=NO",1.29E+00 -"C[C@](CC(O)C)(C)O",9.05E+01 -"CC(C)(C)CC(C)(C)N",1.90E-01 -"CC(C)(C)SC(C)(C)C",1.99E-01 -"CCCC(=O)C",1.44E+01 -"CC(=O)CC(C)C",5.21E+00 -"CC(C)OC(C)C",7.69E+00 -"CC1=CC=CC=C1",3.68E-01 -"N1=CC=C(C)C=C1",4.33E+00 -"ClC1=CC=CC=C1",1.50E-01 -"C1CCCCC1O",7.03E+00 -"O=C1CCCCC1",6.33E+00 -"OC1=CC=CC=C1",3.47E-01 -"N1=CC(C)=CC=C1",1.55E+00 -"CN1CCNCC1",2.30E+01 -"N1=C(C)C=CC=C1",9.63E+00 -"N1CC(C)NCC1",2.24E+01 -"CC(=O)OCCC",5.87E-01 -"BrCCCBr",1.04E-02 -"BrCCCC",2.68E-01 -"CCCCN",3.66E+00 -"C=CCC#N",2.71E+00 -"NCCCN",1.61E+01 -"N#CCC#N",8.48E-03 -"COCCN",6.98E+00 -"CCNCC",1.17E+01 -"N1C=CC=C1",3.13E+00 -"C1CCCO1",3.00E+01 -"C1=COC=C1",8.96E-01 -"CC(C)(C)SSC(C)(C)C",7.68E-03 -"CC(=O)CCC(C)C",1.39E+00 -"CCOC(=O)CCCCCCCCC(=O)OCC",1.05E-02 -"CCCCCC(=O)C",1.15E+00 -"CCCCCC",2.90E-02 -"ClCCCCCl",4.06E-01 -"CCCCCN",2.03E+00 -"CCCCC=O",1.50E-01 -"C(O)C#CC(O)",6.23E-01 -"CCNCCO",1.66E+01 -"C1CCCCC1",5.38E-02 -"N1=CC=CC=C1",1.26E+00 -"C1OCOCO1",6.61E+01 -"O=C(CC/C=C(C)/C)C",6.79E-01 -"CC(=O)CCCCCC",2.81E-01 -"CC(=O)OCCOCC",3.19E-01 -"BrCCCCCC",2.09E-02 -"CCCCCCN",5.59E-01 -"CCCCCCO",9.56E-01 -"OCCNCCO",4.48E+01 -"OCCOCCO",7.09E+02 -"CCCSCCC",1.84E-01 -"CCCCCCCN",1.89E-01 -"N#CCCCCC#N",1.79E+01 -"CCCCCCCO",2.97E-01 -"BrCCCCCCCC",4.34E-03 -"CCCCCCCCN",4.02E-02 -"CCCCCCCCO",1.04E-01 -"CCOCCOCCO",1.98E+02 -"CCCCCCCCC(=O)O",6.57E-01 -"CCCCCCCCCC(=O)C",8.81E-03 -"CCCCCCCCCN",1.50E-02 -"OCCOCCOCCO",4.59E+02 -"CCCCCCCCCCO",1.52E-02 -"CCCCCCCCCCCCCO", -"CC(C)OC1=CC=CC=C1OC(=O)NC",4.21E-02 -"CC(O)(C)C#C",3.91E+01 -"C(Cl)(Cl)(Cl)CO",2.00E+00 -"OC(C1=CC=C(C=C1)Cl)(C2=CC=C(C=C2)Cl)C(Cl)(Cl)Cl",1.67E-03 -"C1=CC=CC=C1OP(=O)(OC2=CC=CC=C2)OC3=CC=CC=C3",2.66E-03 -"S(=O)(C)C1=CC=C(OP(=S)(OCC)OCC)C=C1",1.40E-01 -"CC(C=NOC(=O)NC)(SC)C",4.52E-03 -"O=C(C1=C(C=CC=C1)C(=O)OCC(CCCC)CC)OCC(CCCC)CC", -"CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC", -"C1=CC=CC(O)=C1C(=O)OC2=CC=CC=C2",5.51E-03 -"C1=CC=CC(O)=C1C(=O)OCC",1.22E-01 -"OC1=C(Br)C=C(Br)C=C1Br",1.98E-02 -"OC1=C(C=C(C=C1)N)[N+](=O)[O-]",2.35E-01 -"C1=CC=CC=C1C(=O)C2=CC=CC=C2",8.07E-02 -"C1=CC=CC=C1N(CCO)CCO",4.06E+00 -"C1=CC(=CC=C1C=O)N(CC)CC",1.35E-01 -"OC1=C(C=CC=C1)O",8.37E-02 -"ClC1=C(Cl)C=C(Cl)C=C1",1.65E-02 -"ClC1=C(C=CC(=C1)Cl)O",4.75E-02 -"CC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-]",1.33E-01 -"O=CC1=CC(OCC)=C(O)C=C1",5.27E-01 -"C1(C=O)=CC(OC)=C(O)C=C1",5.51E-01 -"CN(C1=CC=CC=C1)C",5.29E-01 -"ClC1=CC([N+](=O)[O-])=CC=C1",1.19E-01 -"O=C(C(SP(=S)(OC)OC)CC(=O)OCC)OCC",4.27E-02 -"NC1=C(Cl)C=C([N+]([O-])=O)C=C1",1.16E-01 -"C1(C=O)=CC=C(C(C)C)C=C1",4.47E-02 -"C1=CC=CC=C1NC2=CC=CC=C2",2.24E-02 -"C1=CC=CC=C1OCCO",2.49E+00 -"OC1=CC=C(CC)C=C1",8.51E-02 -"CC(C=O)CCC",1.88E-01 -"CC(=O)CC(=O)C",1.35E+00 -"CCCCCC(=O)OCC",6.17E-02 -"CCCC=O",2.04E-01 -"CC(=O)OCCCC",1.55E-01 -"C1COCCO1",1.17E+02 -"CCCCCCCCCCCCN",5.56E-04 -"CCCCCCCCCCCCCC=O", -"CCCCOP(=O)(OCCCC)OCCCC",3.56E-02 -"O=C(CC(=O)C1)CC1(C)C",8.20E+01 -"OC(C)CCl",2.59E+00 -"ClC(=C(Cl)Cl)Cl",9.95E-02 -"CC(C1=CC=CC=C1)(O)C#C",7.73E-01 -"OC1=C(C=C(C=C1C(C)(C)C)C)C(C)(C)C",1.65E-03 -"O=S(C1=CC=CC=C1C([N-]2)=O)2=O.[Na+].[O]",8.20E+01 -"C1=CC=CC2C3=CC=CC=C3OC1=2",8.92E-03 -"C1=CC=CC=C1OC(=O)C2=C(O)C=C(N)C=C2",2.08E-02 -"CCN(CC)C(=O)C1=CC=CC(C)=C1",5.75E-01 -"CCC([O-])=O.[Na+]",4.99E+01 -"NCCN1CCNCC1",1.70E+01 -"CCCCOC(=O)CCC(=O)OCCCC",1.94E-02 -"CCOC(=O)CCCCC(=O)OCC",8.99E-02 -"OCCN",3.39E+01 -"CC(=O)OCC",2.61E+00 -"N1CC(C)OC(C)C1",3.36E+00 -"CCC1=CC(CC)=CC=C1",3.09E-02 -"ClCCCCl",9.82E-01 -"CCCCCC(O)=O",2.76E+00 -"CC(=O)OCCCCCC",3.05E-02 -"CCCCOCCCC",2.48E-01 -"CCCCCCCCCO",3.95E-02 -"CCCCCCNCCCCCC",4.21E-03 -"OCCCCCCCC\C=C/CCCCCCCC", -"C1(C=O)=C(O)C(OC)=CC=C1",1.58E-02 -"OC1=CC(OC)=CC=C1",5.96E-01 -"COC1=CC=C(C=C1)O",8.86E-01 -"COC1=CC=C(OC)C=C1",8.47E-01 -"C1=COC2=C1C=CC=C2",1.19E-01 -"C(CN(C1)C2)N(C1)C2",1.54E+01 -"C(CC(CC1CC23)C2)(C1)C3",2.06E-03 -"CCOP(OCC)(=S)SCCSCC",9.95E-03 -"[O-]C(N1)=NC(C(C(CCC)C)(CC=C)C1=O)=O.[Na+]",9.07E-02 -"BrC1=C(C)NC(=O)N(C(C)CC)C1=O",7.12E-01 -"OC1=C([N+](=O)[O-])C=CC([N+]([O-])=O)=C1",1.82E-02 -"ClC1=C(C=CC(=C1)NC(=O)N(C)C)Cl",6.09E-02 -"C1=CC(F)=CC=C1OC2=CC=C(F)C=C2",5.48E-03 -"S=P(OC1=NC(=NC(=C1)C)C(C)C)(OCC)OCC",3.07E-02 -"FC1=CC=C([N+](=O)[O-])C=C1",2.01E-01 -"C(F)(F)(F)C1=CC(C#N)=CC=C1",2.79E-01 -"NC1=CC=C(F)C=C1",1.52E-01 -"C1(C=O)=C(Cl)C=CC=C1F",5.93E-02 -"NC1=C(C(F)(F)F)C=C(F)C=C1",1.65E-01 -"C1(C=O)=C(F)C=CC=C1",1.09E-02 -"C1=CC=CC(=C1C(F)(F)F)C#N",2.47E-01 -"C1(C=O)=CC(C(F)(F)F)=CC=C1",5.31E-03 -"CNC1=CC=C(F)C=C1",3.07E-01 -"CCCCCCC(=O)CCCCCC", -"O[C@H]1[C@@]([C@@](C)2C)(C)CC[C@H]2C1",4.10E-01 -"O=C(CC1C2)C(C2)(C1(C)C)C",1.12E-01 -"CC2(C)OC1(C)CCC2CC1",6.61E-01 -"O=[C@](O)[C@@]1(C)[C@]([C@]([C@]([H])2CC3)(C)CCC1)([H])CCC2=C\C3=C(C)/C",4.93E-03 -"N1=C(C2=CC=CC=C2)NC(C3=CC=CC=C3)=C1C4=CC=CC=C4", -"C1COC2=CC=CC=C12",6.80E-01 -"O[C@H]1[C@H](CC2)C[C@H]2C1",2.03E+00 -"C1C2C=CC1CC2",1.06E-01 -"N1=C(C(=O)O)C=CC=C1C(=O)O",1.93E+00 -"N1=CC(C=O)=CC=C1",1.53E-01 -"CCCCC(=O)CCCC",2.18E-01 -"C=C(C)C(C)=C",8.41E-02 -"O=[C@](O)[C@@]3(C)[C@@]1([H])[C@@](CCC3)(C)[C@]2([H])C(C=[C@@]([C@@H](C)C)CC2)=CC1",7.87E-03 -"C1=CC=CC=C1C2=CC(=O)C3=CC=CC=C3O2",1.57E-02 -"OC1=C(C)C=C(C)C=C1C",9.54E-02 -"C1(C#N)=CC=CC=C1C",3.82E-01 -"C1(C=O)=C(C)C=CC=C1",4.40E-01 -"C1(=CC=CC=C1)C(=O)[O-].[Na+]",3.36E+00 -"OC1=C(C)C=C([N+]([O-])=O)C=C1[N+]([O-])=O",8.73E-03 -"C1=CC=CC=C1CCCCC",1.15E-02 -"O=C(OC(C)(C)C)C",2.82E+00 -"ClC1=CC(Cl)=CC=C1",5.46E-02 -"Cl\C=C\CCl",2.15E-03 -"CCCCSCCCC",2.45E-02 -"C1(O)=CC(OC)=CC=C1C(=O)C",4.18E-01 -"C1(C=O)=C([N+]([O-])=O)C=CC=C1",9.53E-02 -"O=CC1=CC=C([N+](=O)[O-])C=C1",6.68E-02 -"CC(=O)C(C)C",1.00E+01 -"OC1=C([N+]([O-])=O)C=CC=C1[N+]([O-])=O",2.16E-01 -"BrC1=C(Br)C=CC=C1",1.72E-02 -"C=CCNC1=CC=CC=C1",2.70E-01 -"NC1=CC=C(CC)C=C1",6.02E-01 -"CC(C)CC=O",3.77E-02 -"CCCCC(=O)C",4.27E+00 -"CC=CC=CC",2.43E-01 -"CCCCCCCCCCCC(=O)C",1.81E-03 -"C1=CC=CC=C1[Sn](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4", -"[H][C@]1(CC2)C(C)(C)CCC[C@@](C)1[C@@H](CC[C@@](O)(C)C=C)C2=C",4.13E-04 -"CC[Sn](CC)(CC)CC",4.68E-05 -"CC(C)C(C)N",3.26E+00 -"CC(C)C(O)C(C)C",1.40E+00 -"C1=CC=CC=C1N(C2=CC=CC=C2)C3=CC=CC=C3", -"C1=CC=CC=C1N(C2=CC=CC=C2)C=O",1.54E-01 -"CCOC(=O)C(CC1=CC=CC=C1)C(=O)OCC",2.17E-02 -"OC1=C(Br)C(Br)=C(Br)C(Br)=C1Br",1.90E-04 -"OC1=C(I)C=C(I)C=C1I",2.56E-03 -"C1(C=O)=C(OC)C=C(OC)C=C1",1.21E-01 -"OC1=C(NC(=O)C)C=CC=C1",1.79E-01 -"NC1=C(Cl)C=C(C)C=C1",2.54E-01 -"NC1=C([N+]([O-])=O)C=C(OCC)C=C1",1.43E-01 -"C1=CC([N+](=O)[O-])=CC=C1C(=O)OC",1.31E-01 -"C1=CC([N+]([O-])=O)=CC=C1C(=O)N",8.01E-01 -"C1=CC=CC=C1OC2=CC=C([N+](=O)[O-])C=C2",1.23E-02 -"C1=CC=C(CS(=O)CC2=CC=CC=C2)C=C1",3.48E-01 -"OC1=CC(NC(=O)C)=CC=C1",7.48E+00 -"OCCN1CCOCC1",2.07E+01 -"ClCC1=CC=C(CCl)C=C1",2.23E-04 -"IC1=CC=C(I)C=C1", -"O1C(C)=CC=C1C",7.40E-01 -"ClCCCCCCl",1.79E-01 -"BrCCCCCCC",8.21E-03 -"CCCSSCCC",1.70E-02 -"N#CCCCCCCC#N",3.88E+00 -"NC1=C(Cl)C(Cl)=C(Cl)C=C1",1.85E-02 -"C1(C=O)=C(O)C=CC(Cl)=C1",4.92E-03 -"OC1=CC=C(CCC)C=C1",8.08E-02 -"C1(C=O)=C(F)C(F)=C(F)C(F)=C1F",5.61E-03 -"C(Cl)(Cl)C(=O)N",1.88E+00 -"CCCCCCC(C)N",4.02E-02 -"CC(=O)CCCCCCCC",3.09E-02 -"CCCCCOCCCCC",1.98E-02 -"CC1=COC=N1",1.67E+01 -"CC1=NC=CN1",3.48E+00 -"O=C1C3CC2CC1CC(C3)C2",4.05E-01 -"CCCCCCC1OC(=O)CC1",1.06E-01 -"C1(C=O)=C(O)C=C(OC)C=C1OC",1.47E-02 -"C1=C(Cl)C(Cl)=CC=C1NC(=O)CC",3.94E-02 -"OC1=C(C=C(C=C1C(C)(C)C)C(C)(C)C)C(C)(C)C",2.32E-04 -"C=CC(Cl)C(Cl)",6.54E-02 -"C(=O)N(CCCC)CCCC",5.68E-01 -"C(O)C#CC",1.44E-01 -"CC(C)=CC=C(C)C",3.43E-02 -"NC13CC(CC(C3)C2)CC2C1",1.65E-01 -"N1=C(O)C(C#N)=C(C)C=C1C",1.06E+00 -"NC1=C(F)C(F)=C(F)C(F)=C1F",2.03E-01 -"ClC1=CC=C(SCSP(=S)(OCC)OCC)C=C1",7.00E-04 -"C1=CC=CC=C1P(=O)(C2=CC=CC=C2)C3=CC=CC=C3",1.93E-01 -"C1=CC(N(C)C)=CC=C1P(=O)(C2=CC=C(N(C)C)C=C2)C3=CC=C(N(C)C)C=C3", -"C=CC(=O)OCCO",4.14E-02 -"C#CC(O)CCCCC",3.27E-03 -"CCCCCCCC(=O)C",1.07E-01 -"Cl[C@@H]1CCCC[C@H]1Cl",1.20E-01 -"C1=CC=CC=C1OC2=CC=C(O)C=C2",2.66E-02 -"C=C(C)C(=O)OCCO",1.74E+00 -"C1(Br)=CSC=C1",3.80E-02 -"O=CC1=C(Cl)C=C(Cl)C=C1",1.03E-02 -"C1=CC=CC=C1SSC2=CC=CC=C2",5.04E-04 -"C1(=CC=CC=C1)/C=C/C=C/C2=CC=CC=C2", -"O=C(OCC)C1=CC(N)=CC=C1.OS(C)(=O)=O",3.02E-01 -"C(F)(F)(F)C(O)C(F)(F)(F)",1.45E+00 -"C=CC(O)CC=C",3.88E-01 -"C(O)CC#C",5.15E-01 -"CC\C=C/CCO",3.80E+00 -"CC/C=C/CCO",2.71E+00 -"CN1C(C(=O)C)=CC=C1",1.28E+00 -"N1=CC=C(C2=CC=CC=C2)C=C1",1.04E-01 -"C1=CC=CC=C1S(=O)C2=CC=CC=C2",4.32E-01 -"C1=CC=CC=C1C2=CC=C(C3=CC=CC=C3)O2", -"C=CC(=O)OCC(O)C",2.60E-02 -"N1=C(N)C=CC(Br)=C1",1.02E+00 -"CCOP(=O)(CC1=CC=CC=C1)OCC",1.47E+00 -"CCCCCCCCCCCC(=O)N", -"N1=CC=C(C(=O)C)C=C1",1.39E+00 -"C1=CC(Cl)=CC=C1C(=O)OC",6.40E-02 -"CCCCOC1=CC=CC=C1",3.80E-02 -"C1=CC(C#N)=CC=C1C(=O)OC",2.90E-01 -"OC1=C(O)C(Cl)=C(Cl)C(Cl)=C1Cl",5.12E-03 -"C1=C(C(=O)CBr)C(OC)=CC=C1OC",2.55E-03 -"CCCC[Sn](CCCC)(CCCC)CCCC",1.30E-04 -"C#CC(C)(O)C(C)C",1.83E+00 -"C1=CC=C2C3=CC=CC=C3N(C2=C1)C=C",1.66E-05 -"C1=C(N)C=CC=C1OCC2=CC=CC=C2",4.59E-02 -"O=C(NC)OC1=CC=CC(C2)=C1OC2(C)C",3.81E-03 -"CC(OC)(C)C",7.62E+00 -"C=CCCCCCCC=C",2.10E-03 -"C1=CC(O)=CC=C1/N=N/C2=CC=CC=C2",6.00E-03 -"C1=C(I)C(O)=C(I)C=C1C#N",1.83E-02 -"C1=C(Br)C(O)=C(Br)C=C1C#N",4.55E-02 -"O=[C@](O)[C@@]3(C)[C@@]2([H])[C@@](CCC3)(C)C1=C(CC2)C=[C@@]([C@@H](C)C)C=C1",6.99E-03 -"C=CCC1=CC=CC=C1O",1.12E-01 -"C1(C=O)=C(O)C=CC(Br)=C1",6.46E-03 -"C=C(CCl)C(Cl)",1.52E-03 -"C1=C(Cl)C(O)=C(Cl)C=C1C#N",1.29E-01 -"CCCCOC(=O)C1=CC=C(C(=O)OCCCC)C=C1",2.12E-03 -"C1=CC(O)=CC=C1OC2=CC=C(O)C=C2",2.86E-02 -"C1(Cl)=CC=CC(Cl)=C1C(=O)N",2.47E+00 -"CCCCCCCCCCN",6.55E-03 -"CNC(=O)OC1=CC(C)=C(N(C)C)C=C1",9.36E-03 -"N1=C(Br)NC(Br)=C1Br",2.01E-02 -"CCOP(=S)(OC1=CC=C(C=C1)[N+](=O)[O-])C2=CC=CC=C2",2.43E-04 -"OC(C)CC#C",4.17E-01 -"OC1=C(O)C=C(Cl)C=C1",1.09E-02 -"C1(O)=CC(O)=CC=C1C(=O)OC",2.72E-01 -"C=CC(=O)OCCCCCCCCCCCC", -"N1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl",1.87E-03 -"C1[C@H](C[C@H]([C@@H](C1)C(C)C)O)C",1.21E-01 -"C1=CN=CN1S(=O)(=O)C2=CC=C(C)C=C2",1.88E-01 -"C1=C(C(=O)C)C(Cl)=CC(Cl)=C1",6.89E-02 -"CCCCCCCCC#N",3.77E-02 -"NC1=CC(C(F)(F)F)=C(F)C=C1",1.68E-01 -"[C@H]1(CCCC[C@H]1O)C2=CC=CC=C2",2.52E-01 -"C=C(C)C(=O)OCCOCC",1.75E-01 -"OC1=C(C)C(C)=CC=C1C",6.02E-02 -"CCCCCCCCCCCC#N",2.37E-03 -"C1(OC)=CC=CC=C1C(=O)N",7.94E-01 -"C1(Cl)=CC(Cl)=CC=C1C(=O)N",5.03E-01 -"C=C(C)C(=O)OCC1OCCC1",2.04E-01 -"OC1=C(OC)C=C(Cl)C(Cl)=C1",2.32E-02 -"C=C(C)C(=O)OCC1=CC=CC=C1",2.65E-02 -"C=CC(=O)OCCCCCC",7.10E-03 -"CC(C)(C)C1=CC=C(OC(=O)NC)C=C1",4.82E-02 -"N1=C(CCN)C=CC=C1", -"C1=CC=CC=C1CN2CCNCC2",2.69E-01 -"N1=CC=CC(=C1)CCCO",1.09E+00 -"CCCCCCCCCCCCCN",3.28E-04 -"C1=CC=CC(N)=C1C(=O)C2=CC=C(Cl)C=C2",9.15E-03 -"C1(Cl)=CC=C(Cl)C=C1C(=O)OC",6.83E-02 -"S=P(OC1=NC(=C(C=C1Cl)Cl)Cl)(OCC)OCC",9.07E-04 -"C1(OC)=CC(C=O)=CC(Br)=C1O",2.58E-01 -"C=CC(=O)OC1CCCCC1",9.60E-03 -"S(C1=CC=C(Cl)C=C1)(=O)C2=CC=C(Cl)C=C2", -"CCOC(=O)N(C(=O)OCC)C(=O)OCC",5.70E-02 -"OC1=C(O)C=C(Cl)C(Cl)=C1",4.97E-03 -"NC1=C(Cl)C(Cl)=CC(Cl)=C1Cl",1.17E-03 -"N1=C(C2=CC=CC=C2)C=CC=C1C3=CC=CC=C3",9.08E-04 -"ClC1=CC(Cl)=C([N+]([O-])=O)C=C1[N+]([O-])=O",1.92E-04 -"C1(Cl)=CC(Cl)=C(Cl)C=C1SSC2=C(Cl)C=C(Cl)C(Cl)=C2", -"C1=C(C)C(C)=CC=C1OP(=O)(OC2=CC(C)=C(C)C=C2)OC3=CC(C)=C(C)C=C3", -"CCC(C)C(C)C=O",1.40E-01 -"C(O)C#CCCCCCCC",6.94E-03 -"N1=C(O)C=CC(Cl)=C1",8.80E+00 -"CC(C)SSC(C)C",5.53E-02 -"C1(C=O)=C(OC)C=C(OC)C(OC)=C1",2.52E-01 -"C=C(C)C(=O)OC(C)C",2.96E-01 -"C=CC(O)CCC",3.04E-01 -"OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1",1.77E-03 -"C1=CN=CC=C1CCC2=CC=NC=C2",8.20E-01 -"C1C(=O)N(CC)C(=S)N(CC)C1=O",2.25E+01 -"COC(=O)C1=CC=C(C(=O)OC)C=C1[N+]([O-])=O",2.73E-02 -"C1=CC(Cl)=CC2N=C(S)SC1=2",1.59E-02 -"COC(=O)C1=CC=C(C(=O)OC)C=C1N",4.27E-02 -"CCSCCSCC",4.01E-01 -"CN(CCCCl)C.[H]Cl",8.41E-01 -"C1=C(C(=O)C)C=C([N+]([O-])=O)C(Cl)=C1",2.76E-02 -"CC1=CC(Cl)=NC(N)=N1",9.82E-01 -"CC1=C(OC)C=CC=C1OC",1.33E-01 -"N1=C(N(C)C)C=CC=C1",1.04E+00 -"CC(C)(C)CN",5.45E+00 -"O=[C@](O)[C@@]3(C)[C@@]1([H])[C@@](CCC3)(C)[C@]2([H])C(C[C@](C=C)(C)CC2)=CC1",2.88E-03 -"C1(N)=CC=C(Cl)C=C1C#N",1.87E-01 -"ClC(Cl)(C(C)(O)C)Cl.ClC(Cl)(C(C)(O)C)Cl.[H]O[H]",3.62E-01 -"CCCCCCCCCCC(=O)C",6.40E-03 -"C1=C(/C=C/C=O)C=CC(N(C)C)=C1",3.67E-02 -"C(C(=O)O)[N+]1(=CC=CC=C1).[Cl-]",9.33E-01 -"ClC1=C([N+]([O-])=O)C(Cl)=C([N+]([O-])=O)C(Cl)=C1",8.18E-04 -"ClC1=CC=C([N+](=O)[O-])C=C1C=O",2.09E-02 -"N#CC1=C(Cl)C=CC=C1C",9.96E-02 -"N1=C(Br)C(O)=CC=C1",2.70E+00 -"N1=C(Cl)C(O)=CC=C1",4.80E+00 -"C#CCN(CC#C)CC#C",2.26E+00 -"CCOC(OCC)CN(C)CC(OCC)OCC",2.41E+00 -"NCCCN1CCN(CCCN)CC1",1.55E+01 -"OC(CC/C=C(C)/CC/C=C(C)\C)(C)C=C",6.43E-03 -"ClCCN1CCCC1.[H]Cl",9.00E-01 -"CCCCCCCCCCCN",1.23E-03 -"C#CC(O)CCCC",1.57E-02 -"C1(C=O)=CC=C(OCC)C=C1",1.87E-01 -"O=C(C(C(C1C2)(C)C)(C2)C)C1Br",2.96E-01 -"CC(C)=CC1C(C)(C)C1C(=O)OCC2=COC(CC3=CC=CC=C3)=C2",1.82E-05 -"CCOP(=S)(OCC)SCSC(C)(C)C",4.61E-05 -"BrC(Br)C1=C(C(Br)Br)C=CC=C1",1.04E-03 -"C1=C(C(=O)C)C(Cl)=C(Cl)C(Cl)=C1",8.95E-03 -"C1(OC)=C(OC)C(OC)=CC=C1C(=O)C",9.47E-01 -"CCOC(=O)C(Cl)C(=O)OCC",4.88E-03 -"CCNCC1=CC=CC=C1",4.22E-01 -"ClC1=CC=CC=[N+]1C.[I-]",7.79E-01 -"C1=CC(Br)=CC=C1C(=O)C2=CC=CN=C2",7.78E-02 -"C1=CC=CC=C1C(=O)C2=CC=NC=C2",5.62E-01 -"CC1(C)CCC(C)(C)O1",1.31E+00 -"N1=C([N+]([O-])=O)C(O)=CC=C1",1.19E+00 -"C1(CC)=CC=CC(CC)=C1N(COC)C(=O)CCl",1.85E-02 -"NC1=CC=C(CCCCCCCC)C=C1",5.84E-04 -"CSC(C)=NOC(=O)NC",1.30E-02 -"N1=C(O)C=CC=C1Cl",1.65E+00 -"NC1=NN=C(C)C(C)=N1",7.67E+00 -"C1=CC([N+]([O-])=O)=CC([N+](=O)[O-])=C1OC2=CC=C(Br)C=C2", -"O=CC1=CC=C(N(CC)CC)C=C1O",2.77E-02 -"N1=C(C)C=CC=C1Cl",1.82E+00 -"C#CC(CCC(C)C)(C)O",3.49E-01 -"CC1=C(C)OC(C)=N1",4.04E+00 -"CC(=O)C(C)CN(C)C",6.58E-02 -"C1=CC([N+](=O)[O-])=CC=C1OC2=CC(C)=C(Cl)C=C2", -"C1=CC=C(Br)C=C1C(=O)N",4.63E-01 -"O=C(C(=NOC(=O)NC)SC)N(C)C",3.09E-02 -"NC1=C(C(C)C)C=CC=C1C(C)C",8.63E-02 -"[Na+].[N-]=[N+]=[N-]",8.40E-02 -"C[N+](C1=CC=CC=C1)(C)C.[O-]S(=O)(=O)OC",1.00E+00 -"ClC1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)C(=C(Cl)Cl)Cl", -"CC(C)(O)C(F)(C(F)F)F",3.64E+00 -"CCC(N)C",3.76E+00 -"COCCCNCC1=CC(OC)=C(OC)C(OC)=C1",5.05E-01 -"BrCC1OCCCC1",1.15E+00 -"NC1=CC=C(CCCCCCCCCC)C=C1",2.66E-04 -"NC1=CC=C(OCCCCCC)C=C1",1.56E-02 -"C1([N+](=O)[O-])=CC(Cl)=CC=C1C(=O)OC",1.28E-01 -"C1(C=O)=C([N+](=O)[O-])C=CC(O)=C1",2.51E-01 -"O=C(C(C1=CC=C(C=C1)Cl)C(C)C)OC(C2=CC=CC(=C2)OC3=CC=CC=C3)C#N",1.21E-05 -"C1=CC=C(OC2=CC=CC=C2)C=C1COC(=O)C3C(C)(C)C3C=C(Cl)Cl",4.09E-05 -"CCSCCCCSCC",3.40E-02 -"CCCCCCCCOC1=CC=CC=C1NC(=O)C",1.71E-03 -"C1=CC(C(C)(C)C)=CC=C1C(=O)N",1.80E-01 -"CSCCCCCCSC",5.66E-02 -"CC(O)C#C",1.67E-01 -"C1(C)=C(C)C=CC=C1OP(=O)(OC2=C(C)C(C)=CC=C2)OC3=C(C)C(C)=CC=C3", -"C1C(=CC=C[N+]=1CC2C=CC=CC=2)S(=O)(=O)[O-]",9.67E+00 -"C1=CC(C(C)(C)C)=CC=C1OC2=CC=CC(C=O)=C2",1.45E-03 -"O=C(OC(C2=CC=CC(OC3=CC=CC=C3)=C2)C#N)[C@H](C1=CC=C(OC(F)F)C=C1)[C@H](C)C",4.21E-07 -"ClC1=CC=CC(Cl)=C1OP(=O)(OC2=C(Cl)C=CC=C2Cl)OC3=C(Cl)C=CC=C3Cl", -"C1=C(C=O)C=CC=C1OC2=CC(Cl)=C(Cl)C=C2",1.12E-03 -"[Na+].O.O.[O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=CC=CC=C12",1.45E-02 -"CC(C)(C)C1=CC=C(C=C)C=C1",3.06E-03 -"O=P(OCC)(SCCSCC)OCC",6.19E-02 -"ClCC1=CC(C=C)=CC=C1",2.03E-03 diff --git a/test/data/EPAFHM.mini.csv b/test/data/EPAFHM.mini.csv deleted file mode 100644 index c86cd33..0000000 --- a/test/data/EPAFHM.mini.csv +++ /dev/null @@ -1,21 +0,0 @@ -"STRUCTURE_SMILES","LC50_mmol" -"C1=CC(C=O)=CC(OC)=C1OCCCCCC",1.13E-02 -"C1(OC)=C([N+]([O-])=O)C(C=O)=CC(Br)=C1O",2.66E-01 -"CCCCCCCCOC(=O)C1=CC=CC(C(=O)OCCCCCCCC)=C1", -"C1=CC(Cl)=CC=C1OC2=C([N+](=O)[O-])C=CC=C2",7.69E-03 -"CC1=C(NC=O)C=CC=C1Cl",2.75E-01 -"CCCCOC(=O)C1=CC=CC(C(=O)OCCCC)=C1",3.23E-03 -"C(C1=CC=CC=C1)(C2=CC=CC=C2)(O)C#C",5.33E-02 -"CCCSCCSCCC",4.22E-02 -"CCCCCCCCOC(=O)C1=CC=C(C(=O)OCCCCCCCC)C=C1", -"OCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCOC(=O)C2=CC=CC=C2C(=O)OCCCCO", -"CCCSCCCCSCCC",1.45E-02 -"C1([N+](=O)[O-])=CC=C(C)C=C1OP(=O)(OC2=C([N+](=O)[O-])C=CC(C)=C2)OC3=C([N+]([O-])=O)C=CC(C)=C3", -"C1=C([N+]([O-])=O)C=CC=C1P(=O)(C2=CC([N+](=O)[O-])=CC=C2)C3=CC([N+](=O)[O-])=CC=C3", -"ClCCOC(=O)NC1CCCCC1",1.70E-01 -"O=C1C(C2=CC=CC=C2)(C(=O)NC(=O)N1)CC",2.08E+00 -"OC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-]",5.92E-02 -"NC(=O)OCC",5.88E+01 -"[O-]C(C1=CC=CC=C1O)=O.[Na+]",1.25E+01 -"C1=CC=CC=C1C(=O)N",5.46E+00 -"CC[N+](CC)(CC)CC1(=CC=CC=C1).[Cl-]",7.07E-01 diff --git a/test/data/ISSCAN-multi.csv b/test/data/ISSCAN-multi.csv deleted file mode 100644 index b404683..0000000 --- a/test/data/ISSCAN-multi.csv +++ /dev/null @@ -1,59 +0,0 @@ -SMILES,ISSCAN -CC(CCl)Cl,1 -C(Br)(Br)Br,1 -C=C(C)CCl,1 -O=Cc1ccco1,1 -COC34(C(COC(N)=O)C=1C(=O)C(N)=C(C)C(=O)C=1N4(CC2NC23)),1 -CC(N)Cc1ccccc1.CC(N)Cc1ccccc1,1 -Cc1cc(ccc1(N))C(=C2C=CC(=N)C=C2)c3ccc(N)cc3,1 -Oc1ccc(cc1)c2ccccc2,1 -CC(C)C=O,1 -N#CC(C#N)=Cc1ccccc1Cl,1 -Nc1ccc(cc1(N))[N+](=O)[O-],2 -NC(CCC(=O)NNc1ccc(CO)cc1)C(O)=O,2 -c1ccc2c(c1)nc(s2)SSc4nc3ccccc3s4,2 -C=CC=O,2 -CC(=O)Nc3cccc2Cc1ccccc1c23,2 -Cc1cccc2cccnc12,2 -Cc1ccc2ncccc2(c1),2 -CBr,2 -Nc1cc(ccc1(C(=O)O))[N+](=O)[O-],2 -C1N2CN3CN1CN(C2)C3,2 -O=[N+]([O-])c2cccc1ccccc12,2 -Oc1cccc2cccnc12,2 -O=CC(=C(C(=O)O)Cl)Cl,2 -CC1CN(N=O)C(=O)NC1(=O),2 -O1C2C1C3C4C2C5C3C6(C4(C(C5(C6(Cl)Cl)Cl)Cl)Cl)Cl,2 -OCCNc1ccc(cc1[N+](=O)[O-])N(CCO)CCO,2 -Cc1cc(N)ccc1(N).OS(=O)(=O)O,2 -CC(O)CCl,2 -O=[N+]([O-])C(Cl)(Cl)Cl,2 -Cc1ccc(cc1)S(=O)(=O)NC(=O)NN2CCCCCC2,2 -c1cc2ccc3cccc4ccc(c1)c2c34,2 -CC(=O)Nc1ccc(cc1)C(=O)CCl,2 -FC(F)Cl,2 -CN(N=O)c1ccc(cc1)[N+](=O)[O-],2 -C=CC,2 -Oc4c(cc1cc(ccc1c4(N=Nc2ccc(c3ccccc23)S(=O)(=O)[O-]))S(=O)(=O)[O-])S(=O)(=O)[O-],0 -CC=NN(C)C=O,0 -Nc2ccc(N=Nc1ccccc1)c(N)n2,0 -Cc3cc(C)c(N=Nc1cc(c2ccccc2(c1(O)))S(=O)(=O)[O-])c(c3)S(=O)(=O)[O-],0 -[O-]c1ccccc1c2ccccc2,0 -NNC(N)=O,0 -CNNCc1ccc(cc1)C(=O)NC(C)C,0 -c1cc(c(cc1c2ccc(c(c2Cl)Cl)Cl)Cl)Cl,0 -CCN(Cc1cccc(c1)S(=O)(=O)[O-])c2ccc(cc2)C(=C3C=CC(C=C3)=[N+](CC)Cc4cccc(c4)S(=O)(=O)[O-])c5ccc(cc5)S(=O)(=O)[O-],0 -COC(=O)C(c1ccccc1)C2CCCCN2,0 -CCCCC(CC)COS(=O)(=O)[O-],0 -Nc1ccccc1,0 -Cc1cccc(N)c1,0 -CN(C)CCN(Cc1cccs1)c2ccccn2,0 -CN(C)CCOC(C)(c1ccccc1)c2ccccn2,0 -Cc1cc(C)c(cc1(C))N=Nc3c(O)c(cc2cc(ccc23)S(=O)(=O)[O-])S(=O)(=O)[O-],0 -Cc1ccccc1(N),0 -CCC1(C(=O)N=C([O-])NC1(=O))c2ccccc2,0 -Nc5cc(cc6cc(c(N=Nc1ccc(cc1(O))c4ccc(N=Nc2c(O)c3c(N)cc(cc3(cc2S(=O)(=O)[O-]))S(=O)(=O)[O-])c(O)[c-]4)c(O)c56)S(=O)(=O)[O-])S(=O)(=O)[O-],0 -O=C1[N-]S(=O)(=O)c2ccccc12,0 -CN(C)c1ccc(cc1)C(c2ccc(cc2)N(C)C)=C3C=CC(C=C3)=[N+](C)C,0 -C13(C4(C2(C5(C(C1(C2(Cl)Cl)Cl)(C3(C(C45Cl)(Cl)Cl)Cl)Cl)Cl)Cl)Cl)Cl,0 -CCOCCc1c(nc(N)[n+]2[nH]cnc12)c3ccccc3,0 diff --git a/test/data/cpdb_100.csv b/test/data/cpdb_100.csv deleted file mode 100644 index e691ccc..0000000 --- a/test/data/cpdb_100.csv +++ /dev/null @@ -1,101 +0,0 @@ -"STRUCTURE_Parent_SMILES ","STRUCTURE_InChI ","ActivityOutcome_CPDBAS_MultiCellCall ","STRUCTURE_Shown ","TestSubstance_ChemicalName ","ActivityScore_CPDBAS_Rat ","TD50_Hamster_mg mg","TD50_Rat_mmol mmol","ActivityOutcome_CPDBAS_SingleCellCall ","TD50_Rat_Note ","STRUCTURE_MolecularWeight ","TD50_Dog_mg mg","TargetSites_Mouse_BothSexes ","DSSTox_CID ","STRUCTURE_ChemicalName_IUPAC ","NTP_TechnicalReport ","TD50_Cynomolgus_mg mg","ActivityOutcome_CPDBAS_Rat ","ActivityOutcome_CPDBAS_Mutagenicity ","ActivityScore_CPDBAS_Mouse ","STRUCTURE_InChIKey ","ChemicalNote ","ActivityOutcome_CPDBAS_MultiCellCall_Details ","TestSubstance_CASRN ","DSSTox_RID ","TargetSites_Mouse_Male ","TD50_Dog_Primates_Note ","STRUCTURE_Formula ","TD50_Rat_mg mg","TestSubstance_Description ","ActivityScore_CPDBAS_Hamster ","Endpoint ","TargetSites_Cynomolgus ","STRUCTURE_TestedForm_DefinedOrganic ","StudyType ","Note_CPDBAS ","TargetSites_Rhesus ","DSSTox_FileID ","TD50_Mouse_mmol mmol","ActivityOutcome_CPDBAS_Dog_Primates ","ChemicalPage_URL ","TD50_Mouse_Note ","ActivityOutcome_CPDBAS_Hamster ","TD50_Mouse_mg mg","STRUCTURE_ChemicalType ","TargetSites_Rat_Male ","TargetSites_Hamster_Female ","TargetSites_Dog ","TargetSites_Mouse_Female ","TargetSites_Hamster_BothSexes ","STRUCTURE_SMILES ","ActivityOutcome_CPDBAS_Mouse ","TargetSites_Rat_BothSexes ","TargetSites_Hamster_Male ","TD50_Hamster_mmol mmol","TD50_Hamster_Note ","Species ","TargetSites_Rat_Female ","DSSTox_Generic_SID ","TD50_Rhesus_mg mg" -"NC1C=CC2=C(N=1)NC3=CC=CC=C23","InChI=1/C11H9N3/c12-10-6-5-8-7-3-1-2-4-9(7)13-11(8)14-10/h1-6H,(H3,12,13,14)/f/h13H,12H2","active","tested chemical","A-alpha-C",blank,blank,blank,"active","blank",183.2122039794922,blank,"blank",1.0,"9H-pyrido[2,3-b]indol-2-amine","blank",blank,"blank","active",35.0,"FJTNLJLPLJDTRM-DXMPFREMCP","blank","multisite active; multisex active","26148-68-5",20001.0,"liver; vascular system","blank","C11H9N3",blank,"single chemical compound",blank,"TD50; Tumor Target Sites","blank","parent","Carcinogenicity","blank","blank","1_CPDBAS_v5d",0.2720000147819519,"blank","http://potency.berkeley.edu/chempages/A-alpha-C.html","TD50 is harmonic mean of more than one positive test","blank",49.79999923706055,"defined organic","blank","blank","blank","liver; vascular system","blank","NC1C=CC2=C(N=1)NC3=CC=CC=C23","active","blank","blank",blank,"blank","mouse","blank",20001.0,blank -"O=S(NC1=O)(OC(C)=C1)=O","InChI=1/C4H5NO4S.K/c1-3-2-4(6)5-10(7,8)9-3;/h2H,1H3,(H,5,6);/q;+1/p-1/fC4H4NO4S.K/q-1;m","inactive","tested chemical","Acesulfame-K",,,,"inactive","",201.24220275878906,,"",10606.0,"potassium 6-methyl-4-oxo-4H-1,2,3-oxathiazin-3-ide 2,2-dioxide","",,"","",0.0,"WBZFUFAFFUEMEI-COHKJUPYCC","parent [33665-90-6]","multisex inactive","55589-62-3",40770.0,"no positive results","","C4H4KNO4S",,"single chemical compound",,"TD50; Tumor Target Sites","","salt K","Carcinogenicity","Mouse added v5a; chemical added v5a","","2_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ACESULFAME-K.html","no positive results","",,"defined organic","","","","no positive results","","O=S([N-]C1=O)(OC(C)=C1)=O.[K+]","inactive","","",,"","mouse","",30606.0, -"CC=O","InChI=1/C2H4O/c1-2-3/h2H,1H3","active","tested chemical","Acetaldehyde",20.0,565.0,3.4700000286102295,"active","TD50 is harmonic mean of more than one positive test",44.0526008605957,,"",2.0,"acetaldehyde","",,"active","inactive",,"IKHGUXGNUITLKF-UHFFFAOYAB","","multisite active; multisex active; multispecies active","75-07-0",20002.0,"","","C2H4O",153.0,"single chemical compound",1.0,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","3_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ACETALDEHYDE.html","","active",,"defined organic","nasal cavity","oral cavity","","","","CC=O","","","nasal cavity; oral cavity",12.800000190734863,"TD50 is harmonic mean of more than one positive test","rat; hamster","nasal cavity",39224.0, -"CC=NN(C)C=O","InChI=1/C4H8N2O/c1-3-5-6(2)4-7/h3-4H,1-2H3/b5-3+","active","tested chemical","Acetaldehyde methylformylhydrazone",,,,"active","",100.12000274658203,,"",3.0,"N'-[(1E)-ethylidene]-N-methylformic hydrazide","",,"","inactive",46.0,"IMAGWKUTFZRWSB-HWKANZROBR","","multisite active; multisex active","16568-02-8",20003.0,"lung; preputial gland","","C4H8N2O",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","4_CPDBAS_v5d",0.025100000202655792,"","http://potency.berkeley.edu/chempages/ACETALDEHYDE%20METHYLFORMYLHYDRAZONE.html","TD50 is harmonic mean of more than one positive test","",2.509999990463257,"defined organic","","","","clitoral gland; lung; stomach","","CC=NN(C)C=O","active","","",,"","mouse","",39225.0, -"CC=NO","InChI=1/C2H5NO/c1-2-3-4/h2,4H,1H3/b3-2+","","tested chemical","Acetaldoxime",0.0,,,"inactive","no positive results",59.06719970703125,,"",4.0,"(1E)-acetaldehyde oxime","",,"inactive","inactive",,"FZENGILVLUJGJX-NSCUHMNNBP","","","107-29-9",20004.0,"","","C2H5NO",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","5_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ACETALDOXIME.html","","",,"defined organic","no positive results","","","","","CC=NO","","","",,"","rat","",20004.0, -"CC(=O)N","InChI=1/C2H5NO/c1-2(3)4/h1H3,(H2,3,4)/f/h3H2","active","tested chemical","Acetamide",21.0,,3.049999952316284,"active","TD50 is harmonic mean of more than one positive test",59.06719970703125,,"",5.0,"acetamide","",,"active","inactive",9.0,"DLFVBJFMPXGRIB-ZZOWFUDICC","","multisite active; multisex active; multispecies active","60-35-5",20005.0,"hematopoietic system","","C2H5NO",180.0,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","6_CPDBAS_v5d",51.0,"","http://potency.berkeley.edu/chempages/ACETAMIDE.html","","",3010.0,"defined organic","liver","","","no positive results","","CC(=O)N","active","","",,"","rat; mouse","liver",20005.0, -"C1(=CC=C(C=C1)O)NC(C)=O","InChI=1/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10)/f/h9H","active","tested chemical","Acetaminophen",20.0,,3.2699999809265137,"active","TD50 is harmonic mean of more than one positive test",151.16259765625,,"",6.0,"N-(4-hydroxyphenyl)acetamide","TR 394; final call in CPDB differs due to additional data",,"active","inactive",17.0,"RZVAJINKPMORJF-BGGKNDAXCW","","multisite active; multisex active; multispecies active","103-90-2",20006.0,"liver","","C8H9NO2",495.0,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","7_CPDBAS_v5d",10.699999809265137,"","http://potency.berkeley.edu/chempages/ACETAMINOPHEN.html","TD50 is harmonic mean of more than one positive test","",1620.0,"defined organic","liver; urinary bladder","","","liver","","C1(=CC=C(C=C1)O)NC(C)=O","active","","",,"","rat; mouse","liver; urinary bladder",20006.0, -"O=S(=O)(C1=CC=C(C=C1)C(=O)C)NC(=O)NC2CCCCC2","InChI=1/C15H20N2O4S/c1-11(18)12-7-9-14(10-8-12)22(20,21)17-15(19)16-13-5-3-2-4-6-13/h7-10,13H,2-6H2,1H3,(H2,16,17,19)/f/h16-17H","inactive","tested chemical","Acetohexamide",0.0,,,"inactive","no positive results",324.3952941894531,,"",7.0,"4-acetyl-N-[(cyclohexylamino)carbonyl]benzenesulfonamide","TR 050",,"inactive","inactive",0.0,"VGZSUPCWNCWDAN-XQMQJMAZCC","","multisex inactive; multispecies inactive","968-81-0",20007.0,"no positive results","","C15H20N2O4S",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","8_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ACETOHEXAMIDE.html","no positive results","",,"defined organic","no positive results","","","no positive results","","O=S(=O)(C1=CC=C(C=C1)C(=O)C)NC(=O)NC2CCCCC2","inactive","","",,"","rat; mouse","no positive results",20007.0, -"C(/C)(C)=N\NC1=NC=C(S1)C2=CC=C(O2)[N+](=O)[O-]","InChI=1/C10H10N4O3S/c1-6(2)12-13-10-11-5-8(18-10)7-3-4-9(17-7)14(15)16/h3-5H,1-2H3,(H,11,13)/f/h13H","","tested chemical","Acetone[4-(5-nitro-2-furyl)-2-thiazolyl] hydrazone",43.0,,0.022700000554323196,"active","",266.27398681640625,,"",8.0,"propan-2-one [5-(5-nitrofuran-2-yl)-1,3-thiazol-2-yl]hydrazone","",,"active","",,"CUWVNOSSZYUJAE-NDKGDYFDCK","","","18523-69-8",20008.0,"","","C10H10N4O3S",6.050000190734863,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","9_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ACETONE[4-(5-NITRO-2-FURYL)-2-THIAZOLYL]HYDRAZONE.html","","",,"defined organic","","","","","","C(/C)(C)=N\NC1=NC=C(S1)C2=CC=C(O2)[N+](=O)[O-]","","","",,"","rat","stomach",20008.0, -"CC#N","InChI=1/C2H3N/c1-2-3/h1H3","inactive","tested chemical","Acetonitrile ",0.0,,,"inactive","no positive results",41.05189895629883,,"",9.0,"acetonitrile","TR 447",,"inactive","inactive",0.0,"WEVYAHXRMPXWCK-UHFFFAOYAJ","","multisex inactive; multispecies inactive","75-05-8",20009.0,"no positive results","","C2H3N",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","10_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ACETONITRILE.html","no positive results","",,"defined organic","no positive results","","","no positive results","","CC#N","inactive","","",,"","rat; mouse","no positive results",20009.0, -"CC(=NO)C","InChI=1/C3H7NO/c1-3(2)4-5/h5H,1-2H3","","tested chemical","Acetoxime",34.0,,0.16599999368190765,"active","",73.09380340576172,,"",10.0,"propan-2-one oxime","",,"active","",,"PXAJQJMDEXJWFB-UHFFFAOYAK","","","127-06-0",20010.0,"","","C3H7NO",12.100000381469727,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","11_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ACETOXIME.html","","",,"defined organic","liver","","","","","CC(=NO)C","","","",,"","rat","no positive results",20010.0, -"O=C(C)OC(C2=CC1=C(C=C2)OCO1)C=C","InChI=1/C12H12O4/c1-3-10(16-8(2)13)9-4-5-11-12(6-9)15-7-14-11/h3-6,10H,1,7H2,2H3","","tested chemical","1'-Acetoxysafrole",35.0,,0.11400000005960464,"active","TD50 is harmonic mean of more than one positive test",220.22129821777344,,"",11.0,"1-(1,3-benzodioxol-5-yl)prop-2-en-1-yl acetate","",,"active","active",0.0,"TXUCQVJZBXYDKH-UHFFFAOYAY","","","34627-78-6",20011.0,"no positive results","","C12H12O4",25.0,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","12_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/1'-ACETOXYSAFROLE.html","no positive results","",,"defined organic","stomach","","","","","O=C(C)OC(C2=CC1=C(C=C2)OCO1)C=C","inactive","","",,"","rat; mouse","",39226.0, -"N(NC(C)=O)C1=CC=C(C=C1)CO","InChI=1/C9H12N2O2/c1-7(13)10-11-9-4-2-8(6-12)3-5-9/h2-5,11-12H,6H2,1H3,(H,10,13)/f/h10H","active","tested chemical","N'-Acetyl-4-(hydroxymethyl) phenylhydrazine",,,,"active","",180.20599365234375,,"",12.0,"N'-[4-(hydroxymethyl)phenyl]acetohydrazide","",,"","",27.0,"UFFJUAYKLIGSJF-KZFATGLACR","","multisite active; multisex active","65734-38-5",20012.0,"lung; vascular system","","C9H12N2O2",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","13_CPDBAS_v5d",1.340000033378601,"","http://potency.berkeley.edu/chempages/N'-ACETYL-4-(HYDROXYMETHYL)PHENYLHYDRAZINE.html","TD50 is harmonic mean of more than one positive test","",241.0,"defined organic","","","","lung; vascular system","","N(NC(C)=O)C1=CC=C(C=C1)CO","active","","",,"","mouse","",20012.0, -"N(NC(C)=O)C(C1=CC=NC=C1)=O","InChI=1/C8H9N3O2/c1-6(12)10-11-8(13)7-2-4-9-5-3-7/h2-5H,1H3,(H,10,12)(H,11,13)/f/h10-11H","active","tested chemical","1-Acetyl-2-isonicotinoylhydrazine",,,,"active","",179.17799377441406,,"",13.0,"N'-acetylpyridine-4-carbohydrazide","",,"","",25.0,"CVBGNAKQQUWBQV-PZWAIHAUCF","","multisex active","1078-38-2",20013.0,"lung","","C8H9N3O2",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","14_CPDBAS_v5d",1.840000033378601,"","http://potency.berkeley.edu/chempages/1-ACETYL-2-ISONICOTINOYLHYDRAZINE.html","TD50 is harmonic mean of more than one positive test","",330.0,"defined organic","","","","lung","","N(NC(C)=O)C(C1=CC=NC=C1)=O","active","","",,"","mouse","",20013.0, -"O=C1C(C(=O)OC(=C1)C)C(=O)C","InChI=1/C8H8O4/c1-4-3-6(10)7(5(2)9)8(11)12-4/h3,7H,1-2H3","inactive","tested chemical","3-Acetyl-6-methyl-2,4-pyrandione",,,,"inactive","",168.1488037109375,,"",14.0,"3-acetyl-6-methyl-2H-pyran-2,4(3H)-dione","",,"","",0.0,"PGRHXDWITVMQBC-UHFFFAOYAH","tautomers","multisex inactive","520-45-6",20014.0,"no positive results","","C8H8O4",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","15_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/3-ACETYL-6-METHYL-2,4-PYRANDIONE.html","no positive results","",,"defined organic","","","","no positive results","","O=C1C(C(=O)OC(=C1)C)C(=O)C","inactive","","",,"","mouse","",20014.0, -"C1(NNC(C)=O)=CC=CC=C1","InChI=1/C8H10N2O/c1-7(11)9-10-8-5-3-2-4-6-8/h2-6,10H,1H3,(H,9,11)/f/h9H","active","tested chemical","1-Acetyl-2-phenylhydrazine",,,,"active","",150.17779541015625,,"",15.0,"N'-phenylacetohydrazide","",,"","active",34.0,"UICBCXONCUFSOI-BGGKNDAXCP","","multisex active","114-83-0",20015.0,"vascular system","","C8H10N2O",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","16_CPDBAS_v5d",0.3409999907016754,"","http://potency.berkeley.edu/chempages/1-ACETYL-2-PHENYLHYDRAZINE.html","TD50 is harmonic mean of more than one positive test","",51.20000076293945,"defined organic","","","","vascular system","","C1(NNC(C)=O)=CC=CC=C1","active","","",,"","mouse","",20015.0, -"CC(=O)NC1=CC=C(C=C1)C2=CC=CC=C2","InChI=1/C14H13NO/c1-11(16)15-14-9-7-13(8-10-14)12-5-3-2-4-6-12/h2-10H,1H3,(H,15,16)/f/h15H","","tested chemical","4-Acetylaminobiphenyl",49.0,,0.00559999980032444,"active","",211.26280212402344,,"",16.0,"N-biphenyl-4-ylacetamide","",,"active","",,"SVLDILRDQOVJED-YAQRNVERCM","","","4075-79-0",20016.0,"","","C14H13NO",1.1799999475479126,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","17_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/4-ACETYLAMINOBIPHENYL.html","","",,"defined organic","","","","","","CC(=O)NC1=CC=C(C=C1)C2=CC=CC=C2","","","",,"","rat","mammary gland",39243.0, -"CC(=O)NC1=C2CC3=CC=CC=C3C2=CC=C1","InChI=1/C15H13NO/c1-10(17)16-15-8-4-7-13-12-6-3-2-5-11(12)9-14(13)15/h2-8H,9H2,1H3,(H,16,17)/f/h16H","","tested chemical","1-Acetylaminofluorene",0.0,,,"inactive","no positive results",223.2738037109375,,"",17.0,"N-9H-fluoren-1-ylacetamide","",,"inactive","",,"POECHIXSIXBYKI-WYUMXYHSCQ","","","28314-03-6",20017.0,"","","C15H13NO",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","18_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/1-ACETYLAMINOFLUORENE.html","","",,"defined organic","","","","","","CC(=O)NC1=C2CC3=CC=CC=C3C2=CC=C1","","","",,"","rat","no positive results",20017.0, -"C12C3=C(C=CC=C3)CC1=CC(=CC=2)NC(C)=O","InChI=1/C15H13NO/c1-10(17)16-13-6-7-15-12(9-13)8-11-4-2-3-5-14(11)15/h2-7,9H,8H2,1H3,(H,16,17)/f/h16H","active","tested chemical","2-Acetylaminofluorene",49.0,17.399999618530273,0.005499999970197678,"active","TD50 is harmonic mean of more than one positive test",223.26980590820312,,"",18.0,"N-9H-fluoren-2-ylacetamide","",,"active","active",45.0,"CZIHNRWJTSTCEX-WYUMXYHSCF","","multisite active; multisex active; multispecies active","53-96-3",20018.0,"liver; urinary bladder","no positive results for Rhesus","C15H13NO",1.2200000286102295,"single chemical compound",53.0,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","no positive results","19_CPDBAS_v5d",0.03400000184774399,"inactive","http://potency.berkeley.edu/chempages/2-ACETYLAMINOFLUORENE.html","TD50 is harmonic mean of more than one positive test; greater than ten-fold variation among TD50 values for positive results","active",7.590000152587891,"defined organic","liver; mammary gland; skin","no positive results","","liver; urinary bladder","","C12C3=C(C=CC=C3)CC1=CC(=CC=2)NC(C)=O","active","","liver",0.0778999999165535,"","rat; mouse; hamster; rhesus","liver; mammary gland; skin",39227.0, -"C12C3=C(C=CC=C3)CC1=CC=CC=2NC(C)=O","InChI=1/C15H13NO/c1-10(17)16-14-8-4-6-12-9-11-5-2-3-7-13(11)15(12)14/h2-8H,9H2,1H3,(H,16,17)/f/h16H","","tested chemical","4-Acetylaminofluorene",0.0,,,"inactive","no positive results",223.26980590820312,,"",19.0,"N-9H-fluoren-4-ylacetamide","",,"inactive","active",,"PHPWISAFHNEMSR-WYUMXYHSCU","","","28322-02-3",20019.0,"","","C15H13NO",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","20_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/4-ACETYLAMINOFLUORENE.html","","",,"defined organic","","","","","","C12C3=C(C=CC=C3)CC1=CC=CC=2NC(C)=O","","","",,"","rat","no positive results",20019.0, -"O=C(O)Cc1ccc(cc1)NC(C)=O","InChI=1/C10H11NO3/c1-7(12)11-9-4-2-8(3-5-9)6-10(13)14/h2-5H,6H2,1H3,(H,11,12)(H,13,14)/f/h11,13H","inactive","tested chemical","4-Acetylaminophenylacetic acid",0.0,,,"inactive","no positive results",193.19920349121094,,"",20.0,"[4-(acetylamino)phenyl]acetic acid","",,"inactive","",0.0,"MROJXXOCABQVEF-KZZMUEETCP","","multisex inactive; multispecies inactive","18699-02-0",20020.0,"no positive results","","C10H11NO3",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","Rat added v2a; Mouse added v2a","","21_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/4-ACETYLAMINOPHENYLACETIC%20ACID.html","no positive results","",,"defined organic","no positive results","","","no positive results","","O=C(O)Cc1ccc(cc1)NC(C)=O","inactive","","",,"","rat; mouse","no positive results",20020.0, -"CC(=O)N[C@@H](CS)C(=O)O","InChI=1/C5H9NO3S/c1-3(7)6-4(2-10)5(8)9/h4,10H,2H2,1H3,(H,6,7)(H,8,9)/t4-/m0/s1/f/h6,8H","","tested chemical","N-acetylcysteine",0.0,,,"inactive","no positive results",163.1949005126953,,"",21.0,"N-acetyl-L-cysteine","",,"inactive","",,"PWKSKIMOESPYIA-JVBVHTJODB","stereochem","","616-91-1",20021.0,"","","C5H9NO3S",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","Rat added v2a","","22_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/N-ACETYLCYSTEINE.html","","",,"defined organic","no positive results","","","","","CC(=O)N[C@@H](CS)C(=O)O","","","",,"","rat","",20021.0, -"OC(=O)C1=C(C=CC(=C1)OC2=CC=C(C=C2Cl)C(F)(F)F)[N+](=O)[O-]","InChI=1/C14H7ClF3NO5/c15-10-5-7(14(16,17)18)1-4-12(10)24-8-2-3-11(19(22)23)9(6-8)13(20)21/h1-6H,(H,20,21)/f/h20H","active","tested chemical","Acifluorfen",,,,"active","",361.65728759765625,,"",22.0,"5-{[2-chloro-4-(trifluoromethyl)phenyl]oxy}-2-nitrobenzoic acid","",,"","",33.0,"NUFNQYOELLVIPL-UYBDAZJACV","","multisite active; multisex active","50594-66-6",20022.0,"liver; stomach","","C14H7ClF3NO5",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","23_CPDBAS_v5d",0.38999998569488525,"","http://potency.berkeley.edu/chempages/ACIFLUORFEN.html","TD50 is harmonic mean of more than one positive test","",141.0,"defined organic","","","","liver; stomach","","OC(=O)C1=C(C=CC(=C1)OC2=CC=C(C=C2Cl)C(F)(F)F)[N+](=O)[O-]","active","","",,"","mouse","",20022.0, -"C=CC=O","InChI=1/C3H4O/c1-2-3-4/h2-3H,1H2","inactive","tested chemical","Acrolein ",0.0,,,"inactive","no positive results",56.06330108642578,,"",23.0,"acrylaldehyde","",,"inactive","active",0.0,"HGINCPLSRVDWNT-UHFFFAOYAQ","","multisex inactive; multispecies inactive","107-02-8",20023.0,"no positive results","","C3H4O",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","24_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ACROLEIN.html","no positive results","",,"defined organic","no positive results","","","no positive results","","C=CC=O","inactive","","",,"","rat; mouse","no positive results",20023.0, -"C=CC(OCC)OCC","InChI=1/C7H14O2/c1-4-7(8-5-2)9-6-3/h4,7H,1,5-6H2,2-3H3","inactive","tested chemical","Acrolein diethylacetal",0.0,,,"inactive","no positive results",130.1864013671875,,"",24.0,"3,3-bis(ethyloxy)prop-1-ene","",,"inactive","",,"MCIPQLOKVXSHTD-UHFFFAOYAI","","multisex inactive","3054-95-3",20024.0,"","","C7H14O2",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","25_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ACROLEIN%20DIETHYLACETAL.html","","",,"defined organic","no positive results","","","","","C=CC(OCC)OCC","","","",,"","rat","no positive results",20024.0, -"C=C/C=N/O","InChI=1/C3H5NO/c1-2-3-4-5/h2-3,5H,1H2/b4-3+","inactive","tested chemical","Acrolein oxime",0.0,,,"inactive","no positive results",71.07859802246094,,"",25.0,"(1E)-prop-2-enal oxime","",,"inactive","",,"KMNIXISXZFPRDC-ONEGZZNKBI","","multisex inactive","5314-33-0",20025.0,"","","C3H5NO",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","26_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ACROLEIN%20OXIME.html","","",,"defined organic","no positive results","","","","","C=C/C=N/O","","","",,"","rat","no positive results",20025.0, -"CN1C2=C(C(OC)=CC3=C2C=CC(O3)(C)C)C(C4=C1C=CC=C4)=O","InChI=1/C20H19NO3/c1-20(2)10-9-13-15(24-20)11-16(23-4)17-18(13)21(3)14-8-6-5-7-12(14)19(17)22/h5-11H,1-4H3","active","tested chemical","Acronycine",55.0,,0.0015999999595806003,"active","positive test results only by intraperitoneal or intravenous injection; TD50 is harmonic mean of more than one positive test",321.36981201171875,,"",26.0,"3,3,12-trimethyl-6-(methyloxy)-3,12-dihydro-7H-pyrano[2,3-c]acridin-7-one","TR 49",,"active","",0.0,"SMPZPKRDRQOOHT-UHFFFAOYAD","","multisite active; multisex active","7008-42-6",20026.0,"NTP bioassay inadequate","","C20H19NO3",0.5049999952316284,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","ActivityOutcome_CPDBAS_Mouse modified v5d","","27_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ACRONYCINE.html","only experiment is NCI NTP bioassay inadequate","",,"defined organic","bone; peritoneal cavity","","","NTP bioassay inadequate","","CN1C2=C(C(OC)=CC3=C2C=CC(O3)(C)C)C(C4=C1C=CC=C4)=O","unspecified","","",,"","rat; mouse","mammary gland; peritoneal cavity",20026.0, -"NC(=O)C=C","InChI=1/C3H5NO/c1-2-3(4)5/h2H,1H2,(H2,4,5)/f/h4H2","active","tested chemical","Acrylamide ",39.0,,0.052799999713897705,"active","TD50 is harmonic mean of more than one positive test",71.0779037475586,,"",27.0,"acrylamide","",,"active","inactive",,"HRPVXLWXLXDGHG-LGEMBHMGCJ","","multisite active; multisex active","79-06-1",20027.0,"","","C3H5NO",3.75,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","TD50_Rat modified v3a","","28_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ACRYLAMIDE.html","","",,"defined organic","nervous system; peritoneal cavity; thyroid gland","","","","","NC(=O)C=C","","","",,"","rat","clitoral gland; mammary gland; nervous system; oral cavity; thyroid gland; uterus",20027.0, -"OC(=O)C=C","InChI=1/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5)/f/h4H","inactive","tested chemical","Acrylic acid",0.0,,,"inactive","no positive results",72.06269836425781,,"",28.0,"acrylic acid","",,"inactive","inactive",,"NIXOWILDQLNWCW-JLSKMEETCA","","multisex inactive","79-10-7",20028.0,"","","C3H4O2",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","29_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ACRYLIC%20ACID.html","","",,"defined organic","no positive results","","","","","OC(=O)C=C","","","",,"","rat","no positive results",39229.0, -"C=CC#N","InChI=1/C3H3N/c1-2-3-4/h2H,1H2","active","tested chemical","Acrylonitrile ",31.0,,0.3179999887943268,"active","TD50 is harmonic mean of more than one positive test; greater than ten-fold variation among TD50 values for positive results",53.062599182128906,,"",29.0,"acrylonitrile","",,"active","active",39.0,"NLHHRLWOUZZQLW-UHFFFAOYAG","","multisite active; multisex active","107-13-1",20029.0,"harderian gland; stomach","","C3H3N",16.899999618530273,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","Mouse added v5a","","30_CPDBAS_v5d",0.11900000274181366,"","http://potency.berkeley.edu/chempages/ACRYLONITRILE.html","TD50 is harmonic mean of more than one positive test","",6.320000171661377,"defined organic","ear Zymbals gland; nervous system; oral cavity; small intestine; stomach","","","harderian gland; stomach","","C=CC#N","active","","",,"","rat; mouse","ear Zymbals gland; mammary gland; nasal cavity; nervous system; oral cavity; small intestine; stomach",20029.0, -"O=C(N[C@@H]([C@H](OC([C@@H]5[C@@H](C)C)=O)C)C(N[C@H]([C@@H](C)CC)C(N4CCC[C@@](C(N(C)CC(N5C)=O)=O)4[H])=O)=O)C(C(C(OC2=C(C)C=C3)=C(C)C1=O)=NC2=C3C(N[C@@H]([C@H](OC([C@@H]7[C@H](C)C)=O)C)C(N[C@H](C(C)C)C(N6CCC[C@@](C(N(C)CC(N7C)=O)=O)6[H])=O)=O)=O)=C1N","InChI=1/C63H88N12O16/c1-17-31(8)44-61(86)75-25-19-21-38(75)59(84)71(14)27-40(77)73(16)50(30(6)7)63(88)90-35(12)46(57(82)67-44)69-55(80)41-42(64)51(78)33(10)53-48(41)65-47-36(23-22-32(9)52(47)91-53)54(79)68-45-34(11)89-62(87)49(29(4)5)72(15)39(76)26-70(13)58(83)37-20-18-24-74(37)60(85)43(28(2)3)66-56(45)81/h22-23,28-31,34-35,37-38,43-46,49-50H,17-21,24-27,64H2,1-16H3,(H,66,81)(H,67,82)(H,68,79)(H,69,80)/t31-,34+,35+,37-,38-,43+,44+,45-,46-,49-,50-/m0/s1/f/h66-69H","","representative component in mixture","Actinomycin C",0.0,,,"inactive","no positive results",1269.443603515625,,"",30.0,"2-amino-4,6-dimethyl-3-oxo-N~9~-[(6S,9R,10S,13R,18aS)-2,5,9-trimethyl-6,13-bis(1-methylethyl)-1,4,7,11,14-pentaoxohexadecahydro-1H-pyrrolo[2,1-i][1,4,7,10,13]oxatetraazacyclohexadecin-10-yl]-N~1~-{(6S,9R,10S,13R,18aS)-2,5,9-trimethyl-6-(1-methylethyl)","",,"inactive","",,"QCXJFISCRQIYID-IFORFJDKDU","mixture of actinomycin C1 [50-76-0] (10%), actinomycin C2 [2612-14-8] (45%), and actinomycin C3 [6156-47-4] (45%), structure shown C2, stereochem","","8052-16-2",20030.0,"","","C63H88N12O16",,"mixture or formulation",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","31_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ACTINOMYCIN%20C.html","","",,"defined organic","no positive results","","","","","O=C(N[C@@H]([C@H](OC([C@@H]5[C@@H](C)C)=O)C)C(N[C@H]([C@@H](C)CC)C(N4CCC[C@@](C(N(C)CC(N5C)=O)=O)4[H])=O)=O)C(C(C(OC2=C(C)C=C3)=C(C)C1=O)=NC2=C3C(N[C@@H]([C@H](OC([C@@H]7[C@H](C)C)=O)C)C(N[C@H](C(C)C)C(N6CCC[C@@](C(N(C)CC(N7C)=O)=O)6[H])=O)=O)=O)=C1N","","","",,"","rat","",20030.0, -"C12C(OC3=C(N=1)C(=CC=C3C)C(N[C@@H]4C(N[C@@H](C(N5[C@@H](CCC5)C(N(CC(N([C@H](C(O[C@H]4C)=O)C(C)C)C)=O)C)=O)=O)C(C)C)=O)=O)=C(C(C(=C2C(N[C@@H]6C(N[C@@H](C(N7[C@@H](CCC7)C(N(CC(N([C@H](C(O[C@H]6C)=O)C(C)C)C)=O)C)=O)=O)C(C)C)=O)=O)N)=O)C","InChI=1/C62H86N12O16/c1-27(2)42-59(84)73-23-17-19-36(73)57(82)69(13)25-38(75)71(15)48(29(5)6)61(86)88-33(11)44(55(80)65-42)67-53(78)35-22-21-31(9)51-46(35)64-47-40(41(63)50(77)32(10)52(47)90-51)54(79)68-45-34(12)89-62(87)49(30(7)8)72(16)39(76)26-70(14)58(83)37-20-18-24-74(37)60(85)43(28(3)4)66-56(45)81/h21-22,27-30,33-34,36-37,42-45,48-49H,17-20,23-26,63H2,1-16H3,(H,65,80)(H,66,81)(H,67,78)(H,68,79)/t33-,34-,36+,37+,42-,43-,44+,45+,48+,49+/m1/s1/f/h65-68H","active","tested chemical","Actinomycin D",88.0,,0.0,"active","positive test results only by intraperitoneal or intravenous injection; TD50 is harmonic mean of more than one positive test",1255.4169921875,,"",31.0,"2-amino-4,6-dimethyl-3-oxo-N,N'-bis[(6S,9R,10S,13R,18aS)-2,5,9-trimethyl-6,13-bis(1-methylethyl)-1,4,7,11,14-pentaoxohexadecahydro-1H-pyrrolo[2,1-i][1,4,7,10,13]oxatetraazacyclohexadecin-10-yl]-3H-phenoxazine-1,9-dicarboxamide","",,"active","inactive",,"RJURFGZVJUQBHK-HQANWYOLDQ","stereochem","multisex active","50-76-0",20031.0,"","","C62H86N12O16",0.0010999999940395355,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","TD50_Rat_Note modified v5a","","32_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ACTINOMYCIN%20D.html","","",,"defined organic","peritoneal cavity","","","","","C12C(OC3=C(N=1)C(=CC=C3C)C(N[C@@H]4C(N[C@@H](C(N5[C@@H](CCC5)C(N(CC(N([C@H](C(O[C@H]4C)=O)C(C)C)C)=O)C)=O)=O)C(C)C)=O)=O)=C(C(C(=C2C(N[C@@H]6C(N[C@@H](C(N7[C@@H](CCC7)C(N(CC(N([C@H](C(O[C@H]6C)=O)C(C)C)C)=O)C)=O)=O)C(C)C)=O)=O)N)=O)C","","","",,"","rat","peritoneal cavity",20031.0, -"NC(=O)CCCCC(=O)N","InChI=1/C6H12N2O2/c7-5(9)3-1-2-4-6(8)10/h1-4H2,(H2,7,9)(H2,8,10)/f/h7-8H2","inactive","tested chemical","Adipamide",0.0,,,"inactive","no positive results",144.1717071533203,,"",32.0,"hexanediamide","",,"inactive","inactive",0.0,"GVNWZKBFMFUVNX-UNXFWZPKCL","","multisex inactive; multispecies inactive","628-94-4",20032.0,"no positive results","","C6H12N2O2",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","33_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ADIPAMIDE.html","no positive results","",,"defined organic","no positive results","","","no positive results","","NC(=O)CCCCC(=O)N","inactive","","",,"","rat; mouse","no positive results",20032.0, -"O=C(N)\C(C2=CC=CO2)=C/C1=CC=C([N+]([O-])=O)O1","InChI=1/C11H8N2O5/c12-11(14)8(9-2-1-5-17-9)6-7-3-4-10(18-7)13(15)16/h1-6H,(H2,12,14)/b8-6-/f/h12H2","active","tested chemical","AF-2",35.0,164.0,0.11800000071525574,"active","TD50 is harmonic mean of more than one positive test; greater than ten-fold variation among TD50 values for positive results",248.1916046142578,,"",33.0,"(2Z)-2-(furan-2-yl)-3-(5-nitrofuran-2-yl)prop-2-enamide","",,"active","active",31.0,"LYAHJFZLDZDIOH-SDXKRDFODJ","stereochem","multisite active; multisex active; multispecies active","3688-53-7",20033.0,"stomach","","C11H8N2O5",29.399999618530273,"single chemical compound",30.0,"TD50; Tumor Target Sites","","parent","Carcinogenicity","structure modified v5b","","34_CPDBAS_v5d",0.527999997138977,"","http://potency.berkeley.edu/chempages/AF-2.html","TD50 is harmonic mean of more than one positive test; greater than ten-fold variation among TD50 values for positive results","active",131.0,"defined organic","mammary gland","stomach","","stomach","","O=C(N)\C(C2=CC=CO2)=C/C1=CC=C([N+]([O-])=O)O1","active","","esophagus; stomach",0.6610000133514404,"TD50 is harmonic mean of more than one positive test","rat; mouse; hamster","mammary gland",20033.0, -"O=C(O2)C([C@@H](CC3)O)=C3C1=C2C4=C(O[C@@]5([H])[C@]([H])4C=CO5)C=C1OC","InChI=1/C17H14O6/c1-20-10-6-11-14(8-4-5-21-17(8)22-11)15-13(10)7-2-3-9(18)12(7)16(19)23-15/h4-6,8-9,17-18H,2-3H2,1H3/t8-,9+,17-/m0/s1","","tested chemical","Aflatoxicol",78.0,,0.0,"active","",314.29400634765625,,"",34.0,"(1R,6aS,9aS)-1-hydroxy-4-(methyloxy)-2,3,6a,9a-tetrahydrocyclopenta[c]furo[3',2':4,5]furo[2,3-h]chromen-11(1H)-one","",,"active","active",,"WYIWLDSPNDMZIT-BTKFHORUBM","stereochem","","29611-03-8",20034.0,"","","C17H14O6",0.0024999999441206455,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","35_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/AFLATOXICOL.html","","",,"defined organic","liver","","","","","O=C(O2)C([C@@H](CC3)O)=C3C1=C2C4=C(O[C@@]5([H])[C@]([H])4C=CO5)C=C1OC","","","",,"","rat","",20034.0, -"C12=C3C(C4=C(C(O3)=O)C(=O)CC4)=C(C=C1OC5C2C=CO5)OC","InChI=1/C17H12O6/c1-20-10-6-11-14(8-4-5-21-17(8)22-11)15-13(10)7-2-3-9(18)12(7)16(19)23-15/h4-6,8,17H,2-3H2,1H3","active","tested chemical","Aflatoxin B1",77.0,,0.0,"active","TD50 is harmonic mean of more than one positive test; harmonic mean of TD50 includes a value for upper 99% confidence limit from study with 100% tumor incidence but no lifetable; greater than ten-fold variation among TD50 values for positive results",312.2735900878906,,"",35.0,"4-(methyloxy)-2,3,6a,9a-tetrahydrocyclopenta[c]furo[3',2':4,5]furo[2,3-h]chromene-1,11-dione","",0.020099999383091927,"active","active",0.0,"OQIQSTLJSLGHID-UHFFFAOYAB","","multisite active; multisex active; multispecies active","1162-65-8",20035.0,"no positive results","Tree Shrew (TD50=0.0269; Target Sites=liver)","C17H12O6",0.0031999999191612005,"single chemical compound",,"TD50; Tumor Target Sites","gall bladder; liver; vascular system","parent","Carcinogenicity","TD50_Rat_Note modified v5a","gall bladder; liver; vascular system","36_CPDBAS_v5d",,"active","http://potency.berkeley.edu/chempages/AFLATOXIN%20B1.html","no positive results","",,"defined organic","kidney; large intestine; liver","","","no positive results","","C12=C3C(C4=C(C(O3)=O)C(=O)CC4)=C(C=C1OC5C2C=CO5)OC","inactive","","",,"","rat; mouse; rhesus; cynomolgus; tree shrew","large intestine; liver",20035.0,0.008200000040233135 -"O=C1C(C(OCC5)=O)=C5C(C(OC)=C4)=C(C2=C4OC3C2C=CO3)O1","InChI=1/C17H12O7/c1-20-9-6-10-12(8-3-5-22-17(8)23-10)14-11(9)7-2-4-21-15(18)13(7)16(19)24-14/h3,5-6,8,17H,2,4H2,1H3","active","representative component in mixture","Aflatoxin, crude",50.0,,,"active","TD50 is harmonic mean of more than one positive test; TD50_Rat_mmol was not calculated for this mixture, but Activiity Score is assigned value of "50" to indicate active",328.27301025390625,,"",36.0,"5-(methyloxy)-3,4,7a,10a-tetrahydro-1H,12H-furo[3',2':4,5]furo[2,3-h]pyrano[3,4-c]chromene-1,12-dione","",,"active","",50.0,"XWIYFDMXXLINPU-UHFFFAOYAD","mixture of aflatoxins, structure shown G1 [1165-39-5]","multisite active; multispecies active","1402-68-2",20036.0,"hematopoietic system","","C17H12O7",0.003000000026077032,"mixture or formulation",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","TD50_Rat_mmol and TD50_Mouse_mmol conversions from mg values not provided due substance being a mixture","","37_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/AFLATOXIN,%20CRUDE.html","","",0.34299999475479126,"defined organic","liver","","","","","O=C1C(C(OCC5)=O)=C5C(C(OC)=C4)=C(C2=C4OC3C2C=CO3)O1","active","","",,"","rat; mouse","",20036.0, -"","InChI=1//","inactive","no structure","Agar",0.0,,,"inactive","no positive results",,,"",,"","TR 230",,"inactive","",0.0,"MOSFIJXAXDLOML-UHFFFAOYAM","","multisex inactive; multispecies inactive","9002-18-0",20037.0,"no positive results","","",,"mixture or formulation",,"TD50; Tumor Target Sites","","","Carcinogenicity","","","38_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/AGAR.html","no positive results","",,"no structure","no positive results","","","no positive results","","","inactive","","",,"","rat; mouse","no positive results",20037.0, -"C1(OCC=C)=CC=C(CC(=O)O)C=C1Cl","InChI=1/C11H11ClO3/c1-2-5-15-10-4-3-8(6-9(10)12)7-11(13)14/h2-4,6H,1,5,7H2,(H,13,14)/f/h13H","inactive","tested chemical","Alclofenac",0.0,,,"inactive","no positive results",226.6562042236328,,"",38.0,"[3-chloro-4-(prop-2-en-1-yloxy)phenyl]acetic acid","",,"inactive","",,"ARHWPKZXBHOEEE-NDKGDYFDCL","","multisex inactive","22131-79-9",20038.0,"","","C11H11ClO3",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","Rat added v2a","","39_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ALCLOFENAC.html","","",,"defined organic","no positive results","","","","","C1(OCC=C)=CC=C(CC(=O)O)C=C1Cl","","","",,"","rat","no positive results",20038.0, -"CC(C=NOC(=O)NC)(SC)C","InChI=1/C7H14N2O2S/c1-7(2,12-4)5-9-11-6(10)8-3/h5H,1-4H3,(H,8,10)/b9-5+/f/h8H","inactive","tested chemical","Aldicarb",0.0,,,"inactive","no positive results",190.2633056640625,,"",39.0,"(1E)-2-methyl-2-(methylthio)propanal O-[(methylamino)carbonyl]oxime","TR 136",,"inactive","inactive",0.0,"QGLZXHRNAYXIBU-RVKZGWQMDN","","multisex inactive; multispecies inactive","116-06-3",20039.0,"no positive results","","C7H14N2O2S",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","40_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ALDICARB.html","no positive results","",,"defined organic","no positive results","","","no positive results","","CC(C=NOC(=O)NC)(SC)C","inactive","","",,"","rat; mouse","no positive results",39223.0, -"ClC(C(Cl)(Cl)C43Cl)(C(Cl)=C4Cl)C1C3C2C=CC1C2","InChI=1/C12H8Cl6/c13-8-9(14)11(16)7-5-2-1-4(3-5)6(7)10(8,15)12(11,17)18/h1-2,4-7H,3H2","","tested chemical","Aldrin",0.0,,,"active","no positive results",364.909912109375,,"liver",40.0,"1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-1,4:5,8-dimethanonaphthalene","TR 21; final call in CPDB differs due to additional data",,"inactive","inactive",56.0,"QBYJBZPUGVGKQQ-UHFFFAOYAT","stereochem","","309-00-2",20040.0,"liver","","C12H8Cl6",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","41_CPDBAS_v5d",0.0035000001080334187,"","http://potency.berkeley.edu/chempages/ALDRIN.html","TD50 is harmonic mean of more than one positive test","",1.2699999809265137,"defined organic","no positive results","","","","","ClC(C(Cl)(Cl)C43Cl)(C(Cl)=C4Cl)C1C3C2C=CC1C2","active","","",,"","rat; mouse","no positive results",20040.0, -"O=S(C1=CC=C(C(C)CCCCCCCCCC)C=C1)(O)=O","InChI=1/C18H30O3S.Na/c1-3-4-5-6-7-8-9-10-11-16(2)17-12-14-18(15-13-17)22(19,20)21;/h12-16H,3-11H2,1-2H3,(H,19,20,21);/q;+1/p-1/fC18H29O3S.Na/q-1;m","inactive","representative isomer in mixture","Alkylbenzenesulfonate, linear",0.0,,,"inactive","no positive results",348.4757995605469,,"",41.0,"sodium 4-(dodecan-2-yl)benzenesulfonate","",,"inactive","",,"GHRHULTYHYEOQB-MFZBKVKLCJ","mixture of C10-13 alkylbenzenesulfonates average 11.6; with phenyl attachment varying in apprpx equal amounts between C-2,3,4,5 or 6; structure shown C12 attached at C2","multisex inactive","42615-29-2",20041.0,"","","C18H29NaO3S",,"mixture or formulation",,"TD50; Tumor Target Sites","","salt Na","Carcinogenicity","structure modified v5b","","42_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ALKYLBENZENESULFONATE,%20LINEAR.html","","",,"defined organic","no positive results","","","","","O=S(C1=CC=C(C(C)CCCCCCCCCC)C=C1)([O-])=O.[Na+]","","","",,"","rat","no positive results",20041.0, -"[O-][N+](C)(C)CCCCCCCCCC","InChI=1/C12H27NO/c1-4-5-6-7-8-9-10-11-12-13(2,3)14/h4-12H2,1-3H3","inactive","representative isomer in mixture","Alkyldimethylamine oxides, commercial grade",0.0,,,"inactive","no positive results",201.34890747070312,,"",42.0,"decyl(dimethyl)amine oxide","",,"inactive","",,"ZRKZFNZPJKEWPC-UHFFFAOYAU","mixture, C10-16 [70592-80-2], C12-18 [68955-55-5], C12-16 [68439-70-3], C14-18 [68390-99-8], structure shown C-12","multisex inactive","NOCAS",20042.0,"","","C12H27NO",,"mixture or formulation",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","43_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ALKYLDIMETHYLAMINE%20OXIDES,%20COMMERCIAL%20GRADE.html","","",,"defined organic","no positive results","","","","","[O-][N+](C)(C)CCCCCCCCCC","","","",,"","rat","no positive results",20042.0, -"O=C1C(NC(=O)N1)NC(=O)N","InChI=1/C4H6N4O3/c5-3(10)6-1-2(9)8-4(11)7-1/h1H,(H3,5,6,10)(H2,7,8,9,11)/f/h6-8H,5H2","inactive","tested chemical","Allantoin",0.0,,,"inactive","no positive results",158.11639404296875,,"",43.0,"1-(2,5-dioxoimidazolidin-4-yl)urea","",,"inactive","",,"POJWUDADGALRAB-BANUENCFCI","","multisex inactive","97-59-6",20043.0,"","","C4H6N4O3",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","44_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ALLANTOIN.html","","",,"defined organic","no positive results","","","","","O=C1C(NC(=O)N1)NC(=O)N","","","",,"","rat","no positive results",20043.0, -"C=CCO","InChI=1/C3H6O/c1-2-3-4/h2,4H,1,3H2","inactive","tested chemical","Allyl alcohol",0.0,,,"inactive","no positive results",58.0791015625,,"",44.0,"prop-2-en-1-ol","",,"inactive","inactive",,"XXROGKLTLUQVRX-UHFFFAOYAC","","multisex inactive","107-18-6",20044.0,"","","C3H6O",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","Mutagenicity_SAL_CPDB added v3a","","45_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ALLYL%20ALCOHOL.html","","",,"defined organic","no positive results","","","","","C=CCO","","","",,"","rat","no positive results",20044.0, -"C=CCCl","InChI=1/C3H5Cl/c1-2-3-4/h2H,1,3H2","inactive","tested chemical","Allyl chloride",0.0,,,"inactive","only experiment is NCI NTP bioassay inadequate",76.5248031616211,,"",45.0,"3-chloroprop-1-ene","TR 73",,"unspecified","active",0.0,"OSDWBNJEKMUWAV-UHFFFAOYAQ","","multisex inactive","107-05-1",20045.0,"no positive results","","C3H5Cl",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","ActivityOutcome_CPDBAS_Mouse modified v5d","","46_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ALLYL%20CHLORIDE.html","no positive results","",,"defined organic","NTP bioassay inadequate","","","no positive results","","C=CCCl","inactive","","",,"","rat; mouse","NTP bioassay inadequate",39231.0, -"C=CCOCC1CO1","InChI=1/C6H10O2/c1-2-3-7-4-6-5-8-6/h2,6H,1,3-5H2","","tested chemical","Allyl glycidyl ether",0.0,,,"active","no positive results",114.14240264892578,,"",46.0,"2-[(allyloxy)methyl]oxirane","TR 376",,"inactive","active",26.0,"LSWYGACWGAICNM-UHFFFAOYAR","","","106-92-3",20046.0,"nasal cavity","","C6H10O2",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","47_CPDBAS_v5d",1.590000033378601,"","http://potency.berkeley.edu/chempages/ALLYL%20GLYCIDYL%20ETHER.html","","",182.0,"defined organic","no positive results","","","no positive results","","C=CCOCC1CO1","active","","",,"","rat; mouse","no positive results",39232.0, -"C=CCN=C=S","InChI=1/C4H5NS/c1-2-3-5-4-6/h2H,1,3H2","","tested chemical","Allyl isothiocyanate",26.0,,0.9679999947547913,"active","",99.1541976928711,,"",47.0,"3-isothiocyanatoprop-1-ene","TR 234",,"active","active",0.0,"ZOJBYZNEUISWFT-UHFFFAOYAS","","","57-06-7",20047.0,"no positive results","","C4H5NS",96.0,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","48_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ALLYL%20ISOTHIOCYANATE.html","no positive results","",,"defined organic","urinary bladder","","","no positive results","","C=CCN=C=S","inactive","","",,"","rat; mouse","no positive results",20047.0, -"O=C(CC(C)C)OCC=C","InChI=1/C8H14O2/c1-4-5-10-8(9)6-7(2)3/h4,7H,1,5-6H2,2-3H3","active","tested chemical","Allyl isovalerate",26.0,,0.8650000095367432,"active","",142.1956024169922,,"",48.0,"allyl 3-methylbutanoate","TR 253",,"active","inactive",32.0,"HOMAGVUCNZNWBC-UHFFFAOYAF","","multisex active; multispecies active","2835-39-4",20048.0,"no positive results","","C8H14O2",123.0,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","49_CPDBAS_v5d",0.44200000166893005,"","http://potency.berkeley.edu/chempages/ALLYL%20ISOVALERATE.html","","",62.79999923706055,"defined organic","hematopoietic system","","","hematopoietic system","","O=C(CC(C)C)OCC=C","active","","",,"","rat; mouse","no positive results",39233.0, -"NC(=O)N(CC=C)N=O","InChI=1/C4H7N3O2/c1-2-3-7(6-9)4(5)8/h2H,1,3H2,(H2,5,8)/f/h5H2","active","tested chemical","1-Allyl-1-nitrosourea",52.0,,0.0026000000070780516,"active","TD50 is harmonic mean of more than one positive test",129.11819458007812,,"",49.0,"1-nitroso-1-prop-2-en-1-ylurea","",,"active","",,"WBBDVRPSJSJSPC-GLFQYTTQCA","","multisite active; multisex active","760-56-5",20049.0,"","","C4H7N3O2",0.3409999907016754,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","50_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/1-ALLYL-1-NITROSOUREA.html","","",,"defined organic","large intestine; lung; stomach","","","","","NC(=O)N(CC=C)N=O","","","",,"","rat","mammary gland; stomach; uterus",20049.0, -"C=CCNN","InChI=1/C3H8N2.ClH/c1-2-3-5-4;/h2,5H,1,3-4H2;1H","active","tested chemical","Allylhydrazine.HCl",,,,"active","",108.57050323486328,,"",50.0,"prop-2-en-1-ylhydrazine hydrochloride","",,"","",34.0,"PWGPATVPEGLIAN-UHFFFAOYAO","parent [7422-78-8]","multisite active; multisex active","52207-83-7",20050.0,"lung","","C3H9ClN2",,"single chemical compound",,"TD50; Tumor Target Sites","","complex HCl","Carcinogenicity","","","51_CPDBAS_v5d",0.3149999976158142,"","http://potency.berkeley.edu/chempages/ALLYLHYDRAZINE.HCl.html","TD50 is harmonic mean of more than one positive test","",34.20000076293945,"defined organic","","","","lung; vascular system","","C=CCNN.HCl","active","","",,"","mouse","",20050.0, -"","InChI=1/Al.K.2H2O4S/c;;2*1-5(2,3)4/h;;2*(H2,1,2,3,4)/q+3;+1;;/p-4/fAl.K.2O4S/q2m;2*-2","inactive","tested chemical","Aluminum potassium sulfate",0.0,,,"inactive","no positive results",258.18670654296875,,"",51.0,"aluminum potassium sulfate","",,"inactive","",0.0,"GRLPQNLYRHEGIJ-MHPHYJPNCZ","","multisex inactive; multispecies inactive","10043-67-1",20051.0,"no positive results","","AlKO8S2",,"single chemical compound",,"TD50; Tumor Target Sites","","","Carcinogenicity","","","52_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ALUMINUM%20POTASSIUM%20SULFATE.html","no positive results","",,"inorganic","no positive results","","","no positive results","","O=S(=O)([O-])[O-].O=S(=O)([O-])[O-].[Al+3].[K+]","inactive","","",,"","rat; mouse","no positive results",39234.0, -"O=C1C2=C(C(=CC(=C2C(=O)C3=C1C=CC=C3)Br)Br)N","InChI=1/C14H7Br2NO2/c15-8-5-9(16)12(17)11-10(8)13(18)6-3-1-2-4-7(6)14(11)19/h1-5H,17H2","active","tested chemical","1-Amino-2,4-dibromoanthraquinone",35.0,,0.12099999934434891,"active","TD50 is harmonic mean of more than one positive test",381.0188903808594,,"",52.0,"1-amino-2,4-dibromo-9,10-anthraquinone","TR 383",,"active","active",27.0,"ZINRVIQBCHAZMM-UHFFFAOYAC","","multisite active; multisex active; multispecies active","81-49-2",20052.0,"liver; lung; stomach","","C14H7Br2NO2",46.0,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","53_CPDBAS_v5d",1.25,"","http://potency.berkeley.edu/chempages/1-AMINO-2,4-DIBROMOANTHRAQUINONE.html","TD50 is harmonic mean of more than one positive test","",477.0,"defined organic","kidney; large intestine; liver; urinary bladder","","","liver; lung; stomach","","O=C1C2=C(C(=CC(=C2C(=O)C3=C1C=CC=C3)Br)Br)N","active","","",,"","rat; mouse","kidney; large intestine; liver; urinary bladder",39235.0, -"NC1=C(C=CC(=C1)NC(=O)C)OCC","InChI=1/C10H14N2O2/c1-3-14-10-5-4-8(6-9(10)11)12-7(2)13/h4-6H,3,11H2,1-2H3,(H,12,13)/f/h12H","","tested chemical","3-Amino-4-ethoxyacetanilide",0.0,,,"active","no positive results",194.2303924560547,,"",53.0,"N-[3-amino-4-(ethyloxy)phenyl]acetamide","TR 112",,"inactive","active",17.0,"XTXFAVHDQCHWCS-XWKXFZRBCV","","","17026-81-2",20053.0,"thyroid gland","","C10H14N2O2",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","54_CPDBAS_v5d",10.699999809265137,"","http://potency.berkeley.edu/chempages/3-AMINO-4-ETHOXYACETANILIDE.html","","",2070.0,"defined organic","no positive results","","","no positive results","","NC1=C(C=CC(=C1)NC(=O)C)OCC","active","","",,"","rat; mouse","no positive results",20053.0, -"CCN1(C2C(=CC=CC=2)C3=C1C=CC(=C3)N)","InChI=1/C14H14N2.ClH/c1-2-16-13-6-4-3-5-11(13)12-9-10(15)7-8-14(12)16;/h3-9H,2,15H2,1H3;1H","active","tested chemical","3-Amino-9-ethylcarbazole.HCl",32.0,,0.23199999332427979,"active","TD50 is harmonic mean of more than one positive test",246.7353057861328,,"",54.0,"9-ethyl-9H-carbazol-3-amine hydrochloride","TR 93",,"active","active",37.0,"UUYSTZWIFZYHRM-UHFFFAOYAB","parent [132-32-1]","multisite active; multisex active; multispecies active","6109-97-3",20054.0,"liver","","C14H15ClN2",57.20000076293945,"single chemical compound",,"TD50; Tumor Target Sites","","complex HCl","Carcinogenicity","","","55_CPDBAS_v5d",0.15600000321865082,"","http://potency.berkeley.edu/chempages/3-AMINO-9-ETHYLCARBAZOLE.HCl.html","TD50 is harmonic mean of more than one positive test","",38.599998474121094,"defined organic","ear Zymbals gland; liver; skin","","","liver","","CCN1(C2C(=CC=CC=2)C3=C1C=CC(=C3)N).[H]Cl","active","","",,"","rat; mouse","ear Zymbals gland; liver; uterus",20054.0, -"CCN1(C2C(=CC=CC=2)C3=C1C=CC(=C3)N)","InChI=1/C14H14N2/c1-2-16-13-6-4-3-5-11(13)12-9-10(15)7-8-14(12)16/h3-9H,2,15H2,1H3","active","representative component in mixture","3-Amino-9-ethylcarbazole mixture",50.0,,,"active","TD50 is harmonic mean of more than one positive test; TD50_Rat_mmol was not calculated for this mixture, but Activiity Score is assigned value of "50" to indicate active",210.27439880371094,,"",55.0,"9-ethyl-9H-carbazol-3-amine","TR 93",,"active","active",50.0,"OXEUETBFKVCRNP-UHFFFAOYAV","mixture, structure shown 3-Amino-9-ethylcarbazole [132-32-1]","multisite active; multisex active; multispecies active","NOCAS",20055.0,"liver","","C14H15N2",26.399999618530273,"mixture or formulation",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","TD50_Rat_mmol and TD50_Mouse_mmol conversions from mg values not provided due substance being a mixture","","56_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/3-AMINO-9-ETHYLCARBAZOLE%20MIXTURE.html","TD50 is harmonic mean of more than one positive test","",38.0,"defined organic","ear Zymbals gland; liver; skin","","","liver","","CCN1(C2C(=CC=CC=2)C3=C1C=CC(=C3)N)","active","","",,"","rat; mouse","ear Zymbals gland",20055.0, -"N=C(N)NC1=NC(CSCCNC2=NSN=C2N)=CS1","InChI=1/C9H14N8S3/c10-6-7(17-20-16-6)13-1-2-18-3-5-4-19-9(14-5)15-8(11)12/h4H,1-3H2,(H2,10,16)(H,13,17)(H4,11,12,14,15)/f/h11,13,15H,10,12H2","active","tested chemical","3-Amino-4-[2-[(2-guanidinothiazol-4-yl)methylthio], ethylamino]-1,2,5-thiadiazole",14.0,,15.100000381469727,"active","TD50 is harmonic mean of more than one positive test",330.4560852050781,,"",56.0,"1-{4-[({2-[(4-amino-1,2,5-thiadiazol-3-yl)amino]ethyl}sulfanyl)methyl]-1,3-thiazol-2-yl}guanidine","",,"active","",,"MOMKQYRYLQUFMV-GVMYFUFNCD","BL-6341","multisex active","78441-84-6",20056.0,"","","C9H14N8S3",4990.0,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","Rat added v2a; CPDB lists HCl complex in some instances in tables but referenced study for this chemical does not specify HCl complex - parent is assumed correct","","57_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/3-AMINO-4-[2-[(2-GUANIDINOTHIAZOL-4-YL)METHYLTHIO].html","","",,"defined organic","stomach","","","","","N=C(N)NC1=NC(CSCCNC2=NSN=C2N)=CS1","","","",,"","rat","stomach",39236.0, -"O=C1C2=C(C(=CC=C2C(=O)C3=C1C=CC=C3)C)N","InChI=1/C15H11NO2/c1-8-6-7-11-12(13(8)16)15(18)10-5-3-2-4-9(10)14(11)17/h2-7H,16H2,1H3","active","tested chemical","1-Amino-2-methylanthraquinone",32.0,,0.25,"active","TD50 is harmonic mean of more than one positive test",237.2532958984375,,"",57.0,"1-amino-2-methylanthracene-9,10-dione","TR 111",,"active","active",30.0,"ZLCUIOWQYBYEBG-UHFFFAOYAP","C.I. 60700","multisite active; multisex active; multispecies active","82-28-0",20057.0,"no positive results","","C15H11NO2",59.20000076293945,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","58_CPDBAS_v5d",0.7329999804496765,"","http://potency.berkeley.edu/chempages/1-AMINO-2-METHYLANTHRAQUINONE.html","","",174.0,"defined organic","kidney; liver","","","liver","","O=C1C2=C(C(=CC=C2C(=O)C3=C1C=CC=C3)C)N","active","","",,"","rat; mouse","liver",20057.0, -"O1C(=NN=C1C2OC(=CC=2)[N+](=O)[O-])N","InChI=1/C6H4N4O4/c7-6-9-8-5(14-6)3-1-2-4(13-3)10(11)12/h1-2H,(H2,7,9)/f/h7H2","active","tested chemical","2-Amino-5-(5-nitro-2-furyl)-1,3,4-oxadiazole",44.0,,0.018699999898672104,"active","",196.1219940185547,,"",58.0,"5-(5-nitrofuran-2-yl)-1,3,4-oxadiazol-2-amine","",,"active","",,"VTWQUFUBSCXPOW-IAUQMDSZCD","","multisite active","3775-55-1",20058.0,"","","C6H4N4O4",3.6700000762939453,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","59_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/2-AMINO-5-(5-NITRO-2-FURYL)-1,3,4-OXADIAZOLE.html","","",,"defined organic","","","","","","O1C(=NN=C1C2OC(=CC=2)[N+](=O)[O-])N","","","",,"","rat","kidney; lung; mammary gland; stomach",20058.0, -"NC1=NN=C(C2=CC=C([N+]([O-])=O)O2)S1","InChI=1/C6H4N4O3S/c7-6-9-8-5(14-6)3-1-2-4(13-3)10(11)12/h1-2H,(H2,7,9)/f/h7H2","active","tested chemical","2-Amino-5-(5-nitro-2-furyl)-1,3,4-thiadiazole",52.0,,0.003100000089034438,"active","",212.18260192871094,,"",59.0,"5-(5-nitrofuran-2-yl)-1,3,4-thiadiazol-2-amine","",,"active","",,"SXZZHGJWUBJKHH-IAUQMDSZCG","","multisite active","712-68-5",20059.0,"","","C6H4N4O3S",0.6620000004768372,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","60_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/2-AMINO-5-(5-NITRO-2-FURYL)-1,3,4-THIADIAZOLE.html","","",,"defined organic","","","","","","NC1=NN=C(C2=CC=C([N+]([O-])=O)O2)S1","","","",,"","rat","kidney; lung; mammary gland; stomach",20059.0, -"NC1=NC(C2=CC=C([N+]([O-])=O)O2)=CS1","InChI=1/C7H5N3O3S/c8-7-9-4(3-14-7)5-1-2-6(13-5)10(11)12/h1-3H,(H2,8,9)/f/h8H2","active","tested chemical","2-Amino-4-(5-nitro-2-furyl)thiazole",42.0,,0.027699999511241913,"active","",211.19479370117188,,"",60.0,"4-(5-nitrofuran-2-yl)-1,3-thiazol-2-amine","",,"active","active",44.0,"ZAVLMIGIVYJYMU-FSHFIPFOCT","","multisite active; multispecies active","38514-71-5",20060.0,"","","C7H5N3O3S",5.849999904632568,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","61_CPDBAS_v5d",0.037300001829862595,"","http://potency.berkeley.edu/chempages/2-AMINO-4-(5-NITRO-2-FURYL)THIAZOLE.html","","",7.869999885559082,"defined organic","","","","stomach","","NC1=NC(C2=CC=C([N+]([O-])=O)O2)=CS1","active","","",,"","rat; mouse","stomach; urinary bladder",39237.0, -"NC1=NC(/C=C/C2=CC=C([N+]([O-])=O)O2)=NO1","InChI=1/C8H6N4O4/c9-8-10-6(11-16-8)3-1-5-2-4-7(15-5)12(13)14/h1-4H,(H2,9,10,11)/b3-1+/f/h9H2","active","tested chemical","trans-5-Amino-3[2-(5-nitro-2-furyl)vinyl]-1,2,4-oxadiazole",,,,"active","",222.15980529785156,,"",61.0,"3-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-1,2,4-oxadiazol-5-amine","",,"","",32.0,"RMZNNIOKNRDECR-OYGOROAMDP","stereochem","multisite active; multisex active","28754-68-9",20061.0,"hematopoietic system; stomach","","C8H6N4O4",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","62_CPDBAS_v5d",0.5040000081062317,"","http://potency.berkeley.edu/chempages/trans-5-AMINO-3[2-(5-NITRO-2-FURYL)VINYL]-1,2,4-OX.html","TD50 is harmonic mean of more than one positive test","",112.0,"defined organic","","","","hematopoietic system; stomach","","NC1=NC(/C=C/C2=CC=C([N+]([O-])=O)O2)=NO1","active","","",,"","mouse","",20061.0, -"O=[N+](C1=CC(=C(C=C1)O)N)[O-]","InChI=1/C6H6N2O3/c7-5-3-4(8(10)11)1-2-6(5)9/h1-3,9H,7H2","","tested chemical","2-Amino-4-nitrophenol",18.0,,5.440000057220459,"active","",154.12339782714844,,"",62.0,"2-amino-4-nitrophenol","TR 339",,"active","active",0.0,"VLZVIIYRNMWPSN-UHFFFAOYAN","","","99-57-0",20062.0,"no positive results","","C6H6N2O3",839.0,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","63_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/2-AMINO-4-NITROPHENOL.html","no positive results","",,"defined organic","kidney","","","no positive results","","O=[N+](C1=CC(=C(C=C1)O)N)[O-]","inactive","","",,"","rat; mouse","no positive results",20062.0, -"O=[N+](C1=CC(=C(C=C1)N)O)[O-]","InChI=1/C6H6N2O3/c7-5-2-1-4(8(10)11)3-6(5)9/h1-3,9H,7H2","","tested chemical","2-Amino-5-nitrophenol",27.0,,0.7200000286102295,"active","",154.12339782714844,,"",63.0,"2-amino-5-nitrophenol","TR 334",,"active","active",0.0,"DOPJTDJKZNWLRB-UHFFFAOYAU","","","121-88-0",20063.0,"no positive results","","C6H6N2O3",111.0,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","64_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/2-AMINO-5-NITROPHENOL.html","no positive results","",,"defined organic","pancreas","","","no positive results","","O=[N+](C1=CC(=C(C=C1)N)O)[O-]","inactive","","",,"","rat; mouse","no positive results",20063.0, -"OC1=C(C=C(C=C1)N)[N+](=O)[O-]","InChI=1/C6H6N2O3/c7-4-1-2-6(9)5(3-4)8(10)11/h1-3,9H,7H2","","tested chemical","4-Amino-2-nitrophenol",23.0,,2.0,"active","",154.12339782714844,,"",64.0,"4-amino-2-nitrophenol","TR 94",,"active","active",0.0,"WHODQVWERNSQEO-UHFFFAOYAM","","","119-34-6",20064.0,"no positive results","","C6H6N2O3",309.0,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","65_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/4-AMINO-2-NITROPHENOL.html","no positive results","",,"defined organic","urinary bladder","","","no positive results","","OC1=C(C=C(C=C1)N)[N+](=O)[O-]","inactive","","",,"","rat; mouse","no positive results",20064.0, -"NC1=NC(C2=CC=C([N+]([O-])=O)C=C2)=CS1","InChI=1/C9H7N3O2S/c10-9-11-8(5-15-9)6-1-3-7(4-2-6)12(13)14/h1-5H,(H2,10,11)/f/h10H2","","tested chemical","2-Amino-4-(p-nitrophenyl)thiazole",,,,"active","",221.2332000732422,,"",65.0,"4-(4-nitrophenyl)-1,3-thiazol-2-amine","",,"","",43.0,"RIKJWJIWXCUKQV-GIMVELNWCN","","","2104-09-8",20065.0,"","","C9H7N3O2S",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","66_CPDBAS_v5d",0.04500000178813934,"","http://potency.berkeley.edu/chempages/2-AMINO-4-(p-NITROPHENYL)THIAZOLE.html","","",9.949999809265137,"defined organic","","","","hematopoietic system","","NC1=NC(C2=CC=C([N+]([O-])=O)C=C2)=CS1","active","","",,"","mouse","",39238.0, -"O=[N+](C1=CN=C(S1)N)[O-]","InChI=1/C3H3N3O2S/c4-3-5-1-2(9-3)6(7)8/h1H,(H2,4,5)/f/h4H2","active","tested chemical","2-Amino-5-nitrothiazole",31.0,,0.3070000112056732,"active","",145.13980102539062,,"",66.0,"5-nitro-1,3-thiazol-2-amine","TR 53; final call in CPDB differs due to additional data; NTP-assigned level of evidence of carcinogenicity is "positive" in male rat; noting that "these experiments were particularly difficult to evaluate".",,"active","active",0.0,"MIHADVKEHAFNPG-LGEMBHMGCP","","multisite active","121-66-4",20066.0,"no positive results","","C3H3N3O2S",44.599998474121094,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","TargetSites_Rat_Male modified v5d","","67_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/2-AMINO-5-NITROTHIAZOLE.html","no positive results","",,"defined organic","no positive results - CPDB evaluation based on NCI Technical Report","","","no positive results","","O=[N+](C1=CN=C(S1)N)[O-]","inactive","","",,"","rat; mouse","kidney; lung; mammary gland",20066.0, -"NC1=NC(C(C2=CC=CC=C2)O1)=O","InChI=1/C9H8N2O2.Mg.2H2O/c10-9-11-8(12)7(13-9)6-4-2-1-3-5-6;;;/h1-5,7H,(H2,10,11,12);;2*1H2/q;+2;;/p-2/fC9H8N2O2.Mg.2HO/h10H2;;2*1h/q;m;2*-1/rC9H8N2O2.H2MgO2/c10-9-11-8(12)7(13-9)6-4-2-1-3-5-6;2-1-3/h1-5,7H,(H2,10,11,12);2-3H/f/h10H2;","","tested chemical","2-Amino-5-phenyl-2-oxazolin-4-one + Mg(OH)2",0.0,,,"inactive","no positive results",234.49400329589844,,"",67.0,"2-amino-5-phenyl-1,3-oxazol-4(5H)-one - dihydroxymagnesium (1:1)","",,"inactive","",,"JOPOQPCBCUIPFX-VWMXNRJTCY","parent [2152-34-3]","","18968-99-5",20067.0,"","","C9H10MgN2O4",,"single chemical compound",,"TD50; Tumor Target Sites","","complex Mg(OH)2","Carcinogenicity","","","68_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/2-AMINO-5-PHENYL-2-OXAZOLIN-4-ONE%20+%20Mg(OH)2.html","","",,"defined organic","","","","","","NC1=NC(C(C2=CC=CC=C2)O1)=O.O[Mg]O","","","",,"","rat","no positive results",20067.0, -"O=C1C2=CC(=CC=C2C(=O)C3=C1C=CC=C3)N","InChI=1/C14H9NO2/c15-8-5-6-11-12(7-8)14(17)10-4-2-1-3-9(10)13(11)16/h1-7H,15H2","active","tested chemical","2-Aminoanthraquinone ",29.0,,0.4519999921321869,"active","",223.226806640625,,"",68.0,"2-amino-9,10-anthraquinone","TR 144",,"active","active",20.0,"XOGPDSATLSAZEK-UHFFFAOYAH","","multisite active; multisex active; multispecies active","117-79-3",20068.0,"liver","","C14H9NO2",101.0,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","69_CPDBAS_v5d",5.329999923706055,"","http://potency.berkeley.edu/chempages/2-AMINOANTHRAQUINONE.html","TD50 is harmonic mean of more than one positive test","",1190.0,"defined organic","liver","","","hematopoietic system; liver","","O=C1C2=CC(=CC=C2C(=O)C3=C1C=CC=C3)N","active","","",,"","rat; mouse","no positive results",20068.0, -"CC1=C(C=CC=C1)/N=N/C2=CC(=C(C=C2)N)C","InChI=1/C14H15N3/c1-10-5-3-4-6-14(10)17-16-12-7-8-13(15)11(2)9-12/h3-9H,15H2,1-2H3/b17-16+","active","tested chemical","o-Aminoazotoluene",44.0,,0.017899999395012856,"active","TD50 is harmonic mean of more than one positive test",225.28900146484375,,"",69.0,"2-methyl-4-[(E)-(2-methylphenyl)diazenyl]aniline","",,"active","active",0.0,"PFRYFZZSECNQOL-WUKNDPDIBU","","multisex active","97-56-3",20069.0,"no positive results","","C14H15N3",4.039999961853027,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","70_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/o-AMINOAZOTOLUENE.html","no positive results","",,"defined organic","liver","","","","","CC1=C(C=CC=C1)/N=N/C2=CC(=C(C=C2)N)C","inactive","","",,"","rat; mouse","liver",20069.0, -"OC(=O)CCCCCN","InChI=1/C6H13NO2/c7-5-3-1-2-4-6(8)9/h1-5,7H2,(H,8,9)/f/h8H","","tested chemical","6-Aminocaproic acid",0.0,,,"inactive","no positive results",131.1741943359375,,"",70.0,"6-aminohexanoic acid","",,"inactive","",,"SLXKOJJOQWFEFD-FZOZFQFYCD","","","60-32-2",20070.0,"","","C6H13NO2",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","71_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/6-AMINOCAPROIC%20ACID.html","","",,"defined organic","no positive results","","","","","OC(=O)CCCCCN","","","",,"","rat","",20070.0, -"NC1=CC=C(C=C1)C2=CC=CC=C2","InChI=1/C12H11N/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,13H2","active","tested chemical","4-Aminodiphenyl",,,,"active","",169.22239685058594,,"",71.0,"biphenyl-4-amine","",,"","active",50.0,"DMVOXQPQNTYEKQ-UHFFFAOYAX","","multisite active; multisex active","92-67-1",20071.0,"liver; urinary bladder","","C12H11N",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","72_CPDBAS_v5d",0.012400000356137753,"","http://potency.berkeley.edu/chempages/4-AMINODIPHENYL.html","TD50 is harmonic mean of more than one positive test","",2.0999999046325684,"defined organic","","","","liver; urinary bladder","","NC1=CC=C(C=C1)C2=CC=CC=C2","active","","",,"","mouse","",20071.0, -"NC1(=CC=C(C=C1)C2=CC=CC=C2)","InChI=1/C12H11N.ClH/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;/h1-9H,13H2;1H","","tested chemical","4-Aminodiphenyl.HCl",50.0,,0.004800000227987766,"active","",205.68649291992188,,"",72.0,"biphenyl-4-amine hydrochloride","",,"active","active",,"GUHXYHYUBFCYGJ-UHFFFAOYAT","parent [92-67-1]","","2113-61-3",20072.0,"","","C12H12ClN",0.9800000190734863,"single chemical compound",,"TD50; Tumor Target Sites","","complex HCl","Carcinogenicity","","","73_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/4-AMINODIPHENYL.HCl.html","","",,"defined organic","","","","","","NC1(=CC=C(C=C1)C2=CC=CC=C2).[H]Cl","","","",,"","rat","mammary gland",20072.0, -"NC3=CC1=C(C=C3)OC2=C1C=CC=C2","InChI=1/C12H9NO/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12/h1-7H,13H2","active","tested chemical","2-Aminodiphenylene oxide",,,,"active","",183.20919799804688,,"",73.0,"dibenzo[b,d]furan-2-amine","",,"","",47.0,"FFYZMBQLAYDJIG-UHFFFAOYAK","","multisite active; multisex active","3693-22-9",20073.0,"liver; urinary bladder","","C12H9NO",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","74_CPDBAS_v5d",0.023099999874830246,"","http://potency.berkeley.edu/chempages/2-AMINODIPHENYLENE%20OXIDE.html","TD50 is harmonic mean of more than one positive test; harmonic mean of TD50 includes a value for upper 99% confidence limit from study with 100% tumor incidence but no lifetable","",4.239999771118164,"defined organic","","","","liver","","NC3=CC1=C(C=C3)OC2=C1C=CC=C2","active","","",,"","mouse","",39239.0, -"NCC1(CC(=O)O)CCCCC1","InChI=1/C9H17NO2/c10-7-9(6-8(11)12)4-2-1-3-5-9/h1-7,10H2,(H,11,12)/f/h11H","","tested chemical","1-(Aminomethyl)cyclohexaneacetic acid",10.0,,34.20000076293945,"active","",171.23880004882812,,"",74.0,"[1-(aminomethyl)cyclohexyl]acetic acid","",,"active","",,"UGJMXCAKCUNAIE-WXRBYKJCCG","","","60142-96-3",20074.0,"","","C9H17NO2",5850.0,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","Rat added v3a","","75_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/1-(AMINOMETHYL)CYCLOHEXANEACETIC%20ACID.html","","",,"defined organic","pancreas","","","","","NCC1(CC(=O)O)CCCCC1","","","",,"","rat","no positive results",20074.0, -"OCCN(CCO)c1ccc(N)cc1","InChI=1/C10H16N2O2.H2O4S/c11-9-1-3-10(4-2-9)12(5-7-13)6-8-14;1-5(2,3)4/h1-4,13-14H,5-8,11H2;(H2,1,2,3,4)/f/h;1-2H","inactive","tested chemical","2,2'-[(4-Aminophenyl)imino]bisethanol sulfate",0.0,,,"inactive","no positive results",294.32470703125,,"",75.0,"2,2'-[(4-aminophenyl)imino]diethanol sulfate (salt)","",,"inactive","",,"KMCFMEHSEWDYKG-ATDHBCBACR","parent [7575-35-1]","multisex inactive","54381-16-7",20075.0,"","","C10H18N2O6S",,"single chemical compound",,"TD50; Tumor Target Sites","","complex H2SO4","Carcinogenicity","Rat added v2a","","76_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/2,2'-[(4-AMINOPHENYL)IMINO]BISETHANOL%20SULFATE.html","","",,"defined organic","no positive results","","","","","OS(O)(=O)=O.OCCN(CCO)c1ccc(N)cc1","","","",,"","rat","no positive results",20075.0, -"C1(N=CNN=1)N","InChI=1/C2H4N4/c3-2-4-1-5-6-2/h1H,(H3,3,4,5,6)/f/h5H,3H2","active","tested chemical","3-Aminotriazole",35.0,,0.11800000071525574,"active","TD50 is harmonic mean of more than one positive test",84.08000183105469,,"",76.0,"1H-1,2,4-triazol-3-amine","",,"active","inactive",34.0,"KLSJWNVTNUYHDU-YPUDGCQOCD","tautomers","multisite active; multisex active; multispecies active","61-82-5",20076.0,"liver","","C2H4N4",9.9399995803833,"single chemical compound",0.0,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","77_CPDBAS_v5d",0.3009999990463257,"","http://potency.berkeley.edu/chempages/3-AMINOTRIAZOLE.html","TD50 is harmonic mean of more than one positive test","inactive",25.299999237060547,"defined organic","thyroid gland","no positive results","","liver","","C1(N=CNN=1)N","active","","no positive results",,"no positive results","rat; mouse; hamster","pituitary gland; thyroid gland",20076.0, -"OC(=O)CCCCCCCCCCN","InChI=1/C11H23NO2/c12-10-8-6-4-2-1-3-5-7-9-11(13)14/h1-10,12H2,(H,13,14)/f/h13H","active","tested chemical","11-Aminoundecanoic acid",18.0,,5.460000038146973,"active","",201.30580139160156,,"",77.0,"11-aminoundecanoic acid","TR 216",,"active","inactive",0.0,"GUOSQNAUYHMCRU-NDKGDYFDCZ","","multisite active","2432-99-7",20077.0,"no positive results","","C11H23NO2",1100.0,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","78_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/11-AMINOUNDECANOIC%20ACID.html","no positive results","",,"defined organic","liver; urinary bladder","","","no positive results","","OC(=O)CCCCCCCCCCN","inactive","","",,"","rat; mouse","no positive results",20077.0, -"","InChI=1/ClH.H3N/h1H;1H3/fCl.H4N/h1h;1H/q-1;+1","","tested chemical","Ammonium chloride",,,,"inactive","",53.49150085449219,,"",78.0,"ammonium chloride","",,"","",0.0,"NLXLAEXVIDQMFP-DWOZJLMICO","","","12125-02-9",20078.0,"","","H4ClN",,"single chemical compound",,"TD50; Tumor Target Sites","","","Carcinogenicity","","","79_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/AMMONIUM%20CHLORIDE.html","no positive results","",,"inorganic","","","","no positive results","","[H][N+]([H])([H])[H].[Cl-]","inactive","","",,"","mouse","",20078.0, -"C(CC(O)=O)(CC(O)=O)(C(O)=O)O","InChI=1/C6H8O7.2H3N/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);2*1H3/fC6H6O7.2H4N/h7H;2*1H/q-2;2*+1","","tested chemical","Ammonium citrate",0.0,,,"inactive","no positive results",226.18580627441406,,"",79.0,"diammonium 2-(carboxymethyl)-2-hydroxybutanedioate","",,"inactive","",,"YXVFQADLFFNVDS-JYGIMERMCP","parent [77-92-9]","","3012-65-5",20079.0,"","","C6H14N2O7",,"single chemical compound",,"TD50; Tumor Target Sites","","complex 2NH4","Carcinogenicity","","","80_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/AMMONIUM%20CITRATE.html","","",,"defined organic","no positive results","","","","","C(CC([O-])=O)(CC(O)=O)(C([O-])=O)O.[N+].[N+]","","","",,"","rat","",20079.0, -"","InChI=1/H3N.H2O/h1H3;1H2/fH4N.HO/h1H;1h/q+1;-1","inactive","tested chemical","Ammonium hydroxide",,,,"inactive","",35.045799255371094,,"",80.0,"ammonium hydroxide","",,"","",0.0,"VHUUQVKOLVNVRT-QBBVKLOVCT","","multisex inactive","1336-21-6",20080.0,"no positive results","","H5NO",,"single chemical compound",,"TD50; Tumor Target Sites","","","Carcinogenicity","","","81_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/AMMONIUM%20HYDROXIDE.html","no positive results","",,"inorganic","","","","no positive results","","[N+].[O-]","inactive","","",,"","mouse","",20080.0, -"N1C(=O)C(CC)(CCC(C)C)C(=O)NC1=O","InChI=1/C11H18N2O3/c1-4-11(6-5-7(2)3)8(14)12-10(16)13-9(11)15/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16)/f/h12-13H","","tested chemical","Amobarbital",0.0,,,"inactive","no positive results",226.27479553222656,,"",81.0,"5-ethyl-5-(3-methylbutyl)pyrimidine-2,4,6(1H,3H,5H)-trione","",,"inactive","",,"VIROVYVQCGLCII-BAINRFMOCW","","","57-43-2",20081.0,"","","C11H18N2O3",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","82_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/AMOBARBITAL.html","","",,"defined organic","no positive results","","","","","N1C(=O)C(CC)(CCC(C)C)C(=O)NC1=O","","","",,"","rat","",20081.0, -"C1=CC=CC=C1CC(N)C","InChI=1/2C9H13N.H2O4S/c2*1-8(10)7-9-5-3-2-4-6-9;1-5(2,3)4/h2*2-6,8H,7,10H2,1H3;(H2,1,2,3,4)/f/h;;1-2H","inactive","tested chemical","dl-Amphetamine sulfate",0.0,,,"inactive","no positive results",368.49090576171875,,"",82.0,"1-phenylpropan-2-amine sulfate (2:1)","TR 387",,"inactive","inactive",0.0,"PYHRZPFZZDCOPH-IPLSSONACD","racemic mixture of L- [51-62-7] and D- [51-63-8], parent [300-62-9], structure shown without stereochem","multisex inactive; multispecies inactive","60-13-9",20082.0,"no positive results","","C18H28N2O4S",,"single chemical compound",,"TD50; Tumor Target Sites","","complex bis H2SO4","Carcinogenicity","","","83_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/dl-AMPHETAMINE%20SULFATE.html","no positive results","",,"defined organic","no positive results","","","no positive results","","O=S(O)(O)=O.C1(=CC=CC=C1CC(N)C).C2=CC=CC=C2CC(N)C","inactive","","",,"","rat; mouse","no positive results",20082.0, -"[H][C@@]12[C@]([H])(NC([C@H](N)C3=CC=CC=C3)=O)C(N1[C@@H]([C@@](O)=O)C(C)(C)S2)=O","InChI=1/C16H19N3O4S.3H2O/c1-16(2)11(15(22)23)19-13(21)10(14(19)24-16)18-12(20)9(17)8-6-4-3-5-7-8;;;/h3-7,9-11,14H,17H2,1-2H3,(H,18,20)(H,22,23);3*1H2/t9-,10-,11+,14-;;;/m1.../s1/f/h18,22H;;;","inactive","tested chemical","Ampicillin trihydrate",0.0,,,"inactive","no positive results",403.4505920410156,,"",83.0,"(2S,5R,6R)-6-{[(2R)-2-amino-2-phenylacetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid trihydrate","TR 318",,"inactive","inactive",0.0,"RXDALBZNGVATNY-FQLIROBNDT","stereochem; parent [69-53-4]","multisex inactive; multispecies inactive","7177-48-2",20083.0,"no positive results","","C16H25N3O7S",,"single chemical compound",,"TD50; Tumor Target Sites","","complex 3H2O","Carcinogenicity","structure modified v5b","","84_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/AMPICILLIN%20TRIHYDRATE.html","no positive results","",,"defined organic","no positive results","","","no positive results","","[H][C@@]12[C@]([H])(NC([C@H](N)C3=CC=CC=C3)=O)C(N1[C@@H]([C@@](O)=O)C(C)(C)S2)=O.O.O.O","inactive","","",,"","rat; mouse","no positive results",20083.0, -"O=C(N(CCCCC)N=O)N","InChI=1/C6H13N3O2/c1-2-3-4-5-9(8-11)6(7)10/h2-5H2,1H3,(H2,7,10)/f/h7H2","active","tested chemical","1-Amyl-1-nitrosourea",51.0,,0.0035000001080334187,"active","TD50 is harmonic mean of more than one positive test",159.18760681152344,,"",84.0,"1-nitroso-1-pentylurea","",,"active","",,"YYTNAQDGJQPZFU-IAUQMDSZCI","","multisite active; multisex active","10589-74-9",20084.0,"","","C6H13N3O2",0.5550000071525574,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","TD50_Rat modified v5a","","85_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/1-AMYL-1-NITROSOUREA.html","","",,"defined organic","hematopoietic system; lung; stomach","","","","","O=C(N(CCCCC)N=O)N","","","",,"","rat","hematopoietic system; lung; mammary gland; stomach; uterus",20084.0, -"","InChI=1//","","no structure","Amylopectin sulfate",50.0,,,"active","TD50 is harmonic mean of more than one positive test; TD50_Rat_mmol was not calculated for this mixture, but Activiity Score is assigned value of "50" to indicate active",,,"",,"","",,"active","",,"MOSFIJXAXDLOML-UHFFFAOYAM","non-linear polymer of glucose (Merck - amylopectic)","","9047-13-6",20085.0,"","","",283.0,"macromolecule",,"TD50; Tumor Target Sites","","","Carcinogenicity","TD50_Rat_mmol and TD50_Mouse_mmol conversions from mg values not provided due substance being a mixture","","86_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/AMYLOPECTIN%20SULFATE.html","","",,"no structure","large intestine","","","","","","","","",,"","rat","",20085.0, -"C/C=C/C1=CC=C(C=C1)OC","InChI=1/C10H12O/c1-3-4-9-5-7-10(11-2)8-6-9/h3-8H,1-2H3/b4-3+","inactive","tested chemical","trans-Anethole",0.0,,,"inactive","no positive results",148.2017059326172,,"",87.0,"1-(methyloxy)-4-[(1E)-prop-1-en-1-yl]benzene","",,"inactive","inactive",0.0,"RUVINXPYWBROJD-ONEGZZNKBR","stereochem","multisex inactive","4180-23-8",20087.0,"","","C10H12O",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","88_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/trans-ANETHOLE.html","no positive results","",,"defined organic","no positive results","","","no positive results","","C/C=C/C1=CC=C(C=C1)OC","inactive","","",,"","rat","no positive results",20087.0, -"C/C=C/C1=CC=C(C=C1)OC","InChI=1/C10H12O/c1-3-4-9-5-7-10(11-2)8-6-9/h3-8H,1-2H3/b4-3+","inactive","tested chemical","trans-Anethole",0.0,,,"inactive","no positive results",148.2017059326172,,"",87.0,"1-(methyloxy)-4-[(1E)-prop-1-en-1-yl]benzene","",,"inactive","inactive",0.0,"RUVINXPYWBROJD-ONEGZZNKBR","stereochem","multisex inactive","4180-23-8",20087.0,"","","C10H12O",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","88_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/trans-ANETHOLE.html","no positive results","",,"defined organic","no positive results","","","no positive results","","C/C=C/C1=CC=C(C=C1)OC","inactive","","",,"","rat","no positive results",20087.0, -"O[C@H]1[C@@H]([C@H](O)CO)O[C@H]2[C@@H]1O[C@@H]([C@@](Cl)(Cl)Cl)O2","InChI=1/C8H11Cl3O6/c9-8(10,11)7-16-5-3(14)4(2(13)1-12)15-6(5)17-7/h2-7,12-14H,1H2/t2-,3+,4-,5-,6-,7-/m1/s1","inactive","tested chemical","Anhydroglucochloral",,,,"inactive","",309.5282897949219,,"",88.0,"1,2-O-[(1R)-2,2,2-trichloroethylidene]-alpha-D-glucofuranose","",,"","",0.0,"OJYGBLRPYBAHRT-IPQSZEQABF","Chlorlose-alpha, stereochem","multisex inactive","15879-93-3",20088.0,"no positive results","","C8H11Cl3O6",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","structure modified v5b","","89_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ANHYDROGLUCOCHLORAL.html","no positive results","",,"defined organic","","","","no positive results","","O[C@H]1[C@@H]([C@H](O)CO)O[C@H]2[C@@H]1O[C@@H]([C@@](Cl)(Cl)Cl)O2","inactive","","",,"","mouse","",20088.0, -"ClC1=NC(=NC(=N1)NC2=CC=CC=C2Cl)Cl","InChI=1/C9H5Cl3N4/c10-5-3-1-2-4-6(5)13-9-15-7(11)14-8(12)16-9/h1-4H,(H,13,14,15,16)/f/h13H","inactive","tested chemical","Anilazine",0.0,,,"inactive","no positive results",275.52178955078125,,"",89.0,"4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine","TR 104",,"inactive","inactive",0.0,"IMHBYKMAHXWHRP-NDKGDYFDCD","","multisex inactive; multispecies inactive","101-05-3",20089.0,"no positive results","","C9H5Cl3N4",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","90_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ANILAZINE.html","no positive results","",,"defined organic","no positive results","","","no positive results","","ClC1=NC(=NC(=N1)NC2=CC=CC=C2Cl)Cl","inactive","","",,"","rat; mouse","no positive results",20089.0, -"NC1=CC=CC=C1","InChI=1/C6H7N/c7-6-4-2-1-3-5-6/h1-5H,7H2","","tested chemical","Aniline",0.0,,,"inactive","no positive results",93.12650299072266,,"",90.0,"aniline","",,"inactive","inactive",,"PAYRUJLWNCNPSJ-UHFFFAOYAP","","","62-53-3",20090.0,"","","C6H7N",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","91_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ANILINE.html","","",,"defined organic","no positive results","","","","","NC1=CC=CC=C1","","","",,"","rat","",20090.0, -"NC1=CC=CC=C1","InChI=1/C6H7N.ClH/c7-6-4-2-1-3-5-6;/h1-5H,7H2;1H","active","tested chemical","Aniline.HCl",22.0,,2.0799999237060547,"active","TD50 is harmonic mean of more than one positive test; greater than ten-fold variation among TD50 values for positive results",129.58740234375,,"",91.0,"aniline hydrochloride","TR 130",,"active","inactive",0.0,"MMCPOSDMTGQNKG-UHFFFAOYAJ","parent [62-53-3]","multisite active; multisex active","142-04-1",20091.0,"no positive results","","C6H8ClN",269.0,"single chemical compound",,"TD50; Tumor Target Sites","","complex HCl","Carcinogenicity","","","92_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ANILINE.HCl.html","no positive results","",,"defined organic","peritoneal cavity; spleen; vascular system","","","no positive results","","NC1=CC=CC=C1[H]Cl","inactive","","",,"","rat; mouse","peritoneal cavity",20091.0, -"C1(=C(C=CC=C1)N)OC","InChI=1/C7H9NO.ClH/c1-9-7-5-3-2-4-6(7)8;/h2-5H,8H2,1H3;1H","active","tested chemical","o-Anisidine.HCl",33.0,,0.1860000044107437,"active","TD50 is harmonic mean of more than one positive test",159.6134033203125,,"",92.0,"2-methoxyaniline hydrochloride","TR 89",,"active","active",19.0,"XCZCWGVXRBJCCD-UHFFFAOYAX","parent [90-04-0]","multisite active; multisex active; multispecies active","134-29-2",20092.0,"urinary bladder","","C7H10ClNO",29.700000762939453,"single chemical compound",,"TD50; Tumor Target Sites","","complex HCl","Carcinogenicity","","","93_CPDBAS_v5d",6.050000190734863,"","http://potency.berkeley.edu/chempages/o-ANISIDINE.HCl.html","TD50 is harmonic mean of more than one positive test","",966.0,"defined organic","kidney; thyroid gland; urinary bladder","","","urinary bladder","","C1(=C(C=CC=C1)N)OC.[H]Cl","active","","",,"","rat; mouse","urinary bladder",20092.0, -"C1(=CC=C(N)C=C1)OC","InChI=1/C7H9NO.ClH/c1-9-7-4-2-6(8)3-5-7;/h2-5H,8H2,1H3;1H","inactive","tested chemical","p-Anisidine.HCl",0.0,,,"inactive","no positive results",159.6134033203125,,"",93.0,"4-(methyloxy)aniline hydrochloride","TR 116",,"inactive","active",0.0,"VQYJLACQFYZHCO-UHFFFAOYAH","parent [104-94-9]","multisex inactive; multispecies inactive","20265-97-8",20093.0,"no positive results","","C7H10ClNO",,"single chemical compound",,"TD50; Tumor Target Sites","","complex HCl","Carcinogenicity","","","94_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/p-ANISIDINE.HCl.html","no positive results","",,"defined organic","no positive results","","","no positive results","","C1(=CC=C(N)C=C1)OC.[H]Cl","inactive","","",,"","rat; mouse","no positive results",20093.0, -"NC1=C(C=CC=C1)C(=O)O","InChI=1/C7H7NO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,8H2,(H,9,10)/f/h9H","inactive","tested chemical","Anthranilic acid",0.0,,,"inactive","no positive results",137.13600158691406,,"",94.0,"2-aminobenzoic acid","TR 36",,"inactive","inactive",0.0,"RWZYAGGXGHYGMB-BGGKNDAXCO","","multisex inactive; multispecies inactive","118-92-3",20094.0,"no positive results","","C7H7NO2",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","95_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ANTHRANILIC%20ACID.html","no positive results","",,"defined organic","no positive results","","","no positive results","","NC1=C(C=CC=C1)C(=O)O","inactive","","",,"","rat; mouse","no positive results",20094.0, -"O=C1C2=C(C=CC=C2)C(=O)C3=C1C=CC=C3","InChI=1/C14H8O2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-8H","inactive","tested chemical","9,10-Anthraquinone",,,,"inactive","",208.21209716796875,,"",95.0,"9,10-anthraquinone","",,"","active",0.0,"RZVHIXYEVGDQDX-UHFFFAOYAA","","multisex inactive","84-65-1",20095.0,"no positive results","","C14H8O2",,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","96_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/9,10-ANTHRAQUINONE.html","no positive results","",,"defined organic","","","","no positive results","","O=C1C2=C(C=CC=C2)C(=O)C3=C1C=CC=C3","inactive","","",,"","mouse","",20095.0, -"","InChI=1/2C4H4O6.2K.3H2O.2Sb/c2*5-1(3(7)8)2(6)4(9)10;;;;;;;/h2*1-2H,(H,7,8)(H,9,10);;;3*1H2;;/q2*-2;2*+1;;;;2*+3/p-4/f2C4H2O6.2K.3H2O.2Sb/q2*-4;2m;;;;2m/rC8H6O12Sb2.2K.3H2O/c9-5(10)1-3-7(13)19-22(17-3)16-2(6(11)12)4-8(14)20-21(15-1)18-4;;;;;/h1-4H,(H,9,10)(H,11,12);;;3*1H2/q;2*+1;;;/p-2/fC8H4O12Sb2.2K.3H2O/q-2;2m;;;","","tested chemical","Antimony potassium tartrate",,,,"inactive","",667.8726196289062,,"no positive results",96.0,"dipotassium 5,11-dioxo-2,6,8,12,13,14-hexaoxa-1,7-distibatricyclo[8.2.1.1~4,7~]tetradecane-3,9-dicarboxylate trihydrate","",,"","inactive",0.0,"WBTCZEPSIIFINA-DYFLWLNICK","","","28300-74-5",20096.0,"","","C8H10K2O15Sb2",,"single chemical compound",,"TD50; Tumor Target Sites","","","Carcinogenicity","","","97_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ANTIMONY%20POTASSIUM%20TARTRATE.html","","",,"organometallic","","","","","","[K+].[K+].[O-]C(=O)C2O[Sb]3OC(C(O[Sb]1OC(=O)C2O1)C([O-])=O)C(=O)O3.O.O.O","inactive","","",,"","mouse","",39240.0, -"CC(COC1=CC=C(C=C1)C(C)(C)C)OS(=O)OCCCl","InChI=1/C15H23ClO4S/c1-12(20-21(17)19-10-9-16)11-18-14-7-5-13(6-8-14)15(2,3)4/h5-8,12H,9-11H2,1-4H3","active","tested chemical","Aramite",31.0,,0.289000004529953,"active","TD50 is harmonic mean of more than one positive test",334.85870361328125,,"",97.0,"2-chloroethyl 2-{[4-(1,1-dimethylethyl)phenyl]oxy}-1-methylethyl sulfite","",,"active","",32.0,"YKFRAOGHWKADFJ-UHFFFAOYAL","","multispecies active","140-57-8",20097.0,"liver","","C15H23ClO4S",96.69999694824219,"single chemical compound",,"TD50; Tumor Target Sites","","parent","Carcinogenicity","","","98_CPDBAS_v5d",0.47200000286102295,"","http://potency.berkeley.edu/chempages/ARAMITE.html","","",158.0,"defined organic","","","","no positive results","","CC(COC1=CC=C(C=C1)C(C)(C)C)OS(=O)OCCCl","active","liver","",,"","rat; mouse","",20097.0, -"O=C(OC)C1=CCCN(C)C1","InChI=1/C8H13NO2.ClH/c1-9-5-3-4-7(6-9)8(10)11-2;/h4H,3,5-6H2,1-2H3;1H","active","tested chemical","Arecoline.HCl",,,,"active","",191.6571044921875,,"",98.0,"methyl 1-methyl-1,2,5,6-tetrahydropyridine-3-carboxylate hydrochloride","",,"","",36.0,"LQSWCSYIDIBGRR-UHFFFAOYAO","parent [63-75-2]","multisite active; multisex active","61-94-9",20098.0,"lung; stomach; vascular system","","C8H14ClNO2",,"single chemical compound",,"TD50; Tumor Target Sites","","complex HCl","Carcinogenicity","","","99_CPDBAS_v5d",0.20600000023841858,"","http://potency.berkeley.edu/chempages/ARECOLINE.HCl.html","TD50 is harmonic mean of more than one positive test","",39.5,"defined organic","","","","lung; vascular system","","O=C(OC)C1=CCCN(C)C1.[H]Cl","active","","",,"","mouse","",20098.0, -"[O-][N+](C1=CC(C(OC)=CC=C4)=C4C2=C1C(C(O)=O)=CC3=C2OCO3)=O","InChI=1/C17H11NO7.Na/c1-23-12-4-2-3-8-9(12)5-11(18(21)22)14-10(17(19)20)6-13-16(15(8)14)25-7-24-13;/h2-6H,7H2,1H3,(H,19,20);/q;+1/p-1/fC17H10NO7.Na/q-1;m","active","representative component in mixture","Aristolochic acid, sodium salt (77% AA I, 21% AA II)",50.0,,,"active","TD50 is harmonic mean of more than one positive test; TD50_Rat_mmol was not calculated for this mixture, but Activiity Score is assigned value of "50" to indicate active",363.25360107421875,,"",99.0,"sodium 8-(methyloxy)-6-nitrophenanthro[3,4-d][1,3]dioxole-5-carboxylate","",,"active","active",,"BQVOPWJSBBMGBR-KEMNOBITCY","structure shown AA I, parent [313-67-7]; AA II 6-Nitrophenanthro(3,4-d)-1,3-dioxole-5-carboxylic acid, sodium salt, AA II parent [475-80-9]","multisex active","10190-99-5",20099.0,"","","C17H10NNaO7",0.014100000262260437,"mixture or formulation",,"TD50; Tumor Target Sites","","salt Na","Carcinogenicity","kidney and urinary bladder were additional target sites but experiments too short to meet the inclusion rules of the CPDB; Rat added v2a; Mutagenicity_SAL_CPDB added v3a; TD50_Rat_mmol conversion from mg value not provided due to substance being a mixture","","100_CPDBAS_v5d",,"","http://potency.berkeley.edu/chempages/ARISTOLOCHIC%20ACID,%20SODIUM%20SALT%20(77%25%20AA%20I,%2021%25%20AA%20I.html","","",,"defined organic","stomach","","","","","[O-][N+](C1=CC(C(OC)=CC=C4)=C4C2=C1C(C([O-])=O)=CC3=C2OCO3)=O.[Na+]","","","",,"","rat","stomach",20099.0, diff --git a/test/data/hamster_carcinogenicity.csv b/test/data/hamster_carcinogenicity.csv deleted file mode 100644 index 52d89a3..0000000 --- a/test/data/hamster_carcinogenicity.csv +++ /dev/null @@ -1,86 +0,0 @@ -SMILES, Hamster Carcinogenicity
-CC=O,true
-C12C3=C(C=CC=C3)CC1=CC(=CC=2)NC(C)=O,true
-O=C(N)\C(C2=CC=CO2)=C/C1=CC=C([N+]([O-])=O)O1,true
-C1(N=CNN=1)N,false
-Br(=O)(=O)[O-].[K+],true
-[Cl-].[Cd+2].[Cl-],false
-O=S(=O)([O-])[O-].[Cd+2],false
-ClC1=CC(=NC(=N1)SCC(=O)O)NC2=CC=CC(=C2C)C,false
-ClCOC,true
-C=C(Cl)C=C,false
-Clc1ccc(cc1)c2ccc(COC(C)(C)C(O)=O)cc2,false
-O=C1OC2=C(C=CC=C2)C=C1,false
-ClC(=C(C1=CC=C(C=C1)Cl)C2=CC=C(C=C2)Cl)Cl,true
-ClC(C(C1=CC=C(C=C1)Cl)C2=CC=C(C=C2)Cl)(Cl)Cl,false
-C=CCN(CC=C)N=O,true
-Cl\C2=C(/Cl)C3(Cl)C1C4CC(C1C2(Cl)C3(Cl)Cl)C5OC45,false
-O=C(N(C)C)Cl,true
-CN(C)N,true
-N(NC)C.[H]Cl.[H]Cl,true
-CCO,false
-O=C(N(CC)N=O)NCCO,true
-O=C(N(CC)N=O)NCC(=O)C,true
-C=O,false
-[O-][N+](=O)C1=CC=C(O1)C2=CSC(=N2)NNC=O,true
-O=CC1=CC=CO1,false
-OCC1CO1,true
-O=C2C1=C(OC)C=C(OC)C(Cl)=C1O[C@]32C(OC)=CC(C[C@@](C)3[H])=O,false
-ClC1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl,true
-NN,true
-OS(=O)(=O)O.NN,true
-CC(=O)N(O)C1=CC2=C(C=C1)C3=CC=CC=C3C2,true
-OCCNN,false
-O=C(C1=CC=NC=C1)NN,false
-OC(=O)C1=CC=NC=C1,false
-O=C(NC1=CC=CC(=C1)Cl)OC(C)C,false
-O=C(NC1=CC=CC=C1)OC(C)C,false
-[O-]C(C)=O.[O-]C(C)=O.[Pb+2].[OH-].[OH-].[Pb+2].[OH-].[OH-].[Pb+2],false
-CN(C)CCN(CC2=CC=CS2)C1=NC=CC=C1.Cl,false
-NC1=C2C(=NC(=N1)N)N=CC(=N2)CN(C3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)O)C(=O)O)C,false
-CN(N)C=O,true
-O=C(C(=C)C)OC,false
-CNN,true
-O=C(C1=CC=CN=C1)CCCN(N=O)C,false
-CC1=CC(=O)NC(=S)N1,true
-CC(C(O)=O)(OC1=CC=C(C=C1)C2CCCC3=C2C=CC=C3)C,false
-O=N[O-].[Na+],false
-[O-][N+](C1=CC=C(C2=CSC(NC(C)=O)=N2)O1)=O,true
-[O-][N+](=O)C1=CC=C(O1)C2=CSC(=N2)NC=O,true
-O=[N+](C1=CC=C2C3=C1C=CC=C3CC2)[O-],false
-N(CC(CO)O)(CC(O)C)N=O,true
-N(CC(CO)O)(CC(C)=O)N=O,true
-N(CC(CO)O)(CCO)N=O,false
-O=C(C)CN(N=O)CCO,true
-C1C(N(C(CN1N=O)C)C)C,true
-N(CC(C)=O)(CC=C)N=O,true
-N(CC(CO)O)(C)N=O,true
-O=NN1CCOCC1,true
-N1C=CC=C(C=1)C2N(N=O)CCC2,true
-C1=CC=C(C=[N+]1[O-])C2CCCN2N=O,false
-O=NN1CCCCC1,true
-O=NN1CCCC1,true
-O=C(N(CC(C)=O)N=O)NCCCl,true
-N(C(=O)N)(N=O)CC(C)=O,true
-C1(CCN=C=S)=CC=CC=C1,false
-O=C1C(C2=CC=CC=C2)(C(=O)NC(=O)N1)CC,false
-C1=C2C(=CC=C1NC3=CC=CC=C3)C=CC=C2,false
-O=C1N2C(C3=C(C=CC=C3)CC2)CN(C1)C(=O)C4CCCCC4,false
-C1(=CC(=C(O)C=C1)O)C(O)=O,false
-O=C1C2=C(C=C(C=C2O)O)O/C(=C\1O)C3=CC(=C(C=C3)O)O.O.O,false
-C1=C(C=CC(=C1)C(C2=CC=C(N)C(=C2)C)=C3C=CC(=N)C=C3)N.[H]Cl,false
-C(C1=CC=C(C=C1)N)(C2=CC=C(C=C2)N)=C3C=CC(C=C3)=N.[H]Cl,false
-OC2=CC1=C(C(O)=C2)C(C(O[C@@H]4O[C@@H]([C@H]([C@H](O)[C@H]4O)O)CO[C@H]3[C@H](O)[C@H](O)[C@H]([C@H](C)O3)O)=C(C5=CC(O)=C(C=C5)O)O1)=O,false
-ClC(=CCl)Cl,false
-NC(=O)OCC,true
-C=CCl,true
-N#[N+]C1=CC=CC=C1.F[B-](F)(F)F,false
-C1(CN(CC(N1N=O)C)N=O)C,true
-N(CCN(C)C)(C)N=O,true
-C1(CN(N=O)CC(O1)C)C,true
-O1C(N(CC1C)N=O)=O,true
-CCOC(=O)N(C)N=O,true
-C1N(COC1)N=O,true
-O=C(N(CCC1=CC=CC=C1)N=O)N,true
-O=NN1CCC1,true
-F[B-](F)(F)F.[Na+],false
diff --git a/test/data/hamster_carcinogenicity.mini.csv b/test/data/hamster_carcinogenicity.mini.csv deleted file mode 100644 index 4267235..0000000 --- a/test/data/hamster_carcinogenicity.mini.csv +++ /dev/null @@ -1,11 +0,0 @@ -SMILES, Hamster Carcinogenicity
-CC=O,1
-C12C3=C(C=CC=C3)CC1=CC(=CC=2)NC(C)=O,1
-O=C(N)\C(C2=CC=CO2)=C/C1=CC=C([N+]([O-])=O)O1,1
-C1(N=CNN=1)N,0
-Br(=O)(=O)[O-].[K+],1
-[Cl-].[Cd+2].[Cl-],0
-O=S(=O)([O-])[O-].[Cd+2],0
-ClC1=CC(=NC(=N1)SCC(=O)O)NC2=CC=CC(=C2C)C,0
-ClCOC,1
-C=C(Cl)C=C,0
diff --git a/test/data/hamster_carcinogenicity.sdf b/test/data/hamster_carcinogenicity.sdf deleted file mode 100644 index df230d5..0000000 --- a/test/data/hamster_carcinogenicity.sdf +++ /dev/null @@ -1,2805 +0,0 @@ -
-
-
- 3 2 0 0 0 0 0 0 0 0 1 V2000
- 2.3030 -0.6656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1515 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.6656 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 17 19 0 0 0 0 0 0 0 0 1 V2000
- 5.7640 -1.7698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.0213 -1.3540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.8046 -2.4275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.1296 -2.2921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.6712 -1.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.8878 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.5629 -0.1451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.0213 -3.5106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7640 -3.0948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6035 -3.7621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4526 -3.0948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4526 -1.7698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6035 -1.1025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3017 -3.7621 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1509 -3.0948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.7621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1509 -1.7698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 9 1 0 0 0 0
- 1 13 2 0 0 0 0
- 2 3 2 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 2 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 2 0 0 0 0
- 11 14 1 0 0 0 0
- 12 13 1 0 0 0 0
- 14 15 1 0 0 0 0
- 15 16 1 0 0 0 0
- 15 17 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 18 19 0 0 0 0 0 0 0 0 2 V2000
- 3.2537 -3.5906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.2537 -2.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.4062 -1.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.4062 -4.2555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.1011 -4.2555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9682 -0.2748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6649 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.1011 -1.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.1525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8866 -2.1366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7006 -3.5817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 7.0038 -3.8654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.5587 -2.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.6687 -2.7129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.7733 -1.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.5446 -5.0800 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 6.7644 -6.1527 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 8.8656 -5.2130 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 5 1 0 0 0 0
- 1 4 2 0 0 0 0
- 2 3 2 0 0 0 0
- 2 8 1 0 0 0 0
- 3 13 1 0 0 0 0
- 6 7 1 0 0 0 0
- 6 8 1 0 0 0 0
- 7 9 2 0 0 0 0
- 8 10 2 0 0 0 0
- 9 10 1 0 0 0 0
- 11 12 1 0 0 0 0
- 11 13 1 0 0 0 0
- 12 14 2 0 0 0 0
- 12 16 1 0 0 0 0
- 13 15 2 0 0 0 0
- 14 15 1 0 0 0 0
- 16 17 1 0 0 0 0
- 16 18 2 0 0 0 0
-M CHG 2 16 1 17 -1
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 6 6 0 0 0 0 0 0 0 0 1 V2000
- 1.3304 -1.0738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.1104 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3767 -0.4086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3767 -1.7390 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.1104 -2.1509 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.0738 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 5 2 0 0 0 0
- 1 6 1 0 0 0 0
- 2 3 2 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 13 13 0 0 0 0 0 0 0 0 1 V2000
- 1.1541 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3012 -0.6703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4553 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6094 -0.6703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6094 -1.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4553 -2.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3012 -1.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1541 -2.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.4837 -1.5134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.8175 -3.8147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7566 -2.6606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9107 -1.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 5 6 1 0 0 0 0
- 5 12 1 0 0 0 0
- 6 7 2 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 1 0 0 0 0
- 8 10 1 0 0 0 0
- 8 11 1 0 0 0 0
- 12 13 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 3 0 0 0 0 0 0 0 0 0 2 V2000
- 10.0000 -0.0700 0.0000 Cl 0 5 0 0 0 0 0 0 0 0 0 0
- 4.5200 0.0000 0.0000 Cd 0 2 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.3400 0.0000 Cl 0 5 0 0 0 0 0 0 0 0 0 0
-M CHG 3 1 -1 2 2 3 -1
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 6 4 0 0 0 0 0 0 0 0 2 V2000
- 2.6600 -2.6600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6600 -1.3320 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6600 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3280 -1.3320 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 3.9880 -1.3320 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.3320 0.0000 Cd 0 2 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 2 0 0 0 0
- 2 4 1 0 0 0 0
- 2 5 1 0 0 0 0
-M CHG 3 4 -1 5 -1 6 2
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 0 0 0 0 0 0 0 0 0 0 1 V2000
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 21 22 0 0 0 0 0 0 0 0 1 V2000
- 5.7698 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7698 -1.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9111 -2.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9111 -3.3351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7698 -3.9945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6158 -3.3351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6158 -2.0036 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4619 -3.9945 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3079 -3.3351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1540 -3.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1540 -5.3260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.3351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0650 -3.9945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2190 -3.3351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2190 -2.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3730 -1.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 11.5269 -2.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 11.5269 -3.3351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3730 -3.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3730 -5.3260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.6809 -3.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 13 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 6 8 1 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 1 0 0 0 0
- 10 11 2 0 0 0 0
- 10 12 1 0 0 0 0
- 13 14 1 0 0 0 0
- 14 15 2 0 0 0 0
- 14 19 1 0 0 0 0
- 15 16 1 0 0 0 0
- 16 17 2 0 0 0 0
- 17 18 1 0 0 0 0
- 18 19 2 0 0 0 0
- 18 21 1 0 0 0 0
- 19 20 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 4 3 0 0 0 0 0 0 0 0 1 V2000
- 3.4575 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3061 -0.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1513 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 5 4 0 0 0 0 0 0 0 0 1 V2000
- 2.2415 -0.6520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1191 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3606 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.6520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.2415 -2.0836 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 3 2 0 0 0 0
- 1 5 1 0 0 0 0
- 2 4 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 21 22 0 0 0 0 0 0 0 0 1 V2000
- 12.5806 -1.3138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 11.2668 -1.3138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.9397 -1.3138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3083 -2.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9945 -2.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 13.2574 -0.1592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3177 -1.3138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9718 -1.3138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3177 -3.6229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9585 -3.6229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 13.2707 -2.4683 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2762 -2.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3403 -2.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9359 -2.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9906 -1.3138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9906 -3.6229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.2989 -3.6229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.2989 -1.3138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.4683 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 11.2668 -2.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 11.2668 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 6 2 0 0 0 0
- 1 11 1 0 0 0 0
- 2 3 1 0 0 0 0
- 2 20 1 0 0 0 0
- 2 21 1 0 0 0 0
- 3 12 1 0 0 0 0
- 4 8 2 0 0 0 0
- 4 5 1 0 0 0 0
- 4 10 1 0 0 0 0
- 5 7 1 0 0 0 0
- 5 9 2 0 0 0 0
- 7 15 2 0 0 0 0
- 8 18 1 0 0 0 0
- 9 16 1 0 0 0 0
- 10 17 2 0 0 0 0
- 12 14 1 0 0 0 0
- 13 16 2 0 0 0 0
- 13 19 1 0 0 0 0
- 13 15 1 0 0 0 0
- 14 17 1 0 0 0 0
- 14 18 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 11 12 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -2.6606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1518 -1.9983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3036 -2.6606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4554 -1.9983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4554 -0.6680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6071 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7589 -0.6680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7589 -1.9983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6071 -2.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3036 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1518 -0.6680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 11 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 9 1 0 0 0 0
- 5 6 1 0 0 0 0
- 5 10 1 0 0 0 0
- 6 7 2 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 2 0 0 0 0
- 10 11 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 18 19 0 0 0 0 0 0 0 0 1 V2000
- 3.4540 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6054 -0.6632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6054 -1.9895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7567 -2.6527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9080 -1.9895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0594 -2.6527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0594 -3.9882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9080 -4.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7567 -3.9882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2107 -4.6514 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4540 -2.6527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4540 -3.9882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3027 -4.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1513 -3.9882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1513 -2.6527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3027 -1.9895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -4.6514 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7567 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 18 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 11 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 9 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 7 8 1 0 0 0 0
- 7 10 1 0 0 0 0
- 8 9 2 0 0 0 0
- 11 12 2 0 0 0 0
- 11 16 1 0 0 0 0
- 12 13 1 0 0 0 0
- 13 14 2 0 0 0 0
- 14 15 1 0 0 0 0
- 14 17 1 0 0 0 0
- 15 16 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 19 20 0 0 0 0 0 0 0 0 1 V2000
- 3.2800 -1.3268 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6068 -1.3268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6068 -2.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7585 -3.3169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9102 -2.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0619 -3.3169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0619 -4.6529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9102 -5.3162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7585 -4.6529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2136 -5.3162 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4551 -3.3169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4551 -4.6529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3034 -5.3162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1517 -4.6529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1517 -3.3169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3034 -2.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -5.3162 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6068 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9336 -1.3268 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 1 0 0 0 0
- 2 18 1 0 0 0 0
- 2 19 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 11 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 9 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 7 8 1 0 0 0 0
- 7 10 1 0 0 0 0
- 8 9 2 0 0 0 0
- 11 12 2 0 0 0 0
- 11 16 1 0 0 0 0
- 12 13 1 0 0 0 0
- 13 14 2 0 0 0 0
- 14 15 1 0 0 0 0
- 14 17 1 0 0 0 0
- 15 16 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 9 8 0 0 0 0 0 0 0 0 1 V2000
- 2.6588 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9976 -1.1548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6588 -2.3049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9976 -3.4597 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6588 -4.6098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9905 -4.6098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6563 -3.4597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6659 -3.4597 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.3049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 8 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 8 9 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 19 23 0 0 0 0 0 0 0 0 1 V2000
- 1.2310 -2.6401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.6401 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6007 -3.6931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.2470 -2.9219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4113 -2.7068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.7946 -3.9008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.1061 -5.0280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3001 -3.6931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.8500 -2.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.3902 -3.1295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.6954 -3.7599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.3258 -2.7068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.4159 -2.4250 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 6.1478 -4.8203 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9749 -4.3235 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 4.3902 -0.7787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.1318 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 3.5522 -0.0742 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 5.6583 -1.1643 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 3 1 0 0 0 0
- 1 4 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 6 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 7 1 0 0 0 0
- 5 9 1 0 0 0 0
- 5 8 1 0 0 0 0
- 6 7 1 0 0 0 0
- 6 8 1 0 0 0 0
- 8 10 1 0 0 0 0
- 9 12 1 0 0 0 0
- 9 16 1 0 0 0 0
- 9 19 1 0 0 0 0
- 10 11 1 0 0 0 0
- 10 16 1 0 0 0 0
- 10 15 1 0 0 0 0
- 11 12 2 0 0 0 0
- 11 14 1 0 0 0 0
- 12 13 1 0 0 0 0
- 16 17 1 0 0 0 0
- 16 18 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 6 5 0 0 0 0 0 0 0 0 1 V2000
- 1.3307 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9943 -1.1509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3307 -2.3053 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9943 -3.4563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.3053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3250 -1.1509 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 6 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 5 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 4 3 0 0 0 0 0 0 0 0 1 V2000
- 1.9950 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3292 -1.1518 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9950 -2.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.1518 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 1 0 0 0 0
- 2 4 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 8 5 0 0 0 0 0 0 0 0 1 V2000
- 2.7482 -0.6668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.0518 -0.6668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.5964 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6623 -1.9955 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9909 -1.9955 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.9955 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3286 -1.9955 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 4 1 0 0 0 0
- 2 3 1 0 0 0 0
- 5 6 1 0 0 0 0
- 7 8 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 3 2 0 0 0 0 0 0 0 0 1 V2000
- 2.3030 -0.6656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1515 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.6656 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 11 10 0 0 0 0 0 0 0 0 1 V2000
- 2.2999 -3.9852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.2999 -2.6591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1534 -1.9891 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1534 -0.6630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.6591 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.9852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4534 -1.9891 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6068 -2.6591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7533 -1.9891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9067 -2.6591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 8 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 6 1 0 0 0 0
- 4 5 1 0 0 0 0
- 6 7 2 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 1 0 0 0 0
- 10 11 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 12 11 0 0 0 0 0 0 0 0 1 V2000
- 2.3006 -3.9862 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3006 -2.6598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1537 -1.9897 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1537 -0.6632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.6598 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.9862 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4543 -1.9897 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6080 -2.6598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7548 -1.9897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7548 -0.6632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9086 -2.6598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 8 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 6 1 0 0 0 0
- 4 5 1 0 0 0 0
- 6 7 2 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 1 0 0 0 0
- 10 11 2 0 0 0 0
- 10 12 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 2 1 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3300 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 17 18 0 0 0 0 0 0 0 0 2 V2000
- 11.3714 -1.9900 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 10.2229 -1.3304 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 10.2229 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 9.0743 -1.9900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.9265 -3.3204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.6302 -3.5933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9706 -2.4448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.8576 -1.4555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.6402 -2.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.7532 -3.2863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.5365 -2.7519 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 3.6729 -1.4328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.9807 -1.1485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6950 -0.5345 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.4442 -1.0121 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.2395 -2.3311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.8087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 8 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 7 8 1 0 0 0 0
- 7 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 9 13 1 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 1 0 0 0 0
- 12 13 2 0 0 0 0
- 12 14 1 0 0 0 0
- 14 15 1 0 0 0 0
- 15 16 1 0 0 0 0
- 16 17 2 0 0 0 0
-M CHG 2 1 -1 2 1
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 7 7 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -1.5998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1503 -2.2653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3050 -1.5998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.4416 -0.2777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.7417 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.4072 -1.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.5169 -2.1419 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 2 0 0 0 0
- 3 7 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 2 0 0 0 0
- 6 7 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 5 5 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -1.1519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1519 -1.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3037 -1.1519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.9687 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.6336 -1.1519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 5 1 0 0 0 0
- 4 5 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 24 26 0 0 1 0 0 0 0 0 1 V2000
- 6.2320 -1.0924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.8471 -2.3097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6298 -2.7050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6298 -3.9743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.8471 -4.3593 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.5857 -3.3293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.2308 -2.2369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.5001 -2.2369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.1347 -3.3293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.4040 -3.3293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 8.5001 -4.4321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.2308 -4.4321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.5857 -5.5453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.0019 -0.9780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9799 -0.1665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.5374 -4.6090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.5374 -5.8783 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 2.4241 -3.9743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3213 -4.6090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.1316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.4241 -2.7050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.5374 -2.0600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.5374 -0.7907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.6334 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 6 2 1 1 0 0 0
- 3 4 2 0 0 0 0
- 3 22 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 16 1 0 0 0 0
- 6 5 1 6 0 0 0
- 6 7 1 0 0 0 0
- 6 12 1 0 0 0 0
- 7 8 2 0 0 0 0
- 7 14 1 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 9 11 1 0 0 0 0
- 11 12 1 0 0 0 0
- 12 13 1 1 0 0 0
- 14 15 1 0 0 0 0
- 16 17 1 0 0 0 0
- 16 18 2 0 0 0 0
- 18 19 1 0 0 0 0
- 18 21 1 0 0 0 0
- 19 20 1 0 0 0 0
- 21 22 2 0 0 0 0
- 22 23 1 0 0 0 0
- 23 24 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 12 12 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -2.3036 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3300 -2.3036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9950 -1.1491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3250 -1.1491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9901 -2.3036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3250 -3.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9950 -3.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3300 -4.6072 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9901 -4.6072 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3201 -2.3036 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9901 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3300 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 12 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 11 1 0 0 0 0
- 5 6 1 0 0 0 0
- 5 10 1 0 0 0 0
- 6 7 2 0 0 0 0
- 6 9 1 0 0 0 0
- 7 8 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 2 1 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3300 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 7 5 0 0 0 0 0 0 0 0 1 V2000
- 3.9900 -2.6600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9900 -1.3300 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6600 -1.3300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3200 -1.3300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9900 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.3300 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3300 -1.3300 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 4 2 0 0 0 0
- 2 5 1 0 0 0 0
- 6 7 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 18 20 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -2.3030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3313 -2.3030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9920 -3.4593 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9920 -1.1564 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3313 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3233 -1.1564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9938 -2.3030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3251 -2.3030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9858 -1.1564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3251 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9938 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.2880 -1.4284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.3666 -0.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.5812 -1.1952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.7173 -2.5168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.6387 -3.2942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.4240 -2.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.2093 -3.2942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 6 11 1 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 2 0 0 0 0
- 8 18 1 0 0 0 0
- 9 10 1 0 0 0 0
- 9 12 1 0 0 0 0
- 10 11 2 0 0 0 0
- 12 13 2 0 0 0 0
- 12 17 1 0 0 0 0
- 13 14 1 0 0 0 0
- 14 15 2 0 0 0 0
- 15 16 1 0 0 0 0
- 16 17 2 0 0 0 0
- 17 18 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 5 4 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -0.6638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1525 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3050 -0.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4575 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6099 -0.6638 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 10 10 0 0 0 0 0 0 0 0 1 V2000
- 4.6545 -3.4536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9889 -2.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6577 -2.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9968 -3.4536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6656 -3.4536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.3040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6656 -1.1497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9968 -1.1497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6545 -1.1497 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9889 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 9 1 0 0 0 0
- 3 4 2 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 2 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 2 0 0 0 0
- 9 10 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 9 9 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -2.3037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6655 -1.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9965 -1.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6574 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9884 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6539 -1.1542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9884 -2.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6574 -2.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 9 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 14 14 0 0 0 0 0 0 0 0 1 V2000
- 3.4524 -0.6629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4524 -1.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6031 -2.6606 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7539 -1.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7539 -0.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9047 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0555 -0.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0555 -1.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9047 -2.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2063 -2.6606 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3016 -2.6606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1508 -1.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1508 -0.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 11 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 9 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 2 0 0 0 0
- 8 10 1 0 0 0 0
- 11 12 1 0 0 0 0
- 12 13 1 0 0 0 0
- 12 14 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 13 13 0 0 0 0 0 0 0 0 1 V2000
- 3.4601 -0.6694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4601 -2.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6054 -2.6616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7587 -2.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7587 -0.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9121 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0654 -0.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0654 -2.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9121 -2.6616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3067 -2.6616 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1534 -2.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.6616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1534 -0.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 10 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 9 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 2 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 1 0 0 0 0
- 11 13 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 15 6 0 0 0 0 0 0 0 0 3 V2000
- 5.7806 -4.7517 0.0000 Pb 0 2 0 0 0 2 0 0 0 0 0 0
- 5.1849 0.0000 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 4.5351 -1.1507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.1849 -2.3014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.1949 -1.1507 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0036 0.0000 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 1.3267 -1.1507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0036 -2.3014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.1507 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 7.6759 -4.9413 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 5.8754 -5.6452 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 11.4935 -1.8817 0.0000 Pb 0 2 0 0 0 2 0 0 0 0 0 0
- 13.5377 -1.9900 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 11.7778 -2.7075 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 3.6281 -3.4792 0.0000 Pb 0 2 0 0 0 2 0 0 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 5 2 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 1 0 0 0 0
- 7 9 2 0 0 0 0
-M CHG 8 1 2 2 -1 6 -1 10 -1 11 -1 12 2 13 -1 14 -1
-M CHG 1 15 2
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 20 20 0 0 0 0 0 0 0 0 1 V2000
- 4.4090 -3.9937 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.5672 -4.6567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.7174 -3.9937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.8676 -4.6567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.8676 -5.9906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.7174 -6.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.5672 -5.9906 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.2589 -4.6567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.1087 -3.9937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8946 -4.5368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.5464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6630 -2.3962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9649 -2.6678 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 4.4090 -2.6598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.2589 -1.9969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.2589 -0.6630 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.1087 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.4090 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3307 -7.9874 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6567 -7.9874 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 8 1 0 0 0 0
- 1 14 1 0 0 0 0
- 2 3 1 0 0 0 0
- 2 7 2 0 0 0 0
- 3 4 2 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 2 0 0 0 0
- 6 7 1 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 9 13 1 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 2 0 0 0 0
- 12 13 1 0 0 0 0
- 14 15 1 0 0 0 0
- 15 16 1 0 0 0 0
- 16 17 1 0 0 0 0
- 16 18 1 0 0 0 0
- 19 20 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 33 35 0 0 1 0 0 0 0 0 1 V2000
- 14.9725 -5.3302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 13.8197 -5.9890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.6668 -5.3302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 11.5139 -5.9890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 11.5139 -7.3216 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 12.6668 -7.9804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 13.8197 -7.3216 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 12.6668 -9.3129 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3610 -5.3302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3610 -3.9977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 11.5139 -3.3239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 12.6668 -3.9977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 11.5139 -1.9913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3610 -1.3326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2081 -1.9913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2081 -3.3239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0552 -3.9977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9173 -3.3239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9173 -1.9913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0552 -1.3326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7644 -3.9977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6115 -3.3239 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7644 -5.3302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6115 -5.9890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4587 -5.3302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3058 -5.9890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1529 -5.3302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1529 -3.9977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -5.9890 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6115 -7.3216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4587 -7.9804 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7644 -7.9804 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3610 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 12 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 9 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 6 8 1 0 0 0 0
- 9 10 2 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 2 0 0 0 0
- 11 13 1 0 0 0 0
- 13 14 1 0 0 0 0
- 14 15 1 0 0 0 0
- 14 33 1 0 0 0 0
- 15 16 2 0 0 0 0
- 15 20 1 0 0 0 0
- 16 17 1 0 0 0 0
- 17 18 2 0 0 0 0
- 18 19 1 0 0 0 0
- 18 21 1 0 0 0 0
- 19 20 2 0 0 0 0
- 21 22 2 0 0 0 0
- 21 23 1 0 0 0 0
- 24 23 1 6 0 0 0
- 24 25 1 0 0 0 0
- 24 30 1 0 0 0 0
- 25 26 1 0 0 0 0
- 26 27 1 0 0 0 0
- 27 28 2 0 0 0 0
- 27 29 1 0 0 0 0
- 30 31 2 0 0 0 0
- 30 32 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 5 4 0 0 0 0 0 0 0 0 1 V2000
- 2.3056 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3056 -1.3308 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4567 -1.9945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1511 -1.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.3308 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 1 0 0 0 0
- 2 4 1 0 0 0 0
- 4 5 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 7 6 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -2.3052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3306 -2.3052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9941 -1.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3247 -1.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3306 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9941 -3.4560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3247 -3.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 6 1 0 0 0 0
- 3 4 2 0 0 0 0
- 3 5 1 0 0 0 0
- 6 7 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 3 2 0 0 0 0 0 0 0 0 1 V2000
- 2.3030 -0.6656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1515 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.6656 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 15 15 0 0 0 0 0 0 0 0 1 V2000
- 3.4524 -3.9915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4524 -2.6644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3016 -2.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1508 -2.6644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.6635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1508 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3016 -0.6635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6032 -2.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7643 -2.6644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9151 -2.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0659 -2.6644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2167 -2.0009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3675 -2.6644 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0659 -3.9915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 9 1 0 0 0 0
- 3 4 2 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 2 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 2 0 0 0 0
- 9 10 1 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 1 0 0 0 0
- 12 13 1 0 0 0 0
- 12 15 1 0 0 0 0
- 13 14 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 9 9 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -2.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3315 -2.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9950 -1.1518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3265 -1.1518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9899 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9899 -2.3037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3265 -3.4555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9899 -4.6073 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9950 -3.4555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 9 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 6 1 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 2 0 0 0 0
- 7 9 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 23 25 0 0 0 0 0 0 0 0 1 V2000
- 1.6416 -5.7565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.2982 -4.6074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1491 -3.9398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -4.6074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1491 -2.6156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.9658 -3.4583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.3010 -3.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.9576 -2.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.2928 -2.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9604 -3.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.2928 -4.6074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.9576 -4.6074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.2846 -3.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.9522 -4.6074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.2764 -4.6074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.9440 -3.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.2764 -2.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.9522 -2.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.2846 -1.1491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.9522 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.2764 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.9440 -1.1491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4583 -5.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 1 0 0 0 0
- 2 6 1 0 0 0 0
- 2 23 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 5 2 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 2 0 0 0 0
- 7 12 1 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 10 11 1 0 0 0 0
- 10 13 1 0 0 0 0
- 11 12 2 0 0 0 0
- 13 14 1 0 0 0 0
- 13 18 1 0 0 0 0
- 14 15 1 0 0 0 0
- 15 16 1 0 0 0 0
- 16 17 1 0 0 0 0
- 17 18 2 0 0 0 0
- 17 22 1 0 0 0 0
- 18 19 1 0 0 0 0
- 19 20 2 0 0 0 0
- 20 21 1 0 0 0 0
- 21 22 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 4 2 0 0 0 0 0 0 0 0 2 V2000
- 2.3030 -0.6656 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1515 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.6656 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 1.1975 -1.9944 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
-M CHG 2 3 -1 4 1
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 17 18 0 0 0 0 0 0 0 0 2 V2000
- 1.2652 -1.2985 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.7091 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 1.5426 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.2529 -2.1863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.5514 -1.9089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.2173 -3.0631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3294 -4.0508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.1086 -3.5070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.5380 -3.1963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.4258 -2.2085 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 7.6466 -2.7523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.5023 -4.0730 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 6.2039 -4.3505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.8008 -2.0865 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 9.9439 -2.7523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.9439 -4.0841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 11.0981 -2.0865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 3 2 0 0 0 0
- 1 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 8 2 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 6 9 1 0 0 0 0
- 7 8 1 0 0 0 0
- 9 10 1 0 0 0 0
- 9 13 2 0 0 0 0
- 10 11 2 0 0 0 0
- 11 12 1 0 0 0 0
- 11 14 1 0 0 0 0
- 12 13 1 0 0 0 0
- 14 15 1 0 0 0 0
- 15 16 2 0 0 0 0
- 15 17 1 0 0 0 0
-M CHG 2 1 1 2 -1
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 16 17 0 0 0 0 0 0 0 0 2 V2000
- 10.9589 -1.9945 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 9.8082 -1.3260 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 9.8082 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 8.6575 -1.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.5151 -3.3205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.2110 -3.5945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.5534 -2.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.4411 -1.4575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.2274 -2.3014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.3397 -3.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.1233 -2.7507 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 3.2658 -1.4247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.5589 -1.1507 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.2795 -0.5370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0301 -1.0192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.1753 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 8 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 7 8 1 0 0 0 0
- 7 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 9 13 1 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 1 0 0 0 0
- 12 13 2 0 0 0 0
- 12 14 1 0 0 0 0
- 14 15 1 0 0 0 0
- 15 16 2 0 0 0 0
-M CHG 2 1 -1 2 1
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 15 17 0 0 0 0 0 0 0 0 2 V2000
- 4.2842 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.2842 -1.3283 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 3.1294 -1.9925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9805 -1.3283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8257 -1.9925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8257 -3.3268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9805 -3.9910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.1294 -3.3268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.2842 -3.9910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.2842 -5.3193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.1294 -5.9835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9805 -5.3193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6642 -5.5168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -4.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.4330 -1.9925 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 15 1 0 0 0 0
- 3 4 2 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 2 0 0 0 0
- 6 7 1 0 0 0 0
- 6 14 1 0 0 0 0
- 7 8 2 0 0 0 0
- 7 12 1 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 2 0 0 0 0
- 12 13 1 0 0 0 0
- 13 14 1 0 0 0 0
-M CHG 2 2 1 15 -1
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 12 11 0 0 0 0 0 0 0 0 1 V2000
- 3.3277 -1.1482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9859 -2.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3169 -2.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9825 -1.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3135 -1.1482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9825 -3.4520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9966 -1.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3311 -2.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9966 -3.4520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9859 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3169 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 7 1 0 0 0 0
- 1 11 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 6 1 0 0 0 0
- 4 5 1 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 1 0 0 0 0
- 8 10 1 0 0 0 0
- 11 12 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 12 11 0 0 0 0 0 0 0 0 1 V2000
- 3.3277 -1.1482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9859 -2.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3169 -2.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9825 -1.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3135 -1.1482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9825 -3.4520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9966 -1.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3311 -2.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9966 -3.4520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.3038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9859 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3169 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 7 1 0 0 0 0
- 1 11 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 6 1 0 0 0 0
- 4 5 1 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 1 0 0 0 0
- 8 10 2 0 0 0 0
- 11 12 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 11 10 0 0 0 0 0 0 0 0 1 V2000
- 3.9901 -2.3031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3261 -1.1486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9921 -1.1486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3280 -2.3031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.3031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3280 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3182 -2.3031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9822 -1.1486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3182 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3261 -3.4517 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9921 -3.4517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 7 1 0 0 0 0
- 1 10 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 6 1 0 0 0 0
- 4 5 1 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 1 0 0 0 0
- 10 11 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 10 9 0 0 0 0 0 0 0 0 1 V2000
- 1.9973 -3.4592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6584 -2.3046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9973 -1.1546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6658 -1.1546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6584 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6584 -4.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9899 -4.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6557 -3.4592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6658 -3.4592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.3046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 6 1 0 0 0 0
- 1 9 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 5 2 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 1 0 0 0 0
- 9 10 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 11 11 0 0 0 0 0 0 0 0 1 V2000
- 3.3269 -3.4585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9925 -3.4585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3283 -2.3037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9925 -1.1548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3269 -1.1548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9910 -2.3037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3194 -2.3037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9835 -1.1548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3283 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3283 -4.6073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 6 1 0 0 0 0
- 2 3 1 0 0 0 0
- 2 11 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 10 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 9 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 10 9 0 0 0 0 0 0 0 0 1 V2000
- 1.9973 -3.4592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6584 -2.3046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9973 -1.1546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6658 -1.1546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6584 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6584 -4.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9899 -4.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6557 -3.4592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6658 -3.4592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.3046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 6 1 0 0 0 0
- 1 9 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 5 2 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 2 0 0 0 0
- 9 10 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 9 8 0 0 0 0 0 0 0 0 1 V2000
- 2.3046 -1.9992 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4569 -2.6618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6092 -1.9992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6092 -0.6683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4569 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7615 -2.6618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3046 -0.6683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1523 -2.6618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.9992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 7 1 0 0 0 0
- 1 8 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 6 1 0 0 0 0
- 4 5 1 0 0 0 0
- 8 9 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 8 8 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6654 -1.1540 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9962 -1.1540 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6569 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9877 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6531 -1.1540 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9877 -2.3033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6569 -2.3033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 13 14 0 0 0 0 0 0 0 0 1 V2000
- 2.2670 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.5961 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.2606 -1.1490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.5961 -2.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.2670 -2.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.5962 -1.1490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.5962 -3.4532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.1427 -4.6705 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4408 -4.9438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.8507 -6.2108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1490 -5.5587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -4.8941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.2795 -3.5961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 6 2 0 0 0 0
- 2 3 2 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 5 6 1 0 0 0 0
- 5 7 1 0 0 0 0
- 7 8 1 0 0 0 0
- 7 13 1 0 0 0 0
- 8 9 1 0 0 0 0
- 8 11 1 0 0 0 0
- 9 10 2 0 0 0 0
- 11 12 1 0 0 0 0
- 12 13 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 14 15 0 0 0 0 0 0 0 0 2 V2000
- 5.5085 -1.1540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.1727 -2.3014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.5085 -3.4554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.1800 -3.4554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.5091 -2.3014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.1800 -1.1540 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 3.5091 0.0000 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0
- 3.5091 -4.6027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.0525 -5.8171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.0662 -6.7095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9122 -6.0453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.1873 -4.7436 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3016 -3.7573 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -4.0324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 1 6 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 2 0 0 0 0
- 4 5 1 0 0 0 0
- 4 8 1 0 0 0 0
- 5 6 2 0 0 0 0
- 6 7 1 0 0 0 0
- 8 9 1 0 0 0 0
- 8 12 1 0 0 0 0
- 9 10 1 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 1 0 0 0 0
- 12 13 1 0 0 0 0
- 13 14 2 0 0 0 0
-M CHG 2 6 1 7 -1
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 8 8 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6654 -1.1540 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9962 -1.1540 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6569 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9877 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6531 -1.1540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9877 -2.3033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6569 -2.3033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 7 7 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -1.5998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1503 -2.2653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3050 -1.5998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.4416 -0.2777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.7417 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.4072 -1.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.5169 -2.1419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 7 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 13 12 0 0 0 0 0 0 0 0 1 V2000
- 3.3259 -3.4535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9879 -2.2970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3259 -1.1485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9939 -1.1485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3320 -2.2970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9939 -3.4535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.2970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9879 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3199 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3199 -2.2970 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9818 -3.4535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3138 -3.4535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9758 -4.6020 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 10 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 1 0 0 0 0
- 5 7 2 0 0 0 0
- 8 9 2 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 1 0 0 0 0
- 12 13 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 10 9 0 0 0 0 0 0 0 0 1 V2000
- 2.3042 -1.9989 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3042 -0.6682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4563 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1521 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1521 -2.6614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.9989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4563 -2.6614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6084 -1.9989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7605 -2.6614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6084 -0.6682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 5 1 0 0 0 0
- 1 7 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 4 1 0 0 0 0
- 5 6 2 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 1 0 0 0 0
- 8 10 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 11 11 0 0 0 0 0 0 0 0 1 V2000
- 5.7578 -1.9999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6046 -2.6612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4595 -1.9999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3063 -2.6612 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1532 -1.9999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.3306 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7578 -0.6693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9109 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0641 -0.6693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0641 -1.9999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9109 -2.6612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 7 2 0 0 0 0
- 1 11 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 5 6 2 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 2 0 0 0 0
- 9 10 1 0 0 0 0
- 10 11 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 17 18 0 0 0 0 0 0 0 0 1 V2000
- 2.3044 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3044 -1.3295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4567 -1.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.7640 -2.2232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.6208 -1.2039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9281 -1.4329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3860 -2.6885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.5292 -3.7078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.2219 -3.4714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4567 -3.3237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6089 -3.9884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3044 -3.9884 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1522 -3.3237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.9884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1522 -1.9942 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9146 -0.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.2219 -0.5096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 15 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 10 1 0 0 0 0
- 3 16 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 9 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 2 0 0 0 0
- 10 11 2 0 0 0 0
- 10 12 1 0 0 0 0
- 12 13 1 0 0 0 0
- 13 14 2 0 0 0 0
- 13 15 1 0 0 0 0
- 16 17 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 17 19 0 0 0 0 0 0 0 0 1 V2000
- 5.7546 -2.6609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9055 -1.9980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9055 -0.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7546 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6037 -0.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6037 -1.9980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4528 -2.6609 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3018 -1.9980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1509 -2.6609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.9980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1509 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3018 -0.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0564 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2074 -0.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2074 -1.9980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0564 -2.6609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 1 6 1 0 0 0 0
- 2 3 1 0 0 0 0
- 2 17 1 0 0 0 0
- 3 4 2 0 0 0 0
- 3 14 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 2 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 2 0 0 0 0
- 8 13 1 0 0 0 0
- 9 10 1 0 0 0 0
- 10 11 2 0 0 0 0
- 11 12 1 0 0 0 0
- 12 13 2 0 0 0 0
- 14 15 2 0 0 0 0
- 15 16 1 0 0 0 0
- 16 17 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 23 26 0 0 0 0 0 0 0 0 1 V2000
- 4.6025 -7.9798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6025 -6.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4579 -5.9889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4579 -4.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3053 -3.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1526 -4.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.6599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1526 -1.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3053 -2.6599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1526 -5.9889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3053 -6.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6025 -3.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7552 -4.6589 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7552 -5.9889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9078 -3.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0604 -4.6589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9078 -2.6599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7552 -1.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7552 -0.6690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9078 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0604 -0.6690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0604 -1.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 15 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 12 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 13 1 0 0 0 0
- 5 6 2 0 0 0 0
- 5 10 1 0 0 0 0
- 6 7 1 0 0 0 0
- 6 11 1 0 0 0 0
- 7 8 2 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 2 0 0 0 0
- 11 12 1 0 0 0 0
- 13 14 1 0 0 0 0
- 14 15 1 0 0 0 0
- 14 16 1 0 0 0 0
- 16 17 2 0 0 0 0
- 16 18 1 0 0 0 0
- 18 19 1 0 0 0 0
- 18 23 1 0 0 0 0
- 19 20 1 0 0 0 0
- 20 21 1 0 0 0 0
- 21 22 1 0 0 0 0
- 22 23 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 11 11 0 0 0 0 0 0 0 0 1 V2000
- 1.9925 -2.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6567 -1.1488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9910 -1.1488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6552 -2.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9835 -2.3037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9910 -3.4525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6567 -3.4525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6552 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6642 -2.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.4525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.1488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 1 7 1 0 0 0 0
- 1 9 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 2 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 9 10 1 0 0 0 0
- 9 11 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 24 24 0 0 0 0 0 0 0 0 1 V2000
- 4.6016 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6016 -1.3369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4512 -2.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4512 -3.3268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3008 -3.9901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1504 -3.3268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1504 -2.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3008 -1.3369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3008 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -3.9901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6016 -3.9901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7623 -3.3268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7623 -2.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9127 -1.3369 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9127 -3.9901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0631 -3.3268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2135 -3.9901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2135 -5.3270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0631 -5.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9127 -5.3270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3639 -5.9903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3639 -3.3268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.1819 -7.3169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.8554 -7.3169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 13 1 0 0 0 0
- 3 4 2 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 11 1 0 0 0 0
- 5 6 2 0 0 0 0
- 6 7 1 0 0 0 0
- 6 10 1 0 0 0 0
- 7 8 2 0 0 0 0
- 8 9 1 0 0 0 0
- 11 12 1 0 0 0 0
- 12 13 2 0 0 0 0
- 12 15 1 0 0 0 0
- 13 14 1 0 0 0 0
- 15 16 2 0 0 0 0
- 15 20 1 0 0 0 0
- 16 17 1 0 0 0 0
- 17 18 2 0 0 0 0
- 17 22 1 0 0 0 0
- 18 19 1 0 0 0 0
- 18 21 1 0 0 0 0
- 19 20 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 25 26 0 0 0 0 0 0 0 0 1 V2000
- 10.6420 -6.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.9717 -8.0683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.6429 -8.0683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9845 -6.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.6429 -5.7580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.9717 -5.7580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9845 -4.6088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.6429 -3.4596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9845 -2.3104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.6429 -1.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.9717 -1.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.6420 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 10.6420 -2.3104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.9717 -3.4596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 11.9708 -2.3104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.6558 -4.6088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9854 -5.7580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6566 -5.7580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9863 -4.6088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6575 -4.6088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6566 -3.4596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9854 -3.4596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.6420 -9.2175 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -4.5609 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3288 -4.5609 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 1 6 1 0 0 0 0
- 2 3 1 0 0 0 0
- 2 23 1 0 0 0 0
- 3 4 2 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 2 0 0 0 0
- 5 7 1 0 0 0 0
- 7 8 1 0 0 0 0
- 7 16 2 0 0 0 0
- 8 9 2 0 0 0 0
- 8 14 1 0 0 0 0
- 9 10 1 0 0 0 0
- 10 11 2 0 0 0 0
- 11 12 1 0 0 0 0
- 11 13 1 0 0 0 0
- 13 14 2 0 0 0 0
- 13 15 1 0 0 0 0
- 16 17 1 0 0 0 0
- 16 22 1 0 0 0 0
- 17 18 2 0 0 0 0
- 18 19 1 0 0 0 0
- 19 20 2 0 0 0 0
- 19 21 1 0 0 0 0
- 21 22 2 0 0 0 0
- 24 25 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 24 25 0 0 0 0 0 0 0 0 1 V2000
- 7.9826 -4.6086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.6532 -3.4591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9826 -2.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.6532 -1.1495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.9730 -1.1495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.6435 -2.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.9730 -3.4591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.6435 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 8.6532 -5.7581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.9730 -5.7581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.6435 -6.9076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.9730 -8.0678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.6532 -8.0678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9826 -6.9076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.6435 -9.2173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 6.6522 -4.6086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9923 -5.7581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6619 -5.7581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9913 -4.6086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6619 -3.4591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9923 -3.4591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6609 -4.6086 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -4.5554 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3304 -4.5554 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 9 1 0 0 0 0
- 1 16 2 0 0 0 0
- 2 3 2 0 0 0 0
- 2 7 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 5 6 1 0 0 0 0
- 5 8 1 0 0 0 0
- 6 7 2 0 0 0 0
- 9 10 2 0 0 0 0
- 9 14 1 0 0 0 0
- 10 11 1 0 0 0 0
- 11 12 2 0 0 0 0
- 12 13 1 0 0 0 0
- 12 15 1 0 0 0 0
- 13 14 2 0 0 0 0
- 16 17 1 0 0 0 0
- 16 21 1 0 0 0 0
- 17 18 2 0 0 0 0
- 18 19 1 0 0 0 0
- 19 20 1 0 0 0 0
- 19 22 2 0 0 0 0
- 20 21 2 0 0 0 0
- 23 24 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 43 47 0 0 1 0 0 0 0 0 1 V2000
- 4.6024 -11.2995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6024 -9.9693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7644 -9.3118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9112 -9.9693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0580 -9.3118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2048 -9.9693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2048 -11.2995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0580 -11.9723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9112 -11.2995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7644 -11.9723 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3668 -11.9723 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0580 -7.9815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7644 -7.9815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4556 -9.3118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4556 -7.9815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6024 -7.3088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6024 -5.9785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7644 -5.3210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7644 -3.9908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9112 -3.3180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9112 -1.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0580 -1.3303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2048 -1.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3668 -1.3303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 9.2048 -3.3180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0580 -3.9908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 10.3668 -3.9908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0580 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7644 -1.3303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4556 -5.3210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4556 -3.9908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3088 -5.9785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3088 -7.3088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1468 -7.9815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1468 -5.3210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4556 -11.9723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4556 -13.3026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3088 -13.9600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1468 -13.3026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -13.9600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1468 -11.9723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3088 -11.2995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3088 -15.2903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 1 10 1 0 0 0 0
- 1 36 1 0 0 0 0
- 2 3 1 0 0 0 0
- 2 14 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 13 2 0 0 0 0
- 4 5 1 0 0 0 0
- 4 9 2 0 0 0 0
- 5 6 2 0 0 0 0
- 5 12 1 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 2 0 0 0 0
- 7 11 1 0 0 0 0
- 8 9 1 0 0 0 0
- 9 10 1 0 0 0 0
- 15 14 1 1 0 0 0
- 15 16 1 0 0 0 0
- 15 33 1 0 0 0 0
- 16 17 1 0 0 0 0
- 17 18 1 1 0 0 0
- 17 30 1 0 0 0 0
- 18 19 1 0 0 0 0
- 20 19 1 1 0 0 0
- 20 21 1 0 0 0 0
- 20 26 1 0 0 0 0
- 21 22 1 0 0 0 0
- 21 29 1 6 0 0 0
- 22 23 1 0 0 0 0
- 22 28 1 6 0 0 0
- 23 24 1 1 0 0 0
- 23 25 1 0 0 0 0
- 25 26 1 0 0 0 0
- 25 27 1 6 0 0 0
- 30 31 1 6 0 0 0
- 30 32 1 0 0 0 0
- 32 33 1 0 0 0 0
- 32 35 1 1 0 0 0
- 33 34 1 6 0 0 0
- 36 37 2 0 0 0 0
- 36 42 1 0 0 0 0
- 37 38 1 0 0 0 0
- 38 39 2 0 0 0 0
- 38 43 1 0 0 0 0
- 39 40 1 0 0 0 0
- 39 41 1 0 0 0 0
- 41 42 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 5 4 0 0 0 0 0 0 0 0 1 V2000
- 3.4567 -1.9945 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3056 -1.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1511 -1.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.3308 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3056 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 5 1 0 0 0 0
- 3 4 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 6 5 0 0 0 0 0 0 0 0 1 V2000
- 4.6084 -1.9954 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4563 -1.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4563 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3042 -1.9954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1521 -1.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 2 0 0 0 0
- 2 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 3 2 0 0 0 0 0 0 0 0 1 V2000
- 2.3030 -0.6656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1515 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -0.6656 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 13 12 0 0 0 0 0 0 0 0 2 V2000
- 0.0000 -1.1513 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3274 -1.1513 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0
- 2.6611 -1.1513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3217 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6554 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3159 -1.1513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6554 -2.3025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3217 -2.3025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6611 -6.2911 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6611 -4.9636 0.0000 B 0 5 0 0 0 0 0 0 0 0 0 0
- 1.3274 -4.9636 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6611 -3.6299 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9885 -4.9636 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 3 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 2 0 0 0 0
- 3 8 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 2 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 2 0 0 0 0
- 9 10 1 0 0 0 0
- 10 11 1 0 0 0 0
- 10 12 1 0 0 0 0
- 10 13 1 0 0 0 0
-M CHG 2 2 1 10 -1
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
-$$$$
-
-
-
- 12 12 0 0 0 0 0 0 0 0 1 V2000
- 3.4560 -1.3271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6103 -1.9906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6103 -3.3247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4560 -3.9882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3017 -3.3247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3017 -1.9906 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1543 -1.3271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.9906 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1543 -3.9882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7577 -3.9882 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9120 -3.3247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4560 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 6 1 0 0 0 0
- 1 12 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 10 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 1 0 0 0 0
- 5 9 1 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 2 0 0 0 0
- 10 11 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 9 8 0 0 0 0 0 0 0 0 1 V2000
- 4.6053 -1.9954 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4522 -1.3257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.2992 -1.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1530 -1.3257 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1530 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6053 -3.3210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7514 -1.3257 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 6.9045 -1.9954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 7 1 0 0 0 0
- 1 8 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 4 6 1 0 0 0 0
- 8 9 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 10 10 0 0 0 0 0 0 0 0 1 V2000
- 0.6656 -1.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9968 -1.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6577 -2.3040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9889 -2.3040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6545 -1.1543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9968 -3.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6656 -3.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.3040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -4.6079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 8 1 0 0 0 0
- 1 10 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 6 1 0 0 0 0
- 4 5 2 0 0 0 0
- 6 7 1 0 0 0 0
- 7 8 1 0 0 0 0
- 7 9 1 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 9 9 0 0 0 0 0 0 0 0 1 V2000
- 2.1136 -0.3740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3772 -0.7820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3772 -2.1136 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.1136 -2.5272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3316 -1.4506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.4506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.4538 -2.8956 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.6665 -2.3572 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.4538 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 5 1 0 0 0 0
- 2 3 1 0 0 0 0
- 2 9 2 0 0 0 0
- 3 4 1 0 0 0 0
- 3 7 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 1 0 0 0 0
- 7 8 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 9 8 0 0 0 0 0 0 0 0 1 V2000
- 0.0000 -1.1552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.6644 -2.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9932 -2.3044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6576 -1.1552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9932 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9924 -1.1552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6568 -2.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.6568 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9855 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 2 0 0 0 0
- 4 6 1 0 0 0 0
- 6 7 1 0 0 0 0
- 6 8 1 0 0 0 0
- 8 9 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 7 7 0 0 0 0 0 0 0 0 1 V2000
- 3.5169 -2.1419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.3050 -1.5998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.4416 -0.2777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.7417 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 4.4072 -1.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.1503 -2.2653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.5998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 5 1 0 0 0 0
- 2 3 1 0 0 0 0
- 2 6 1 0 0 0 0
- 3 4 1 0 0 0 0
- 4 5 1 0 0 0 0
- 6 7 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 14 14 0 0 0 0 0 0 0 0 1 V2000
- 1.9935 -3.4527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3316 -2.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9935 -1.1482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 3.3251 -1.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9869 -2.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.3186 -2.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9804 -1.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3120 -1.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.9739 -2.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.3120 -3.4527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.9804 -3.4527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.3316 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.3044 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 2 0 0 0 0
- 2 3 1 0 0 0 0
- 2 14 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 12 1 0 0 0 0
- 4 5 1 0 0 0 0
- 5 6 1 0 0 0 0
- 6 7 2 0 0 0 0
- 6 11 1 0 0 0 0
- 7 8 1 0 0 0 0
- 8 9 2 0 0 0 0
- 9 10 1 0 0 0 0
- 10 11 2 0 0 0 0
- 12 13 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 6 6 0 0 0 0 0 0 0 0 1 V2000
- 2.2694 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.2694 -1.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.9376 -1.3318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -2.2694 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.3409 -3.5516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.9376 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 1 6 1 0 0 0 0
- 2 3 1 0 0 0 0
- 3 4 1 0 0 0 0
- 3 6 1 0 0 0 0
- 4 5 2 0 0 0 0
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-active
-
-$$$$
-
-
-
- 6 4 0 0 0 0 0 0 0 0 2 V2000
- 2.6600 -2.6600 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6600 -1.3320 0.0000 B 0 5 0 0 0 0 0 0 0 0 0 0
- 1.3280 -1.3320 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
- 2.6600 0.0000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
- 3.9880 -1.3320 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.3320 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0
- 1 2 1 0 0 0 0
- 2 3 1 0 0 0 0
- 2 4 1 0 0 0 0
- 2 5 1 0 0 0 0
-M CHG 2 2 -1 6 1
-M END
-> <ActivityOutcome_CPDBAS_Hamster>
-inactive
-
diff --git a/test/data/hamster_carcinogenicity.xls b/test/data/hamster_carcinogenicity.xls Binary files differdeleted file mode 100644 index 680c30e..0000000 --- a/test/data/hamster_carcinogenicity.xls +++ /dev/null diff --git a/test/data/hamster_carcinogenicity.yaml b/test/data/hamster_carcinogenicity.yaml deleted file mode 100644 index 108edd9..0000000 --- a/test/data/hamster_carcinogenicity.yaml +++ /dev/null @@ -1,352 +0,0 @@ ---- !ruby/object:OpenTox::Dataset -compounds: -- http://localhost/compound/InChI=1S/C2H4O/c1-2-3/h2H,1H3 -- http://localhost/compound/InChI=1S/C15H13NO/c1-10(17)16-13-6-7-15-12(9-13)8-11-4-2-3-5-14(11)15/h2-7,9H,8H2,1H3,(H,16,17) -- http://localhost/compound/InChI=1S/C11H8N2O5/c12-11(14)8(9-2-1-5-17-9)6-7-3-4-10(18-7)13(15)16/h1-6H,(H2,12,14) -- http://localhost/compound/InChI=1S/C2H4N4/c3-2-4-1-5-6-2/h1H,(H3,3,4,5,6) -- http://localhost/compound/InChI=1S/BrHO3.K/c2-1(3)4;/h(H,2,3,4);/q;+1/p-1 -- http://localhost/compound/InChI=1S/Cd.2ClH/h;2*1H/q+2;;/p-2 -- http://localhost/compound/InChI=1S/Cd.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2 -- http://localhost/compound/InChI=1S/C14H14ClN3O2S/c1-8-4-3-5-10(9(8)2)16-12-6-11(15)17-14(18-12)21-7-13(19)20/h3-6H,7H2,1-2H3,(H,19,20)(H,16,17,18) -- http://localhost/compound/InChI=1S/C2H5ClO/c1-4-2-3/h2H2,1H3 -- http://localhost/compound/InChI=1S/C4H5Cl/c1-3-4(2)5/h3H,1-2H2 -- http://localhost/compound/InChI=1S/C17H17ClO3/c1-17(2,16(19)20)21-11-12-3-5-13(6-4-12)14-7-9-15(18)10-8-14/h3-10H,11H2,1-2H3,(H,19,20) -- http://localhost/compound/InChI=1S/C9H6O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H -- http://localhost/compound/InChI=1S/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H -- http://localhost/compound/InChI=1S/C14H9Cl5/c15-11-5-1-9(2-6-11)13(14(17,18)19)10-3-7-12(16)8-4-10/h1-8,13H -- http://localhost/compound/InChI=1S/C6H10N2O/c1-3-5-8(7-9)6-4-2/h3-4H,1-2,5-6H2 -- http://localhost/compound/InChI=1S/C12H8Cl6O/c13-8-9(14)11(16)5-3-1-2(6-7(3)19-6)4(5)10(8,15)12(11,17)18/h2-7H,1H2 -- http://localhost/compound/InChI=1S/C3H6ClNO/c1-5(2)3(4)6/h1-2H3 -- http://localhost/compound/InChI=1S/C2H8N2/c1-4(2)3/h3H2,1-2H3 -- http://localhost/compound/InChI=1S/C2H8N2.2ClH/c1-3-4-2;;/h3-4H,1-2H3;2*1H -- http://localhost/compound/InChI=1S/C2H6O/c1-2-3/h3H,2H2,1H3 -- http://localhost/compound/InChI=1S/C5H11N3O3/c1-2-8(7-11)5(10)6-3-4-9/h9H,2-4H2,1H3,(H,6,10) -- http://localhost/compound/InChI=1S/C6H11N3O3/c1-3-9(8-12)6(11)7-4-5(2)10/h3-4H2,1-2H3,(H,7,11) -- http://localhost/compound/InChI=1S/CH2O/c1-2/h1H2 -- http://localhost/compound/InChI=1S/C8H6N4O4S/c13-4-9-11-8-10-5(3-17-8)6-1-2-7(16-6)12(14)15/h1-4H,(H,9,13)(H,10,11) -- http://localhost/compound/InChI=1S/C5H4O2/c6-4-5-2-1-3-7-5/h1-4H -- http://localhost/compound/InChI=1S/C3H6O2/c4-1-3-2-5-3/h3-4H,1-2H2 -- http://localhost/compound/InChI=1S/C17H17ClO6/c1-8-5-9(19)6-12(23-4)17(8)16(20)13-10(21-2)7-11(22-3)14(18)15(13)24-17/h6-8H,5H2,1-4H3/t8-,17?/m1/s1 -- http://localhost/compound/InChI=1S/C6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9 -- http://localhost/compound/InChI=1S/H4N2/c1-2/h1-2H2 -- http://localhost/compound/InChI=1S/H4N2.H2O4S/c1-2;1-5(2,3)4/h1-2H2;(H2,1,2,3,4) -- http://localhost/compound/InChI=1S/C15H13NO2/c1-10(17)16(18)13-6-7-15-12(9-13)8-11-4-2-3-5-14(11)15/h2-7,9,18H,8H2,1H3 -- http://localhost/compound/InChI=1S/C2H8N2O/c3-4-1-2-5/h4-5H,1-3H2 -- http://localhost/compound/InChI=1S/C6H7N3O/c7-9-6(10)5-1-3-8-4-2-5/h1-4H,7H2,(H,9,10) -- http://localhost/compound/InChI=1S/C6H5NO2/c8-6(9)5-1-3-7-4-2-5/h1-4H,(H,8,9) -- http://localhost/compound/InChI=1S/C10H12ClNO2/c1-7(2)14-10(13)12-9-5-3-4-8(11)6-9/h3-7H,1-2H3,(H,12,13) -- http://localhost/compound/InChI=1S/C10H13NO2/c1-8(2)13-10(12)11-9-6-4-3-5-7-9/h3-8H,1-2H3,(H,11,12) -- http://localhost/compound/InChI=1S/2C2H4O2.4H2O.3Pb/c2*1-2(3)4;;;;;;;/h2*1H3,(H,3,4);4*1H2;;;/q;;;;;;3*+2/p-6 -- http://localhost/compound/InChI=1S/C14H19N3S.ClH/c1-16(2)9-10-17(12-13-6-5-11-18-13)14-7-3-4-8-15-14;/h3-8,11H,9-10,12H2,1-2H3;1H -- http://localhost/compound/InChI=1S/C20H22N8O5/c1-28(9-11-8-23-17-15(24-11)16(21)26-20(22)27-17)12-4-2-10(3-5-12)18(31)25-13(19(32)33)6-7-14(29)30/h2-5,8,13H,6-7,9H2,1H3,(H,25,31)(H,29,30)(H,32,33)(H4,21,22,23,26,27)/t13-/m0/s1 -- http://localhost/compound/InChI=1S/C2H6N2O/c1-4(3)2-5/h2H,3H2,1H3 -- http://localhost/compound/InChI=1S/C5H8O2/c1-4(2)5(6)7-3/h1H2,2-3H3 -- http://localhost/compound/InChI=1S/CH6N2/c1-3-2/h3H,2H2,1H3 -- http://localhost/compound/InChI=1S/C10H13N3O2/c1-13(12-15)7-3-5-10(14)9-4-2-6-11-8-9/h2,4,6,8H,3,5,7H2,1H3 -- http://localhost/compound/InChI=1S/C5H6N2OS/c1-3-2-4(8)7-5(9)6-3/h2H,1H3,(H2,6,7,8,9) -- http://localhost/compound/InChI=1S/C20H22O3/c1-20(2,19(21)22)23-16-12-10-15(11-13-16)18-9-5-7-14-6-3-4-8-17(14)18/h3-4,6,8,10-13,18H,5,7,9H2,1-2H3,(H,21,22) -- http://localhost/compound/InChI=1S/HNO2.Na/c2-1-3;/h(H,2,3);/q;+1/p-1 -- http://localhost/compound/InChI=1S/C9H7N3O4S/c1-5(13)10-9-11-6(4-17-9)7-2-3-8(16-7)12(14)15/h2-4H,1H3,(H,10,11,13) -- http://localhost/compound/InChI=1S/C8H5N3O4S/c12-4-9-8-10-5(3-16-8)6-1-2-7(15-6)11(13)14/h1-4H,(H,9,10,12) -- http://localhost/compound/InChI=1S/C12H9NO2/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-3,6-7H,4-5H2 -- http://localhost/compound/InChI=1S/C6H14N2O4/c1-5(10)2-8(7-12)3-6(11)4-9/h5-6,9-11H,2-4H2,1H3 -- http://localhost/compound/InChI=1S/C6H12N2O4/c1-5(10)2-8(7-12)3-6(11)4-9/h6,9,11H,2-4H2,1H3 -- http://localhost/compound/InChI=1S/C5H12N2O4/c8-2-1-7(6-11)3-5(10)4-9/h5,8-10H,1-4H2 -- http://localhost/compound/InChI=1S/C5H10N2O3/c1-5(9)4-7(6-10)2-3-8/h8H,2-4H2,1H3 -- http://localhost/compound/InChI=1S/C7H15N3O/c1-6-4-10(8-11)5-7(2)9(6)3/h6-7H,4-5H2,1-3H3 -- http://localhost/compound/InChI=1S/C6H10N2O2/c1-3-4-8(7-10)5-6(2)9/h3H,1,4-5H2,2H3 -- http://localhost/compound/InChI=1S/C4H10N2O3/c1-6(5-9)2-4(8)3-7/h4,7-8H,2-3H2,1H3 -- http://localhost/compound/InChI=1S/C4H8N2O2/c7-5-6-1-3-8-4-2-6/h1-4H2 -- http://localhost/compound/InChI=1S/C9H11N3O/c13-11-12-6-2-4-9(12)8-3-1-5-10-7-8/h1,3,5,7,9H,2,4,6H2 -- http://localhost/compound/InChI=1S/C9H11N3O2/c13-10-12-6-2-4-9(12)8-3-1-5-11(14)7-8/h1,3,5,7,9H,2,4,6H2 -- http://localhost/compound/InChI=1S/C5H10N2O/c8-6-7-4-2-1-3-5-7/h1-5H2 -- http://localhost/compound/InChI=1S/C4H8N2O/c7-5-6-3-1-2-4-6/h1-4H2 -- http://localhost/compound/InChI=1S/C6H10ClN3O3/c1-5(11)4-10(9-13)6(12)8-3-2-7/h2-4H2,1H3,(H,8,12) -- http://localhost/compound/InChI=1S/C4H7N3O3/c1-3(8)2-7(6-10)4(5)9/h2H2,1H3,(H2,5,9) -- http://localhost/compound/InChI=1S/C9H9NS/c11-8-10-7-6-9-4-2-1-3-5-9/h1-5H,6-7H2 -- http://localhost/compound/InChI=1S/C12H12N2O3/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16/h3-7H,2H2,1H3,(H2,13,14,15,16,17) -- http://localhost/compound/InChI=1S/C16H13N/c1-2-8-15(9-3-1)17-16-11-10-13-6-4-5-7-14(13)12-16/h1-12,17H -- http://localhost/compound/InChI=1S/C19H24N2O2/c22-18-13-20(19(23)15-7-2-1-3-8-15)12-17-16-9-5-4-6-14(16)10-11-21(17)18/h4-6,9,15,17H,1-3,7-8,10-13H2 -- http://localhost/compound/InChI=1S/C7H6O4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,8-9H,(H,10,11) -- http://localhost/compound/InChI=1S/C15H10O7.2H2O/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6;;/h1-5,16-19,21H;2*1H2 -- http://localhost/compound/InChI=1S/C20H19N3.ClH/c1-13-12-16(6-11-19(13)23)20(14-2-7-17(21)8-3-14)15-4-9-18(22)10-5-15;/h2-12,21H,22-23H2,1H3;1H -- http://localhost/compound/InChI=1S/C19H17N3.ClH/c20-16-7-1-13(2-8-16)19(14-3-9-17(21)10-4-14)15-5-11-18(22)12-6-15;/h1-12,20H,21-22H2;1H -- http://localhost/compound/InChI=1S/C27H30O16/c1-8-17(32)20(35)22(37)26(40-8)39-7-15-18(33)21(36)23(38)27(42-15)43-25-19(34)16-13(31)5-10(28)6-14(16)41-24(25)9-2-3-11(29)12(30)4-9/h2-6,8,15,17-18,20-23,26-33,35-38H,7H2,1H3/t8-,15+,17-,18+,20+,21-,22+,23+,26+,27?/m0/s1 -- http://localhost/compound/InChI=1S/C2HCl3/c3-1-2(4)5/h1H -- http://localhost/compound/InChI=1S/C3H7NO2/c1-2-6-3(4)5/h2H2,1H3,(H2,4,5) -- http://localhost/compound/InChI=1S/C2H3Cl/c1-2-3/h2H,1H2 -- http://localhost/compound/InChI=1S/C6H5N2.BF4/c7-8-6-4-2-1-3-5-6;2-1(3,4)5/h1-5H;/q+1;-1 -- http://localhost/compound/InChI=1S/C6H12N4O2/c1-5-3-9(7-11)4-6(2)10(5)8-12/h5-6H,3-4H2,1-2H3 -- http://localhost/compound/InChI=1S/C5H13N3O/c1-7(2)4-5-8(3)6-9/h4-5H2,1-3H3 -- http://localhost/compound/InChI=1S/C6H12N2O2/c1-5-3-8(7-9)4-6(2)10-5/h5-6H,3-4H2,1-2H3 -- http://localhost/compound/InChI=1S/C4H6N2O3/c1-3-2-6(5-8)4(7)9-3/h3H,2H2,1H3 -- http://localhost/compound/InChI=1S/C4H8N2O3/c1-3-9-4(7)6(2)5-8/h3H2,1-2H3 -- http://localhost/compound/InChI=1S/C3H6N2O2/c6-4-5-1-2-7-3-5/h1-3H2 -- http://localhost/compound/InChI=1S/C9H11N3O2/c10-9(13)12(11-14)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,10,13) -- http://localhost/compound/InChI=1S/C3H6N2O/c6-4-5-2-1-3-5/h1-3H2 -- http://localhost/compound/InChI=1S/BF4.Na/c2-1(3,4)5;/q-1;+1 -data_entries: - http://localhost/compound/InChI=1S/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C3H6ClNO/c1-5(2)3(4)6/h1-2H3: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C2H8N2O/c3-4-1-2-5/h4-5H,1-3H2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C4H10N2O3/c1-6(5-9)2-4(8)3-7/h4,7-8H,2-3H2,1H3: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/CH2O/c1-2/h1H2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C5H12N2O4/c8-2-1-7(6-11)3-5(10)4-9/h5,8-10H,1-4H2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C7H15N3O/c1-6-4-10(8-11)5-7(2)9(6)3/h6-7H,4-5H2,1-3H3: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C4H8N2O2/c7-5-6-1-3-8-4-2-6/h1-4H2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C16H13N/c1-2-8-15(9-3-1)17-16-11-10-13-6-4-5-7-14(13)12-16/h1-12,17H: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C3H6O2/c4-1-3-2-5-3/h3-4H,1-2H2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C4H6N2O3/c1-3-2-6(5-8)4(7)9-3/h3H,2H2,1H3: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C6H5NO2/c8-6(9)5-1-3-7-4-2-5/h1-4H,(H,8,9): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/2C2H4O2.4H2O.3Pb/c2*1-2(3)4;;;;;;;/h2*1H3,(H,3,4);4*1H2;;;/q;;;;;;3*+2/p-6: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C17H17ClO6/c1-8-5-9(19)6-12(23-4)17(8)16(20)13-10(21-2)7-11(22-3)14(18)15(13)24-17/h6-8H,5H2,1-4H3/t8-,17?/m1/s1: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C3H6N2O2/c6-4-5-1-2-7-3-5/h1-3H2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C3H7NO2/c1-2-6-3(4)5/h2H2,1H3,(H2,4,5): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C5H8O2/c1-4(2)5(6)7-3/h1H2,2-3H3: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C2H6N2O/c1-4(3)2-5/h2H,3H2,1H3: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C6H12N2O4/c1-5(10)2-8(7-12)3-6(11)4-9/h6,9,11H,2-4H2,1H3: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C5H4O2/c6-4-5-2-1-3-7-5/h1-4H: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C4H8N2O/c7-5-6-3-1-2-4-6/h1-4H2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C9H11N3O2/c10-9(13)12(11-14)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,10,13): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C14H14ClN3O2S/c1-8-4-3-5-10(9(8)2)16-12-6-11(15)17-14(18-12)21-7-13(19)20/h3-6H,7H2,1-2H3,(H,19,20)(H,16,17,18): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/H4N2.H2O4S/c1-2;1-5(2,3)4/h1-2H2;(H2,1,2,3,4): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C5H10N2O/c8-6-7-4-2-1-3-5-7/h1-5H2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C10H13N3O2/c1-13(12-15)7-3-5-10(14)9-4-2-6-11-8-9/h2,4,6,8H,3,5,7H2,1H3: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C3H6N2O/c6-4-5-2-1-3-5/h1-3H2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C4H8N2O3/c1-3-9-4(7)6(2)5-8/h3H2,1-2H3: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C6H10N2O2/c1-3-4-8(7-10)5-6(2)9/h3H,1,4-5H2,2H3: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C14H9Cl5/c15-11-5-1-9(2-6-11)13(14(17,18)19)10-3-7-12(16)8-4-10/h1-8,13H: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/BrHO3.K/c2-1(3)4;/h(H,2,3,4);/q;+1/p-1: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C2H5ClO/c1-4-2-3/h2H2,1H3: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C10H12ClNO2/c1-7(2)14-10(13)12-9-5-3-4-8(11)6-9/h3-7H,1-2H3,(H,12,13): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C8H5N3O4S/c12-4-9-8-10-5(3-16-8)6-1-2-7(15-6)11(13)14/h1-4H,(H,9,10,12): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/Cd.2ClH/h;2*1H/q+2;;/p-2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C20H19N3.ClH/c1-13-12-16(6-11-19(13)23)20(14-2-7-17(21)8-3-14)15-4-9-18(22)10-5-15;/h2-12,21H,22-23H2,1H3;1H: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/BF4.Na/c2-1(3,4)5;/q-1;+1: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C6H5N2.BF4/c7-8-6-4-2-1-3-5-6;2-1(3,4)5/h1-5H;/q+1;-1: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C2H4N4/c3-2-4-1-5-6-2/h1H,(H3,3,4,5,6): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C9H6O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C2HCl3/c3-1-2(4)5/h1H: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C2H8N2/c1-4(2)3/h3H2,1-2H3: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C6H7N3O/c7-9-6(10)5-1-3-8-4-2-5/h1-4H,7H2,(H,9,10): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C12H8Cl6O/c13-8-9(14)11(16)5-3-1-2(6-7(3)19-6)4(5)10(8,15)12(11,17)18/h2-7H,1H2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/Cd.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C5H10N2O3/c1-5(9)4-7(6-10)2-3-8/h8H,2-4H2,1H3: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C27H30O16/c1-8-17(32)20(35)22(37)26(40-8)39-7-15-18(33)21(36)23(38)27(42-15)43-25-19(34)16-13(31)5-10(28)6-14(16)41-24(25)9-2-3-11(29)12(30)4-9/h2-6,8,15,17-18,20-23,26-33,35-38H,7H2,1H3/t8-,15+,17-,18+,20+,21-,22+,23+,26+,27?/m0/s1: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C12H12N2O3/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16/h3-7H,2H2,1H3,(H2,13,14,15,16,17): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C8H6N4O4S/c13-4-9-11-8-10-5(3-17-8)6-1-2-7(16-6)12(14)15/h1-4H,(H,9,13)(H,10,11): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C9H7N3O4S/c1-5(13)10-9-11-6(4-17-9)7-2-3-8(16-7)12(14)15/h2-4H,1H3,(H,10,11,13): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/CH6N2/c1-3-2/h3H,2H2,1H3: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C12H9NO2/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-3,6-7H,4-5H2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C15H10O7.2H2O/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6;;/h1-5,16-19,21H;2*1H2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C7H6O4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,8-9H,(H,10,11): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C9H9NS/c11-8-10-7-6-9-4-2-1-3-5-9/h1-5H,6-7H2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C20H22O3/c1-20(2,19(21)22)23-16-12-10-15(11-13-16)18-9-5-7-14-6-3-4-8-17(14)18/h3-4,6,8,10-13,18H,5,7,9H2,1-2H3,(H,21,22): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C6H12N2O2/c1-5-3-8(7-9)4-6(2)10-5/h5-6H,3-4H2,1-2H3: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C10H13NO2/c1-8(2)13-10(12)11-9-6-4-3-5-7-9/h3-8H,1-2H3,(H,11,12): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C6H14N2O4/c1-5(10)2-8(7-12)3-6(11)4-9/h5-6,9-11H,2-4H2,1H3: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C19H24N2O2/c22-18-13-20(19(23)15-7-2-1-3-8-15)12-17-16-9-5-4-6-14(16)10-11-21(17)18/h4-6,9,15,17H,1-3,7-8,10-13H2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C5H11N3O3/c1-2-8(7-11)5(10)6-3-4-9/h9H,2-4H2,1H3,(H,6,10): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C14H19N3S.ClH/c1-16(2)9-10-17(12-13-6-5-11-18-13)14-7-3-4-8-15-14;/h3-8,11H,9-10,12H2,1-2H3;1H: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/H4N2/c1-2/h1-2H2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C4H5Cl/c1-3-4(2)5/h3H,1-2H2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C17H17ClO3/c1-17(2,16(19)20)21-11-12-3-5-13(6-4-12)14-7-9-15(18)10-8-14/h3-10H,11H2,1-2H3,(H,19,20): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C2H8N2.2ClH/c1-3-4-2;;/h3-4H,1-2H3;2*1H: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C6H10ClN3O3/c1-5(11)4-10(9-13)6(12)8-3-2-7/h2-4H2,1H3,(H,8,12): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C6H11N3O3/c1-3-9(8-12)6(11)7-4-5(2)10/h3-4H2,1-2H3,(H,7,11): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C11H8N2O5/c12-11(14)8(9-2-1-5-17-9)6-7-3-4-10(18-7)13(15)16/h1-6H,(H2,12,14): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C2H6O/c1-2-3/h3H,2H2,1H3: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C5H13N3O/c1-7(2)4-5-8(3)6-9/h4-5H2,1-3H3: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C15H13NO/c1-10(17)16-13-6-7-15-12(9-13)8-11-4-2-3-5-14(11)15/h2-7,9H,8H2,1H3,(H,16,17): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C5H6N2OS/c1-3-2-4(8)7-5(9)6-3/h2H,1H3,(H2,6,7,8,9): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C9H11N3O/c13-11-12-6-2-4-9(12)8-3-1-5-10-7-8/h1,3,5,7,9H,2,4,6H2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C6H12N4O2/c1-5-3-9(7-11)4-6(2)10(5)8-12/h5-6H,3-4H2,1-2H3: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C19H17N3.ClH/c20-16-7-1-13(2-8-16)19(14-3-9-17(21)10-4-14)15-5-11-18(22)12-6-15;/h1-12,20H,21-22H2;1H: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/HNO2.Na/c2-1-3;/h(H,2,3);/q;+1/p-1: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C2H3Cl/c1-2-3/h2H,1H2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C6H10N2O/c1-3-5-8(7-9)6-4-2/h3-4H,1-2,5-6H2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C9H11N3O2/c13-10-12-6-2-4-9(12)8-3-1-5-11(14)7-8/h1,3,5,7,9H,2,4,6H2: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C15H13NO2/c1-10(17)16(18)13-6-7-15-12(9-13)8-11-4-2-3-5-14(11)15/h2-7,9,18H,8H2,1H3: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C20H22N8O5/c1-28(9-11-8-23-17-15(24-11)16(21)26-20(22)27-17)12-4-2-10(3-5-12)18(31)25-13(19(32)33)6-7-14(29)30/h2-5,8,13H,6-7,9H2,1H3,(H,25,31)(H,29,30)(H,32,33)(H4,21,22,23,26,27)/t13-/m0/s1: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - false - http://localhost/compound/InChI=1S/C4H7N3O3/c1-3(8)2-7(6-10)4(5)9/h2H2,1H3,(H2,5,9): - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true - http://localhost/compound/InChI=1S/C2H4O/c1-2-3/h2H,1H3: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - - true -features: - http://localhost/dataset/1/feature/hamster_carcinogenicity: - http://www.opentox.org/api/1.1#hasSource: hamster_carcinogenicity.csv - http://purl.org/dc/elements/1.1/title: hamster_carcinogenicity -metadata: - http://www.opentox.org/api/1.1#hasSource: hamster_carcinogenicity.csv - http://purl.org/dc/elements/1.1/title: hamster_carcinogenicity - http://www.w3.org/2001/XMLSchema#anyUri: http://localhost/dataset/1 -uri: http://localhost/dataset/1 diff --git a/test/data/hamster_carcinogenicity_with_errors.csv b/test/data/hamster_carcinogenicity_with_errors.csv deleted file mode 100644 index e4f97e5..0000000 --- a/test/data/hamster_carcinogenicity_with_errors.csv +++ /dev/null @@ -1,88 +0,0 @@ -SMILES,Hamster Carcinogenicity
-CC=O,1
-CC=O,1
-C12C3=C(C=CC=C3)CC1=CC(=CC=2)NC(C)=O,1
-O=C(N)\C(C2=CC=CO2)=C/C1=CC=C([N+]([O-])=O)O1,1
-C1(N#C#N#N=1)N,0
-Br(=O)(=O)[O-].[K+],1
-[Cl-].[Cd+2].[Cl-],0
-O=S(=O)([O-])[O-].[Cd+2],0
-ClC1=CC(=NC(=N1)SCC(=O)O)NC2=CC=CC(=C2C)C,0
-ClCOC,1
-C=C(Cl)C=C,0
-Clc1ccc(cc1)c2ccc(COC(C)(C)C(O)=O)cc2,0
-O=C1OC2=C(C=CC=C2)C=C1,0
-ClC(=C(C1=CC=C(C=C1)Cl)C2=CC=C(C=C2)Cl)Cl,1
-ClC(C(C1=CC=C(C=C1)Cl)C2=CC=C(C=C2)Cl)(Cl)Cl,0
-C=CCN(CC=C)N=O,1
-Cl\C2=C(/Cl)C3(Cl)C1C4CC(C1C2(Cl)C3(Cl)Cl)C5OC45,
-O=C(N(C)C)Cl,1
-CN(C)N,1
-N(NC)C.[H]Cl.[H]Cl,1
-CCO,0
-O=C(N(CC)N=O)NCCO,1
-O=C(N(CC)N=O)NCC(=O)C,1
-C#O,0
-[O-][N+](=O)C1=CC=C(O1)C2=CSC(=N2)NNC=O,
-O=CC1=CC=CO1,0
-OCC1CO1,1
-O=C2C1=C(OC)C=C(OC)C(Cl)=C1O[C@]32C(OC)=CC(C[C@@](C)3[H])=O,0
-O=C2C1=C(OC)C=C(OC)C(Cl)=C1O[C@]32C(OC)=CC(C[C@@](C)3[H])=O,1
-ClC1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl,1
-NN,1
-OS(=O)(=O)O.NN,1
-CC(=O)N(O)C1=CC2=C(C=C1)C3=CC=CC=C3C2,1
-OccNN,0
-O=C(C1=CC=NC=C1)NN,0
-OC(=O)C1=CC=NC=C1,0
-O=C(NC1=CC=CC(=C1)Cl)OC(C)C,0
-O=C(NC1=CC=CC=C1)OC(C)C,0
-[O-]C(C)=O.[O-]C(C)=O.[Pb+2].[OH-].[OH-].[Pb+2].[OH-].[OH-].[Pb+2],0
-CN(C)CCN(CC2=CC=CS2)C1=NC=CC=C1.Cl,0
-NC1=C2C(=NC(=N1)N)N=CC(=N2)CN(C3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)O)C(=O)O)C,0
-CN(N)C=O,TRUE
-O=C(C(=C)C)OC,0
-CNN,1
-O=C(C1=CC=CN=C1)CCCN(N=O)C,NA
-CC1=CC(=O)NC(=S)N1,1
-CC(C(O)=O)(OC1=CC=C(C=C1)C2CCCC3=C2C=CC=C3)C,0
-O=N[O-].[Na+],0
-[O-][N+](C1=CC=C(C2=CSC(NC(C)=O)=N2)O1)=O,1
-[O-][N+](=O)C1=CC=C(O1)C2=CSC(=N2)NC=O,1
-O=[N+](C1=CC=C2C3=C1C=CC=C3CC2)[O-],0
-stupid error,1
-N(CC(CO)O)(CC(C)=O)N=O,1
-N(CC(CO)O)(CCO)N=O,0
-O=C(C)CN(N=O)CCO,1
-C1C(N(C(CN1N=O)C)C)C,1
-N(CC(C)=O)(CC=C)N=O,1
-N(CC(CO)O)(C)N=O,1
-O=NN1CCOCC1,1
-N1C=CC=C(C=1)C2N(N=O)CCC2,1
-C1=CC=C(C=[N+]1[O-])C2CCCN2N=O,0
-O=NN1CCCCC1,1
-O=NN1CCCC1,1
-O=C(N(CC(C)=O)N=O)NCCCl,1
-N(C(=O)N)(N=O)CC(C)=O,1
-C1(CCN=C=S)=CC=CC=C1,0
-O=C1C(C2=CC=CC=C2)(C(=O)NC(=O)N1)CC,0
-C1=C2C(=CC=C1NC3=CC=CC=C3)C=CC=C2,0
-O=C1N2C(C3=C(C=CC=C3)CC2)CN(C1)C(=O)C4CCCCC4,0
-C1(=CC(=C(O)C=C1)O)C(O)=O,0
-O=C1C2=C(C=C(C=C2O)O)O/C(=C\1O)C3=CC(=C(C=C3)O)O.O.O,0
-C1=C(C=CC(=C1)C(C2=CC=C(N)C(=C2)C)=C3C=CC(=N)C=C3)N.[H]Cl,0
-C(C1=CC=C(C=C1)N)(C2=CC=C(C=C2)N)=C3C=CC(C=C3)=N.[H]Cl,0
-OC2=CC1=C(C(O)=C2)C(C(O[C@@H]4O[C@@H]([C@H]([C@H](O)[C@H]4O)O)CO[C@H]3[C@H](O)[C@H](O)[C@H]([C@H](C)O3)O)=C(C5=CC(O)=C(C=C5)O)O1)=O,0
-ClC(=CCl)Cl,0
-NC(=O)OCC,1
-C=CCl,1
-N#[N+]C1=CC=CC=C1.F[B-](F)(F)F,0
-C1(CN(CC(N1N=O)C)N=O)C,1
-N(CCN(C)C)(C)N=O,1
-C1(CN(N=O)CC(O1)C)C,1
-O1C(N(CC1C)N=O)=O,1
-CCOC(=O)N(C)N=O,1
-C1N(COC1)N=O,1
-O=C(N(CCC1=CC=CC=C1)N=O)N,1
-O=NN1CCC1,1
-F[B-](F)(F)F.[Na+],0
diff --git a/test/data/kazius.csv b/test/data/kazius.csv deleted file mode 100644 index 9dc3a74..0000000 --- a/test/data/kazius.csv +++ /dev/null @@ -1,4069 +0,0 @@ -COC1=CC=C(C=C1)C2=NC(=C([NH]2)C3=CC=CC=C3)C4=CC=CC=C4,1 -CC1=C(C=CC=C1N=C=O)N=C=O,1 -OCCC1=C[N](N=O)C2=CC=CC=C12,1 -[O-][N+](=O)C1=CC(=CS1)C(=O)NC2=CC(=CC=C2)Br,1 -CN(N=O)C1=CC=CC=C1,1 -CN2C1=C(C=CC=C1)C(=O)C3=C2C4=C(C=C3O)OC(C4)C5(C)CO5,1 -CS(=O)(=O)NC1=CC=C(C=C1)NC3=C2C=CC=CC2=NC4=CC=CC=C34,1 -[O-][N+](=O)C1=CC=C(C=C1)OC2=C(C=C(C=C2)Cl)Cl,1 -OC1=C(C=CC(=C1)[N+]([O-])=O)[N+]([O-])=O,1 -C[N]2C(=NC3=C1N=CC=NC1=C(C)C(=C23)C)N,1 -CSC1=C(C(=C(C(=C1)SC)N)C)N,1 -OC1=CC4=C(C=C1)C3=CC2=CC=CC=C2C=C3C5=CC=CC=C45,1 -CC(=O)C(Br)=C,1 -NCCNCCNCCN,1 -CN(C)C1=CC=C(C=C1)CCO,1 -COC4=CC(=O)C3=C2[NH]C1=CC=NC=C1C2=CN=C3C4=O,1 -N1C3C1C2=CSC=C2C4=CSC=C34,1 -CC1=C(C=C(C(=C1)N=NC2=CC=CC=C2)N)N,1 -NC3=CC2=NC1=CC(=CC=C1C=C2C=C3)N,1 -[O-][N+](=O)C3=C1CCC2=CC=CC(=C12)C=C3,1 -NC1=CC=C(C=C1)C=CC2=CC=C(C=C2)[N+]([O-])=O,1 -COC(=O)C1(OC1(C)C(O)C(C)C)C(N)=O,1 -CC(I)C1OCC(CO)O1,1 -CN(C)CCNC(=O)C3=C2N=C1C=CC=CC1=NC2=CC=C3,1 -CC1=C(C=C(C=C1)N)C,1 -CC1=C3C(=CC=N1)C2=CC=CC=C2[NH]3,1 -OC1CN(CCO1)N=O,1 -[O-][N+](=O)C1=C(C=CC=C1)C(Cl)=O,1 -ClCCOP(OCCCl)OCCCl,1 -COC(=O)NC2=NC1=CC=CC=C1[NH]2,1 -CCOC(=O)N(CCCC(=O)C1=CN=CC=C1)N=O,1 -C1CSCCS1,1 -NC1=CC=C(C=C1)C2=CC=C(C=C2)Cl,1 -NNC2=C1C=CC=CC1=C(N=N2)NN,1 -C[N]3C(=NC4=CC=C2C=CC1=CC=C(O)C=C1C2=C34)C,1 -CC(=O)OC1=CC=C(C=C1)CCl,1 -NC1=CC=C(C=C1)OC2=CC=C(C=C2)[N+]([O-])=O,1 -[O-][N+](=O)C1=CC=C(C=C1)C2=C(C=C(C=C2)[N+]([O-])=O)[N+]([O-])=O,1 -COC1=C(C=CC=C1)[N+]([O-])=O,1 -C1=CC2=C(C=C1)C4=C(C=C2)C3=NC=CC=C3C=C4,1 -OC2=C3C=CC4=CC=C(C5=C1C=CC=CC1=C(C=C2)C3=C45)[N+]([O-])=O,1 -[O-][N+](=O)C1=CC(=C(C(=C1)[N+]([O-])=O)Cl)[N+]([O-])=O,1 -[O-][N+](=O)C1=C3C(=CC=C1)C2=CC=CC=C2C(O3)=O,1 -CC3=C2C1=CC=CC=C1C=CC2=C(C4=CC=CC=C34)CO,1 -CC3=C2C=CC1=CC=CC=C1C2=CC4=CC=CC=C34,1 -CC1=CC=C(C=C1)S(=O)(=O)OCC2=CC=C(C=C2)[N+]([O-])=O,1 -CN1CCN(CC1)C5=CC(=O)C2=C(C4=C(C(=N2)C)C3=CC=CC=C3[NH]4)C5=O,1 -CC1=C(C3=C(C=C1)C(=O)C2=C(C=CC=C2)C3=O)O,1 -CC2C1=C(C=CC(=C1)F)C3=C2C=C(C=C3)F,1 -O=NC1=CC3=C(C=C1)C2=CC=CC=C2C3,1 -OC3C1OC1C2=C4C(=C(C=C2)O)C7=C5C(=C34)C(=CC=C5C6OC6C7=O)O,1 -OC(=O)C1=CC(=C(C=C1)Cl)[N+]([O-])=O,1 -N(C1=CC=CC=C1)C2=CC=C(C=C2)NC3=CC=CC=C3,1 -C[N+]3=C2C=CC1OC1C2=CC=C3,1 -COC1=C(C=C(C=C1)N)N,1 -CC(=O)NC1=CC=C(C=C1)C(=O)C2OC2C3=CC=CC=C3,1 -C[N]1C(=NC2=C1C=C(C)C3=NC(=CN=C23)C4=CC=CC=C4)N,1 -[O-][N+]([O-])=C1CCCC1,1 -COC2=C1OC(=CC1=C(C=C2)N(CCCl)CCCl)[N+]([O-])=O,1 -COC3=C(C=C2N=C1C=C(C(=CC1=NC2=C3)N)OC)N,1 -C[N]2C(=NC3=NC1=CC=CC=C1C=C23)N,1 -OC5C(O)C4=C(C3=NC2=C1C=CC=CC1=CC=C2C=C3C=C4)C6OC56,1 -NC3=C2C=C1C=CC=CC1=NC2=CC=C3,1 -[O-][N+](=O)C1=CC4=C2C(=C1)CCC3=C2C(=CC(=C3)[N+]([O-])=O)CC4,1 -[O-][N+](=O)C3=CC2=NC1=CC=CC=C1N=C2C=C3,1 -CCOP(=O)(OC1=CC=C(C=C1)[N+]([O-])=O)C2=CC=CC=C2,1 -[O-][N+](=O)C3=C2C=CC1=CC=CC4=C1C2=C(C=C3)C(=O)C4=O,1 -CC(C)S(Cl)(=O)=O,1 -CC3=C2C1=CC=CC=C1[NH]C2=CC(=N3)N,1 -ClCC(Cl)CBr,1 -CC2=C(N=C1C(=C(C=CC1=N2)N)C)C,1 -CC1=CC4=C(C=C1)C5=C2C=CC=CC2=CC6=C3C=CC=CC3=CC4=C56,1 -NC1=CC(=CC=C1)[N+]([O-])=O,1 -[O-][N+](=O)C2=C1SN=C(C1=CC=C2)Cl,1 -[O-][N+](=O)C4=C2C=CC=C3C1=CC=CC=C1C(=C23)C(=C4)[N+]([O-])=O,1 -[O-][N+](=O)C1=C(C=CC=C1)SSC(Cl)=C(Cl)Cl,1 -CN(C)CCCNC2=C1C(=CC=C(C1=NC3=CC=CC=C23)Cl)[N+]([O-])=O,1 -COC4=CC(=O)C3=C2[NH]C1=C(CCCC1)C2=C(C)N=C3C4=O,1 -CC=CC=O,1 -C[N+]2=C1C=CC(=CC1=CC3=CC=CC=C23)N,1 -CC(=O)ON(C(C)=O)C1=CC=C(C=C1)SC2=CC=CC=C2,1 -CC1C=C(C=O)C(=CC2(O)CC(C)(C)CC12)C=O,1 -C1=CC2=C(C=C1)C3=CC=C4C=CC=C5C=CC(=C2)C3=C45,1 -ClC2=C1C=CC=CC1=CC=C2,1 -C2C1=C(C=CC=C1)C3=C2C4=C(C=C3)C=CC5=C4C=CC=C5,1 -CC1=C(C=CC(=C1)N)N,1 -COC1=CC(=C(C=C1)OC)N=NC3=C2C=CC=CC2=CC=C3O,1 -CN(C)C1=CC=C(C=C1)N=NC3=C2C=CC=CC2=CC=C3,1 -COP(=O)(OC)OC,1 -ClC(Cl)C#N,1 -[O-][N+](=O)C1=CC2=C(C=C1)NCC2,1 -[O-][N+](=O)C1=CC(=CS1)C(=O)NC2=C(C=CC=C2)F,1 -C[N]1C(=NC=C1[N+]([O-])=O)C2NC(CO)(CO)CO2,1 -COC1=C(C=CC(=C1)O)NC3=C2C=CC=CC2=NC4=CC=CC=C34,1 -COC(=O)C1=C(C=CC=C1)O,1 -O1C4C1C2=C(C=CC3=CC=CC=C23)C5=C4C=CC=C5,1 -CC1=CC(=C(C=C1)[N+]([O-])=O)[N+]([O-])=O,1 -O=C5C=C3C2=C(C=C1C=CC=CC1=C2)C4=C3C(=CC=C4)C5=O,1 -[O-][N+](=O)C1=CC=C(O1)C=CC=NN2CC(=O)NC2=O,1 -C[N]1C(=NC2=NC=C(C=C12)C3=CC=CC=C3)N,1 -BrC(=C)C=O,1 -CC(=O)NC(CSC(Cl)=C(Cl)C(Cl)=C(Cl)Cl)C(O)=O,1 -[O-][N+](=O)C2=C1C(=CC=CC1=CC=C2)[N+]([O-])=O,1 -COC4=C1C5=C(C(OC1=C3C2C=COC2OC3=C4)=O)C(CC5)O,1 -CC(=C)C2=CC=C(C)C1=CC=C(C=O)C1=C2,1 -CC1=CC=C[N]2C1=NC3=CC=C(N)N=C23,1 -C1=CC2=C(C=C1)C3=CN=C4C=CC=C5C=CC(=C2)C3=C45,1 -COC(=O)C(=CC1=CC=C(O1)[N+]([O-])=O)[N+]([O-])=O,1 -ClCC4=CC=C3C2=C1C(=CC=CC1=CC=C2)C3=C4,1 -[O-][N+](=O)C1=CC(=C(C=C1)Cl)[N+]([O-])=O,1 -COC(=O)C(=CC1=CC=C(O1)[N+]([O-])=O)C#N,1 -C(N1C3C1C2=C(C=CC=C2)C4=C3C=CC=C4)C5=CC=CC=C5,1 -OC1C(O)C5=C4C2=C1C=CC=C2C3=CC=CC=C3C4=C(C=C5)[N+]([O-])=O,1 -CN(C)C1=CC=C(C=C1)C=CC2=CC(C=C(C)O2)=C(C#N)C#N,1 -CCCCOCC1CO1,1 -OC(=O)C=CC1=CC(=CC=C1)[N+]([O-])=O,1 -NC(O)=NO,1 -FCC1CO1,1 -ClC(C(=O)NCC1=CC=CC=C1)C2=CC=CC=C2,1 -CC1(C)CC(O)CC(C)(C)N1O,1 -CC(=O)NC1=CC=C(C=C1)SC2=CC=CC=C2,1 -OC1=C(C=CC=C1)NC2=C(C=C(C=C2)[N+]([O-])=O)[N+]([O-])=O,1 -CCC(=O)N(O)C1=CC=C(C=C1)C2=CC=CC=C2,1 -O=CC1CC(=O)C(=O)CO1,1 -C(COCC1CO1)OCC2CO2,1 -C1CN1,1 -OCC(CBr)(CBr)CBr,1 -CCCCCCCCCCCCCCCCCC(=O)OCC1=CC=C2C(=CCC(C=C12)C(C)=C)C,1 -OC(=O)C1=CC=C(C=C1)C=NN4N=NC2=C([NH]C3=CC=CC=C23)C4=O,1 -ONC1=CC=C(C=C1)SC2=CC=CC=C2,1 -CC1=CC=C[N]2C1=NC3=CC=C(NO)N=C23,1 -ClC1=NC=CC=C1,1 -FC2=CC1=NC=CC=C1C=C2,1 -CN(C)CCNC(=O)C2=C1C(C3=C(C(C1=CC=C2)=O)C=CC=C3)=O,1 -NC1=CC=C(C=C1)N,1 -[O-][N+](=O)C3=CC2=C(C=C1C=CC=CC1=C2C=C3)[N+]([O-])=O,1 -[O-][N+](=O)C1=CC4=C3C(=C1[N+]([O-])=O)C2=CC=CC=C2C3=CC=C4,1 -[O-][N+](=O)C1=CC=C(C=C1)C=C,1 -CN(CS(O)(=O)=O)C1=C(C)N(C)N(C1=O)C2=CC=CC=C2,1 -N1C5C1C3=C(C2=CC=CC=C2C4=CC=CC=C34)C6=C5C=CC=C6,1 -NC(=O)C(=CC1=CC=C(O1)[N+]([O-])=O)C2=CC=CO2,1 -NC2=CC=C1SN=C(Cl)C1=C2,1 -ClC1OC1CBr,1 -OC2=C1C=CC=NC1=CC=C2,1 -NC3=CC2=NC1=CC=CC(=C1N=C2C=C3)N,1 -[O-][N+](=O)C1=CC(=CS1)C(=O)NC2=C(C=CC=C2)Br,1 -C1=CN=C(C=C1)C2=CC=NC=C2,1 -CC(C)C1CCC(C)CC1=O,1 -CCOS(C)(=O)=O,1 -O=NN1CCOCC1,1 -[O-][N+](=O)C1=CC=C(C=C1)C=CC2=CC=C(C=C2)C#N,1 -CCCC=CCC=O,1 -NNC(=O)CNC(=O)C=[N+]=[N-],1 -C=CCCCCC1CO1,1 -CC(=O)NC1=CC(=CC=C1)N,1 -CC1=C(C=CC=C1N)N,1 -OC2=C3C=CC4=C1C=CC=CC1=CC5=CC=C(C=C2)C3=C45,1 -CC1=CC3=C(C=C1)C2=CC=CC=C2C=C3,1 -[O-][N+](=O)C1=C(C=CC(=C1)N=[N+]=[N-])F,1 -COC4=CC(=O)C3=C2[NH]C1=CC=NC=C1C2=C(C)N=C3C4=O,1 -CCC=CC=CC=CC=CC=COCC(O)CO,1 -CNC(=O)ON(C(C)=O)C(=O)NC,1 -[O-][N+](=O)C1=CC(=C(C=C1)I)[N+]([O-])=O,1 -CC4=C2C=C1C=CC=CC1=CC2=C3C=CC=CC3=C4,1 -C1OC1C2=CC=CC=C2,1 -[O-][N+](=O)C1=CC(=CC(=C1)CCl)[N+]([O-])=O,1 -CC(=O)OCC2=C1C=CC=CC1=CC3=CC=CC=C23,1 -ClCC=CCl,1 -COC1=CC=C(C=C1)N=O,1 -NC1=C(C=CC=C1)C2=CC=CC=C2,1 -CNC3CC2=C1C(=CC=CC1=CC=C2)C3,1 -CC(=O)OCC1=COC=C2C(=CC=[C]12)C=O,1 -OCC[N]1C(=NC=C1[N+]([O-])=O)CO,1 -CCN1C=C(C(O)=O)C(=O)C3=C1C=C2OCOC2=C3,1 -CC3=C2[NH]C1=CC=CC=C1C2=C(C)C4=CN=CC=C34,1 -O=C2NC1(CCCCC1)C(=O)N2CCN3CC3,1 -NC1=CC3=C(C=C1)C2=CC=C(C=C2C3)N,1 -CCN(N)C1=CC=CC=C1,1 -CC(=O)NC1=CC=C(C=C1)C=CC(=O)C2=CC=CC=C2,1 -CCC[N]3C=C2CC1C(C=C(C)CN1C)C4=C2C3=CC=C4,1 -C[N]1C=CN=C1N=O,1 -[O-][N+](=O)C2=C1[NH]N=CC1=CC=C2,1 -ClCC2=C4C1=CC=CC=C1C=C5C=CC3=CC=CC(=C2)C3=C45,1 -NC1=C(C=CC=C1)SCCSC2=C(C=CC=C2)N,1 -C1=CC4=C(C=C1)C3=CC2=CC=CC5=C2C(=C3C=C4)C=C5,1 -[O-][N+](=O)C1=CC3=C(C=C1)C2=CC4=C(C=C2CC3)CCCC4,1 -[O-][N+](=O)C2=C1N=CC=CC1=CC=C2,1 -S=C1NCCN1,1 -C2=CC1=CC3=C(C=C1C=C2)C5=C4C(=C3)C=CC=C4C=C5,1 -NC1=CC4=C(C=C1)C3=CC=C2C=CC=CC2=C3C=C4,1 -O=NC1=C2C=CC3=CC5=C(C4=CC=C(C=C1)C2=C34)CCCC5,1 -CC(C)N(C(C)C)C(=O)SCC(Cl)=CCl,1 -COC1=CC=C(C=C1)C2OC2C(=O)C3=CC=CC=C3,1 -CC1CNCC(C)O1,1 -CC(C)=C(Cl)C=O,1 -[O-][N+](=O)C3=CC2=C1C=CC(=CC1=CC=C2O3)N(CCCl)CCCl,1 -ClC(=O)CC1=CC=CC=C1,1 -NC3=CC2=NC1=CC=CC=C1C(=C2C=C3)N,1 -C1=CC5=C(C=C1)C4=CC3=C2C=CC=CC2=CC=C3N=C4C=C5,1 -OC1=C4C(=CC=C1)C3=CC=C2C=CC=CC2=C3C=C4,1 -C1=CC4=C(C=C1)C3=CC=C2C=CC=CC2=C3C=C4,1 -[O-][N+](=O)C1=CC=C(C=C1)C=CC2=CC=C(C=C2)Cl,1 -NC1=CC=C(C=C1)NC2=CC=C(C=C2)[N+]([O-])=O,1 -OC1=CC=C(C=C1)C(=O)NN=CC2=CC=C(O2)[N+]([O-])=O,1 -NC3=C2C(C1=CC=CC(=C1C(C2=C(C=C3)N)=O)[N+]([O-])=O)=O,1 -[O-][N+](=O)C1=CC(=C(C=C1)C2=C(C=CC=C2)[N+]([O-])=O)[N+]([O-])=O,1 -OC2=C3C1=CC=CC=C1C4=C(C=CC5=CC=C(C=C2)C3=C45)[N+]([O-])=O,1 -CC1=CC(=C(C=C1)N=NC3=C2C=CC=CC2=CC=C3O)C,1 -OC1=C(C=C(C=C1[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O,1 -C1=CC2=C(C=C1)C3=CC=CC4=CC=CC2=C34,1 -CC2C1=C(C=CC=C1)C3=C2C=C(C=C3)F,1 -OC4C=CC3=C2C=CC1=CC=CC=C1C2=CC=C3C4O,1 -CCN(CC)N=O,1 -OC2=C1C=CC=CC1=CC3=CC=CC=C23,1 -[O-][N+](=O)C1=CC=C2C=CC3=C(C=CC4=CC=C1C2=C34)[N+]([O-])=O,1 -OC2C=CC1=C3C=CC4=CC=C(C5=CC=C(C=C1C2O)C3=C45)[N+]([O-])=O,1 -OCC4OC(OC2=C1C(C3=C(OC1=CC(=C2)O)C(=CC=C3O)O)=O)C(O)C(O)C4O,1 -ClCCN(CCCl)P1(=O)OCCCN1CCCl,1 -NC1=C(C=C(C=C1Cl)[N+]([O-])=O)[N+]([O-])=O,1 -OC2C=CC1=C4C(=CC=C1C2O)C3=CC(=CC=C3C=C4)O,1 -OCCN(CCO)C1=CC=C(C=C1)N=NC2=C(C=C(C=C2)[N+]([O-])=O)[N+]([O-])=O,1 -NC2=NC(=C1[NH]C=NC1=N2)NO,1 -CN(C)N,1 -CN2N(C1=CC=CC=C1)C(=O)C(=C2C)N=O,1 -ClCCNC(=O)N(CCCl)N=O,1 -C1=CC2=C(C=C1)C4=C3C(=C2)C=CC=C3C=C4,1 -OCC1=C2C=CC3=CC=CC4=CC=C(C=C1)C2=C34,1 -CC3=CC2=C(C1=CC=CC=C1C(=C2C=C3)C)C,1 -COC3=C(C=C2N=C1C=CC(=CC1=NC2=C3)N)N,1 -BrCC1CO1,1 -CN(C)N=O,1 -[O-][N+](=O)C1=C(C=CC=C1)[N+]([O-])=O,1 -CC(=O)C1=C(C(=C(O1)[N+]([O-])=O)C2=CC=CC=C2)C3=CC=CC=C3,1 -OS(=O)(=O)C1=C2C=CC3=CC=CC4=CC=C(C=C1)C2=C34,1 -C1OC1C2CO2,1 -[O-][N+](=O)C1=CC(=C(C=C1)Br)[N+]([O-])=O,1 -NC1=C(C=C(C(=C1)[N+]([O-])=O)N)Cl,1 -[O-][N+](=O)C1=CC2=CC=C3C=CC=C4CCC(=C1)C2=C34,1 -[O-][N+](=O)C1=C2C=CC3=C(C=CC4=CC=C(C=C1)C2=C34)N=O,1 -CCN(CC)C3=CC=C2N=C1C=CC(=CC1=[O+]C2=C3)N(CC)CC,1 -CCN1CCOCC1,1 -OCCCBr,1 -C1=CC3=C(C=C1)C2=NC=CC=C2C=C3,1 -NC3=C(C=C2N=C1C=CC=CC1=NC2=C3)O,1 -CN(C)C2=C(C1=NC(=C(N=C1C=C2)C)C)C,1 -CC1=CC(=C(C=C1)N)N,1 -NC1=C(C(=CC=C1)N)C(O)=O,1 -OC(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -[O-][N+](=O)C1=C(C=CC=C1)SSC(F)=C(Cl)Cl,1 -ONC1=CC3=C(C=C1)C2=CC=CC=C2C3,1 -COC(=O)NC2=NC1=CC(=CC=C1[NH]2)C(=NO)C3=CC=C(C=C3)F,1 -C1=CC2=CC=C3N=CC=C4C=CC(=C1)C2=C34,1 -NC1=C(C=CC(=C1)[N+]([O-])=O)C(O)=O,1 -CN(C)CCCNC2=C1C(=CC=C(C1=NC3=CC=CC=C23)F)[N+]([O-])=O,1 -CC4=C1C=CC=CC1=C3N=C2C=CC=CC2=C(C3=C4C)N,1 -NC4=CC=C3C2=C1C(=CC=CC1=CC=C2)C3=C4,1 -CCC1=C3C(=CC2=CC=CC=C12)C4=C(C=C3)C(O)C(O)C5OC45,1 -ON(C=O)C1=CC=C(C=C1)[N+]([O-])=O,1 -CN(N=O)C(C)=O,1 -BrC(C=O)=CC1=CC=CC=C1,1 -C1OC1COC2=CC(=CC=C2)OCC3CO3,1 -CC1=C(C=C(C=C1)N=C=O)N=C=O,1 -N1C4C1C2=C(C=CC3=CC=CC=C23)C5=C4C=CC=C5,1 -OC(=O)CCCC1=CC=C(C=C1)N(CCCl)CCCl,1 -NCCNCCNCCNCCNCCN,1 -CC(C)NCC2CCC1=C(C=C(C(=C1)CO)[N+]([O-])=O)N2,1 -[O-][N+](=O)C1=CC(=CS1)C(=O)NC2=CC=C(C=C2)Cl,1 -CC1=CC=C(C=C1)N=NNCC2=CC=CC=C2,1 -CNC(=O)OC2=C1C=CC=CC1=CC=C2,1 -CCOC(=O)N(C)C,1 -ClC(=O)C1=C(C=C(C=C1)Cl)Cl,1 -[O-][N+](=O)C2=CC(=C1C(=CC(=CC1=C2)[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O,1 -COS(=O)(=O)C(F)(F)F,1 -CC1=CC(=C(C=C1)NO)C,1 -ClC(=O)C1=C(C=CC=C1)C(Cl)=O,1 -CC(=O)C=O,1 -O=C1OC5=C4C3=C1C=C2C=CC=CC2=C3C=CC4=CC=C5,1 -ClCC1=CC=CC=C1,1 -C[N]1C(=NC2=C1C=CC3=NC(=C(C)N=C23)C)N,1 -ClC(CBr)CBr,1 -CC(=O)OC1=C2C=CC3=CC=CC4=CC=C(C(=C1)[N+]([O-])=O)C2=C34,1 -CC1=CC=C[N]2C1=NC3=C(C)C(=CN=C23)N,1 -OC1=C([NH]C2=CC=CC=C12)C4=NC3=C(C=CC=C3)C4=O,1 -OCC1=C4C(=C(C2=CC=CC=C12)CO)C3=CC=CC=C3C=C4,1 -NC1=CC3=C(C=C1)C2=CC=CC=C2O3,1 -CC4=C3C=C2C1=CC=CC=C1C=CC2=CC3=CC=C4,1 -C1CCC(CC1)N2C4C2C3=C(C=CC=C3)C5=C4C=CC=C5,1 -COC1=C(C=CC=C1)N,1 -ONC1=CC=C(C=C1)C2=CC=CC=C2,1 -CN1CC(CBr)CC2C1CC3=C[NH]C4=CC=CC2=C34,1 -CCN(CC)CCNC2=C1C(C3=C(SC1=C(C=C2)C)C=CC=C3)=O,1 -OCC1=C3C=CC4=CC=CC5=CC=C(C2=CC=CC=C12)C3=C45,1 -C1=CC5=C4C(=C1)C2=CC=CC3=CC=CC(=C23)C4=CC=C5,1 -C[N]2C(=NC3=C1N=C(C)C=NC1=CC(=C23)C)N,1 -CNN=O,1 -COC(=O)C(=C)C#N,1 -CN(C)C1=CC=C(C=C1)N=NC3=CC=C2N=CSC2=C3,1 -COP(=S)(OC)SCN2N=NC1=C(C=CC=C1)C2=O,1 -OCC1SCCN1N=O,1 -[O-][N+](=O)C1=C(C(=CC=C1)[N+]([O-])=O)C=O,1 -CC1=CC2=C(C=C1)C(=CC=C2)[N+]([O-])=O,1 -OC1=C(C(=CC=C1)[N+]([O-])=O)[N+]([O-])=O,1 -OC3=C(C2=CC1=CC=CC=C1C(=C2C=C3)O)O,1 -OC1=C4C(=CC=C1)C3=CC2=CC=CC5=C2C(=C3C=C4)C=C5,1 -CN2C(=O)CN=C(C1=C(C=CC=C1)F)C3=C2C=CC(=C3)[N+]([O-])=O,1 -[O-][N+](=O)C1=CC2=C(C=C1)C(=O)OC2=O,1 -COC(=O)C1=CC=C(C=C1)C=NN4N=NC2=C([NH]C3=CC=CC=C23)C4=O,1 -ClCC2=C1C3=CC=C4C=CC=C5C=CC(=CC1=CC=C2)C3=C45,1 -NC1=NC(=CC=C1)N,1 -[O-][N+](=O)C1=CC=C(O1)C=CC(=O)NN=CC2=CC=C(O2)[N+]([O-])=O,1 -OOC1CCCC2=C1C=CC=C2,1 -[O-][N+](=O)C2=CC=C1SN=C(Cl)C1=C2,1 -[O-][N+](=O)C1=CC(=CC=C1)CCl,1 -CC(O)=NO,1 -CN(C)CCNC(=O)C2=C1SC3=C(C(C1=CC=C2)=O)C=CC=C3,1 -COC1=CC=C(C=C1)CNC(=O)C(C)Br,1 -NC3=CC2=NC1=CC=C(C=C1N=C2C=C3)N,1 -OCCC1=C[NH]C2=CC(=CC=C12)[N+]([O-])=O,1 -CC1=C(C=CC=C1)N=NC2=CC(=C(C=C2)N)C,1 -CC1=C(C3=C(C=C1)C(=O)C2=C(C=CC=C2)C3=O)N,1 -[O-][N+](=O)C3=CC2=C1C(=CC=CC1=CC=C2C=C3)[N+]([O-])=O,1 -C2=CC1=NC=CN=C1C=C2,1 -[O-][N+](=O)C1=CC=C(C=C1)CCl,1 -OC(=O)C1=CC=C(C=C1)NC3=C2C=CC(=CC2=NC4=CC=CC=C34)N=[N+]=[N-],1 -COC1=C4C(=CC=C1)C3=C2OCOC2=CC(=C3C=C4)C(O)=O,1 -CC2=[N+](C1=CC=CC=C1[N+](=C2C(=O)NCCO)[O-])[O-],1 -CC(C)(C)C1=CC(=O)C=CC1=O,1 -CN(C)CCCNC2=C1C=C(C=CC1=NC3=CC=CC=C23)[N+]([O-])=O,1 -O=NC2=C3C=CC4=C1C=CC=CC1=CC5=CC=C(C=C2)C3=C45,1 -CC1(CO1)C2=CC=CC=C2,1 -NC2=C1SN=C(C1=CC=C2)Cl,1 -CC2C1=C(C=CC=C1)C3=C2C=C(C(=C3)C)C,1 -CC(O)C1=CC2=CC=C3C=CC=C4C=CC(=C1)C2=C34,1 -[O-][N+](=O)C1=CC(=CS1)C(=O)NC2=CC=C(C=C2)[N+]([O-])=O,1 -C1=CC2=C(C=C1)C4=CC=C5C=CC6=CC3=CC=CC2=C3C4=C56,1 -[O-][N+](=O)C2=CC3=CC=C4C1=CC=CC=C1C=C5C=CC(=C2)C3=C45,1 -CC1=C(C=CC(=C1)[N+]([O-])=O)N,1 -OC1=CC=C(C=C1)N=O,1 -NC2=CC=C1SN=CC1=C2,1 -[N-]=[N+]=C1C=CC(=O)C=C1,1 -O=C2CC(=NC1=CC=CC=C1)C(=O)C3=C2C=CC=C3,1 -[O-][N+](=O)C2=CC1=CC(=CC=C1O2)N(CCCl)CCCl,1 -OC(=O)C(Br)=C(Br)C=O,1 -COC1=C4C(=CC=C1)C3=C2OCOC2=CC5=C3C(=C4)NC5=O,1 -CN(C)N=NC1=CC=C(C=C1)[N+]([O-])=O,1 -C1=CC2=C(C=C1)C5=C(C=C2)C4=C3C=CC=CC3=CC=C4C=C5,1 -COC1=C(C3=C(C(=C1)N)C(=O)C2=C(C=CC=C2)C3=O)N,1 -NC1=CC=C(C=C1)OC2=CC(=C(C=C2)N)N,1 -CC(=O)N1CCCC1C(=O)N(CC(O)=O)N=O,1 -COC1=C(C=CC(=C1)CC2CO2)O,1 -CN(C)CCCNC2=C1C=CC=CC1=NC3=CC=CC=C23,1 -CCC1=C(C3=C(C=C1)C(=O)C2=C(C=CC=C2)C3=O)[N+]([O-])=O,1 -OC5C(O)C2=C1C6(C4=C(C1=CC=C2)C3=C(C=CC=C3)C=C4)OC56,1 -NC(CSC(Cl)=C(Cl)C(Cl)(Cl)Cl)C(O)=O,1 -C[N]2C1=CC=CC=C1C3=CC(=CC=C23)N,1 -NC1=CC=C(C=C1)OC2=C(C=C(C=C2)Cl)Cl,1 -C1=CC3=C(C=C1)C2=CC5=C(C=C2C=C3)C4=CC=CC=C4C=C5,1 -OC1C=CC=CC1O,1 -CCNN=O,1 -S3C1=CC=CC=C1C4=CC=C2C=CC=CC2=C34,1 -CC(=O)OCC1=CC=C(C=C1)N=NC2=CC=C(C=C2)COC(C)=O,1 -CCC4(O)CC(O)C2=C(C=C1C(C3=C(C(C1=C2O)=O)C(=CC=C3)O)=O)C4C(=O)OC,1 -OC5C=CC1=C(C2=CC=C3C=CC(=C4C=CC(=C1)C2=C34)[N+]([O-])=O)C5O,1 -O[N+]([O-])=C=CC1=CC=C(O1)[N+]([O-])=O,1 -NC(CS)C(O)=O,1 -CCC3=C1C4=C(C=CC1=C2C=CC=CC2=C3)C(O)C(O)C5OC45,1 -O=C3[N]2C1=CC=CC=C1N=C2C8=C6C3=CC=C7C5=NC4=CC=CC=C4[N]5C(C(=C67)C=C8)=O,1 -OCCCCl,1 -CCOC1=CC=C(C=C1)NC(=O)CC(C)O,1 -CC1=C(C(=C(C=C1[N+]([O-])=O)[N+]([O-])=O)N)[N+]([O-])=O,1 -ClCC1CO1,1 -CC(C)=CC2C(C(=O)OC1=C(C)C(CC=C)C(=O)C1)C2(C)C,1 -O=NC1=CC=C(C=C1)OC2=CC=CC=C2,1 -[O-][N+](=O)C2=C4C=CC=C5C1=CC=CC=C1C3=CC=CC(=C2)C3=C45,1 -CC(C)N(C(C)C)C(=O)SCC(Cl)=C(Cl)Cl,1 -COC(=O)NC1=CC(=CC=C1)OC(=O)NC2=CC(=CC=C2)C,1 -FC5=C3C=CC=C4C2=C1C=CC=CC1=CC=C2C(=C34)C=C5,1 -ClC(=O)OCC2C1=C(C=CC=C1)C3=C2C=CC=C3,1 -COC4=CC(=O)C1=C(C3=C(C(=N1)C)C2=CC=CC=C2[NH]3)C4=O,1 -CC1=CC(=C(C=C1)N)O,1 -CCOP(=S)(OCC)OC1=N[N](C(C)C)C(=N1)Cl,1 -[O-][N+](=O)C1=CC5=C2C(=C1)CCC4=C2C(=C3CCCCC3=C4)CC5,1 -S=P(N1CC1)(N2CC2)N3CC3,1 -C1=CC4=C(C=C1)C3=CC=C2C=NC=CC2=C3C=C4,1 -CN(C)CCNC(=O)C2=C1NC3=C(OC1=CC=C2)C=CC=C3,1 -CC1=CC=C(C=C1)CCC2CO2,1 -OC4=CC3=C2C=CC1=CC=CC=C1C2=CC=C3C=C4,1 -NC2=C1N=C[N](C1=NC=N2)CC3=CC=CC=C3,1 -OCC(O)CI,1 -NC3=C2N=C1CCCCC1=CC2=CC=C3,1 -CN1CCN(CC1)C4=C2OCN(N3C=C(C(C(=C23)C=C4F)=O)C(O)=O)C,1 -C1=CC4=C(C=C1)C3=CC2=CC=NC=C2C=C3C=C4,1 -CCN(CC)N(O)N=O,1 -COC1=CC4=C(C=C1)C2=NC=CC3=CC(=C(C(=C23)C4=O)OC)OC,1 -ClC(=O)C1=CC=C(C=C1)C(Cl)=O,1 -NC1=CC3=C(C=C1)C2=CC=CC=C2C3,1 -[O-][N+](=O)C2=CC1=C[NH]N=C1C=C2,1 -OCC1OC(C(O)C1O)N(N=O)C2=CC=C(C=C2)[N+]([O-])=O,1 -CCCCCCCCCCSC[N]1C=C[N+](=C1)C,1 -OC4C=CC3=C(C2=CC=C1C=CC=CC1=C2C=C3)C4O,1 -CC2=C1N=CC=CC1=CC=C2,1 -OC1=C(C3=C(C(=C1)O)C(=O)C2=C(C=CC=C2)C3=O)O,1 -NC2=C1C=CC=CC1=NC3=CC=CC=C23,1 -[O-][N+](=O)C1=C2C=CC3=C(C=CC4=CC=C(C=C1)C2=C34)[N+]([O-])=O,1 -BrCC1=CC=CC=C1,1 -ClCN2C(=O)C1=C(C=CC=C1)C2=O,1 -CN(C)C1=CC=C(C=C1)C=CC2=CC=CC=C2,1 -C5=CC4=CC3=C1C=CC=CC1=C2C=CC=CC2=C3N=C4C=C5,1 -ClCC4=C2C=CC=C3C1=CC=CC=C1C(=C23)C=C4,1 -[O-][N+](=O)C4=CC=C3C2=C1C(=C(C=CC1=CC=C2)[N+]([O-])=O)C5=C3C4=CC=C5,1 -COC1=CC4=C(C=C1)C2=C(C(=CC3=CC=NC(=C23)C4=O)OC)OC,1 -CC1=CC(=C(C(=C1)C)N)C,1 -CC2=C1C=CC=CC1=CC3=CC=CC=C23,1 -COP(=S)(OC)OC1=CC=C(C=C1)[N+]([O-])=O,1 -COC1=C(C4=C(C=C1)C3=C2OCOC2=CC5=C3C(=C4)N(C)C(=O)C5=O)OC,1 -ON=C1C=CC(C=C1)=NO,1 -CN(C1=C(C=C(C=C1[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O,1 -ONC2=CC1=CC=CC=C1C=C2,1 -[O-][N+](=O)C1=CC2=CC=C3C=C(C=C4C=CC(=C1)C2=C34)[N+]([O-])=O,1 -COC5=C2[C]1=CC=C(C1=C(OC2=C4C3CCOC3OC4=C5)O)O,1 -OCC(Cl)CCl,1 -O=NN1CCCCC1,1 -C1=CN=C(C=C1)C2=NC=CC=C2,1 -CC3=C(C1=CC=CC=C1C4=CC=C2C=CC=CC2=C34)[N+]([O-])=O,1 -C[N]1C(=NC2=CC=CC=C12)N,1 -CC(=O)OC1CC5=C4C1=C3C=CC2=CC=CC=C2C3=CC4=CC=C5C,1 -[O-][N+](=O)C1=C(N=C2SC=C[N]12)C3=CC=C(C=C3)Cl,1 -CN2C1=C(C=CC=C1)C(=O)C3=C2C4=C(C=C3O)OC(C4)C(C)=C,1 -[O-][N+](=O)C1=C(C=CC=C1)SSC(Cl)=C(Cl)C(F)(F)F,1 -CC(=O)N(O)C1=CC3=C(C=C1)C2=CC=CC=C2C3,1 -COC1=C(C=C(C=C1)C(=O)NC2=CC=CC=C2)[N+]([O-])=O,1 -CN(C)CCCNC2=C1C(=CC=C(C1=NC3=CC=CC=C23)N(C)C)[N+]([O-])=O,1 -NC1=CC=C(C=C1)Cl,1 -ClC3=CC2=CC1=CC=CC=C1C=C2C=C3,1 -OC(=O)C(Cl)=C(C(Cl)Cl)C(O)=O,1 -ClC(Br)C#N,1 -[O-][N+](=O)C3=C1C=CC=CC1=C2C=CC=CC2=C3,1 -NC1=CC=C(C=C1)OC2=C(C=C(C=C2Cl)Cl)Cl,1 -[O-][N+](=O)C2=CC1=C3C(=CC=C1C=C2)C(=CC=C3)[N+]([O-])=O,1 -FC2=C1N=CC=CC1=CC=C2,1 -CCC(Cl)=[N+](O)[O-],1 -CC(C)(C)CCCCCC(=O)OCC1CO1,1 -CC(=O)NNC1=CC=CC=C1,1 -[O-][N+](=O)C1=CC(=CS1)C(=O)NC2=CC(=CC=C2)Cl,1 -OC2=C(C1=CC=CC=C1C=C2)[N+]([O-])=O,1 -CCN(CC)C(=O)C(Cl)=C(C)OP(=O)(OC)OC,1 -CCC2=C1[NH]C3=C(C1=CC(=C2)O)CCOC3(CC)CC(O)=O,1 -OC3C=CC2=C(C=C1C=CC(=CC1=C2)[N+]([O-])=O)C3O,1 -NC1=CC=C(C=C1)C=CC2=CC=CC=C2,1 -COCC1CO1,1 -O=NN1CCCC1C2=CN=CC=C2,1 -CCN(CC)C(=S)SCC(Cl)=C,1 -NC(=O)NCC=C,1 -O1C5C1C3=C(C2=CC=CC=C2C4=CC=CC=C34)C6=C5C=CC=C6,1 -OC5C(O)C2=C(C1=NC4=C(C=C1C=C2)C3=CC=CC=C3C=C4)C6OC56,1 -CC4=C3C1=CC=CC2=CC=CC(=C12)C3=C(C5=CC=CC=C45)C,1 -O=CCC=O,1 -NC1=C(C=C(C=C1)[N+]([O-])=O)[N+]([O-])=O,1 -CC1=NSC(=C1)N,1 -N(C1=CC=C(C=C1)NC3=CC2=CC=CC=C2C=C3)C5=CC4=CC=CC=C4C=C5,1 -CCCCN1C3C1C2=C(C=CC=C2)C4=C3C=CC=C4,1 -FC5=CC=C4C=C3C2=C1C(=CC=CC1=CC=C2)C3=CC4=C5,1 -CC(=O)OCC1=CC=C(C=C1)[N+]([O-])=O,1 -CN(C)C1=CC=C(C=C1)CC2=CC=C(C=C2)N(C)C,1 -NCCNCCNCCNCCN,1 -[O-][N+](=O)C1=CC3=C(C=C1)C2=C(C=CC=C2)C3=O,1 -CC(=O)N(O)C1=C2C=CC3=CC=CC4=CC=C(C=C1)C2=C34,1 -[O-][N+](=O)C1=CC=C(C=C1)OCC2CO2,1 -C1OC1COC3=CC2=CC=CC=C2C=C3,1 -O=C2C1=C(C=CC=C1)C4=C2C=C3C=CC=CC3=C4,1 -CNC1=CC=C(C=C1)N=NC2=CC=CC=C2,1 -CC2=C1C3=CC=C4C=CC=C5C=CC(=CC1=CC=C2)C3=C45,1 -ClC1=C(N=CC=C1)Cl,1 -[O-][N+](=O)C1=CC(=CC=C1)C#N,1 -CN(C)CCNC(=O)C2=C1OC3=C(C(C1=CC=C2)=O)C=CC=C3,1 -ClCC(CCl)OP(=O)(OC(CCl)CCl)OC(CCl)CCl,1 -COC1=C(C=CC(=C1)CNC(=O)C(C)Br)O,1 -CCN1C=C(C(O)=O)C(=O)C2=C1N=C(N=C2)N3CCNCC3,1 -COP(=O)(OC)OC1=CC(=C(C=C1)[N+]([O-])=O)C,1 -[O-][N+](=O)C1=CC2=C(C=C1)C(=CC3=CC=CC=C23)[N+]([O-])=O,1 -O[N+]([O-])=C=CC1=CC=CC=C1,1 -COC(=O)C4=C2C=CC1=C(C=CC=C1C2=C3OCOC3=C4)OC,1 -COC1=NSC2=CC(=CC=C12)[N+]([O-])=O,1 -ClCCOCC(Cl)=CCl,1 -NC2=C1C(C3=C(C(C1=C(C=C2Br)Br)=O)C=CC=C3)=O,1 -C[N]1C=NC2=C(N)N=CN=C12,1 -C[N]1C=NC2=C1C=CC3=NC=CC=C23,1 -CC2C1=C(C=CC=C1)C3=C2C=CC(=C3)C,1 -[O-][N+](=O)C2=CC=C1C(=NSC1=C2)Cl,1 -[O-][N+](=O)C1=CC(=CS1)C(=O)NC2=CC(=CC=C2)[N+]([O-])=O,1 -ClC2=C1C=CC=CC1=CC3=CC=CC=C23,1 -COC1=C(C=C(C(=C1)Cl)OC)Cl,1 -[O-][N+](=O)C1=CC=C(C=C1)C=NN4N=NC2=C([NH]C3=CC=CC=C23)C4=O,1 -OC(=O)C4=C2C(=CC1=C(C=CC=C1C2=C3OCOC3=C4)O)[N+]([O-])=O,1 -NC(CCC(=O)NNC1=CC=CC=C1)C(O)=O,1 -[O-][N+](=O)C1=CC=C(C=C1)OC=C,1 -CC2(OO)C1=C(C=CC=C1)C3=C2C=CC=C3,1 -[O-][N+](=O)C1=CC=C(C=C1)C=CC2=CC(=CC=C2)C#N,1 -[O-][N+](=O)C1=CC4=C2C(=C1)CCC3=C2C(=CC=C3)CC4,1 -CC2=C1C=C4C(=CC1=CC=C2)C3=CC=CC=C3C=C4,1 -CC2=CC=C1N=C(SC1=C2)C3=CC=C(C=C3)N,1 -N1C2C1C4=C3C2=CC=CC3=CC=C4,1 -CC(C)(C)OC(=O)C(N)CN=[N+]=[N-],1 -[O-][N+](=O)C2=CC1=CC=C(C=C1O2)N(CCCl)CCCl,1 -ON(C=O)C1=CC=C(C=C1)C=CC2=CC=CC=C2,1 -CN(CCCl)CCCl,1 -CC(=O)NC1=CC=C(C=C1)C2=CC=CC=C2,1 -COS(C)(=O)=O,1 -CC2=C4C=CC=C5C=CC3=CC1=CC=CC=C1C(=C2)C3=C45,1 -ClNC1=CC3=C(C=C1)C2=CC=CC=C2C3,1 -CC(=O)NC2=CC1=CC=CN=C1C=C2,1 -[O-][N+](=O)C5=C3C=CC=C4C2=CC1=CC=CC=C1C=C2C(=C34)C=C5,1 -C1OC1CC2=CC=C(C=C2)C3=CC=CC=C3,1 -C[N]2C1=CC=CC=C1C3=CC(=CC=C23)[N+]([O-])=O,1 -CCCCCCOCC1CO1,1 -OCC1=CC2=CC=C3C=CC=C4C=CC(=C1)C2=C34,1 -CCOS(=O)(=O)OCC,1 -BrCC(Br)C1=CC=CC=C1,1 -CCCNN=O,1 -OC2=CC1=CC=CC(=C1C=C2)O,1 -CC1=C(N=C3C(=C1)C2=CC=CC=C2[NH]3)N,1 -OC4=C1C=CC=CC1=C3C=CC2=CC=CC=C2C3=C4,1 -ClC(Cl)(Cl)C1=CC=CC=C1,1 -C=CC=O,1 -CCC(=O)C2=C1C=CC=C(C1=C(C3=C(C=CC=C23)O)O)O,1 -NC2=C3C=CC4=CC1=CC=CC=C1C5=CC=C(C=C2)C3=C45,1 -CN(CC(O)CO)N=O,1 -C1OC1COC3=C2C=CC=CC2=CC=C3,1 -C1OC1COC2=CC=CC=C2,1 -OCC1OC(CC1O)N2C=C(COO)C(=O)NC2=O,1 -CC(Cl)C(Br)CBr,1 -NC2=C1SN=CC1=CC=C2,1 -OC(=O)C=CCl,1 -[O-][N+](=O)C3=CC2=C1C=C(C=CC1=CC=C2C=C3)[N+]([O-])=O,1 -CC1OC1C,1 -CC1=C(C=C(C=C1)C(O)(P(O)(O)=O)P(O)(O)=O)N(CCCl)CCCl,1 -OC(=O)C(Cl)=C(Cl)C=O,1 -COC4=CC(=O)C3=C2[NH]C1=C(CCCC1)C2=CN=C3C4=O,1 -CCN(CC)CCNC2=C1C(C3=C(SC1=C(C=C2)CO)C=CC=C3)=O,1 -CC(=O)OC2=C(OC(C)=O)C4=C(C=CC5=C1C=CC=CC1=C3C=CC=C2C3=C45)[N+]([O-])=O,1 -O[N+]([O-])=CCl,1 -COC1=C(C=CC(=C1)N)NC(C)=O,1 -COC(=O)C(CSCC(C)Br)NC(C)=O,1 -ClCC(=O)NCC1=CC=CC=C1,1 -FC1=CC=C2C(=C1)C=CC3=C2C4=CC=CC5=CC=CC3=C45,1 -CC4=C2C1=CC=CC=C1[NH]C2=C3C(C(=CC(C3=N4)=O)N5CC5)=O,1 -CC(Br)C(=O)NCC1=CC=C(C=C1)Cl,1 -CC1CCCCN1CCCNCC(=O)NC2=C(C(=N[N]2C)C)C(=O)C3=C(C=CC=C3)F,1 -[O-][N+](=O)C1=CC4=C(C=C1)C3=CC=C2CCCCC2=C3CC4,1 -NC1=CC=C(C=C1)C=CC2=CC(=CC=C2)C#N,1 -CCC(=O)OCC1=CC=C(C=C1)[N+]([O-])=O,1 -CC(Br)CBr,1 -CC1=C(C=C(C=C1)[N+]([O-])=O)[N+]([O-])=O,1 -CCCCOC1=CC=C(C=C1)C=NC2=CC=C(C=C2)CC,1 -OCC1=C(C=C(C=C1)[N+]([O-])=O)[N+]([O-])=O,1 -OC1COC(C(O)C1O)N(N=O)C2=CC=C(C=C2)[N+]([O-])=O,1 -CN(CC1=CC=CC=C1)N=O,1 -NC(=O)C1=CSC(=C1)[N+]([O-])=O,1 -OC2=C1C(C3=C(C(C1=C(C=C2)[N+]([O-])=O)=O)C(=CC=C3O)[N+]([O-])=O)=O,1 -OC2C1=C(C=CC=C1)OC3=C2C=CC=C3,1 -OC1=C(C=C(C=C1)Cl)C(=O)NC2=C(C=C(C=C2)[N+]([O-])=O)Cl,1 -ClC2=C1N=CC=CC1=CC=C2,1 -COC1=CC3=C(C(=C1)O)C(=O)C2=C(C=C(C=C2O)C)C3=O,1 -CC(C)(C)OC(=O)NN=CC2=[N+](C1=CC=CC=C1[N+](=C2)[O-])[O-],1 -CC(=O)N(O)C2=CC1=CC=CC=C1C=C2,1 -CCOC1=CC(=O)C(CC1=O)=NC(C)=O,1 -O1C5C1C2=C(C=C4C(=C2)C3=CC=CC=C3C=C4)C6=C5C=CC=C6,1 -C1=CC4=C(C=C1)C3=CC2=CC=NC=C2C=C3C5=CC=CC=C45,1 -CC1=CC=C(C=C1)CC2CO2,1 -OC(=O)CC1=C(C=CC=C1)[N+]([O-])=O,1 -COC1=C(C=CC(=C1)N)N,1 -NC2=C1C=CC=CC1=CC3=CC=CC=C23,1 -COC1=C(C4=C(C=C1)C3=C2OCOC2=CC5=C3C(=C4)N(C)CC5)OC,1 -CC2=CC1=CC=CN=C1C=C2,1 -C[N]2C(=NC3=C1N=C(C)C(=NC1=CC(=C23)C)C)N,1 -OC(=O)CC=[N+](O)[O-],1 -OC1=CC(=C(C=C1)O)O,1 -OC3C=CC2=C1N=CC=CC1=CC=C2C3O,1 -COC1=CC5=C(C=C1)C3=C2OCOC2=CC4=CC=NC(=C34)C5=O,1 -OC(=O)C(Cl)=C(C(Cl)Cl)C(Cl)Cl,1 -CC2=C[N]1C(=C(N=C1S2)C3=CC=C(C=C3)[N+]([O-])=O)[N+]([O-])=O,1 -COC1=CC3=C(C=C1)OC2=C(C(=CC(=C2)OC)OC)C3=O,1 -[O-][N+](=O)C1=CC=C(C=C1)C=CC=O,1 -OCC1=C4C(=CC2=CC=CC=C12)C3=CC=CC=C3C=C4,1 -NC1=CC=C(C=C1)C=CC2=CC=C(C=C2)Cl,1 -NC1=CC3=C(C=C1)C2=CC=CC=C2C=C3,1 -CC(=O)N(O)C1=CC=C(C=C1)OC2=CC=C(C=C2)Cl,1 -CCCN(N=O)C(N)=O,1 -NC1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)N,1 -CC(=O)NC1=CC3=C(C=C1)C2=CC=CC=C2C3,1 -O=NC1=CC(=CC=C1)C2=CC=CC=C2,1 -C5CC4=C(C3=CC2=C1C=CC=CC1=CC=C2N=C3C=C4)C=C5,1 -O=C2C1=C(C=CC=C1)C4=C3C2=CC=CC3=CC=C4,1 -COC1=CC=C(C=C1)N,1 -NC(CCC(=O)NNC1=CC=C(C=C1)CO)C(O)=O,1 -ClC1=CC(=C(C=C1)C(Cl)(Cl)Cl)Cl,1 -[O-][N+](=O)C2=C3C=CC4=CC1=CC=CC=C1C5=CC=C(C=C2)C3=C45,1 -OC1=C(C=C(C=C1)C2=CC(=CC=C2)[N+]([O-])=O)[N+]([O-])=O,1 -CC(C)CNC(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -FC2=C1C=CC=NC1=CC=C2,1 -CC(C)CC(=O)OC2OC=C(COC(C)=O)C3=CC(OC(=O)CC(C)C)C1(CO1)C23,1 -[O-][N+](=O)C1=CC=C(C=C1)C=CC2=CC=CC=C2,1 -[O-][N+](=O)C2=C1SN=CC1=CC=C2,1 -[O-][N+](=O)C1=CC=C(C=C1)[N+]#N,1 -CC3=C2C1OC1C5=C(C2=CC4=CC=CC=C34)C=CC=C5,1 -CC1=C(C(=C(C=C1)[N+]([O-])=O)C)[N+]([O-])=O,1 -NC2=C1N=C[NH]C1=NC=N2,1 -OC2=C1N=CC=CC1=CC=C2,1 -[O-][N+](=O)C1=CC=C(C=C1)C=O,1 -NC(NC1=CC=CC=C1)=NC2=CC=CC=C2,1 -CCC2=C1[NH]C3=C(C1=CC=C2O)CCOC3(CC)CC(O)=O,1 -OC2=C(C1=C(C3=C(C(=C1C=C2)O)C(=O)C=CC3=O)O)O,1 -CC(=O)OCC1=C3C=CC4=CC=CC5=CC=C(C2=CC=CC=C12)C3=C45,1 -NC1=CC3=C(C=C1)C(=O)C2=C(C=CC=C2)C3=O,1 -CC(O)CN(CC(C)=O)N=O,1 -OC6C1OC1C5=C4C=C2C=CC=C3C=CC(=C23)C4=CC=C5C6O,1 -CC1=CC5=C4C(=C1)C3=CC2=CC=CC=C2C=C3C4=CC=C5,1 -ClCC2=C4C=C1C=CC=CC1=C5C=CC3=CC=CC(=C2)C3=C45,1 -[O-][N+](=O)C3=CC=C2OC1=CC=CC=C1C2=C3,1 -C2=CC1=CC4=C(C=C1C=C2)C3=NC=CC=C3C=C4,1 -NC2=C(C=C1C=CC=CC1=C2)N,1 -ClC2=C1C=CC=NC1=CC=C2,1 -COC(=O)NC2=NC1=CC=C(C=C1[NH]2)C(=O)C3=CC=CC=C3,1 -OC(CCl)CCl,1 -NC1=CC=C(C=C1)C2=CC=CC=C2,1 -OC(=O)C(Cl)=C(C=O)C(Cl)Cl,1 -[O-][N+](=O)C4=C1C=CC=CC1=C3C=CC2=CC=CC=C2C3=C4,1 -COP(=S)(OC)SCN2C(=O)C1=C(C=CC=C1)C2=O,1 -CNC(=O)N(O)C(C)=O,1 -CC(=O)NNC1=CC=C(C=C1)CO,1 -[NH]2C1=CC=CC=C1N=C2C3=CSC=N3,1 -CCOCC1CO1,1 -CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)N(C)C(C)=O,1 -CC(C)(OO)C1=CC=CC=C1,1 -C(SSCC1=CC=CC=C1)C2=CC=CC=C2,1 -CCC(=O)C(=O)CC,1 -ClCCSCC1=CC=CC=C1,1 -ClCCNCCCNC1=C4C(=NC2=CC=CC=C12)C3=NC=CC=C3C=C4,1 -CC(C)(O)CCC2=C1OC3=C(C(C1=C(C=C2)O)=O)C(=C4C(=C3)OC5OC=CC45O)O,1 -NC(=N)NC#N,1 -BrCBr,1 -CN(C)N=NC1=CC=C(C=C1)C,1 -CN(C)CCNC(=O)C2=CC=CN3C(=O)C1=C(C=CC=C1)N=C23,1 -COC1=CC=C(C=C1)CC2CO2,1 -COC1=C(C=C(C=C1)CNC(=O)C(C)Br)OC,1 -ClC1=C(C=C(C=C1)C(Cl)(Cl)Cl)Cl,1 -[O-][N+](=O)C1=CC(=C(C=C1)SC#N)[N+]([O-])=O,1 -C1=NC=CC(=C1)C2=CC=NC=C2,1 -NNC1=CC=C(C=C1)[N+]([O-])=O,1 -OC1OC(=O)C=C1CCl,1 -NC3=C2C(=C1C(C=CC(C1=C(C2=C(C=C3)N)O)=N)=N)O,1 -CN(C)CCCNC2=C1C=CC(=CC1=NC3=CC=CC=C23)[N+]([O-])=O,1 -COC5=C2[C]1=CC=C(C1=C(OC2=C4C3C=COC3OC4=C5)O)O,1 -COC1=NSC2=CC(=CC=C12)N,1 -ClCCl,1 -OC1=CC(=C(C=C1)[N+]([O-])=O)[N+]([O-])=O,1 -C1CS1,1 -C1OCC2=C1C=CC=C2,1 -OCCNCCNC3=C2C(=C1C(C=CC(C1=C(C2=C(C=C3)NCCNCCO)O)=O)=O)O,1 -CC2C1=C(C=CC=C1)C3=C2C=CC=C3C,1 -[O-][N+](=O)C1=CC(=CS1)C(=O)NC2=C(C=CC=C2)[N+]([O-])=O,1 -[O-][N+](=O)C1=CC(=C(C=C1)Cl)Cl,1 -O=C2N(N=CC1=CC=CC=C1)N=NC3=C2[NH]C4=CC=CC=C34,1 -CC4=CC3=C(C2=CC=C1C=CC=CC1=C2N=C3C=C4)C,1 -C5=CC4=CC3=C1C=CC=CC1=C2C=CC=CC2=C3C=C4C=C5,1 -COC(=O)C2=C1C(C5=C(OC1=CC=C2)C3=C(OC4OC=CC34)C=C5OC)=O,1 -CC3=CC2=C(C1=CC=CC=C1C=C2C=C3)C,1 -C[N]2C1=CC(=CN=C1N=C2[N+]([O-])=O)C3=CC=CC=C3,1 -NC3=C(C=C2N=C1C=CC=CC1=NC2=C3)N,1 -COC2=C1C=C(OC1=C(C=C2)N(CCCl)CCCl)[N+]([O-])=O,1 -C2CCC1OC1C2,1 -OC6C1OC1C5=C4C2=CC=CC3=CC=CC(=C23)C4=CC=C5C6O,1 -OCCNC1=CC=C(C=C1)N=NC2=CC=C(C=C2)NCCO,1 -O=C(NC1=CC3=C(C=C1)C2=CC=CC=C2C3)C4=CC=CC=C4,1 -CC2=CC(=O)C1=C(C=CC=C1)C2=O,1 -CC(C)=CC3C(C(=O)OCC1=CC(=CC=C1)OC2=CC=CC=C2)C3(C)C,1 -CC(=C)C2=CC=C(C)C1=CC=C(CO)C1=C2,1 -O=C2C1=C(C=CC=C1)C3=C2C=CC4=C3C=CC=C4,1 -CCC(C)OS(C)(=O)=O,1 -CCCC(=O)C2=C1C=CC=C(C1=C(C3=C(C=CC=C23)O)O)O,1 -OC3C=CC2=C1C=C5C(=CC1=CC=C2C3O)C4=CC=CC=C4C=C5,1 -O=C2C1=C(C=CC=C1)C(=O)C3=C2C=CC=C3[N+]#N,1 -C1OC1COC2=C(C=CC=C2)CC3=CC=CC=C3,1 -NC4=C2C=CC=C3C1=CC=CC=C1C(=C23)C=C4,1 -CC(O)C(=O)NCCO,1 -CC3=C2C1=CC=CC=C1C=CC2=C(C4=CC=CC=C34)CCl,1 -COC3=C2N=C1OC=CC1=C(C2=CC4=C3OCO4)OC,1 -ClC(Cl)C(=O)C(Cl)(Cl)Cl,1 -C[N]2C(=NC3=C1N=C(C)C=NC1=CC(=C23)CO)N,1 -COC1=C(C=CC(=C1)C2=CC(=C(C=C2)N=C=O)OC)N=C=O,1 -CC2=C3C=CC4=C1C=CC=CC1=CC5=CC=C(C=C2)C3=C45,1 -CCCCN(CCO[N+]([O-])=O)[N+]([O-])=O,1 -ClC(=C)C=O,1 -COC4=C(C=C3C2=C1OCOC1=CC5=C2C(CC3=C4)N(C)CC5)OC,1 -CC(=O)N(O)C1=CC=C(C=C1)OC2=CC=CC=C2,1 -OC(=O)C1=C(C=CC=C1)[N+]([O-])=O,1 -[O-][N+](=O)C1=C3C=CC=C4C5=C(C2=CC=CC(=C1)C2=C34)CCCC5,1 -CC(C)OC(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -OC1=C2C=CC3=C(C=CC4=CC=C(C=C1)C2=C34)[N+]([O-])=O,1 -CC1=CC(=C(C=C1)N)C,1 -OC1=CC=C(C=C1)NC2=C(C=C(C=C2)[N+]([O-])=O)[N+]([O-])=O,1 -CC2=C(C1=CC=CC=C1C=C2)[N+]([O-])=O,1 -OC5C=CC4=C(C=C3C1=CC=CC2=CC=CC(=C12)C3=C4)C5O,1 -[O-][N+](=O)C1=C(C=CC=C1)C=CC=O,1 -NC1=CC=C(C=C1)C=CC2=CC=C(C=C2)C#N,1 -OC(=O)C1=CC=C(C=C1)[N+]([O-])=O,1 -CN(CC1=CC(=CC=C1)C#N)N=O,1 -CC1=C(C(=CC(=C1)N)[N+]([O-])=O)N,1 -OS(=O)(=O)C1=CC(=O)C(=O)C2=C1C=CC=C2,1 -COC1=CC(=CC=C1)C=CC2=CC=C(C=C2)[N+]([O-])=O,1 -CC(=O)NC1=CC=C(C=C1)OC2=CC=C(C=C2)N,1 -CC1=CC3=C(C(=C1)O)C(=O)C2=C(C=C(C=C2O)O)C3=O,1 -ONC2=C1N=C[NH]C1=NC=N2,1 -[O-][N+](=O)C1=CC3=C(C=C1)C2=C(C=CC=C2C=C3[N+]([O-])=O)[N+]([O-])=O,1 -CCN1N=C(C(O)=O)C(=O)C3=C1C=C2OCOC2=C3,1 -CN(C)C1=CC=C(C=C1)N(C)C,1 -[O-][N+](=O)C1=CC(=CC=C1)C2=C(C=C(C=C2)[N+]([O-])=O)[N+]([O-])=O,1 -CCNC1=CC(=CC=C1)O,1 -NC1=CC(=C(C=C1)CC2=C(C=C(C=C2)N)[N+]([O-])=O)[N+]([O-])=O,1 -NC2=C1C=CC=NC1=CC=C2,1 -FC2=C1C=CC=NC1=C(C=C2)F,1 -NC1=CC3=C(C=C1)C2=CC=C(C=C2C3)[N+]([O-])=O,1 -[O-][N+](=O)C1=CC4=C2C1=CC=CC2=CC5=C3C=CC=CC3=CC=C45,1 -COC1=CC=C(C=C1)CCC2CO2,1 -NC3=CC=C2[NH]C1=CC=CC=C1C2=C3[N+]([O-])=O,1 -COC3=CC=C2[NH]C1=C(C)C=C(N)C(=C1C2=C3)C,1 -O=NC1=C(C=CC=C1)C2=CC=CC=C2,1 -CC2=NC1=CC=CC=C1C=C2,1 -OC3C(O)C2=C(C1=NC=CC=C1C=C2)C4OC34,1 -ClCC(Cl)CCl,1 -COC1OC(=O)C(=C1C(Cl)Cl)Cl,1 -CC1=CC(=CC=C1)C(Cl)=O,1 -CC2=C[N]1C(=C(N=C1S2)C3=CC=C(C=C3)[N+]([O-])=O)N=O,1 -COC1=C(C=C(C=C1)C)N,1 -COC1=CC=C(C=C1)C=CC2=CC=C(C=C2)N,1 -OC(=O)CCOP(O)(=N)N(CCCl)CCCl,1 -S=C=NC2=C1C=CC=CC1=CC=C2,1 -COC1=CC=C(C=C1)C(Br)=CC(O)=O,1 -CCOC1=C(C=C(C=C1)N)N,1 -CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)NC(C)=O,1 -CC(=O)N(O)C1=CC=C(C=C1)OC2=C(C=C(C=C2)Cl)Cl,1 -C[N]2C(=NC3=C1N=CC=NC1=CC(=C23)C)N,1 -[O-][N+](=O)C(Br)(Br)Br,1 -OCCN(CCO)C2=C1C=CC=CC1=NC(=N2)C3=CC=C(S3)[N+]([O-])=O,1 -CC1(C)CC2C(O)(C1)C=C(C=O)C34CC23C(=O)OC4O,1 -NC3=C2N=C1C=CC=C(C1=NC2=CC=C3)N,1 -OC4C=CC3=C2C=C1C=CC=CC1=C(C2=CC=C3C4O)Cl,1 -[O-][N+](=O)C2=CC=C1SN=CC1=C2,1 -OC2C=CC1=C3C=CC4=CC=CC5=CC=C(C=C1C2O)C3=C45,1 -[O-][N+](=O)C1=CC3=C(C=C1)C2=CC(=CC=C2C=C3)[N+]([O-])=O,1 -[O-][N+](=O)C2=C3C=CC4=C1C=CC=CC1=CC5=CC=C(C=C2)C3=C45,1 -[O-][N+](=O)C1=CC3=C(C=C1)C2=CC=CC=C2[NH]3,1 -NC1=C(C=C(C=C1Cl)[N+]([O-])=O)Cl,1 -S=C=NCCC1=CC=CC=C1,1 -CCC=CC=CC=CC=COCC(O)CO,1 -[O-][N+](=O)C1=C2C=CC3=CC5=C(C4=CC=C(C=C1)C2=C34)CCC=C5,1 -[O-][N+](=O)C2=C3C=CC4=CC=CC5=C1CCCCC1=C(C(=C2)[N+]([O-])=O)C3=C45,1 -C1CO1,1 -CN2C1=C(C=C(C(=C1)C)C)N=C3C(=O)NC(=O)N=C23,1 -OC(=O)CC1=CC=C(C=C1)[N+]([O-])=O,1 -CC1=C(C=CC2=CC=CC=C12)[N+]([O-])=O,1 -CC(=O)ON(C(C)=O)C1=CC=C(C=C1)C2=CC=CC=C2,1 -O5C6C=CC4=C3C=C1C=CC=C2C=CC(=C12)C3=CC=C4C56,1 -NC(=O)C1=C(C=C(C(=C1)N2CC2)[N+]([O-])=O)[N+]([O-])=O,1 -OCC(Br)=C(Br)CO,1 -OC1=CC3=C(C(=C1)O)C(=O)C2=C(C(=CC=C2O)O)O3,1 -[O-][N+](=O)C1=CC3=C(C=C1)OC2=C(C=CC(=C2)[N+]([O-])=O)O3,1 -OC2C=CC1OC1C2O,1 -[O-][N+](=O)C1=CC(=CC=C1)S(=O)(=O)OCC2CO2,1 -[O-][N+](=O)C1=CC=C(O1)C=NN2CC(=O)NC2=O,1 -CC1(CO1)C2=CC=C(C=C2)C#N,1 -FC5=C4C=C3C1=CC=CC2=CC=CC(=C12)C3=CC4=CC=C5,1 -OCC(O)CCl,1 -CC1=C(C=C(C=C1[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O,1 -CCC1(C(=O)NC(=O)NC1=O)C2=CC=CC=C2,1 -[O-][N+](=O)OCC(CO[N+]([O-])=O)O[N+]([O-])=O,1 -CC(=C)C(=O)OCC(Br)CBr,1 -CN(C)CCNC(=O)C3=C2C=C1C=CC=CC1=NC2=CC=C3,1 -NC1=CC=C(C=C1)C=CC2=CC(=CC=C2)N,1 -CC1=CC=C(C=C1)C=CC2=CC=C(C=C2)[N+]([O-])=O,1 -CCCCOC3=NC2=C(C1=CC=C(C=C1N=C2C=C3)Cl)NCCCN(CC)CCCl,1 -OCC=CCl,1 -OCC(O)C(O)C(O)C(O)C1SCCN1N=O,1 -C1OC1COC2=NSC3=CC=CC=C23,1 -C1OC1COC2=CC=C(C=C2)CC3=CC=CC=C3,1 -CN(CCC#N)C1=CC=C(C=C1)N=NC2=CC=CC=C2,1 -[O-][N+](=O)C1=CC(=C(C(=C1)[N+]([O-])=O)NC2=C(C=C(C=C2[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O,1 -C5CC1=C(C2=CC=C3C=CC=C4C=CC(=C1)C2=C34)C=C5,1 -CCCCOC1=CC=C(C=C1)N=O,1 -CC(C)(C)OCC1CO1,1 -OC6C=CC5=C3C1=CC=CC=C1C4=CC2=CC=CC=C2C(=C34)C=C5C6O,1 -CC1=CC4=C(C=C1)C3=CC2=CC=CC=C2C=C3C=C4,1 -[O-][N+](=O)C3=CC=C2[NH]C1=CC=C(C=C1C2=C3)[N+]([O-])=O,1 -NC1=C3C=CC=C4C=CC2=CC=CC(=C1)C2=C34,1 -CCBr,1 -C1COC1,1 -[O-][N+](=O)C1=C3C=CC=C4C=CC2=CC=CC(=C1)C2=C34,1 -C(CC1=CC=C(C=C1)C2=CC=CC=C2)C3CO3,1 -ClC(=O)C1=CC(=CC=C1)Cl,1 -CC(C)=CCC2=C1OC3=C(C(C1=C(C=C2)O)=O)C(=C4C(=C3)OC5OC=CC45O)O,1 -COC1=CC=C(C=C1)[N+]([O-])=O,1 -CC1(C)CC3=C(C1)C(C=O)C2(CC2(C)C3O)C=O,1 -[O-][N+](=O)C2=CC1=NC3=C(N=C1C=C2)C(=CC=C3)[N+]([O-])=O,1 -CC1=C(C=C(C=C1)N)N,1 -OC(=O)C1=C(C=C(C=C1)[N+]([O-])=O)[N+]([O-])=O,1 -CNC2=C1C(C3=C(C(C1=C(C=C2)NCCO)=O)C=CC=C3)=O,1 -[O-][N+](=O)C4=C3C1=CC=CC=C1C2=CC=CC5=C2C3=C(C=C4)C6OC56,1 -COC2=NSC3=CC=C(OCC1CO1)C=C23,1 -CCCC(=C)C=O,1 -C1=CC3=C(C=C1)C2=CC5=C(N=C2C=C3)C4=CC=CC=C4C=C5,1 -NC1=C(C=C(C=C1Br)[N+]([O-])=O)[N+]([O-])=O,1 -OCC1CO1,1 -ClC1=CC=C(C=C1)C=NN4N=NC2=C([NH]C3=CC=CC=C23)C4=O,1 -O[N+]([O-])=C(Cl)Cl,1 -NC(=O)CNC(=O)C=[N+]=[N-],1 -OC2=C1C(C3=C(C(C1=CC=C2)=O)C=CC=C3)=O,1 -CC1=C(C=C(C=C1)[N+]([O-])=O)N,1 -CC1=NC(=CN=C1)C,1 -NC3=C2C=C1C=CC=CC1=CC2=CC=C3,1 -NC1=CC=C(C=C1)C2=CC(=C(C(=C2)Cl)N)Cl,1 -BrCC(Br)COC(=O)C=C,1 -O=NC1=CC=C(C=C1)SC2=CC=CC=C2,1 -ClC(=O)C1=C(C=CC=C1)Cl,1 -NC1=CC=C(C=C1)OC2=CC=CC=C2,1 -O=CCCCC=O,1 -COC2=CC=C1OC(=CC1=C2N(CCCl)CCCl)[N+]([O-])=O,1 -C=CC(=O)OCC1CO1,1 -[NH]1N=NC2=CC=CC=C12,1 -OC3C=CC2=C(C1=CC=CC=C1C=C2C3O)[N+]([O-])=O,1 -COC1=C(C=C(C=C1)CC2=C(N=C(N=C2)N)N)OC,1 -CC(=O)NC3=C2C1=CC=CC=C1CC2=CC=C3,1 -CC1(CO1)C2CO2,1 -NC(=O)C1CO1,1 -NC(=S)NN=C1C=CC(C=C1)=NN=C(N)N,1 -ClC(C(Cl)=O)C1=CC=CC=C1,1 -NC1=CC=C(C=C1)N=NC2=CC=C(C=C2)N,1 -[O-][N+](=O)C1=CC=C(O1)C=NN2CCOC2=O,1 -[O-][N+](=O)C3=C2C=CC1=CC=CC4=C1C2=C(C=C3)C5OC45,1 -[O-][N+](=O)C3=CC2=NC1=CC=C(C=C1N=C2C=C3)[N+]([O-])=O,1 -NC2=C1N=C[N](C1=NC=N2)C3=CC=C(C=C3)[N+]([O-])=O,1 -C1=CN=C(C=C1)C2=NC(=CC=C2)C3=NC=CC=C3,1 -NC1=C(C=C(C=C1)C2=CC(=C(C=C2)N)Cl)Cl,1 -C[N]3C2=CC=C1N=CC=CC1=C2N=C3[N+]([O-])=O,1 -[O-][N+](=O)C1=CC=C(C=C1)C=CC2=CC(=CC=C2)[N+]([O-])=O,1 -CC2=C1C=CC=CC1=C(C3=CC=CC=C23)CBr,1 -NC1=CC=C(C=C1)C=C,1 -CC1=C(C=CC(=C1)Cl)N,1 -NC(CSC(Cl)=C(Cl)Cl)C(O)=O,1 -OCC4=C2C1=CC=CC=C1C=CC2=C3C=CC=CC3=C4,1 -NC2=NC1=CC=CC=C1C=C2,1 -CCCCON=O,1 -[O-][N+](=O)C1=CC=C(C=C1)Br,1 -C[N]2C1=CC=CC=C1C(=C2C3=CC=CC=C3)N=NC4=[N+](C=CS4)C,1 -CC1=C(C(=C(C(=C1)N)C)[N+]([O-])=O)N,1 -OC1=CC3=C(C(=C1)O)C(=O)C2=C(C=CC=C2)C3=O,1 -[O-][N+](=O)C1=CC3=C(C=C1)C2=CC(=CC=C2C(=C3)[N+]([O-])=O)[N+]([O-])=O,1 -OCC3=C2C1=CC=CC=C1C=CC2=C(C4=CC=CC=C34)COS(O)(=O)=O,1 -ClP(=O)(N1CCOC1=O)N2CCOC2=O,1 -[O-][N+](=O)C1=CC3=C(C=C1)C2=CC=C(C=C2C3)[N+]([O-])=O,1 -OCCCCCl,1 -CC1=C(C=C(C=C1[N+]([O-])=O)N)[N+]([O-])=O,1 -CC(C)CON=O,1 -ClC2=C1C=CC=CC1=NC=C2,1 -[O-][N+](=O)C3=CC2=NC1=CC(=CC=C1N=C2C=C3)[N+]([O-])=O,1 -C1=C2C=CC3=CC=C4C=CC5=CC=C6C=CC(=C1)C7=C2C3=C4C5=C67,1 -NC(CS)C(=O)NCC(O)=O,1 -[O-][N+](=O)C1=CC(=CC=C1)C=O,1 -C[N]1C(=NC2=NC=C(C=C12)C3=CC=CC=C3)NO,1 -[O-][N+](=O)C5=CC=C4C3=C2C(=CC1=CC=CC=C1C2=CC=C3)C4=C5,1 -OS(=O)(=O)C1=CC3=C(C=C1)C(=O)C2=C(C=CC=C2C3=O)[N+]([O-])=O,1 -ClCCNCCCl,1 -BrCC1=C4C(=CC2=CC=CC=C12)C3=CC=CC=C3C=C4,1 -CC(C)(C1=CC=C(C=C1)OCC2CO2)C3=CC=C(C=C3)OCC4CO4,1 -CC(=O)NC1=CC=C(C=C1)C(=O)CCl,1 -CC3=C2[NH]C1=CC=C(N)C=C1C2=C(C)C4=CN=CC=C34,1 -NC1=CC=C(C=C1)SC2=CC=C(C=C2)N,1 -COC4=CC3=C1N=CC=C2C=C(C(C(=C12)C(=C3C=C4)O)=O)OC,1 -CC1(C)CC(N)CC(C)(C)N1O,1 -ClCC2=C1C=CC=CC1=CC3=CC=CC=C23,1 -[O-][N+](=O)C4=C2C=CC=C3C1=C(C=CC=C1C(=C23)C=C4)[N+]([O-])=O,1 -COC5=C2[C]1=C(C=C(C1=C(OC2=C4C3C=COC3OC4=C5)O)O)O,1 -CCOC(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -COCC(O)C[N]1C=C(N=C1Cl)[N+]([O-])=O,1 -ClC1=CC=C(C=C1)CCC2CO2,1 -O=C2OC1=C(C=CC=C1)C=C2,1 -CC(O)C1=C2C=CC3=CC=CC4=CC=C(C=C1)C2=C34,1 -C1=CC2=CC=C3C=NC=C4C=CC(=C1)C2=C34,1 -CC2=C1C=CC=CC1=C(C3=CC=CC=C23)CCl,1 -OC5=CC4=C2C=C1C=CC=CC1=CC2=C3C=CC=CC3=C4C=C5,1 -[O-][N+](=O)C1=CC=C(C=C1)COC(=O)C2=CC=CC=C2,1 -CC(Br)C(N)=O,1 -[O-][N+](=O)C3=C2C(C(C1=CC=CC4=C1C2=C(C=C3)C=C4)=O)=O,1 -C[N]1C(=NC2=C1C=CC3=NC(=CN=C23)C)N,1 -NC4=C2C1=CC=CC=C1C3=CC=CC(=C23)C=C4,1 -C[N]2C=C1C=CC(=CC1=N2)[N+]([O-])=O,1 -[O-][N+](=O)C1=CC=C(O1)C=NN2CCNC2=O,1 -O=C3C2=C(C1=CC=CC=C1C=C2)C4=C3C=CC5=C4C=CC=C5,1 -OC2=C1N=CC=CC1=C(C=C2)S(O)(=O)=O,1 -OC1=CC3=C(C=C1)OC2=C(C(=CC(=C2)O)O)C3=O,1 -CN(CCCC(=O)C1=CN=CC=C1)N=O,1 -CN(C)C3CC2=C1C(=CC=CC1=CC=C2)C3,1 -CC4=C3C2=CC=C1C=CC=CC1=C2C=CC3=CC=C4,1 -CCN(N=O)C(N)=O,1 -CN(C)C1=CC=C(C=C1)N=NC3=CC=C2[NH]N=CC2=C3,1 -CC1=C(C=CC=C1)C2=CC(=C(C=C2)N)C,1 -C1OC1COC3=C2SN=CC2=CC=C3,1 -ONC1=CC=C(C=C1)[N+]([O-])=O,1 -COC1=C(C=C(C(=C1)N)[N+]([O-])=O)N,1 -CN(C)C(=O)N(C)C=O,1 -ClC(Cl)C(C=O)=C(Cl)Cl,1 -NC1=CC(=CC=C1)N,1 -CC4=CC3=C(C2=CC=C1C=CC=CC1=C2N=C3C(=C4)C)C,1 -CC(=O)NC1=C(C=C(C=C1)CC2=CC(=C(C=C2)N)Cl)Cl,1 -CC(=O)NC1=CC=C(C=C1)NC2=CC=C(C=C2)[N+]([O-])=O,1 -[O-][N+](=O)C1=CC=C(C=C1)OC2=CC=C(C=C2)N=C=S,1 -CC1=CC=C(C=C1)N(CCO)CCO,1 -CC1=CC=C(C=C1)C=CC2=CC=C(C=C2)N,1 -[O-][N+](=O)C2=C3C=CC4=CC=C(C5=C1CCCCC1=C(C=C2)C3=C45)[N+]([O-])=O,1 -CC(=O)OCC1=CC=CO1,1 -NC1=C(C(=CC(=C1)[N+]([O-])=O)[N+]([O-])=O)O,1 -NC3=C2C(=C1C=CC=CC1=C(C2=C(C=C3)N)O)O,1 -CC(=O)C1=CC=CO1,1 -CN(N=O)C(N)=O,1 -C1C5=C4C3=C1C=C2C=CC=CC2=C3C=CC4=CC=C5,1 -[O-][N+](=O)C1=CC3=C(C=C1)OC2=C(C=C(C=C2)[N+]([O-])=O)O3,1 -OC(=O)C1=C(C(=C(O1)[N+]([O-])=O)C2=CC=CC=C2)C3=CC=CC=C3,1 -CC4=C(C=C3C(=C2C=CC1=CC=CC=C1C2=NC3=C4)C)C,1 -NC2=C1[NH]C=NC1=NC(=N2)C3=CC=C(C=C3)[N+]([O-])=O,1 -BrCC(Br)C=O,1 -[O-][N+](=O)C2=C1C=CC=CC1=CC3=CC=CC=C23,1 -OC1=CC=C(C=C1)C2=CC=CC=C2,1 -CC(=O)C=CC1=CC=CC=C1,1 -CC2=C4C1=CC=CC=C1C=C5C=CC3=CC=CC(=C2)C3=C45,1 -CC1=CC=C(C=C1)N(N)C2=CC=C(C=C2)C,1 -COC1=C(C=C(C=C1[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O,1 -CC1=C4C(=CC=C1)C3=CC2=CC=CC=C2C=C3C=C4,1 -CCC1(C(=O)NCNC1=O)C2=CC=CC=C2,1 -C2=CC1=CC4=C(C=C1C=C2)C3=CN=CC=C3C=C4,1 -O=S1(=O)CCCO1,1 -CNC(=O)NOC(=O)NC,1 -OC1=CC4=C(C=C1)C5=C2C=CC=CC2=CC6=C3C=CC=CC3=CC4=C56,1 -COC2=C1C(C5=C(OC1=CC4=C2C3C=COC3O4)C(=CC=C5O)CCC(C)(C)O)=O,1 -[O-][N+](=O)C4=C3C1=CC=CC2=CC=CC(=C12)C3=CC=C4,1 -CC3=C1C4=C(C=CC1=C2C=CC=CC2=C3)C(O)C(O)C5OC45,1 -NC2=CC1=CC=CC=C1N=C2,1 -CC4=CC3=C2C=C1C=CC=CC1=CC2=CC=C3C=C4,1 -ClCBr,1 -ClC(Cl)(Cl)C1CO1,1 -[O-][N+](=O)C1=CC(=C(C=C1)C=O)[N+]([O-])=O,1 -CC(C)=CCOC2=C1OC=CC1=CC3=C2OC(C=C3)=O,1 -CC1CC(=O)O1,1 -OCC1=C(C3=C(C=C1O)C(=O)C2=C(C=CC=C2)C3=O)O,1 -[O-][N+](=O)C1=C3C(=CC=C1)C2=C(C=CC=C2C(=C3)[N+]([O-])=O)[N+]([O-])=O,1 -CCC(C)COC(=O)C=CC1=CC=C(C=C1)N=CC2=CC=C(C=C2)OC,1 -C3=CC2=CC1=CC=CC=C1C=C2C=C3,1 -CCCC(=O)C1=C(C=C(C(=C1)O)O)O,1 -CCN(CCCl)C1=CC=C(C=C1)OCCCCCNC3=C2C=CC=CC2=NC4=CC=CC=C34,1 -CC(=O)N(O)C1=CC=C(C=C1)C2=CC=CC=C2,1 -O1C=CC2=CC3=CC=C4C=CC=C5C=CC(=C12)C3=C45,1 -OC1OC(=O)C(=C1CCl)Cl,1 -NC1=CC=C(C=C1)C=CC2=CC(=CC=C2)Cl,1 -CCOC(=O)C(C)Br,1 -COC1=NSC2=CC(=CC=C12)OCC3CO3,1 -COC4=C2C1=CC=CC=C1C=CC2=C3CCC(C3=C4)=O,1 -COC1=CC=C(C=C1)C=NN4N=NC2=C([NH]C3=CC=CC=C23)C4=O,1 -CC1CN(CC(C)O1)N=O,1 -O=CC1=C2C=CC3=CC=CC4=CC=C(C=C1)C2=C34,1 -CN(C(=O)C1=CSC(=C1)[N+]([O-])=O)C2=CC=CC=C2,1 -NC2=C1C(C3=C(C(C1=CC=C2)=O)C(=CC=C3)N)=O,1 -NC1=C(C=C(C=C1)[N+]([O-])=O)N,1 -O1C3C1C2=C(C=CC=C2)C4=C3C=CC=C4,1 -NC1=C(C=C(C=C1)C2=CC(=C(C(=C2)Cl)N)Cl)Cl,1 -C1OC1COC2=CC=C(C=C2)C3=CC=CC=C3,1 -CCCSC(Cl)=O,1 -CC3(C)CC2C=C(C=O)C14CC1(C2C3)C(=O)OC4O,1 -NC2=C1C=C(C=CC1=NC3=CC=CC=C23)O,1 -CC(=O)NC1=CC(=C(C=C1)C)N,1 -CN(CC1=CC=C(C=C1)F)N=O,1 -CC(=C)C(=O)OCC1CO1,1 -CC1=C(C(=CC=C1N)N=NC2=CC=CC=C2)N,1 -CC1=C(C=C(C=C1)[N+]([O-])=O)N=O,1 -ClCC2=C1C=CC=CC1=C(C3=CC=CC=C23)CCl,1 -CCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C,1 -NC2=CC1=CC=CC=C1C=C2,1 -CCCON=O,1 -COC1=CC=C(C=C1)C=CC2=CC=C(C=C2)[N+]([O-])=O,1 -NC3=CC=C2[NH]C1=CC=CC=C1C2=C3,1 -CNC(=O)OC1=C(C=CC=C1)OC(C)C,1 -CC1=C3C(=C(C(=C1)[N+]([O-])=O)C)C2=CC=CC=C2[NH]3,1 -COC1=CC(=C(C=C1)N)C,1 -C1=CC=C4C(=C1)C=C3C2=C(C=CC=C2)C5=C3C4=CC=C5,1 -ClCC=C,1 -CC3=C2C1=CC=CC=C1C=CC2=C(C4=CC=CC=C34)CBr,1 -O=C1C=CC4=C2C1=CC=C3C=CC(C(=C23)C=C4)=O,1 -CC(=O)C(Cl)(Cl)Cl,1 -OC(=O)C1=CC(=C(C=C1)[N+]([O-])=O)[N+]([O-])=O,1 -COC3=C1C=COC1=NC4=CC2=C(OCO2)C=C34,1 -[O-][N+](=O)C4=C3C1OC1C2=CC=CC5=C2C3=C(C=C4)C=C5,1 -NC(CCC(=O)NC(CSN=O)C(=O)NCC(O)=O)C(O)=O,1 -OC1CCOP(=O)(N1)N(CCCl)CCCl,1 -C[N]3C2=CC=C1C=CC=CC1=C2C4=C3C=CC5=CC=CC=C45,1 -NC2=C1C=C(C=CC1=NC3=CC=CC=C23)Cl,1 -NC1=C(C=C(C=C1)C2=CC(=C(C=C2)N)N)N,1 -CC1=C(C(=CC=C1)N)C,1 -OC5=C4C=C3C1=CC=CC=C1C2=CC=CC=C2C3=CC4=CC=C5,1 -OCC(C(Cl)Cl)=C(Cl)C(O)=O,1 -N(N=NC1=CC=CC=C1)C2=CC=CC=C2,1 -C[N]1C=NC(=C1C(=O)N(C)N=O)N(C)N=O,1 -CCCCN(CC(O)C1=CC(=[N+]=[N-])C(=O)C=C1)N=O,1 -CN1CC(O)C4=C2C1CC5=C(C2=C3OCOC3=C4)C=CC=C5,1 -[O-][N+](=O)C1=CC(=C(C=C1)C2=CC=CC=C2)[N+]([O-])=O,1 -OC2=C1C(C=CC(C1=C(C=C2)O)=O)=O,1 -OC2C=CC1=CC5=C4C(=C1C2O)C3=CC=CC=C3C4=CC6=CC=CC=C56,1 -COC2=C1C=COC1=NC3=CC=CC=C23,1 -CCCCCCN(N=O)C(N)=N[N+]([O-])=O,1 -[O-][N+](=O)C1=CC=C(C=C1)C2=CC=C(C=C2)[N+]([O-])=O,1 -NC1=CC3=C(C=C1)C(=O)C2=C(C=CC(=C2)N)C3=O,1 -CC(=O)NC3=C(C=C2C1=CC=CC=C1CC2=C3)Cl,1 -C1=CC5=C(C=C1)C4=C2C=CC3=CC=CC(=C23)C=C4C=C5,1 -[O-][N+](=O)C1=CC3=C2C1=CC=CC2=CC=C3,1 -COC2=CC=C1[N](C)C(=NC1=C2)N,1 -COC1=CC(=C(C=C1)N)OC,1 -CCNC1=C(C=CC(=C1)O)C,1 -OC5C1OC1C4=C(C3=CC=C2C=CC=CC2=C3C=C4)C5O,1 -[O-][N+](=O)C1=CC3=C2C1=CC=CC2=CC5=C3C4=CC=CC=C4C=C5,1 -OC1OC(=O)C(=C1Cl)Cl,1 -CC(=O)NC1=C2C=CC3=CC=CC4=CC=C(C=C1)C2=C34,1 -CN(C)CCNC(=O)C3=C2N=C1C=CC=CC1=CC2=CC=C3,1 -NC(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -CC(CC1=CC(=C(C=C1)O)O)(NN)C(O)=O,1 -ClCC(Br)CCl,1 -CC4=CC3=NC2=C1C=CC=CC1=CC=C2C(=C3C=C4)C,1 -CC(=O)OCC2=C1C=CC=CC1=C(C3=CC=CC=C23)C,1 -CCCCC(CC)COCC1CO1,1 -COC4=CC=C3C(=O)C2=C1C(=NC=CC1=CC(=C2OC)OC)C3=C4,1 -CC(O)CBr,1 -COC(=O)C12CC1(C=O)C(C=O)C=C3CC(C)(C)CC23,1 -[O-][N+](=O)C3=CC=C2OC1=CC=C(C=C1C2=C3)[N+]([O-])=O,1 -NC2=C1N=C[N](C1=NC(=N2)C3=CC=C(C=C3)[N+]([O-])=O)C4CC(O)C(CO)O4,1 -C3CC2=C(C1=NC=CC=C1C=C2)C4OC34,1 -CCOP(=O)(OCC)N1C3C1C2=C(C=CC=C2)C4=C3C=CC=C4,1 -NC1=CC=C(C=C1)SC2=CC=C(C=C2)[N+]([O-])=O,1 -[O-][N+](=O)C1=CC=C(C=C1)C3=C([N]2CCSC2=N3)[N+]([O-])=O,1 -OC5=C4C1=CC=CC=C1C3=CC2=CC=CC=C2C=C3C4=CC=C5,1 -CC1=C(C=CC=C1)N,1 -O1C4C1C3=C(C=C2C=CC=CC2=C3)C5=C4C=CC=C5,1 -N1C4C1C3=C(C=C2C=CC=CC2=C3)C5=C4C=CC=C5,1 -OC1CC(=O)C5=C4C1(C2CCC(C3=C(C=CC(=C23)C4=CC=C5O)O)=O)O,1 -OC(=O)C1=CC=C(O1)[N+]([O-])=O,1 -O=C(OCC1CO1)C2=CC(=CC=C2)C(=O)OCC3CO3,1 -ClC(Cl)=C1OC(=O)C=C1,1 -[O-][N+](=O)C3=C1C=CC2=CC=CC(=C12)C=C3,1 -C[N]1C(=NC2=C1C=CC3=NC=CC=C23)NO,1 -OC1=CC=C(C=C1)C3OC2=C(C(=CC(=C2)O)O)C(=O)C3=O,1 -OCC(CO)(CBr)CBr,1 -FC5=C3C=CC=C4C2=CC1=CC=CC=C1C=C2C(=C34)C=C5,1 -BrCCOC(=O)C=C,1 -[O-][N+](=O)C3=C2C=CC1=CC=CC4=C1C2=C(C=C3)OC4=O,1 -[O-][N+](=O)C1=CC2=C(C=C1)CCN2,1 -COC3=C2N=C1C=CC=CC1=C(C2=CC=C3)NCCCNCCCl,1 -[O-][N+](=O)C2=NC1=CC=CC=C1[NH]2,1 -COC(=O)C4=C2C(=CC1=C(C=CC=C1C2=C3OCOC3=C4)OC)[N+]([O-])=O,1 -CCOCC1=C(C3=C(C=C1O)C(=O)C2=C(C=CC=C2)C3=O)O,1 -NC1=CC4=C3C(=C1)C2=CC=CC=C2C3=CC=C4,1 -COC3=CC2=C(C1=CC=C(C=C1N=C2C=C3)Cl)NCCCNCCCl,1 -C1CN1C2=NC(=NC(=N2)N3CC3)N4CC4,1 -CC3=C(C=C2C(=C1C=CC=CC1=C(C2=C3)C)C)C,1 -CN(C)CCCNC2=C1C(=CC=C(C1=NC3=CC=CC=C23)C)[N+]([O-])=O,1 -CC(=O)OCC1=C4C(=C(C2=CC=CC=C12)C)C3=CC=CC=C3C=C4,1 -CC4=CC3=C2C=CC1=CC=CC=C1C2=CC=C3C=C4,1 -OC4C=CC3=C(C2=CC=C1C=CC=CC1=C2C=C3[N+]([O-])=O)C4O,1 -OC(=O)C4=CN(C1CC1)C2=C(C=C(C(=C2)N3CCNCC3)F)C4=O,1 -CC1=C(C=CC=C1)OCC2CO2,1 -[O-][N+](=O)C1=C(C=C(C=C1)Cl)Cl,1 -COC1=CC2=C(C(=C1)O)C(C(C(O2)C3=CC(=C(C=C3)O)O)=O)=O,1 -CCCCC1C(=O)N(N(C1=O)C2=CC=C(C=C2)O)C3=CC=CC=C3,1 -CCN(CC)C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)N(CC)CC,1 -NC3=CC2=CC1=CC=CC=C1N=C2C=C3,1 -[O-][N+](=O)C1=C(C=CC(=C1)Cl)Cl,1 -ONC1=C(C=CC=C1)C2=CC=CC=C2,1 -NC2=NC1=CC(=CC=C1[NH]2)C#N,1 -CC1=CC=C2C(=C1)C=CC3=C2C4=C([NH]3)C=CC5=C4C=CC=C5,1 -CC1=C(C=C(C=C1N)[N+]([O-])=O)N,1 -CC(=O)NC1=C(C=C(C=C1)CC2=CC(=C(C=C2)NC(C)=O)Cl)Cl,1 -C=CC1CO1,1 -C1=CC5=C(C=C1)C4=NC3=C2C=CC=CC2=CC=C3C=C4C=C5,1 -CC(=O)NC1=CC3=C(C=C1)C2=CC=C(C=C2C3)NC(C)=O,1 -[O-][N+](=O)C2=C3C=CC4=C1C=CCCC1=CC5=CC=C(C=C2)C3=C45,1 -CCN1CCN(CC1)C3=C(C=C2C(C(=CN(C2=C3)C4CC4)C(O)=O)=O)F,1 -OC3C=CC2=C1C=CC=CC1=CC=C2C3O,1 -CN(C)C1=CC=C(C=C1)N=NC2=C(C=CC=C2)C(O)=O,1 -[O-][N+](=O)C1=C2C5=C(C3=C(C=CC4=CC=C(C=C1)C2=C34)[N+]([O-])=O)CCCC5,1 -OC2=C1C(C3=C(C(C1=C(C=C2)O)=O)C=CC=C3)=O,1 -CC(C)CCON=O,1 -OC3=C2C(=C1C=CC=CC1=C(C2=C(C=C3)O)O)O,1 -CCN(CC)CCCC(C)NC2=C1N=CC=CC1=CC(=C2)OC,1 -COC1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl,1 -CN(C)C1=CC=C(C=C1)N=NS(O)(=O)=O,1 -[O-][N+](=O)C1=CC3=C(C=C1)C2=CC(=CC=C2O3)[N+]([O-])=O,1 -CCN(CCO[N+]([O-])=O)[N+]([O-])=O,1 -OC(=O)C4=C2C(=CC1=CC=CC=C1C2=C3OCOC3=C4)[N+]([O-])=O,1 -CCC(=O)C=C,1 -ClCCOC(=O)C=C,1 -CCC(O)C=CC=CC=CC=CC=O,1 -NC2=C1C(C3=C(C(C1=C(C=C2)N)=O)C=CC=C3)=O,1 -[O-][N+](=O)C1=CC=C(O1)C=N[N]2C=CC=N2,1 -[O-][N+](=O)C3=CC=C2C(=O)C1=CC=CC=C1C2=C3,1 -CC(C)OCC1CO1,1 -CC2=C3C=CC4=CC1=CC=CC=C1C5=CC=C(C=C2)C3=C45,1 -N1C2C1C6=C4C3=C2C=CC=C3C=CC4=C5C=CC=CC5=C6,1 -ClC1CN(CC1Cl)N=O,1 -NNC(=O)C1=CC=NC=C1,1 -CCCOC(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -O=NC1=CC=C(C=C1)C2=CC=CC=C2,1 -CC2=CC1=C3C=CC4=CC=CC5=CC=C(C=C1C=C2)C3=C45,1 -[O-][N+](=O)C4=CC=C3C2=C1C(=CC=CC1=CC=C2)C3=C4,1 -C[N]1C(=NC2=CC(=CC=C12)C#N)N,1 -[N-]=[N+]=NCCC1=CC=CC=C1,1 -CC4=C3C2=CC1=CC=CC=C1C=C2C=CC3=CC=C4,1 -CC1=C(C=C(C(=C1)S(O)(=O)=O)N)Cl,1 -OCC1OC(CC1O)N2C=C(CO)C(=O)NC2=O,1 -C1=CC2=C(C=C1)C5=C(C=C2)C4=CC=C3C=CC=CC3=C4C=C5,1 -C1=CC2=C(C=C1)C3=CC5=CC=CC6=CC=C4C=CC2=C3C4=C56,1 -COC1=CC4=C3C(=C1OC)C2=CC5=C(C=C2CC3N(CC4)C)OCO5,1 -NC1=C(C(=CC(=C1)[N+]([O-])=O)Cl)O,1 -[O-][N+](=O)C1=CC=C(O1)C=C(C#N)C#N,1 -CCCCNC(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -CC(=O)C1=CC=C(C=C1)[N+]([O-])=O,1 -CCCC=CC=O,1 -CC1=CC(=CC=C1)NC(=O)C2=CSC(=C2)[N+]([O-])=O,1 -CN(N=O)N(C1=CC=CC=C1)C(=O)C(=NO)C(C)=O,1 -O=NN1CCCCCC1,1 -CN(C)C1=CC=C(C=C1)N=NC2=C(C=CC=C2)COC(C)=O,1 -CC(C)(COCC1CO1)COCC2CO2,1 -ClC1=C(Cl)C(=O)OC1,1 -COC2=NSC3=C(OCC1CO1)C=CC=C23,1 -O=C1NC4=C2C1=CC5=C(C2=C3C=CC=CC3=C4)OCO5,1 -NC1=C(C=CC(=C1)[N+]([O-])=O)O,1 -CC3=CC2=C(C1=CC=CC=C1N=C2C=C3)N,1 -CC=CCC=O,1 -OS(=O)(=O)C3=C2C(C1=CC=CC(=C1C(C2=CC=C3)=O)[N+]([O-])=O)=O,1 -OCCNC(=O)N(CCCl)N=O,1 -CN(CC1=CC=C(C=C1)Cl)N=O,1 -[N-]=[N+]=NC1=CC=C(C=C1)NC3=C2C=CC=CC2=NC4=CC=CC=C34,1 -CC(=O)CN(COC(C)=O)N=O,1 -C=CCOCC1CO1,1 -NC1=CC=C(C=C1)CC2=CC(=C(C=C2)N)CC3=CC=C(C=C3)N,1 -O=NC1=C3C=CC4=CC=CC5=CC=C(C2=CC=CC=C12)C3=C45,1 -CCOC(N)=O,1 -OC(=O)C2=[N+](C1=CC=CC=C1[N+](=C2)[O-])[O-],1 -NC1=CC=C(C=C1)F,1 -CC4=C1C=CC=CC1=C3C=C2C=CC=CC2=CC3=C4,1 -C=CCN1C3C1C2=C(C=CC=C2)C4=C3C=CC=C4,1 -CCCN(CCC)N=O,1 -CC(C)CN(N)CC(C)C,1 -NC1=C(C=CC=C1)S(O)(=O)=O,1 -ClC1=CC=C(C=C1)CC2CO2,1 -O=C2C1=C(C=CC=C1)C(=O)C3=C2C=CC=C3,1 -CN(C=O)N=O,1 -CC(O)CCl,1 -CC(=O)NC3=C2C=CC1=CC=CC4=C1C2=C(C=C3)C(=O)C4=O,1 -[O-][N+](=O)C2=CC1=CC=CC=C1C=C2,1 -[O-][N+](=O)C3=C2C=CC1=CC=CC=C1C2=CC=C3,1 -OCC1=CC=C(O1)C=O,1 -NC1=C3C(=CC=C1)C2=CC=CC=C2C3,1 -ClC3=C2C=CC1=CC=CC=C1C2=CC4=CC=CC=C34,1 -O1C2C1C5=C3C2=CC=CC3=CC6=C4C=CC=CC4=CC=C56,1 -CN(C)C1=CC=C(C=C1)N=NC2=CC=CC=C2,1 -CC1=CC3=C(C(=C1)C)C2=CC=CC=C2C=C3,1 -CC1=C(C(=CC=C1)NO)C,1 -BrCCC(=O)N1CCN(CC1)C(=O)CCBr,1 -CC1=C(C3=C(C=C1)C(=O)C2=C(C=CC=C2)C3=O)[N+]([O-])=O,1 -CC2C1=C(C=CC=C1)C3=C2C(=CC=C3)C,1 -CC1=C(C(=CC=C1)[N+]([O-])=O)[N+]([O-])=O,1 -CC1=CC(=O)OC2=C1C=C3CCCN4CCCC2=C34,1 -NC1=CC=C(C=C1)C2=CC=C(C=C2)[N+]([O-])=O,1 -COC2=C1C(C3=C(C(C1=CC=C2)=O)C=CC=C3)=O,1 -[O-][N+](=O)C1=CC=C(C=C1)[N+]([O-])=O,1 -NC1=CC=C(C=C1)CCC2=CC=CC=C2,1 -C1=CC3=C(C=C1)C4=CC=C5C=CC=C6C2=CC=CC=C2C(=C3)C4=C56,1 -COC(=O)NC(=S)NC1=C(C=CC=C1)NC(=S)NC(=O)OC,1 -O=N[N]1C=C(CC#N)C2=CC=CC=C12,1 -COC(=O)C1=NC(=C3C(=C1)C2=CC=CC=C2[NH]3)C4=NC5=C(C=C4)C(=O)C=CC5=O,1 -[O-][N+](=O)C1=CC=C(C=C1)C=CC2=CC=C(C=C2)[N+]([O-])=O,1 -COCC=O,1 -CC1=C(C=CC=C1)C(Cl)=O,1 -NC1=CC=C(C=C1)OC2=CC=C(C=C2)OC3=CC=C(C=C3)N,1 -OC1=NSC2=CC(=CC=C12)[N+]([O-])=O,1 -[O-][N+](=O)C1=CC5=C2C1=CC=CC2=C4C=C3C=CC=CC3=CC4=C5,1 -NC3=C2C1=CC=CC=C1CC2=CC=C3,1 -C3C=CC4=C2C1=CC=CC=C1C=CC2=CC=C34,1 -CC(=O)C1=CC=C[N]1[N+]([O-])=O,1 -NC1=CC(=C(C=C1)C2=C(C=C(C=C2)[N+]([O-])=O)N)[N+]([O-])=O,1 -O=C2C1=C(C=CC=C1)C4=C3C2=NC=CC3=CC5=C4OCO5,1 -COC6=C2[C]1=CC=C(C1=C(OC2=C5C4C3OC3OC4OC5=C6)O)O,1 -CC1=C(C=CC=C1)N=NC3=C2C=CC=CC2=CC=C3O,1 -OC(=O)C=CC1=CC=C(C=C1)[N+]([O-])=O,1 -[O-][N+](=O)C1=C([NH]C=N1)C2=CC=CC=C2,1 -ClCCNP1(=O)OCCCN1CCCl,1 -NC(CSCCCl)C(O)=O,1 -[O-][N+](=O)C1=C(N=C2SCC[N]12)C3=CC=C(C=C3)Cl,1 -CC1=CC=C[N]2C1=NC3=C(C)C(=CN=C23)NO,1 -CC3=C2C1NC1C5=C(C2=CC4=CC=CC=C34)C=CC=C5,1 -[O-][N+](=O)C3=C1C=CC=C2C=CC(=C12)C=C3,1 -CC1=CC=C(C=C1)[N+]#N,1 -COC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)OC)N,1 -CC1=C(C=CC=C1)OP(=O)(OC2=C(C=CC=C2)C)OC3=C(C=CC=C3)C,1 -[O-][N+](=O)C3=C2OC(C1=CC=CC4=C1C2=C(C=C3)C=C4)=O,1 -NC4=C3C1=CC=CC2=CC=CC(=C12)C3=CC=C4,1 -CC[N+](CC)=C4C=CC3=NC2=C1C=CC=CC1=C(C=C2OC3=C4)N,1 -C[N]2C1=CC=CC=C1N=C2[N+]([O-])=O,1 -ClCCN(N=O)C(=O)NC1CCCCC1,1 -CC1=C3C(=C(C(=C1)[N+]([O-])=O)C)C2=CC(=CC=C2[NH]3)O,1 -NC1=CC=C(C=C1)C2=CC(=C(C=C2)N)[N+]([O-])=O,1 -OC1=C(C(=CC=C1)O)O,1 -C=CC(=O)N(CC1CO1)CC2CO2,1 -NC3=C1C=CC=CC1=C2C=CC4=C(C2=C3)C=CC(O)C4O,1 -CC1=CC4=C(C=C1)C3=CC=C2C=CC=CC2=C3C=C4,1 -OC1C(O)C4=C3C2=C1C=CC=C2C=CC3=C(C=C4)[N+]([O-])=O,1 -[O-][N+](=O)C1=CC(=CC=C1)C(Cl)=O,1 -CC=CC=CC=O,1 -OC2=CC1=CC=CC=C1C(=C2)O,1 -CCCOC=CC=CC=CC=CC=CCC,1 -[O-][N+](=O)C1=CC(=CC(=C1)C(Cl)=O)[N+]([O-])=O,1 -OCC4=CC=C3C2=C1C(=CC=CC1=CC=C2)C3=C4,1 -CC(C)=CC(C)=NNC2=C1C=CC=CC1=CN=N2,1 -C1CSCSC1,1 -CC2=C1C=CC=CC1=C(C3=CC=CC=C23)C,1 -NC1=C(C=C(C=C1)OC2=CC(=C(C=C2)N)Cl)Cl,1 -NC3=CC2=NC1=CC=CC=C1C=C2C=C3,1 -CC(=O)C1=C(C(=C(C=C1)Cl)Cl)Cl,1 -[O-][N+](=O)C2=C3C1=CC=CC=C1C4=CC=CC5=CC=C(C=C2)C3=C45,1 -COC4=C1C5=C(C(OC1=C3C2C=COC2OC3=C4)=O)C(OCC5)=O,1 -O4C5=C1C=CC=CC1=C3C=C2C=CC=CC2=CC3=C45,1 -NC(CN=[N+]=[N-])C(O)=O,1 -[O-][N+](=O)C1=CC=C(C=C1)C(Cl)=O,1 -O=C4OC1=C(C=C2CCCN3CCCC1=C23)C=C4,1 -CC(=C)C=O,1 -[O-][N+](=O)C1=C2C=CC3=CC5=C(C4=CC=C(C=C1)C2=C34)C=CCC5,1 -OC1=C(C3=C(C=C1)C(=O)C2=C(C=CC=C2)C3=O)O,1 -[O-][N+](=O)C1=C(C(=C(O1)C(=O)CBr)Cl)Cl,1 -CC1=C(C=C(C(=C1)N)C)N,1 -[O-][N+](=O)C1=C(C=CC=C1)CCl,1 -OC1=C(C=C(C=C1Cl)Cl)S(=O)C2=C(C(=CC(=C2)Cl)Cl)O,1 -OC(=O)CNC(=O)C1=CC=C(C=C1)[N+]([O-])=O,1 -O1C4C1C3=C(C2=CC=CC=C2C=C3)C5=C4C=CC=C5,1 -BrCCOC(=O)C(=O)OCCBr,1 -C2CC1OC1CC2C3CO3,1 -OC6=CC=C5C1=C2C(=CC3=CC=CC4=CC=C(C=C1)C2=C34)C5=C6,1 -NC1=C(C=C3C(=C1)C2=CC=CC=C2[NH]3)[N+]([O-])=O,1 -[O-][N+](=O)C3=CC(=C2C1=C(C=C(C=C1C(C2=C3)=O)[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O,1 -[O-][N+](=O)C1=C(C(=C(O1)C(=O)CBr)C2=CC=CC=C2)C3=CC=CC=C3,1 -[O-][N+](=O)C2=C3C=CC4=C1CCCCC1=CC5=CC=C(C=C2)C3=C45,1 -CC1=C3C(=CC=C1)C2=CC=CC=C2C=C3,1 -CC1=C2C(=C(C=C1)C)C3=C(C=C2)C(O)C(O)C4OC34,1 -COC1=CC3=C(C(=C1)O)C(=O)C2=C(C(=CC=C2O)O)O3,1 -CC[N]1C(=NC2=C1C=CC3=NC(=CN=C23)C)N,1 -CC(C)COC(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -CC5=C3CCC4=C2C1OC1C6=C(C2=CC(=C34)C=C5)C=CC=C6,1 -OCN1C(O)C(O)N(CO)C1=O,1 -CCC(C)NC(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -CC1(CO1)C(=O)NCC2=CC=CC=C2,1 -NC1=CC=C(C=C1)CC(O)=O,1 -[O-][N+](=O)C2=CC(=C1C=CC=CC1=C2)[N+]([O-])=O,1 -CC2=CC3=CC=C4C1=CC=CC=C1C=C5C=CC(=C2)C3=C45,1 -NC(CCC(=O)NC(CSC(=O)NCCCl)C(=O)NCC(O)=O)C(O)=O,1 -NC1=CC=C(C=C1)CCC2=CC=C(C=C2)N,1 -CC(C)(O)CCC2=C1OC5=C(C(C1=C(C=C2)O)=O)C(=C4C3C=COC3OC4=C5)O,1 -CCOP(=O)(OCC)OC1=NC(=NC(=C1)C)C(C)C,1 -CCCCOC(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -ClCCN(CCCl)C2=CC1=CC=CC=C1C=C2,1 -CC(=O)OCC1=C4C(=CC2=CC=CC=C12)C3=CC=CC=C3C=C4,1 -C[N]1C(=NC2=CC=C(C=C12)C#N)N,1 -COC(=O)C12OC1(C)C(O)(NC2=O)C(C)C,1 -NC2=CC1=NC=CC=C1C=C2,1 -CC1=CC=C(C=C1)OCC2CO2,1 -CC1CNC(=O)N1C2=NC=C(S2)[N+]([O-])=O,1 -ClC(Cl)(Cl)CC1CO1,1 -NC1=CC=C(C=C1)[N+]([O-])=O,1 -ClCCNC(=O)SC2=C1[NH]C=NC1=NC=N2,1 -CC(=O)C1=C(C(=C(O1)[N+]([O-])=O)Cl)Cl,1 -CC(=O)N(O)C1=CC=C(C=C1)SC2=CC=CC=C2,1 -OC1CC=CC2=C3C=CC4=CC=CC5=CC=C(C=C12)C3=C45,1 -COC(=O)C(Cl)Cl,1 -COC5=C2[C]1=CC=C(C1=C(OC2=C4C3(C=COC3OC4=C5)O)O)O,1 -[O-][N+](=O)C1=CC2=C(C=C1)C(=CC3=C(C=CC=C23)[N+]([O-])=O)[N+]([O-])=O,1 -OC2=C1C=CC(C(C1=C(C3=CC=CC=C23)O)=N)=N,1 -NC1=C(C=C(C=C1)Cl)N,1 -CC(=O)NC1=C2C=CC3=CC=C(C4=CC=C(C=C1)C2=C34)O,1 -CC1=C(C=CC=C1)NC(=O)C2=CSC(=C2)[N+]([O-])=O,1 -[O-][N+](=O)C1=CC2=C(O1)C3=CC=C4C=CC=C5C=CC(=C2)C3=C45,1 -[O-][N+](=O)C1=CC3=C(C=C1)C2=CC=CC=C2S3,1 -CC(=O)C1=CC=C(C=C1)NO,1 -CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)COC(C)=O,1 -CN(COC(C)=O)N=O,1 -CC(Br)C(=O)NCC1=CC=CC=C1,1 -OC5C=CC4=C(C3=CC2=C1C=CC=CC1=CC=C2N=C3C=C4)C5O,1 -CC(=O)NC1=CC=C(C=C1)C=N[N]3N=N[C]2=CC=NC2=C3O,1 -[O-][N+](=O)C1=CC=C(C=C1)SC2=CC=CC=C2,1 -ClC(Cl)(Cl)SN2C(=O)C1CC=CCC1C2=O,1 -O=CNC1=CC3=C(C=C1)C2=CC=CC=C2C3,1 -BrCCBr,1 -CCOC(=O)CNC(=O)C=[N+]=[N-],1 -O1C2C1C7=C5C3=C2C=CC=C3C=C6C4=CC=CC=C4C(=C56)C=C7,1 -CC(=O)NC2=CC1=NC=CC=C1C=C2,1 -NC3=CC2=NC1=CC(=CC=C1N=C2C=C3)N,1 -C[N]2C(=NC3=NC1=CN=CC=C1C=C23)N,1 -C1=CC=C2C(=C1)C=CC3=C2C4=CC=CC5=CC=CC3=C45,1 -ClC3=C1C=CC=CC1=C2C=CC=CC2=C3,1 -CC1CCC(CC1)NC(=O)N(CCCl)N=O,1 -COC(=O)C12OC1(C)C(C)(O)NC2=O,1 -CC1=C3C(=C(C(=C1)[N+]([O-])=O)C)C2=CC(=CC=C2[NH]3)[N+]([O-])=O,1 -[O-][N+](=O)C2=C3C=CC4=CC=CC5=C1C=CC=CC1=C(C=C2)C3=C45,1 -OCCCl,1 -[O-][N+](=O)C1=CC3=C(C=C1)C2=CC=CC=C2C=C3,1 -NC1=C(C(=CC=C1)[N+]([O-])=O)N,1 -CCN(CCCl)CCCNC3=C2C=CC1=CC=CC=C1C2=NC4=CC=CC=C34,1 -CC2=C1C=CC=CC1=C(C=C2)[N+]([O-])=O,1 -O1C2C1C5=C4C2=CC3=CC=CC=C3C4=CC6=CC=CC=C56,1 -CN(C)CCCNC1=C3C(=NC2=CC=CC=C12)C(=CC=C3)[N+]([O-])=O,1 -CC1=C(C=C(C(=C1)C)N)C,1 -OC4C=CC3=C2C=C(C1=CC=CC=C1C2=CC=C3C4O)[N+]([O-])=O,1 -CC1=C(C(=CC=C1)C)NO,1 -[O-][N+](=O)C3=C1C=CC=C2CCC(=C12)C=C3,1 -COC(=O)C1=C(C=CC(=C1)C2=CC(=C(C=C2)N)C(=O)OC)N,1 -CC(=O)N(OC1OC(CO)C(O)C(O)C1O)C2=CC=C(C=C2)OC3=CC=C(C=C3)Cl,1 -CCCC(=O)OCC1=CC=C(C=C1)[N+]([O-])=O,1 -CC(C)NC(OCC1=CC=C(C=C1)[N+]([O-])=O)=NC(C)C,1 -C1=CC4=C(C=C1)C3=CC=C2N=CC=CC2=C3C=C4,1 -C[N+](C)(C)CCNCCC1=CC=C(C=C1)N=NC2=C(C=C(C=C2)[N+]([O-])=O)Cl,1 -[O-][N+](=O)C1=C2C=CC3=CC=CC4=CC=C(C=C1)C2=C34,1 -O=C(OCC1CO1)C2CCCCC2C(=O)OCC3CO3,1 -[O-][N+](=O)C3=CC2=C1C=C(C=CC1=C(C=C2C=C3)[N+]([O-])=O)[N+]([O-])=O,1 -CCN(CC)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)[N+]([O-])=O,1 -[O-][N+](=O)C2=CC=C3C1=C(C=CC=C1)C4=C(C=CC5=CC=C2C3=C45)[N+]([O-])=O,1 -NC(CSC(Cl)=CCl)C(O)=O,1 -CCOP(=O)(OCC)C(C)NC(=O)N(CCCl)N=O,1 -OCC1=CC3=C(C(=C1)O)C(=O)C2=C(C=CC=C2O)C3=O,1 -CC1=C(Cl)C(=O)OC1O,1 -C1=CC3=C(C=C1)C2=CC5=C4C(=C2C=C3)C=CC=C4C=C5,1 -NC2=C1N=C[N](C1=NC(=N2)C3=CC=C(C=C3)[N+]([O-])=O)C4=CC=C(C=C4)[N+]([O-])=O,1 -O=C3C(C2=NC1=CC=CC=C1C=C2)C(=O)C4=C3C=CC=C4,1 -O=C2C=CC1=C(C=CC=C1)C2=O,1 -CC(C)(C)ON=O,1 -COC1=C(C=CC(=C1)[N+]([O-])=O)NC(C)=O,1 -OC1=C3C(=CC=C4C=CC2=CC=CC(=C1)C2=C34)[N+]([O-])=O,1 -CC1CC(OC(C)O1)OC(C)=O,1 -CC1=C(C3=C(C=C1)C(=O)C2=C(C=CC=C2)C3=O)NC4=CC=CC=C4,1 -CC(=O)C1=C(C=C([N]1[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O,1 -ClC1=C(Cl)C(=O)C(=C(Cl)C1=O)Cl,1 -NC1=C(C=CC(=C1)[N+]([O-])=O)C2=CC=C(C=C2)[N+]([O-])=O,1 -[O-][N+](=O)C1=CC=C2C=CC3=[N+](C5=C(C4=CC=C1C2=C34)C=CC=C5)[O-],1 -OC1=CC3=C(C=C1)C2=CC=C(C=C2C3)[N+]([O-])=O,1 -C[N]1C=NC(=C1[N+]([O-])=O)C2=CC=CC=C2,1 -CN(CC(C)=O)N=O,1 -ClN1C3C1C2=C(C=CC=C2)C4=C3C=CC=C4,1 -SC2=C1[NH]C=NC1=NC=N2,1 -CC1CN1,1 -ONC3=CN=C2[N]1C=CC=CC1=NC2=C3,1 -COC1=C(C=C(C=C1)CC2CO2)OC,1 -C1=CC2=CC=C3C6=C5C(=C4C=CC(=C1)C2=C34)C=CC=C5C=C6,1 -CCCCOC3=NC2=C(C1=CC=C(C=C1N=C2C=C3)Cl)NCCCNCCCl,1 -C[N]2C(=NC3=C1C=CC=NC1=CC(=C23)C)N,1 -OC(=O)CN(CC(O)=O)N=O,1 -CCOC1=CC=C(C=C1)N=O,1 -OS(=O)(=O)OCC1=C3C=CC4=CC=CC5=CC=C(C2=CC=CC=C12)C3=C45,1 -COC1=CC=C(C=C1)NC3=C2C=CC=CC2=NC4=CC=CC=C34,1 -C[N+]2=C1C=CC=C(C1=CC3=CC=CC=C23)N,1 -C[N]1C(=NC2=C1C=CC3=NC=CC=C23)NC(C)=O,1 -OC2=C1C(C3=C(C(C1=CC=C2)=O)C=CC=C3O)=O,1 -COC1=CC4=C(C(=C1)OC2OC(CO)C(O)C(O)C2O)C(=O)C3=C(C(=CC=C3O)O)O4,1 -CCC[N]3C=C2CC1C(CC(C)CN1C#N)C4=C2C3=CC=C4,1 -[O-][N+](=O)C4=C2C1=CC=CC=C1C3=CC=CC(=C23)C=C4,1 -C[N]2C(=NC3=CC=C1N=CC=CC1=C23)N,1 -O=C1CCO1,1 -NC4=C1C=CC=CC1=C3C=CC2=CC=CC=C2C3=C4,1 -[O-][N+](=O)C1=CC=C(C=C1)C(=O)C=CC2=CC=CC=C2,1 -O=NC1=C2C=CC3=CC=CC4=CC=C(C=C1)C2=C34,1 -NC1=C(C=C(C=C1)C2=CC(=C(C=C2)N)F)F,1 -C(OCC2=C1C=CC=CC1=CC=C2)C3CO3,1 -[O-][N+](=O)C1=CC(=C(C=C1)F)[N+]([O-])=O,1 -CC2=CC(=O)C1=C(C=CC=C1O)C2=O,1 -NC(=O)NC2=NC1=CC=CC=C1[NH]2,1 -COC1=NSC2=C1C=CC=C2[N+]([O-])=O,1 -CC(C)(C)OO,1 -O=C4C=CC3=C(C2=CC=C1C=CC=CC1=C2C=C3)C4=O,1 -CCCNC(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -OC(=O)C1=CC(=CC(=C1)[N+]([O-])=O)[N+]([O-])=O,1 -CN(C)C1=CC=C(C=C1)C=CC2=CC=C(C=C2)[N+]([O-])=O,1 -[O-][N+](=O)C2=CC=C1[NH]C=CC1=C2,1 -CC1=CC(=C(C=C1)C)N,1 -CNC(=O)ONC(C)=O,1 -COC1=CC=C(C=C1)NC(=O)C2=CSC(=C2)[N+]([O-])=O,1 -CC1=CC=C(C=C1)S(=O)(=O)N2C4C2C3=C(C=CC=C3)C5=C4C=CC=C5,1 -CC1=CC(=CC=C1)NO,1 -OC(=O)C1=C(C=CC(=C1)[N+]([O-])=O)[N+]([O-])=O,1 -CCN(CCCl)CCCNC2=C1C=C(C=CC1=NC3=CC(=CC=C23)Cl)OC,1 -[O-][N+](=O)C1=C3C(=CC=C1)C2=CC=CC=C2O3,1 -C[N]1C=NC(=C1C(=O)N(C)N=O)N(C)C(=O)OC(C)(C)C,1 -NC1=CC(=CC=C1)O,1 -[O-][N+](=O)C1=CC=C(C=C1)OC2CO2,1 -NC1=C(C=C(C=C1)Cl)[N+]([O-])=O,1 -CC1=CC=C(C=C1)NN=NCC2=CC=C(C=C2)[N+]([O-])=O,1 -CNN=NC,1 -CC(=O)C1=C(C=CC(=C1)NC(N)=O)OCC(O)CNC(C)(C)C,1 -CCN1C=C(C(O)=O)C(=O)C2=C1C=C(C(=C2)F)N3CCN(C)CC3,1 -CCC1=C(C(=CC=C1)CC)N,1 -NC1=CC3=C(C=C1)C2=CC=CC=C2[NH]3,1 -CS(=O)(=O)NC1=CC=C(C=C1)NC3=C2C=C(C=CC2=NC4=CC=CC=C34)N=[N+]=[N-],1 -NC2=C1C(C3=C(C(C1=C(C=C2)O)=O)C=CC=C3)=O,1 -CCC1CO1,1 -CC1=C(C=C(C=C1)N=[N+]([O-])C2=CC(=C(C=C2)C)N)N,1 -OC1=CC2=C(C=C1)C3=CC5=CC=CC6=CC=C4C=CC2=C3C4=C56,1 -NC3=C(C=C2N=C1C=C(C=CC1=NC2=C3)Cl)N,1 -ClCCSCCCl,1 -NC2=C(C1=CC=CC=C1C=C2)N=NC3=CC=C(C=C3)[N+]([O-])=O,1 -C[N]2C(=NC3=C1N=C(C)C=NC1=C(C)C(=C23)C)N,1 -CC(=O)OC1CC4=C2C1=C(C=CC2=CC5=C3C=CC=CC3=CC=C45)C,1 -CN1CCN(CC1)C2=C(C3=C(C=C2F)C(=O)C(=CN3CCF)C(O)=O)F,1 -[O-][N+](=O)C1=C2C=CC3=CC5=C(C4=CC=C(C=C1)C2=C34)CCCC5,1 -COC(=O)C12OC1(C)C(C)(O)OC2=O,1 -CC[N]1C(=NC2=C1C=CC3=NC=C(C)N=C23)N,1 -NC3=C2N=C1C=CC=CC1=NC2=CC=C3,1 -CC2=CC1=NC=CC=C1C=C2,1 -CC(C)(C)CNC(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -O=C1CCCCC1=O,1 -[O-][N+](=O)C1=CC4=C(C=C1)C3=CC=C2C=CC=CC2=C3C=C4,1 -[O-][N+](=O)C1=CC=C(O1)C=NN2C(=O)C=C(C=C2C3=CC=CC=C3)C4=CC=CC=C4,1 -CCCCCCCC(Cl)=O,1 -CN(CC1=CC(=CC=C1)C)N=O,1 -[O-][N+](=O)C1=CC=C(C=C1)C=CC(=O)C2=CC=CC=C2,1 -CC1=C(C=C(C=C1N)N)[N+]([O-])=O,1 -CC1(CO1)C(=O)NC2=CC=CC=C2,1 -OCCN(CC(O)=O)N=O,1 -[O-][N+](=O)C2=C1C=CC=CC1=CC=C2,1 -N=C1CC(=O)C(=O)C2=C1C=CC=C2,1 -O=C3CN(CCN2CC(=O)N(CN1CCOCC1)C(=O)C2)CC(=O)N3CN4CCOCC4,1 -CC2=C4C=CC=C5C=CC3=C1C=CC=CC1=CC(=C2)C3=C45,1 -COP(=S)(OC)OC1=CC(=C(C=C1)N=O)C,1 -ClC(Cl)C(Cl)=O,1 -CC3=CC2=C(C(=C1C(=CC(=CC1=C2O)O)O)O)C(=O)C3=O,1 -NC1=CC=C(C=C1)C=CC2=CC=C(C=C2)N,1 -COC2=C1C(C5=C(OC1=CC=C2Cl)C=C4OC3OC=CC3C4=C5OC)=O,1 -C[N]1C=CC3=C1C=CC4=CC=C2C=CC(=CC2=C34)O,1 -O=C(NC1CCCCC1)OC(C#C)(C2=CC=CC=C2)C3=CC=CC=C3,1 -NC3=C2C(=C1C(C=CC(C1=C(C2=C(C=C3)O)O)=N)=O)O,1 -CC(C)NC(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -NC1=C(C=CC=C1)SCSC2=C(C=CC=C2)N,1 -ON=C(O)C1=CC(=C(C=C1)O)O,1 -NC1=CC(=C(C=C1)NCCO)[N+]([O-])=O,1 -O=C3N(CC1CO1)C(=O)N(CC2CO2)C(=O)N3CC4CO4,1 -BrCC(Br)=C,1 -OCCNC1=C(C=C(C=C1)N(CCO)CCO)[N+]([O-])=O,1 -NC(=O)CNC(=O)N(CCCl)N=O,1 -C1=CC2=C(C=C1)C5=C4C(=C2)C=C3C=CC=CC3=C4C=C5,1 -NC(CCC(=O)NC(CSCCCl)C(=O)NCC(O)=O)C(O)=O,1 -[O-][N+](=O)C3=CC=C2SC1=CC=CC=C1C2=C3,1 -COC1=C(C=C(C(=C1)OC)C=CC)OC,1 -OC5CC1=C(C2=CC=C3C=CC=C4C=CC(=C1)C2=C34)C=C5,1 -[O-][N+](=O)C3=CC2=C(C=C1C(=CC=CC1=C2C=C3)[N+]([O-])=O)[N+]([O-])=O,1 -CC1=CC(=C(C=C1)O)N,1 -CC4=NC3=C2C1=CC(=CC=C1C=CC2=C(C=C3[NH]4)C)O,1 -CCC1=CC(=CC=C1)NC(=O)C2=CSC(=C2)[N+]([O-])=O,1 -NC1=CC(=CC=C1)C2=CC=CC=C2,1 -[O-][N+](=O)C3=CC2=C1C(=CC=CC1=CC=C2)O3,1 -O=C2N(CC1CO1)SC3=C2C=CC(=C3)OCC4CO4,1 -COC1=CC3=C(C=C1)OC2=C(C(=CC(=C2)O)O)C3=O,1 -NC1=C2C=CC3=CC=CC4=CC=C(C=C1)C2=C34,1 -CC1=C(C=CC=C1)C2=CC=C(C=C2)N,1 -CC(CN(CC(C)OC(C)=O)N=O)OC(C)=O,1 -CN1CCC4=C2C1C(C5=C(C2=C3OCOC3=C4)C=CC=C5)O,1 -COC4=C1C(C5=C(OC1=C3C2C=COC2OC3=C4)C=CC=C5O)=O,1 -ClC(Cl)(Cl)SN2C(=O)C1=C(C=CC=C1)C2=O,1 -CC(C)CCCC(C)C3CCC4C2C=CC1(CC(O)CCC1(C)C2CCC34C)OO,1 -CN(CC1=CC=C(C=C1)[N+]([O-])=O)N=O,1 -NC2=C1C(=CC=CC1=CC=C2)N,1 -C1=CC3=C(C=C1)C2=CC=CC4=C2C(=C3)C=C4,1 -CCCCC(CC)COC(=O)C1=CC(=C(C=C1)N(C)C)[N+]([O-])=O,1 -CC1COC3=C2N1C=CC(C2=C(C(=C3N4CCN(C)CC4)F)C(O)=O)=O,1 -NC2=C1C(C3=C(C(C1=C(C=C2C(O)=O)[N+]([O-])=O)=O)C=CC=C3)=O,1 -[O-][N+](=O)C1=CC=C(S1)C3NC(=O)C2=C(C=CC=C2)N3,1 -CC1=C(C=CC=C1)N=NC2=C(C(=C(C=C2)N)C)N,1 -C1=CC3=C(C=C1)C2=CC=CC=C2C4=CC=CC=C34,1 -CCN(CCCl)CCCNC2=C1C=CC=C(C1=NC3=CC=CC=C23)OC,1 -C1=CC2=C(C=C1)C4=CC=CC5=CC=C3C=CC=C2C3=C45,1 -NC1=C(C3=C(C=C1)C2=CC=CC=C2[NH]3)[N+]([O-])=O,1 -CC1=C(C=C(C=C1)C(OC(=O)NC2CCCCC2)(C#C)C3=CC=CC=C3)C,1 -ClCCCBr,1 -NC2=C1N=C[N](C1=NC(=N2)C3=CC=C(C=C3)[N+]([O-])=O)C4OC(CO)C(O)C4O,1 -NC3=C1C=CC=CC1=C2C=CC=CC2=C3,1 -CN(C)CCCNC2=C1C(=CC=CC1=NC3=CC=CC=C23)[N+]([O-])=O,1 -CCOC1=C(C=C(C=C1)NC(C)=O)N,1 -C1=CC=C(C=C1)N=NC2=CC=CC=C2,1 -ClC4=C1C=CC=CC1=C3C=CC2=CC=CC=C2C3=C4,1 -CCC12OC1(C(=O)NC2(C)O)C(=O)OC,1 -OC5C(O)C4=C(C3=CC2=C1C=CC=CC1=CC=C2N=C3C=C4)C6OC56,1 -O=S1(=O)C5=C4C3=C1C=C2C=CC=CC2=C3C=CC4=CC=C5,1 -[O-][N+](=O)C1=CC3=C(C=C1)C2=CC=CC=C2CC3,1 -CCN(CCCl)C1=CC=C(C=C1)CCCNC3=C2C=CC=CC2=NC4=CC=CC=C34,1 -CN1CC(=CC2C1CC3=C[N](CC=C)C4=CC=CC2=C34)CO,1 -CCCCC=CC=CC=CC=CC=COCC(O)CO,1 -CC(C)(C)OOC(=O)C1=CC=CC=C1,1 -ClC2=C1C(C3=C(C(C1=CC=C2)=O)C(=CC=C3)NC(=O)C4=CC=CC=C4)=O,1 -[O-][N+](=O)C3=CC2=C1C=CC=CC1=CC=C2C=C3,1 -CN(C)C(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -CN(C)C1=CC=C(C=C1)N=NC3=CC2=CC=CC=C2C=C3,1 -O1C5C1C4=C3C2=CC=CC=C2C=CC3=CC6=C4C5=CC=C6,1 -N(NC1=CC=CC=C1)C2=CC=CC=C2,1 -CCOC(=O)CNC(=O)C(C)Br,1 -OC5=CC4=CC3=C1C=CC=CC1=C2C=CC=CC2=C3C=C4C=C5,1 -C1OC1CC2=CC=C(C=C2)CC3=CC=CC=C3,1 -[O-][N+](=O)C4=CC=C3C1=CC=CC2=C(C=CC(=C12)C3=C4)[N+]([O-])=O,1 -NC1=C(C=CC=C1)N,1 -CC1=CC(=C(C=C1)C)NO,1 -[O-][N+](=O)C1=CC=C(C=C1)C=CC(=O)C2=CC=C(C=C2)[N+]([O-])=O,1 -CCC=C1OC(=O)C2=C1C=CC=C2,1 -OC2=C(C1=CC=CC=C1C=C2)N=NC3=CC=CC=C3,1 -C[N]1C(=NC2=CC(=CC=C12)Cl)N,1 -NC3=CC2=C1C=CC=CC1=CC=C2C=C3,1 -CC1=C(C=CC=C1)N=NC2=CC(=C(C=C2)N=NC4=C3C=CC=CC3=CC=C4O)C,1 -C[N+]2=C1C=C(C=CC1=CC3=CC=CC=C23)N,1 -ClC(=O)CCC1=CC=CC=C1,1 -C1CCC2=C(C1)C6=C4C2=C3C=CC=CC3=CC4=C5C=CC=CC5=C6,1 -COC1=C(C=CC=C1)N=NC3=C2C=CC=CC2=CC=C3O,1 -CC1=CC(=C(C=C1)C)[N+]([O-])=O,1 -[O-][N+](=O)C1=CC2=C(C=C1)C(=CC3=C2C(=CC=C3)[N+]([O-])=O)[N+]([O-])=O,1 -CC2C(O)CCC3=CC(=O)C1(OC1C23C)C4OC4CO,1 -CN(C)[N+]([O-])=O,1 -OCCC1=CC=C(C=C1)[N+]([O-])=O,1 -CC(=O)OCC1=C(C=CC(=C1)C(C)=O)OC(C)=O,1 -O1C=CC2=C1C=C3C=CC4=CC=CC5=CC=C2C3=C45,1 -OCCN(CCO)N=O,1 -CC(C)=[N+]([O-])[O-],1 -CC(=O)N(NC1=CC3=C(C=C1)C2=CC=CC=C2C3)C4=CC6=C(C=C4)C5=CC=CC=C5C6,1 -ClC=C(Cl)C(Cl)Cl,1 -OC2=C1C(C5=C(OC1=CC=C2)C3=C(OC4OC=CC34)C=C5O)=O,1 -[O-][N+](=O)C4=C2C=CC=C3C1=CC=CC=C1C(=C23)C=C4,1 -[O-][N+](=O)C1=CC(=CC=C1)[N+]([O-])=O,1 -NC2=C1N=C([N](C1=NC=N2)C3=CC=C(C=C3)[N+]([O-])=O)C4=CC=C(C=C4)[N+]([O-])=O,1 -OS(=O)(=O)OC2=C3C=CC4=C1C=CC=CC1=CC5=CC=C(C=C2)C3=C45,1 -CC1CS(=O)(=O)CCN1N=CC2=CC=C(O2)[N+]([O-])=O,1 -COC2=CC1=C(C3=C(C(=C1C(=C2)O)O)C(=O)C=C(C)C3=O)O,1 -C1CC2(CCO1)CO2,1 -OC1CC2=C4C1=CC=C5C=CC3=CC=CC(=C2)C3=C45,1 -BrCC2=C1C=CC=CC1=CC3=CC=CC=C23,1 -CC4=C1C=CC=CC1=C3N=C2C=CC=CC2=C(C3=C4C)Cl,1 -O=NN1CCCC1,1 -CC(=O)NC1=CC=C(C=C1)C2=CC=C(C=C2)NC(C)=O,1 -C[N]2C1=CC=CC=C1C3=C(C)C=CC(=C23)C,1 -CNC2=C(C1=NC=CN=C1C=C2)C,1 -[O-][N+](=O)C2=C3C=CC4=[N+](C1=CC=CC=C1C5=CC=C(C=C2)C3=C45)[O-],1 -NC1=C(C=C(C(=C1)Cl)[N+]([O-])=O)O,1 -CN(C)CCCl,1 -NNC1=CC=CC=C1,1 -COC1=CC(=C(C=C1)C(=O)C2=C(C=CC=C2)O)O,1 -CCN(CC)C1=CC(=CC=C1)O,1 -NC3=C2C(=C1C=CC=CC1=NC2=CC=C3)N,1 -CC1CO1,1 -CC1=CC=C[N]2C1=NC3=C(C)C(=CN=C23)[N+]([O-])=O,1 -CC1=CC2=C(C=C1)C3=CC=C4C=CC=C5C=CC(=C2)C3=C45,1 -OC1=CC=C(C=C1)NC3=C2C=CC=CC2=NC4=CC=CC=C34,1 -CC3=CC2=C1C=CC=CC1=CC=C2C(=C3)C,1 -CC4CC1C(CC2=C[N](CC=C)C3=CC=CC1=C23)N(C4)C#N,1 -[O-][N+](=O)C1=CC4=C3C(=C1)C2=CC=CC=C2C3=CC=C4,1 -CC1(CO1)C2=CC=C(C=C2)[N+]([O-])=O,1 -CNC3=NC1=C(C=CC2=NC=CC=C12)[N]3C,1 -NC1=CC(=C(C=C1)Cl)N,1 -CN(C)CCNC(=O)C2=C1N=C(C=CC1=CC=C2)C3=CC=CC=C3,1 -ONC2=C1C=CC=CC1=CC=C2,1 -OC1=NC2=CC=C3C=CC=C4C=CC(=C1)C2=C34,1 -CC1=C2C(=CC=C1)C3=C(C(=C2)C)C4=C(C=C3)C(O)C(O)C5OC45,1 -CCCCC1=CC=C(C=C1)N=CC2=CC=C(C=C2)OC,1 -C[N+]1=CC=C(CC1)C2=CC=CC=C2,1 -OC1=NC(=C(C=N1)N(CCCl)CCCl)O,1 -[O-][N+](=O)C1=C(C=CC=C1)SSC(Cl)=C(Cl)C(Cl)=C(Cl)Cl,1 -OC(=O)C1=CC(=CC=C1)[N+]([O-])=O,1 -COC1=C(C=CC(=C1)C2=NC(=C([NH]2)C3=CC=CC=C3)C4=CC=CC=C4)O,1 -[O-][N+](=O)C1=CC2=C(C=C1)NC(=O)C2=O,1 -COC1=NSC2=CC=CC(=C12)[N+]([O-])=O,1 -CN(CC(=O)COC(C)=O)N=O,1 -CS(=O)(=O)OCCCCOS(C)(=O)=O,1 -CCC=CC=CC=CC=CC=COCC(C)O,1 -CN(C)CCNC(=O)N2C1=C(C=CC=C1)C(=O)C3=C2C=CC=C3,1 -[O-][N+](=O)C1=CC(=CC(=C1)[N+]([O-])=O)[N+]([O-])=O,1 -OCCBr,1 -COC1=CC(=CC=C1)NC(=O)C2=CSC(=C2)[N+]([O-])=O,1 -NNC1=C(C=C(C=C1)[N+]([O-])=O)[N+]([O-])=O,1 -ClC(Cl)=CC=O,1 -CC3=CC2=CC1=CC=CC(=C1C(=C2C(=C3)O)O)O,1 -C[N]2C1=CC=CC=C1C3=CC=CC=C23,1 -CCC(COC(=O)C(C)=C)(COC(=O)C(C)=C)COC(=O)C(C)=C,1 -CC(=O)CN(CC(C)=O)N=O,1 -C1=CC3=C(C=C1)C2=CC=CC=C2N=C3,1 -COC1OC1(C)C,1 -CC(Cl)CCl,1 -[O-][N+](=O)C(Cl)(Cl)Cl,1 -CC4=C2C1=CC=CC=C1[NH]C2=C3C(C=CC(C3=N4)=O)=O,1 -OCC2=C1C=CC=CC1=CC3=CC=CC=C23,1 -CC(C)=CC3C(C(=O)OCN2C(=O)C1=C(CCCC1)C2=O)C3(C)C,1 -CC(C)Br,1 -CCC1=CC=C(C=C1)NC(=O)C2=CSC(=C2)[N+]([O-])=O,1 -CCCCC[N]3C=C2CC1C(C=C(C)CN1C)C4=C2C3=CC=C4,1 -C(CC1=CC=CC=C1)C2CO2,1 -C[N]2C(=NC3=C1N=CC(=NC1=C(C)C(=C23)C)C)N,1 -NC1=CC=C(C=C1)C2=C(C=C(C=C2)N)[N+]([O-])=O,1 -CCC12OC1(C(=O)OC)C(=O)OC2C,1 -NC1=CC(=C(C=C1)N)[N+]([O-])=O,1 -[O-][N+](=O)C1=CC=C(O1)C=CC=O,1 -NC3=CC2=NC1=CC=CC=C1N=C2C=C3,1 -CC1=C(C=CC=C1[N+]([O-])=O)[N+]([O-])=O,1 -COC(=O)C(=CC)C=C(C)C=C(C)C=CC=C(C)C(=O)C12OC1C(O)(CCO)NC2=O,1 -OC2=C(C(=C1C(C3=C(C(C1=C2)=O)C=CC=C3)=O)O)O,1 -CCCCCNC(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -CCC(C)=NO,1 -O1C2C1C6=C4C3=C2C=CC=C3C=CC4=C5C=CC=CC5=C6,1 -[O-][N+](=O)C2=CC1=CC(=C(C=C1C=C2)[N+]([O-])=O)[N+]([O-])=O,1 -COC3=CC2=CC1=CC(=CC(=C1C(=C2C(=C3)O)O)O)C,1 -[O-][N+](=O)C1=CC2=C(C=C1)C=CC2,1 -CC4=C2C1=CC=CC=C1C=CC2=C3C=CC=CC3=C4,1 -ClC(Cl)(Cl)Br,1 -[O-][N+](=O)C1=C2C=CC3=CC=C(C4=CC=C(C=C1)C2=C34)N=O,1 -O=C(NCC1=CC=CC=C1)C2CO2,1 -CN(C)C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)N(C)C,1 -CC(C)C(NC(C)=O)C(=O)N(CC(O)=O)N=O,1 -C1=CC2=CN=C3C=CC=C4C=CC(=C1)C2=C34,1 -C(CC1CO1)C2CO2,1 -ClCC=O,1 -CN(C)C1=CC(=C(C=C1)N=NC2=CC=CC=C2)C,1 -CC1=CC=C(C=C1)S(=O)(=O)NN,1 -CN3CCC4=C2C1=CC(=CC=C1C=CC2=CC=C34)O,1 -C[N]2C(=NC3=C1N=CC(=NC1=CC(=C23)C)C)N,1 -COC3=C(C=C2C(=C1C=COC1=NC2=C3)OC)OC,1 -N1C2C1C6=C5C3=C2C=CC=C3C4NC4C5=CC=C6,1 -CNC(=O)ON,1 -NC(=O)N=NC(N)=O,1 -C5=CC=C4C=C3C2=C1C(=CC=CC1=CC=C2)C3=CC4=C5,1 -COC3=NC2=C(C1=CC=C(C=C1N=C2C=C3)Cl)NCCCNCCCl,1 -COC(=O)C1=C(C(=C(O1)[N+]([O-])=O)Cl)Cl,1 -CC2C1=C(C=CC=C1)C3=C2C=C(C=C3)C,1 -CC4=C3N=C2C1=CC=CC=C1C=CC2=C(C3=CC=C4)C,1 -NC1=C(C=CC(=C1)Cl)O,1 -CCC1=NC4=C([NH]1)C3=C2C=C(C=CC2=CC=C3C=C4)O,1 -CC2C1=C(C=CC=C1)C3=C2C=CC=C3,1 -CCC1=C(C=CC=C1)NC(=O)C2=CSC(=C2)[N+]([O-])=O,1 -CC1=C(C=C(C(=C1)C)[N+]([O-])=O)[N+]([O-])=O,1 -CC1=C(C=C(C=C1)N)[N+]([O-])=O,1 -CCCCCOC(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -CC(C)N(N)C(C)C,1 -COC3=C1C=CC=C2OC(=CC(=C12)C=C3)[N+]([O-])=O,1 -NC(CCC(=O)NC(CSC(Cl)=C(Cl)Cl)C(=O)NCC(O)=O)C(O)=O,1 -C4=CC3=CC2=CC1=CC=CC=C1C=C2C=C3C=C4,1 -CNC(=O)C=C(C)OP(=O)(OC)OC,1 -COC1=CC(=CC=C1)C=CC2=CC=C(C=C2)N,1 -NC1=CC(=CC(=C1)[N+]([O-])=O)[N+]([O-])=O,1 -CC(Br)C(=O)NC1=CC=CC=C1,1 -OC(=O)C(Br)Br,1 -COC3=C2N=C1C=CC=CC1=C(C2=C(C=C3)[N+]([O-])=O)NCCCN(C)C,1 -CCN(N=O)C(=O)N(C)C,1 -CC(C)(N=O)[N+]([O-])=O,1 -CC1OCC(=O)C(=O)C1O,1 -O=P2(OCC1=C(C=CC=C1)O2)OC3=CC=CC=C3,1 -CCC1=C(C(=O)OC)C(=O)OC1C,1 -COC(=O)C1=CCCN(C)C1,1 -CN(CCO[N+]([O-])=O)[N+]([O-])=O,1 -ClCC2=C4C=CC=C5C=CC3=CC1=CC=CC=C1C(=C2)C3=C45,1 -NC1=CC(=C(C=C1)C2=C(C=C(C=C2)N)Cl)Cl,1 -O=NN1CCSC1,1 -C[N]1C(=NC2=C1C=CC3=CC=CN=C23)N,1 -OC(=O)C(Cl)Br,1 -CC1=C(C=CC=C1)N=NC2=C(C=C(C(=C2)C)N)N,1 -NC3=CC=C2CC1=CC=CC=C1C2=C3,1 -CC4=CC3=NC2=C1C=CC=CC1=CC=C2C=C3C=C4,1 -COC(=O)C1=CCCN(C1)N=O,1 -OC1=CC(=CC=C1)[N+]([O-])=O,1 -CCS(=O)CCSP(=O)(OC)OC,1 -O1C2C1C6=C3C2=CC=CC3=C5C=C4C=CC=CC4=CC5=C6,1 -FC1=C(C=CC=C1)C(Cl)=O,1 -CC1=C3C(=C(C(=C1)N)C)C2=CC(=CC=C2[NH]3)O,1 -CCC1=C4C(=CC2=CC=CC=C12)C3=CC=CC=C3C=C4,1 -OC2=C1C(C=CC(C1=C(C(=C2Cl)Cl)O)=O)=O,1 -CNC1=CC=C(C=C1)N=NC2=CC=C(C=C2)N(C)C(C)=O,1 -CC2=C1C=CC=CC1=NC=C2,1 -NC1=C(C=C(C=C1)[N+]([O-])=O)Cl,1 -[O-][N+](=O)C1=CC2=C(C=C1)C(=O)NC2=O,1 -ClC(Cl)(Cl)C=O,1 -COC(=COC(N)=O)C1=C(C(=C(C(=C1O)N2CC2)C)O)N3CC3,1 -CC1=C(C=C(C(=C1)N)[N+]([O-])=O)N,1 -[O-][N+](=O)C2=CC=C1C=N[NH]C1=C2,1 -COC2=CC1=CC=CN=C1C(=C2)NC(C)CCCN,1 -CCOC1=CC=C(C=C1)N,1 -OC1=CC=C2C(=C1)C=CC3=C2C4=C([NH]3)C=CC5=C4C=CC=C5,1 -[N-]=[N+]=C1C=NC(=O)NC1=O,1 -C(CCOCC1CO1)COCC2CO2,1 -CNC2=C(C1=NC(=CN=C1C=C2)C)C,1 -CC1=CC3=C(C(=C1)O)C(=O)C2=C(C=CC=C2O)C3=O,1 -COC1=C(C=CC(=C1)N)C,1 -CC1=C(C(=C(C(=C1)C)N)C)N,1 -ONC2=C1C=CC=CC1=[N+](C=C2)[O-],1 -COP(=O)(OC)C(O)C(Cl)(Cl)Cl,1 -NCCNCCO,1 -C1=CC5=C(C=C1)C4=CC3=C2C=NC=CC2=CC=C3C=C4C=C5,1 -CC(=O)N(Cl)C1=CC3=C(C=C1)C2=CC=CC=C2C3,1 -[O-][N+](=O)C1=CC2=CC=C3C=CC=C4C=CC(=C1)C2=C34,1 -CNC2=C(C1=NC=C(N=C1C=C2)C)C,1 -CC(=O)NC1=CC3=C(C=C1)C2=C(C=CC=C2C3)O,1 -[O-][N+](=O)C2=C3C=CC4=C1C=CC=CC1=NC5=CC=C(C=C2)C3=C45,1 -ON=C1CCCCC1,1 -[O-][N+](=O)C1=CC=C(O1)C=NN2CCCNC2=O,1 -CCC=CC=CC=CC=CC=CC=COCC(O)CO,1 -ClCC(Br)=C,1 -CC1=NC(=C(C=N1)CNC(=O)N(CCCl)N=O)N,1 -FC1=NC=CC=C1,1 -ON(C(=O)C1=CC=CC=C1)C2=CC4=C(C=C2)C3=CC=CC=C3C4,1 -O=CC1=CC=CO1,1 -[O-][N+](=O)C3=CN=C2[N]1C=CC=CC1=NC2=C3,1 -CC1=C2C(=CC=C1)C3=CC=C4C=CC=C5C=CC(=C2)C3=C45,1 -CN(C)S(=O)(=O)CCNC(=O)N(CCCl)N=O,1 -CCS(=O)(=O)CC[N]1C(=NC=C1[N+]([O-])=O)C,1 -NC(=O)C1(OC1C(=O)C2=CC=CC=C2)C(N)=O,1 -COC3=CC=C2N=C1OC=CC1=C(OC)C2=C3,1 -CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)C)N,1 -CCNN=NCC,1 -OC2=C1C(C3=C(C(C1=CC=C2)=O)C(=CC=C3)O)=O,1 -CCOC1=CC=C(C=C1)N(O)C(C)=O,1 -COC1=C(C=C(C=C1)[N+]([O-])=O)N=NC3=C2C=CC=CC2=CC(=C3O)C(=O)NC4=CC(=CC=C4)[N+]([O-])=O,1 -OCC=[N+](O)[O-],1 -BrN1C(=O)CCC1=O,1 -ON=C(O)CC1=C[N](C=N1)N=O,1 -OCC(O)CN=[N+]=[N-],1 -CC1=CC=C(C=C1)C(Cl)=O,1 -NC1=CC=C(C=C1)OC2=CC=C(C=C2)N,1 -CCC1=C(C(=CC=C1)CC)NC(=O)CCl,1 -S1C=CN=C1,1 -CC(C)(Cl)[N+]([O-])=O,1 -CN(C)C1=CC=C(C=C1)N=NC2=CC(=CC=C2)C,1 -NC1=C(C=C(C=C1)C2=CC(=C(C=C2)N)Br)Br,1 -COC1=NSC2=C(N)C=CC=C12,1 -C[N]1N=C(C)C(=C1N)C(=O)C2=C(C=CC=C2)F,1 -CC1=CC(=CC(=C1)C)NO,1 -COC1=CC=C(C=C1)N=[N+]([O-])C2=CC=C(C=C2)OC,1 -[O-][N+](=O)C1=C2C(=CC=C1)C(=CC=C2)[N+]([O-])=O,1 -C(OCC1=CC=CC=C1)C2CO2,1 -CC(C)(C)C1=CC(=O)C=C(C1=O)C2=CC(=O)C=C(C2=O)C(C)(C)C,1 -CCC=CC=CC=CC=CC=COCC(O)C1=CC=CC=C1,1 -CC(=O)N(O)C1=C(C=CC=C1)C,1 -COC1=C(C=CC=C1)NC(=O)C2=CSC(=C2)[N+]([O-])=O,1 -CC1=CC=C(C=C1)S(=O)(=O)OCC2CO2,1 -COC1=C(C=C(C=C1)[N+]([O-])=O)[N+]([O-])=O,1 -CC(C)=CC2C(C(=O)OCC1=CC=C(O1)CC#C)C2(C)C,1 -OC1OC(=O)C(=C1C(Cl)Cl)Cl,1 -ClCCNCCCNC2=C1C=CC=CC1=NC3=CC=CC=C23,1 -C1C4=C3C2=C1C=CC=C2C=CC3=CC=C4,1 -O=CC1CO1,1 -NC1=C(C=C(C=C1)CC2=CC(=C(C=C2)N)Cl)Cl,1 -NC(=S)C1=C(C=CC=C1Cl)Cl,1 -CC(C)(C)C1=CC=C(C=C1)OCC2CO2,1 -COC1=CC=C2C(=C1)C=CC3=C2C=C(O3)[N+]([O-])=O,1 -ClCC(Cl)=C,1 -CC1OC(CC(N)C1O)OC2=CC(O)(CC5=C2C(=C4C(=C3C=CC=CC3=C(C4=C5O)O)O)O)C(C)=O,1 -C=CCCC1CO1,1 -BrCC3=C2C1=CC=CC=C1C=CC2=CC4=CC=CC=C34,1 -[O-][N+](=O)C2=C3C=CC4=C1CCC=CC1=CC5=CC=C(C=C2)C3=C45,1 -ClC1=CC3=C(C=C1)C2=CC=CC=C2O3,1 -C([N]1C=CN=C1)C2=CC=CC=C2,1 -OS(=O)(=O)OCC4=C2C1=CC=CC=C1C=CC2=C3C=CC=CC3=C4,1 -CC1=CC(=C(C=C1)N=NC3=C2C=CC=CC2=CC=C3O)[N+]([O-])=O,1 -NC3=C(C=C2C1=CC=CC=C1[NH]C2=C3)[N+]([O-])=O,1 -OC(=O)COC1=CC=C(C=C1)N(CCCl)CCCl,1 -NC2=C1N=C[N](C1=NC=N2)CC(O)CN=[N+]=[N-],1 -C[N]2C(=NC3=C1N=C(C)C(=NC1=C(C)C(=C23)C)C)N,1 -CC3=C2C=CC1=CC=CC=C1C2=NC4=CC=CC=C34,1 -FC1=CC=C(C=C1)C(=O)C2OC2C3=CC=CC=C3,1 -[O-][N+](=O)C1=C(C=CC=C1)CC#N,1 -COC(=O)C12OC1(C)C(OC2=O)C(C)C,1 -[O-][N+](=O)C3=CC2=CC1=CC=CC=C1C=C2C=C3,1 -ClCC1=C4C(=CC2=CC=CC=C12)C3=CC=CC=C3C=C4,1 -BrCC(Br)CBr,1 -NCCC1=C(C=C(C(=C1)O)O)O,1 -ONC1=CC=C(C=C1)N=NC2=CC=CC=C2,1 -[O-][N+](=O)C1=CC3=C(C=C1)C2=C(C=C(C=C2C3=O)[N+]([O-])=O)[N+]([O-])=O,1 -CC(=O)OC(OC(C)=O)C1=CC=C(O1)[N+]([O-])=O,1 -COC1=CC=CC=CC1,1 -NC1=NC3=C(C=C1)C2=CC=CC=C2[NH]3,1 -BrCC(=O)NCC1=CC=CC=C1,1 -COC(=O)C1=CC=C(O1)[N+]([O-])=O,1 -CC1=CC=C2C=C4C(=C3CCC1=C23)C=CC5=CC=CC=C45,1 -COC(=O)C(C)=CC1=CC=C(O1)[N+]([O-])=O,1 -NC1=CC=C(C=C1)N=NC2=CC=CC=C2,1 -CNC2=C(C1=NC(=C(N=C1C=C2)C)C)C,1 -ClC(=O)C1=C(C=CC=C1Cl)Cl,1 -O=C(NC1=CC=CC=C1)C2CO2,1 -[O-][N+](=O)C1=NC=C[N]1CC(=O)NCC2=CC=CC=C2,1 -N1C4C1C3=C(C2=CC=CC=C2C=C3)C5=C4C=CC=C5,1 -O1C3C1C2=CSC=C2C4=CSC=C34,1 -CBr,1 -OC3C=CC2=C1C(=CC4=C(C1=CC=C2C3O)CCC4=O)C(F)(F)F,1 -CNC3=CC2=C1C=C(C=CC1=CC=C2C=C3)O,1 -CC3(C)CC2C=C(CO)C1(CC1(C)C2C3)C=O,1 -ClCC1=CC(=O)OC1,1 -CCOP(=S)(OCC)OP(=S)(OCC)OCC,1 -N1C6C1C2=C(C=C4C(=C2)C3=CC=CC=C3C5NC45)C7=C6C=CC=C7,1 -CC3=C2C1=CC=CC=C1C=CC2=CC4=CC=CC=C34,1 -OC(CC1=C[N](N=O)C2=CC=CC=C12)C(O)=O,1 -CC1=NC=C([N]1CCO)[N+]([O-])=O,1 -ClC3C6(Cl)C4C2C1OC1C5C2C3(Cl)C(Cl)(C45)C6(Cl)Cl,1 -[O-][N+](=O)C1=CC(=CC=C1)Br,1 -[O-][N+](=O)C1=CC3=C(C=C1)C2=C(C=C(C=C2)[N+]([O-])=O)C3=O,1 -COC1=CC4=C3C(=C1OC)C2=CC=CC=C2C(C3=NC=C4)=O,1 -CCCCN(CCCCO)N=O,1 -COS(=O)(=O)OC,1 -OCC(O)C1CO1,1 -ClC1=C2C=CC3=CC=CC4=CC=C(C=C1)C2=C34,1 -C(CC2=C1C=CC=CC1=CC=C2)C3CO3,1 -[O-][N+](=O)C2=C(C=C1OC3=C(OC1=C2)C=C(Cl)C(=C3)Cl)Cl,1 -CC1(C)C(C=C(Cl)Cl)C1C(=O)OCC2=CC(=CC=C2)OC3=CC=CC=C3,1 -[O-][N+](=O)C1=CC(=CS1)C(=O)NC2=CC=CC=C2,1 -OC4=C3C2=CC=C1C=CC=CC1=C2C=CC3=CC=C4,1 -CCN(CC)C1=CC=C(C=C1)N,1 -C[N]2C(=NC3=CC1=NC=C(C)N=C1C(=C23)C)N,1 -OCCC1=C(C=CC=C1)[N+]([O-])=O,1 -CC4=C2C1=CC=CC=C1C=CC2=C3CCC(C3=C4)=O,1 -OC1=CC4=C(C=C1)C3=CC=C2C=CC=CC2=C3C=C4,1 -CC3=CC2=CC1=CC=CC=C1C=C2C=C3,1 -CCC1=C(C(=CC=C1)CC)N(COC)C(=O)CCl,1 -[NH]3C2=CC=C1C=CC=CC1=C2C4=C3C=CC5=CC=CC=C45,1 -CC(=O)C=C,1 -[O-][N+](=O)C1=CC(=C(C=C1)C2=C(C=C(C=C2)[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O,1 -CN1CCC4=C2C1CC5=C(C2=C3OCOC3=C4)C=CC=C5,1 -CC1=C3C=CC4=CC=CC5=CC=C(C2=CC=CC=C12)C3=C45,1 -CC(=O)OCC(O)CO,1 -CC(C)CCCC(C)C3CCC4C2C(OO)C=C1CC(O)CCC1(C)C2CCC34C,1 -CC(=O)C(Cl)Cl,1 -[O-][N+](=O)C2=C1C=CC=C3C1=C(C=C2)C4=C(C=CC5=CC=CC3=C45)[N+]([O-])=O,1 -C1=CC2=C5C=CC=C6C=CC4=CC=C3C=CC(=C1)C2=C3C4=C56,1 -[O-][N+](=O)C3=CC=C2OC(=O)C1=CC=CC=C1C2=C3,1 -CC(=O)NC1=CC=C(C=C1)OC2=CC=CC=C2,1 -CC4CC3(OC1OC(CO)C(O)C(O)C1O)C=C(C)C2(CC2)C(C)(O)C3C4=O,1 -C1OC1COC2=C(C=CC=C2)C3=CC=CC=C3,1 -COC(=O)C(CSCCBr)NC(C)=O,1 -CC5=C3CCC4=C2C1NC1C6=C(C2=CC(=C34)C=C5)C=CC=C6,1 -CC(C)OS(C)(=O)=O,1 -CN(C)C1=CC=C(C=C1)C,1 -CNC(=O)OC1=CC=C(C=C1)C2=CC=CC=C2,1 -C6CCC5=C3C1=CC=CC=C1C4=CC2=CC=CC=C2C(=C34)C=C5C6,1 -NC1=C3C(=CC=C1)C2=CC=CC=C2C=C3,1 -OP(=O)(OCC(Br)CBr)OCC(Br)CBr,1 -[O-][N+](=O)C1=CC=C(C=C1)OC2=CC=CC=C2,1 -CC1=C3C(=C(C=C1)C)C2=CC(=CC=C2[NH]3)[N+]([O-])=O,1 -CC1=CC=C(C=C1)NCCCl,1 -O=NC2=CC1=CC=CC=C1C=C2,1 -C[N]1C(=NC2=C1C=CC3=CC=NC=C23)N,1 -C2=CC1=CC4=C(C=C1C=C2)C3=CC=CC=C3C=C4,1 -OP1(=NCCCO1)N(CCCl)CCCl,1 -OC2C1=C(C=CC=C1)C3=C2C=C(C=C3)[N+]([O-])=O,1 -C1OC1COC3=CC=C2SN=CC2=C3,1 -[O-][N+](=O)C1=CC=C(C=C1)C3=C([N]2C=CSC2=N3)N=O,1 -C1=CC2=CC=C3C=CC=C4C=CC(=C1)C2=C34,1 -CC(=O)ON(C(C)=O)C1=CC3=C(C=C1)C2=CC=CC=C2C3,1 -NC1=C(C=C(C=C1)[N+]([O-])=O)O,1 -COC1=CC3=C(C=C1)OC2=C(C(=CC(=C2)OC)O)C3=O,1 -OC2=C1C(C=CC(C1=CC=C2)=O)=O,1 -CC3=CC(=O)C2=C(C(=C1C=CC=CC1=C2O)O)C3=O,1 -CN(C)C(Cl)=O,1 -COC1=C(C=CC(=C1)N=NC2=CC=CC=C2)N,1 -CC(C)CC(=O)OCC1=COC=C2C(=CC=[C]12)C=O,1 -CC(=O)OCC3=C2C1=CC=CC=C1C=CC2=CC4=CC=CC=C34,1 -COC1=C(C=CC(=C1)[N+]([O-])=O)N,1 -N1C3C1C2=C(C=CC=C2)C4=C3C=CC=C4,1 -CNC(=O)CSP(=S)(OC)OC,1 -CC1=C(C=CC=C1)NO,1 -OC5=CC4=C3C2=C1C=CC=CC1=CC=C2[NH]C3=CC=C4C=C5,1 -C=CC(=O)NCNC(=O)C=C,1 -CCOC1=CC=C(C=C1)[N+]([O-])=O,1 -CC(C)(C)N(CC(=O)C1=CC(=C(C=C1)O)CO)CC2=CC=CC=C2,1 -[O-][N+](=O)C1=CC3=C(C=C1)C2=CC=CC=C2C(O3)=O,1 -[O-][N+](=O)C1=CC(=CS1)C(=O)NC2=C(C=CC=C2)Cl,1 -NC1=C(C=C(C(=C1)[N+]([O-])=O)N)F,1 -OC1=CC2=C(C(=C1)O)C(C(C(O2)C3=CC(=C(C=C3)O)O)=O)=O,1 -CN(C)C1=CC=C(C=C1)N=NC2=CC(=CC=C2)CCl,1 -CC(Br)C(Br)CCl,1 -C[N]1C(=NC2=C1C=C(C)C3=NC=CN=C23)N,1 -C4CC3=C(C2=C1C=CC=CC1=CC=C2C=C3)C4,1 -COCC4CN(C)C3CC1=C[N](C)C2=CC=CC(=C12)C3=C4,1 -[O-][N+](=O)C1=CC(=C(C(=C1)[N+]([O-])=O)C2=CC=CC=C2)[N+]([O-])=O,1 -C3=CC2=CC1=CC=CC=C1N=C2C=C3,1 -CCN1C=C(C(O)=O)C(=O)C2=C1N=C(C(=C2)F)N3CCNCC3,1 -CC(=O)NC(CSCCCl)C(O)=O,1 -ClC(Cl)C1=CC=CC=C1,1 -[O-][N+](=O)C1=CC=C(C=C1)C=CC2=CC(=CC=C2)Cl,1 -[O-][N+](=O)C1=CC(=C(C=C1)C2=CC(=C(C=C2)[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O,1 -CCCCN(CCCC)N=O,1 -CNC(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -COC1=C(C=CC(=C1)NS(C)(=O)=O)NC3=C2C=CC=CC2=NC4=CC=CC=C34,1 -C[N]1C=NC(=C1N=O)C2=CC=CC=C2,1 -[O-][N+](=O)C2=C3C=CC4=NC1=CC=CC=C1C5=CC=C(C=C2)C3=C45,1 -N#CC1=CC3=C2C1=CC=CC2=CC=C3,1 -NC3=CC2=C(C1=CC=CC=C1N=C2C=C3)N,1 -ONC1=CC=CC=C1,1 -ClC2=CC1=CC=CN=C1C=C2,1 -C1=CC3=C(C=C1)C4=C2C=CC=CC2=C5C=CC=C6C=CC(=C3)C4=C56,1 -CCC(C)OC(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -OC1=C2C=CC3=CC=C(C4=CC=C(C=C1)C2=C34)[N+]([O-])=O,1 -ClC=C(Cl)SCC1=CC=CC=C1,1 -S(SC2=NC1=CC=CC=C1S2)C4=NC3=CC=CC=C3S4,1 -N1C5C1C2=C(C=C4C(=C2)C3=CC=CC=C3C=C4)C6=C5C=CC=C6,1 -CC(=O)NC2=C1N=CC=CC1=CC=C2,1 -CN1CN=C2C(=[N+](O)[C-]N=C12)N,1 -CC=C(Cl)C=O,1 -NC(=N)NC(=O)C1=C(N=C(C(=N1)Cl)N)N,1 -C[N]1C(=NC2=C1C=CC3=NC=C(C)N=C23)N,1 -COC3=CC(=C2N=C1OC=CC1=C(OC)C2=C3)OC,1 -CN(COC(C)=O)[N+]([O-])=O,1 -CC(Cl)(Cl)[N+]([O-])=O,1 -CN(C)C(=S)SSC(=S)N(C)C,1 -NC1=CC2=CC=C3C=CC=C4C=CC(=C1)C2=C34,1 -NC1=CC=C(C=C1)SC2=CC=CC=C2,1 -CC1=C3C(=CC2=CC=CC=C12)C4=C(C=C3)C(O)C(O)C5OC45,1 -[O-][N+](=O)C1=CN=C(S1)N2CCN(C(=O)C(Cl)Cl)C2=O,1 -COC1=NSC2=CC=C(N)C=C12,1 -[O-][N+](=O)C1=CC=C2C=CC3=C(C5=C(C4=CC=C1C2=C34)C=CC=C5)[N+]([O-])=O,1 -CN(C)CCCNC2=C1C(=CC=C(C1=NC3=CC=CC=C23)N(CCO)CCO)[N+]([O-])=O,1 -CC1=CC=C(C=C1)NC(=O)C2=CSC(=C2)[N+]([O-])=O,1 -ClC(Cl)=C(Cl)C=O,1 -COC3=C2N=C1OC=CC1=C(C2=CC=C3)OC,1 -COC1=C(C5=C(C(=C1)O)C(=O)C2=C(C3=C(C=C2OC)OC4OC=CC34)O5)OC,1 -[O-][N+](=O)C1=CC=C(C=C1)NC2=CC=C(C=C2)Cl,1 -NC1=CC=C(C=C1)CC2=CC=C(C=C2)N,1 -NC(CCC(=O)NC(CSC1=C(C=C(C=C1)[N+]([O-])=O)[N+]([O-])=O)C(=O)NCC(O)=O)C(O)=O,1 -NC(CSC(Cl)=C(Cl)C(Cl)=C(Cl)Cl)C(O)=O,1 -CNC1=C([N](C=N1)C)C(=O)N(C)N=O,1 -CC3=CC2=C1C=C(C=CC1=CC=C2C=C3)C,1 -COC1=C(C=CC(=C1)NS(C)(=O)=O)NC3=C2C=CC=C(C2=NC4=CC(=CC=C34)N=[N+]=[N-])C,1 -CCN(CCCl)CCCNC2=C1C=CC=CC1=NC3=CC=CC=C23,1 -CC(O)CN(C)C1=NN=C(C=C1)NN,1 -CC4=CC3=CC2=C1C=CC=CC1=CC=C2C=C3C=C4,1 -CC1(C)COC1=O,1 -CC(O)CN(CC(C)O)N=O,1 -CC(Cl)CO,1 -CC1=C(C=C(C=C1)N=NC2=CC(=C(C=C2)C)N)N,1 -ClC(Cl)C(=O)C(Cl)Cl,1 -COC2=C1OC=CC1=CC3=C2OC(C=C3)=O,1 -CC4=C2C=C1C=CC=CC1=CC2=C3C=CC(C(C3=C4)O)O,1 -NC2=C1C=CC=CC1=C(C=C2)N,1 -O=NC2=C3C=CC4=CC1=CC=CC=C1C5=CC=C(C=C2)C3=C45,1 -C[N]2C(=NC3=C1C=CC=NC1=CC(=C23)C)NC(C)=O,1 -C1=CN=C(C=C1)C2=CN=CC=C2,1 -CC(=O)NC1=CC=C(C=C1)C2OC2C(=O)C3=CC=CC=C3,1 -CC1=C4C(=C(C2=CC=CC=C12)CBr)C3=CC=CC=C3C=C4,1 -O=C1NCNC(=O)N1,1 -CC(=O)NC1=C(C(=CC=C1)N)C(O)=O,1 -C1OC1CC2=CC=CC=C2,1 -OC1=C(C=C(C=C1[N+]([O-])=O)C2=CC=CC=C2)[N+]([O-])=O,1 -C[N+]2=C1C=CC=CC1=C(C3=CC=CC=C23)N,1 -CCOC1=C(C=CC=C1)[N+]([O-])=O,1 -CCCCCN1C3C1C2=C(C=CC=C2)C4=C3C=CC=C4,1 -CC2=CC1=CC4=C(N=C1C=C2)C3=CC=CC=C3C=C4,1 -CC1=C3C(=C(C=C1)C)C2=CC=CC=C2C=C3,1 -C1=CC3=C(C=C1)C4=CC=C5C2=CC=CC=C2C=C6C=CC(=C3)C4=C56,1 -O1C2C=CC=CC12,1 -COC(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -NC4=C1C=CC=CC1=C3N=C2C=CC(C=C2OC3=C4)=N,1 -NC1=C(C=CC=C1[N+]([O-])=O)[N+]([O-])=O,1 -COC1=CC3=C(C(=C1)OC)C(=O)C2=C(C(=CC=C2O)OC)O3,1 -O=C1C=CC3=C2C1=CC=CC2=CC=C3,1 -CCC2=C(N=C1C(=C(C=CC1=N2)NC)C)CC,1 -[O-][N+](=O)C2=CC=C1[NH]C=NC1=C2,1 -CN(C)C1=CC(=CC=C1)O,1 -[N-]=[N+]=NCC1=CC=CC=C1,1 -[O-][N+](=O)C1=CC=[N+](C=C1)[O-],1 -CC4=C1C=CC=CC1=C3N=C2C=CC=CC2=C(C3=C4)C,1 -COC1=C(C=CC(=C1)NS(C)(=O)=O)NC3=C2C=CC(=CC2=NC4=CC=CC=C34)N=[N+]=[N-],1 -O=CC=O,1 -CC2=NC1=CC(=C(C=C1C(=C2)C)C)N,1 -COC1=C(C5=C(C=C1)C2=C(C4=C(C=C2)C=C3OCOC3=C4)N(C)C5=O)OC,1 -CC1(C)CC2C(O)(C1)C=C(C=O)C3(CC23C)C=O,1 -CC=C1CC(=C)C(O)(CO)C(=O)OCC2=CCN3CCC(OC1=O)C23,1 -CC(=O)NC1=CC=C(C=C1)N,1 -ClC1=NC(=CC=C1)C(Cl)(Cl)Cl,1 -CCOS(=O)(=O)C1=CC=C(C=C1)C,1 -[O-][N+](=O)C4=CC=C3C2=C1C(=CC=CC1=CC=C2)C5=C3C4=CC=C5,1 -CC(=O)NN=CC2=[N+](C1=CC=CC=C1[N+](=C2)[O-])[O-],1 -CCN(CC)CCCC(C)NC2=C1C=CC(=CC1=NC=C2)Cl,1 -[O-][N+](=O)C1=CC3=C(C=C1)C2=CC=CC=C2C3,1 -S2C4=CC=CC5=CC=C3C1=CC=CC=C1C=C2C3=C45,1 -NC2=C1C(C4=C(C(C1=C(C=C2OC3=CC=CC=C3)O)=O)C=CC=C4)=O,1 -[O-][N+](=O)C1=CC3=C(C=C1)C2=CC5=C(C=C2CC3)C4=CC=CC=C4CC5,1 -O=C1C=CC(=O)C2=C1C=CC=C2,1 -NC3=CN=C2[N]1C=CC=CC1=NC2=C3,1 -[O-][N+](=O)C1=CC(=CS1)C(=O)NC2=CC=C(C=C2)F,1 -NC1=CC(=C(C=C1)O)[N+]([O-])=O,1 -CC1=C2C=CC3=CC=CC4=CC=C(C=C1)C2=C34,1 -CC1=CC=C(C=C1)NO,1 -NC3=CC2=CC1=CC=CC=C1C=C2C=C3,1 -OC5C=C3C2=C(C1=CC=CC=C1C=C2)C4=C3C(=CC=C4)C5O,1 -ClC1=C(Cl)C(=O)NC1=O,1 -OCCN1CN(CCO)CN(CCO)C1,1 -CSC1=C(C=C(C=C1)[N+]([O-])=O)[N+]([O-])=O,1 -NC1=CC=C(C=C1)NC3=C2C=CC=CC2=NC4=CC=CC=C34,1 -[O-][N+](=O)C4=C1C=CC=CC1=C3C=CC2=CC=CC5=C2C3=C4CC5,1 -OCCNC2=C1C=CC=CC1=NC(=N2)C3=CC=C(S3)[N+]([O-])=O,1 -ClCC=CCCl,1 -ClCC1=CC4=C3C(=C1)C2=CC=CC=C2C3=CC=C4,1 -C[N]1C=NC2=C(NO)N=CN=C12,1 -O=CC(=O)C1=CC=CC=C1,1 -[O-][N+](=O)C1=CC3=C(C=C1)C2=CC=C(C=C2C=C3)[N+]([O-])=O,1 -OCCN(CCO)C2=CC1=CC=CC=C1C=C2,1 -C=O,1 -CN(C)C1=CC=C(C=C1)N,1 -C[N]1C(=NC2=C1C=CC3=CN=CC=C23)N,1 -ClCC2=C4C=CC=C5C=CC3=C1C=CC=CC1=CC(=C2)C3=C45,1 -CC1=CC=C(C=C1)NC2=CC=C(C=C2)[N+]([O-])=O,1 -CCCCCC=CC(=O)CCC1=CC(=C(C=C1)O)OC,1 -CC1(CO1)C2=CC=C(C=C2)C3=CC=CC=C3,1 -COP(=S)(OC)OC1=CC(=C(C=C1)N)C,1 -CCNC(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -OC5C=CC4=C3C1=CC=CC2=CC=CC(=C12)C3=CC=C4C5O,1 -COC1=C(C=CC(=C1)CNC(=O)CCCCCCC(C)C)O,1 -O=C(OCC=CC1=CC=CC=C1)C=CC2=CC=CC=C2,1 -C[N]1C(=NC2=C1C=CC3=NC=CC=C23)N,1 -ClC1=CC=C(C=C1)C3=C([N]2C=CSC2=N3)N=O,1 -COC1=C(C=CC=C1)CC2CO2,1 -[O-][N+](=O)C1=C3C=CC4=CC=CC5=CC=C(C2=CC=CC=C12)C3=C45,1 -CC(=O)N(OC(=O)C1=CC=CC=C1)C2=CC4=C(C=C2)C3=CC=CC=C3C4,1 -CC(=O)C1=CC(=CC=C1)[N+]([O-])=O,1 -FC2=CC1=CC=CN=C1C=C2,1 -OC1=C2C=CC3=CC=CC4=CC=C(C(=C1)[N+]([O-])=O)C2=C34,1 -C5CC4=C3C=C2C1=CC=CC=C1C=CC2=NC3=CC=C4C=C5,1 -ON(C=O)C1=CC=C(C=C1)C2=CC=CC=C2,1 -COC4=CC(=O)C3=C2[NH]C1=CC=CC=C1C2=C(C)N=C3C4=O,1 -OC2=C(C1=CC=CC=C1C=C2)N=NC3=CC=C(C=C3)N=NC4=CC=CC=C4,1 -C[N]1C(=NC2=C1C=CC3=NC(=CC=C23)O)N,1 -ClCC(=O)CCl,1 -OP(O)(=N)N(CCCl)CCCl,1 -C[N]2C=C1C=CC=C(C1=N2)[N+]([O-])=O,1 -FC2=C1C=CC=CC1=NC=C2,1 -O=C1C4=C3C2=C1C=CC=C2C=CC3=CC=C4,1 -ClCC1=C(Cl)C(=O)OC1,1 -C1=CC3=C(C=C1)C2=CC=CC=C2C=C3,1 -CC1=C(C=CC=C1)N=O,1 -OC1=C2C(=CC=C1)C3=C(C=C2)[NH]C4=C3C5=C(C=C4)C=CC=C5,1 -CC(=O)C(C)=O,1 -CC1=C(C=C(C=C1)NO)C,1 -[O-][N+](=O)C1=CC(=CS1)C(=O)NC2=CC=C(C=C2)Br,1 -[O-][N+](=O)C2=CC1=C3C=CC4=CC=CC5=CC=C(C=C1O2)C3=C45,1 -CN(C)C(=O)NC1=CC(=C(C=C1)Cl)Cl,1 -CC1=C3C(=C(C=C1)C)C2=CC=CC=C2[NH]3,1 -[O-][N+](=O)C1=CC3=C(C=C1)OC2=C(C=CC=C2)O3,1 -NC(=O)NN=CC1=CC=C(O1)[N+]([O-])=O,1 -C[N]1C(=NC2=C1C=C(C)C3=NC(=C(C)N=C23)C)N,1 -C=CCN=C=S,1 -[O-][N+](=O)C([N+]([O-])=O)([N+]([O-])=O)[N+]([O-])=O,1 -C1COCC2(C1)CO2,1 -ClC3=CC=C2OC1=CC=CC=C1C2=C3,1 -OC2=C3C=CC4=CC1=CC=CC=C1C5=CC=C(C=C2)C3=C45,1 -CC1=C(C=C(C=C1N)[N+]([O-])=O)[N+]([O-])=O,1 -[O-][N+](=NC1=CC=CC=C1)C2=CC=CC=C2,1 -ClC(=O)C1=CC=CC=C1,1 -COC1=CC3=C(C(=C1)O)C(=O)C2=C(C=CC(=C2)O)O3,1 -ClC2=C(Cl)C(=O)C1=C(C=CC=C1)C2=O,1 -OC1=C3C=CC(=C4C=CC2=CC=CC(=C1)C2=C34)[N+]([O-])=O,1 -COC3=CC=C2C(=C1C=COC1=NC2=C3)OC,1 -C1CSCN1,1 -C1=CC3=C(C=C1)C2=CC5=C(C=C2C=C3)C4=CN=CC=C4C=C5,1 -CC2=CC1=CC=CC=C1N=C2,1 -[O-][N+](=O)C1=C(C=CC=C1)Br,1 -CC(C)(C)OC(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -C[N]1C=NC(=C1SC3=C2[NH]C=NC2=NC=N3)[N+]([O-])=O,1 -NC1=C2C=CC3=C(C=CC4=CC=C(C=C1)C2=C34)[N+]([O-])=O,1 -NC2=C1C=CC=CC1=CC=C2,1 -BrCC1=C3C=CC4=CC=CC5=CC=C(C2=CC=CC=C12)C3=C45,1 -NC(=O)OC1CO1,1 -CCN(C=O)N=O,1 -C[N]1C(=NC2=C1C=CC3=NC=C(C)N=C23)NO,1 -OC1=C(C=C(C=C1)Cl)CC2=C(C=CC(=C2)Cl)O,1 -CCCCN(N=O)C(N)=O,1 -CC(C)(C)NC(=O)C=CC1=CC=C(O1)[N+]([O-])=O,1 -[O-][N+](=O)C1=CC3=C(C=C1)C2=C(C=CC=C2C3)[N+]([O-])=O,1 -COC(=O)NN=CC2=[N+](C1=CC=CC=C1[N+](=C2)[O-])[O-],1 -NC1=CC=C(C=C1)C2=CC=C(C=C2)N,1 -CCN(C)N=O,1 -[O-][N+](=O)C1=CC3=C(C=C1)C2=CC=C(C=C2CC3)[N+]([O-])=O,1 -CCOC1=CC=C(C=C1)NO,1 -OC(CN=[N+]=[N-])CN=[N+]=[N-],1 -NC1=C(C=C(C=C1)F)F,1 -CC5=C1C=CC=CC1=C4C3=C2C=CC=CC2=C(C=C3[NH]C4=C5)C,1 -[O-][N+](=O)C3=CC=C2[NH]C1=CC=CC=C1C2=C3,1 -CC(O)CN(CC(O)CO)N=O,1 -CC1=C(C=C(C=C1)N)O,1 -[O-][N+](=O)C2=C3C=CC4=C(C1=CC=CC=C1C5=CC=C(C=C2)C3=C45)[N+]([O-])=O,1 -CN(C)N=NC1=CC=C(C=C1)Cl,1 -NC2=C3C=CC4=C1C=CC=CC1=CC5=CC=C(C=C2)C3=C45,1 -CN(C)CCNC(=O)C2=C1OC3=C(OC1=CC=C2)C=CC=C3,1 -CC#CC(OC(=O)NC1CCCCC1)(C2=CC=CC=C2)C3=CC=CC=C3,1 -C[N]3C=CC4=CC=C2C=CC1=CC=C(O)C=C1C2=C34,1 -ClCC2=C1C=CC=CC1=C(C3=CC=CC=C23)Cl,1 -ON=C(O)C1=CC=CC=C1,1 -C[N]1C=CN=C1[N+]([O-])=O,1 -CC2=CC1=CC4=C(C=C1C=C2)C3=CC=CC=C3C=C4,1 -CC(=O)NC1=C2C=CC3=CC=CC4=CC=C(C(=C1)O)C2=C34,1 -C2=CC1=CC=CN=C1C=C2,1 -[O-][N+](=O)C1=CC=C(C=C1)S,1 -CC3=C2C=CC1=CC=CC=C1C2=C(C4=CC=CC=C34)C,1 -CCN1C=C(C(O)=O)C(=O)C2=C1C=C(C(=C2)F)N3CCNCC3,1 -ClCC4=C2C1=CC=CC=C1C3=CC=CC(=C23)C=C4,1 -[O-][N+](=O)C1=CN=C(S1)N2CCNC2=O,1 -CC3=C(C2=NC1=CC(=C(C=C1N=C2C=C3)C)N)N,1 -C[N]1C(=NC2=C1C=C(C)C3=NC=C(C)N=C23)N,1 -NC2=C1C=CC=C(C1=CC=C2)N,1 -C[N]1C(=NC2=C1C=C(C)C3=NC=C(N=C23)C4=CC=CC=C4)N,1 -C[N+]2=C1C=CC=CC1=CC3=CC=CC=C23,1 -OC(=O)CC1=CC(=C(C=C1)O)O,1 -C[N]1C(=NC2=CC(=CC=C12)C)N,1 -COP(=O)(OC)OC=C(Cl)Cl,1 -COC4=C2C1=CC=CC=C1CC3N(CCC(=C23)C=C4O)C,1 -OCC(Br)CBr,1 -[O-][N+](=O)C1=CC2=CC=C3C=C(C=C4CCC(=C1)C2=C34)[N+]([O-])=O,1 -O=C1C(=O)C3=C2C1=CC=CC2=CC=C3,1 -ClCC1=C2C=CC3=CC=CC4=CC=C(C=C1)C2=C34,1 -[O-][N+](=O)C1=CC=C(O1)C=O,1 -CC3=C2C1=CC=CC=C1[NH]C2=C(C(=N3)N)C,1 -O=C1C=CC4=C2C1=CC=C3C(C=CC(=C23)C=C4)=O,1 -CNC2=C(C1=NC(=CN=C1C=C2)C3=CC=CC=C3)C,1 -CC(=O)NC1=CC=C(C=C1)C2=CC=C(C=C2)N,1 -O2C3C=CC1=C(N=CC=C1)C23,1 -CCC(=C)C=O,1 -CC2=C(N=C1C=C(C=CC1=N2)N)C,1 -OS(=O)(=O)C1=C(C=CC(=C1)NC2=C(C=C(C=C2)[N+]([O-])=O)[N+]([O-])=O)NC3=CC=CC=C3,1 -CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C=O,1 -CNC1=C(C=C(C=C1)N(CCO)CCO)[N+]([O-])=O,1 -O=C1C5=C4C3=C1C=C2C=CC=CC2=C3C=CC4=CC=C5,1 -COC(=O)C3=C2N=C1C=CC=CC1=C(C2=C(C=C3)[N+]([O-])=O)NCCCN(C)C,1 -ClC(Cl)C1=C(Cl)C(=O)OC1,1 -CC1=C(C=C(C(=C1C)N)[N+]([O-])=O)N,1 -CC5CC2C(CC3=C[N](C1CCCC1)C4=CC=CC2=C34)N(C)C5,1 -CC1=C(C=CC(=C1)[N+]([O-])=O)[N+]([O-])=O,1 -C[N]1C(=NC3=C1C=CC4=CC=C2C=CC(=CC2=C34)O)C,1 -[O-][N+](=O)C1=CC=C(C=C1)C(=O)OCC2CO2,1 -[O-][N+](=O)C1=CC=C(C=C1)C2=CC=CC=C2,1 -CC1=C(C(=CC=C1)N)N,1 -[O-][N+](=O)C1=C2C=CC3=CC=CC4=CC=C(C(=C1)[N+]([O-])=O)C2=C34,1 -CNC1=CC=C(C=C1)NC3=C2C=CC=CC2=NC4=CC=CC=C34,1 -CC(=O)C1=CC=C[NH]1,1 -[O-][N+](=O)C1=CC3=C(C=C1)C2=CC5=C(C=C2C=C3)C4=CC=CC=C4C=C5,1 -[O-][N+](=O)C1=CC(=CS1)C(=O)NC2=CC(=CC=C2)F,1 -[O-][N+](=O)C1=CC3=C(C=C1)C2=CC=CC=C2O3,1 -BrCC(=O)C1=CC=C(C=C1)C2=CC=CC=C2,1 -O=C1NC(=O)C=C1,1 -CC(=O)NC1=CC=C(C=C1)N=NC2=C(C=CC(=C2)C)O,1 -CN(C)C1=CC=C(C=C1)N=NC2=C(C=CC=C2)CO,1 -NC1=C(C=C(C=C1)C2=CC(=C(C=C2)N)[N+]([O-])=O)[N+]([O-])=O,1 -NC1=CC(=C(C=C1)CO)[N+]([O-])=O,1 -[O-][N+](=O)C4=C2C(=CC=C3C1=CC=CC=C1C(=C23)C=C4)[N+]([O-])=O,1 -[NH]1C(=NC(=C1C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4,1 -CC(=O)NN,1 -CC(O)CN,1 -CC4=C2C=C1C(C(C=CC1=CC2=C3C=CC=CC3=C4)O)O,1 -NC3=CC=C2N=C1C=CC=C[N]1C2=N3,1 -NC1=C(C=CC(=C1)[N+]([O-])=O)CO,1 -O=C1C(=O)C5=C3C2=C1C=CC=C2C=CC3=C4C=CC=CC4=C5,1 -NC1=CC=C(C=C1)OC2=CC(=CC=C2)OC3=CC=C(C=C3)N,1 -C1=CC2=CC4=CC=C5C=CC=C6C=C3C=CC(=C1)C2=C3C4=C56,1 -ClCC4=C3C1=CC=CC2=CC=CC(=C12)C3=CC=C4,1 -C[N]1C(=NC=C1[N+]([O-])=O)C,1 -CN(C)CCNC(=O)C3=C2N=C1C=CC=CC1=C(C2=CC=C3)N,1 -CC(=O)N(O)C1=CC=C(C=C1)[N+]([O-])=O,1 -C5CCC4=C3C=C2C1=CC=CC=C1C=CC2=NC3=CC=C4C5,1 -[O-][N+](=O)C2=CC1=CC=CN=C1C=C2,1 -C(CCC1CO1)CC2CO2,1 -O=C2CC(=O)C1=C(C=CC=C1)C2=O,1 -C[N]1C(=NC2=C1C=C(C)C3=NC(=CN=C23)C)N,1 -[O-][N+](=O)C2=C1C=CC=CC1=[N+](C=C2)[O-],1 -OC5C=CC4=C3C=C1C=CC=C2C=CC(=C12)C3=CC=C4C5O,1 -NC1=CC(=C(C=C1)[N+]([O-])=O)N,1 -OC1=CC=C(C=C1)C=NN4N=NC2=C([NH]C3=CC=CC=C23)C4=O,1 -CC(O)CN(C)N=O,1 -CC1=C(C(=CC=C1)C)C,1 -C1N2CN3CN1CN(C2)C3,1 -CC4=C2C1=CC=CC=C1[NH]C2=C3C(C=C(C(C3=N4)=O)N5CC5)=O,1 -CN(C)CCNC(=O)C3=C2C=C1C=CC=CC1=CC2=CC=C3,1 -CC2=C4C=C1C=CC=CC1=C5C=CC3=CC=CC(=C2)C3=C45,1 -[O-][N+](=O)C1=CC=C(C=C1)C(=O)C2OC2C3=CC=CC=C3,1 -[O-][N+](=O)C1=CC=C(O1)C2=CSC(=N2)NC=O,1 -OC3=C1C=CC=CC1=C2C=CC=CC2=C3,1 -BrC=CBr,1 -CCCC=CC(=O)OC1C(C)(C)CC2C1(O)C=C(C=O)C34CC23C(=O)OC4O,1 -[O-][N+](=O)C1=CC3=C(C=C1)OC2=C(C=C(C(=C2)Cl)Cl)O3,1 -NCCCNCCCCN(CCCN)N(O)N=O,1 -CC3=C2C1OC1C5=C(C2=C(C4=CC=CC=C34)C)C=CC=C5,1 -[O-][N+](=O)C1=CC=C(C=C1)C3=C([N]2C=CSC2=N3)[N+]([O-])=O,1 -CN(C)N=NC1=CC=C(C=C1)Br,1 -[O-][N+](=O)C3=CC=C2CC1=CC=CC=C1C2=C3,1 -NC(=NO)C1=CC=C(O1)[N+]([O-])=O,1 -C1=CC3=C(C=C1)C2=CC=CN=C2C=C3,1 -[O-][N+](=O)C1=C3C(=CC=C1)C2=CC=CC=C2[NH]3,1 -NC2=C1N=CC=CC1=CC=C2,1 -CC[N+]2=C(C1=CC(=CC=C1C3=CC=C(C=C23)N)N)C4=CC=CC=C4,1 -ON(N=O)C1=CC=CC=C1,1 -CC3=C(C=C2N=C1C=C(C(=CC1=CC2=C3)C)N)N,1 -NC1=CC(=C(C=C1)O)N,1 -NC2=C1C=CC=CC1=NC3=C2CCCC3,1 -CCN(CC)C1=CC=C(C=C1)C(C2=CC=C(C=C2)N(CC)CC)=C3C=CC(C=C3)=[N+](CC)CC,1 -CN(C)C1=CC=C(C=C1)C(=N)C2=CC=C(C=C2)N(C)C,1 -CC1=CC(=C(C=C1)N=NC3=C2C=CC(=CC2=CC(=C3O)S(O)(=O)=O)S(O)(=O)=O)C,1 -ClC=CC[N+]23CN1CN(CN(C1)C2)C3,1 -COC3=CC2=C(C1=CC=C(C=C1N=C2C=C3)Cl)NC(C)CCCN(CCCl)CCCl,1 -CC3=C(C=C2[N+](=C1C=C(C(=CC1=NC2=C3)C)N)C4=CC=CC=C4)N,1 -CN(C)CCCCl,1 -NC1=CC=C(C=C1)C(C2=CC=C(C=C2)N)=C3C=CC(=N)C=C3,1 -CN(C)C3=CC2=[S+]C1=CC(=CC=C1N=C2C=C3)N(C)C,1 -CC(COC1=CC=CC=C1)N(CCCl)CC2=CC=CC=C2,1 -CC1=C(C=CC(=C1)C(C2=CC=C(C=C2)N)=C3C=CC(=N)C=C3)N,1 -CN(C)C3=CC2=NC1=CC(=CC=C1C=C2C=C3)N(C)C,1 -CCN(CC)CCCC(C)NC2=C1C=C(C=CC1=NC3=CC(=CC=C23)Cl)OC,1 -ClCC1=NC=CC=C1,1 -ClCC1=CN=CC=C1,1 -CCN(CC)C1=CC3=C(C=C1)C(=C2C=CC(=CC2=[O+]3)N(CC)CC)C4=C(C=CC=C4)C(O)=O,1 -C[N+]2=C1C=C(C=CC1=CC3=CC=C(C=C23)N)N,1 -CN(C)C3=CC2=[S+]C1=CC(=C(C=C1N=C2C=C3)C)N,1 -NC(COC(=O)C=[N+]=[N-])C(O)=O,1 -NC1=NC=C(S1)[N+]([O-])=O,1 -CC(C)CCCC(C)C4CCC5C3CC1OC12CC(O)CCC2(C)C3CCC45C,1 -CCCCN(N=O)C(=N)N[N+]([O-])=O,1 -NC(CC1=CC=C(C=C1)N(CCCl)CCCl)C(O)=O,1 -COC2=CC=C1N=C(N)SC1=C2,1 -CN(N=O)C(=O)NC(C=O)C(O)C(O)C(O)CO,1 -CC2=CN(C1CC(N=[N+]=[N-])C(CO)O1)C(=O)NC2=O,1 -NC1=NC(=O)N(C=N1)C2OC(CO)C(O)C2O,1 -BrC2=C1C=C4C(=CC1=CC=C2)C3=CC=CC=C3C=C4,1 -OC2=C1C=CC(=CC1=C(N=N2)O)[N+]([O-])=O,1 -CCN(N=O)C(=N)N[N+]([O-])=O,1 -CN(C)N=NC1=C([NH]C=N1)C(N)=O,1 -OC1=NC(=NN=C1)O,1 -OC(CBr)C(O)C(O)C(O)CBr,1 -COC24C1NC1CN2C3=C(C(=C(C(=C3O)C)N)O)C4=COC(N)=O,1 -SC2=C1N=C[NH]C1=NC=N2,1 -OCC1OC(C(O)C1O)[N]2C=NC3=C(S)N=CN=C23,1 -NC(CC1=CC(=C(C=C1)O)O)C(O)=O,1 -NC(=NO)C1=CC=CC=C1,1 -CC(=O)NC(CS)C(O)=O,1 -CC1=C(C=CC(=C1)N)C2=CC=C(C=C2)O,1 -NC2=NC1=CC=C(C=C1S2)[N+]([O-])=O,1 -OCC1OC(CC1O)N2C=C(C(=O)NC2=O)C(F)(F)F,1 -CN(N=O)C(=N)N[N+]([O-])=O,1 -NC2=C1N=C[NH]C1=NC=[N+]2[O-],1 -NC2=C1N=C[N](C1=NC=N2)C3OC(CO)CC3O,1 -NC1=NC=CS1,1 -[O-][N+](=O)C1=CC=C(C=C1)CBr,1 -C=CC#N,1 -CCOP(=O)(OCC)OC1=CC=C(C=C1)[N+]([O-])=O,1 -ClCC(Br)CBr,1 -ClCCCl,1 -CC2=C1C(O)C(C)(C)C=C1C(=O)C(C)(O)C23CC3,1 -CC2=C1C(O)C(C)(CO)C=C1C(=O)C(C)(O)C23CC3,1 -CCCN(C(N)=NN=O)[N+]([O-])=O,1 -CCCCCN(N=O)C(=N)N[N+]([O-])=O,1 -CC(C)(O)C3CC2=C(C=C1OC(C=CC1=C2)=O)O3,1 -CN1C(SC2=C1C=CC=C2)=NN,1 -NC(CO)C(=O)NNCC1=C(C(=C(C=C1)O)O)O,1 -N1C(C1C2=CC=CC=C2)C3=CC=CC=C3,1 -CC(C)CC(=O)OCC1=COC(OC(=O)CC(C)C)C2C1CC(OC(C)=O)C23CO3,1 -C[N]1C(=CN=C1C2=NN=C(S2)N)[N+]([O-])=O,1 -C1=CC=C3C(=C1)C=C4C=CC=C5C2=C(C=CC=C2)C3=C45,1 -NC2=C1N=C([NH]C1=NC=N2)C3=CC=C(C=C3)[N+]([O-])=O,1 -COC4=C3C(=C2C(=C1C(CC(CC1=C(C2=C(C3=CC=C4)O)O)(O)C(C)=O)=O)O)O,1 -COC2=C1OC3=C(C(C1=C(C=C2)O)=O)C(=CC5=C3C4C=COC4O5)OC,1 -NC(CSC1=C(C=C(C=C1)[N+]([O-])=O)[N+]([O-])=O)C(O)=O,1 -ClCCN(CCCl)P1(=O)OCC(=O)CO1,1 -C[N+]2=C1C=CC=CC1=NC3=CC=CC=C23,1 -CS(=O)(=O)OCC(O)C(O)COS(C)(=O)=O,1 -CC(C)(N=NC(C)(C)C(N)=N)C(N)=N,1 -C[N+]([O-])(CCCl)CCCl,1 -N=NC1=NNC=C2C=CC=CC12,1 -[O-][N+](=O)C1=CC=C(S1)NC(=O)NCCCl,1 -OCC1OC(C(O)C1O)[N]2C=NC3=C(NO)N=CN=C23,1 -CCOC(=O)NNC2=C1C=CC=CC1=CN=N2,1 -CCN(CCCl)CCCNC2=C1N=C(C=CC1=NC3=CC(=CC=C23)Cl)OC,1 -CCN(CCCl)CCCNC1=C4C(=NC2=CC=CC=C12)C3=NC=CC=C3C=C4,1 -CC=C1CC(=C)C(C)(O)C(=O)OCC2=CCN3CCC(OC1=O)C23,1 -NCC(=O)NC1=CC=CC=C1,1 -CC(C)CN(N=O)C(N)=N[N+]([O-])=O,1 -CN1CC(=CC2C1CC3=C[NH]C4=CC=CC2=C34)C,1 -CC4CC1C(CC2=C[NH]C3=CC=CC1=C23)N(C)C4,1 -NC3=CC2=[S+]C1=CC(=CC=C1N=C2C=C3)N,1 -CC[N]2C1=CC=CC=C1C3=CC(=CC=C23)N,1 -CC2=CC=C1N=C(N)[NH]C1=C2,1 -CCN(CC)C1=CC=C(C=C1)C(C2=CC=CC=C2)=C3C=CC(C=C3)=[N+](CC)CC,1 -NC1=CC3=C(C=C1)C2=NC4=C(C(N2C3)=O)C=CC=C4,1 -C1OC1CC3=C2C=CC=CC2=CC=C3,1 -NC(CCC(=O)NC(CS)C(=O)NCC(O)=O)C(O)=O,1 -O=C(C1OC1C2=CC=CC=C2)C3=CC=CC=C3,1 -COC2=C(C1=NC3=C(C(=C1C=C2)OC)CCO3)OC,1 -NN=C1N=NC=C2C=CC=CC12,1 -NC(=O)CC1CO1,1 -CCC(C)ON=O,1 -CC3(C[N]1C=CN=N1)C(N2C(CC2=O)S3(=O)=O)C(O)=O,0 -CN(C)CCOC(=O)C=C,0 -ClC1=C(C=C(C(=C1)Cl)Cl)Cl,0 -CCOC(=O)COC1=CC2=C(C=C1)C(=O)C=C(O2)C3=CC=CC=C3,0 -CCCCCCCCCCCCC1=CC=CC=C1,0 -CCOC(=O)CC(C)C,0 -CCCCCOC(=O)C(C)=C,0 -CC1CCCC2(C)CCCCC12O,0 -CC(=C)C(=O)OCCOC(=O)C(C)=C,0 -ClC1=C(C=CC=C1)C=O,0 -OC1=C(C(=C(C=C1Cl)Cl)Cl)[N+]([O-])=O,0 -CCOC1=CC2=C(C=C1)NC(C)(C)C=C2C,0 -CCCCC(CC)COC(=O)C1=C(C=CC=C1)C(=O)OCC(CC)CCCC,0 -CCCCC(CC)COC(=O)COC1=C(C=C(C=C1)Cl)Cl,0 -CCN(CC)CC#CC(C)(C)OC(=O)C(O)(C1CCCCC1)C2=CC=CC=C2,0 -CC(C)(C)COC(=O)C=C,0 -FC(Cl)C(F)(F)C(F)(F)Cl,0 -NC2=NC1=NC(=C(N=C1C(=N2)N)C3=CC=CC=C3)N,0 -COC(=O)C1=CC=C(C=C1)C(=O)OC,0 -ClC2=CC1=CC=CC=C1N=C2,0 -CC(=C)C(=O)OCCCCCOC(=O)C(C)=C,0 -CC(CC1=CC(=C(C=C1)O)O)C(C)CC2=CC(=C(C=C2)O)O,0 -OC1=C(C=C(C=C1)Cl)SC2=C(C=CC(=C2)Cl)O,0 -CC(=O)CC(=O)NC1=C(C=CC=C1)C,0 -C1CCOC1,0 -CCOCCC1=C(N=C([N]2N=CN=C12)N)C3=CC=CC=C3,0 -NCCS,0 -CC(C)(C)NC(=O)C3CCC4C2CC=C1C=C(CCC1(C)C2CCC34C)C(O)=O,0 -OC1=CC=C(C=C1)C2=CC=C(C=C2)O,0 -CC1=CC=C(C=C1)Br,0 -ClC3=C2C=C1C=CC=CC1=CC2=CC=C3,0 -COC2=C1OC=CC1=C(OC)C3=C2OC(C=C3)=O,0 -C2C1=C(C=CC=C1)C3=C2C=CC=C3,0 -CC2CCCC(=O)CCCC=CC1=C(C(=CC(=C1)O)O)C(=O)O2,0 -NC(CCC(O)=O)C(O)=O,0 -CC(O)C[N+](C)(C)NC(=O)C(C)=C,0 -CCOC(=O)OCC,0 -ClCC2=C3C=CC4=C1C=CC=CC1=CC5=CC=C(C=C2)C3=C45,0 -C3CCC2OCCOCCOC1CCCCC1OCCOCCOC2C3,0 -ON1C(=O)CCC1=O,0 -CCN(CC)CCCN,0 -CC(C)CCOC(C)=O,0 -CC1=C(C(=CC(=C1)C2=CC(=C(C(=C2)C)N)C)C)N,0 -CCCCCCC(O)=O,0 -CC(C)C1C(C)C(C)(C)C2=C1C=C(C(=C2)C)C(C)=O,0 -OC(=O)CC(O)(CC(O)=O)C(O)=O,0 -ICI,0 -COC1=CC(=CC=C1)C(=O)CBr,0 -CCN(CC)CCO,0 -CC3CC1=C(C(=C(C=C1)C(=O)NC(CC2=CC=CC=C2)C(O)=O)O)C(=O)O3,0 -CCCCC1CO1,0 -CCOCOCC,0 -CC(=C)C(=O)OCCO,0 -COC1=CC=C(C=C1)C3=COC2=C(C(=CC(=C2)O)O)C3=O,0 -OCC(O)C1=C(C(=C(O1)O)O)O,0 -COC(=O)C1=CC=C(C=C1)C,0 -ClC1=CC(=CC(=C1)Cl)Cl,0 -NC(N)=O,0 -CCCCCl,0 -[O-][N+](=O)C1=CC=CC=C1,0 -C[N]1C=NC2=C1C(NC(N2C)=O)=O,0 -CC1=CC=NC=C1,0 -OC(=O)CCC1=C[NH]C2=CC=CC=C12,0 -CC(C)(C)NCC(O)COC2=C1CC(C(CC1=CC=C2)O)O,0 -NC(CC(=O)C1=C(C(=CC=C1)O)N)C(O)=O,0 -CC(N)CCN,0 -CC(S)C(=O)NCC(O)=O,0 -N#CCCCCC#N,0 -CCCCC(CC)COC(=O)C=CC1=CC=C(C=C1)OC,0 -CC1(C)CC(CC(C)(CN=C=O)C1)N=C=O,0 -CC1NC(CC2=C1[NH]C3=CC=CC=C23)C(O)=O,0 -CCOP(=S)(OCC)OC2=NC1=CC=CC=C1N=C2,0 -CCCCC(CC)COP(=O)(OCC(CC)CCCC)OCC(CC)CCCC,0 -CNS(=O)(=O)C1=CC=C(C=C1)NC(C)=O,0 -OC1=CC(=C(C(=C1)Cl)Cl)Cl,0 -CCOC1=CC=C(C=C1)N=[N+]([O-])C2=CC=C(C=C2)OCC,0 -C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=CC=C3,0 -CCCCCCCCN1SC=CC1=O,0 -OC(=O)C1=C(C=CC(=C1)Cl)O,0 -NC1=NC(=NC(=N1)N)Cl,0 -CC1=C(C=C(C(=C1)O)C(C)(C)C)SC2=C(C=C(C(=C2)C(C)(C)C)O)C,0 -NC2C1=C(C=CC=C1)C3=C2C=CC=C3,0 -COC(N)=O,0 -FC2=CN(C1CCCO1)C(=O)NC2=O,0 -CC3(C)SC2C(NC(=O)COC1=CC=CC=C1)C(=O)N2C3C(O)=O,0 -COC1=CC=C(C=C1)C=C,0 -CC(=O)C2=CC1=CC=CC=C1C=C2,0 -NC1=NCNC2=C1N=C[N]2C3OC(CO)C(O)C3=O,0 -OC1=CC2=C(C=C1)C4=C(C(O2)=O)C3=CC=C(C=C3O4)O,0 -CCCCCCCC(=O)CCC1=CC(=C(C=C1)O)OC,0 -CC1CC(CC(C)(C)C1)OC(=O)C2=C(C=CC=C2)O,0 -OC(=O)CCCCCCCCC(O)=O,0 -COP(=O)(SC)SC,0 -OC(CC(O)=O)C(O)=O,0 -CC(=C)C(=O)OCC(C)(C)C,0 -CC(C)NCC(O)COC1=C(C=CC=C1)CC=C,0 -C1COCCOCCOCCOCCOCCOCCO1,0 -C=CC1=CC=NC=C1,0 -CC(NC(=O)CC1=C(N=C(N=C1)C)N)=C(CCOC(=O)C2=CC=CC=C2)SC(=O)C3=CC=CC=C3,0 -COC(=O)COC1=C(C=C(C=C1)Cl)Cl,0 -CC(Cl)=O,0 -CCOC1=CC(=CC=C1)[N+]([O-])=O,0 -CC1=NC=C[NH]1,0 -CC(=O)NC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)N,0 -CCOC(=O)CNC(=O)CBr,0 -OC(=O)C=CC(O)=O,0 -CN2C(CSCC(F)(F)F)NC1=C(C=C(C(=C1)Cl)S(N)(=O)=O)S2(=O)=O,0 -NC1CCC(CC1)CC2CCC(N)CC2,0 -CCCCC#N,0 -CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)N(C)C,0 -CC2(N(O)C1=C(C=CC=C1)C2=O)C3=CC=CC=C3,0 -CC1=NC=C(N=C1)C,0 -CC(C)CCCCCOC(=O)C=C,0 -NC1=C(C=CC=C1)C(O)=O,0 -OC1=CC=CC=C1,0 -NC(=O)N(C1=CC=CC=C1)C2=CC=CC=C2,0 -CCCCCCCCCCCCS,0 -CC(C)N=C=NC(C)C,0 -COC1=CC=C(C=C1)CN(CCN(C)C)C2=NC=CC=C2,0 -CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)CC1=CC=CC=C1)C(C)(C)CC2=CC=CC=C2,0 -CCOP(=S)(OCC)OC1=C(C=C(C(=N1)Cl)Cl)Cl,0 -CC(C)CC(C)=O,0 -OCC=CC1=CC=CC=C1,0 -NC1=CC(=CC(=C1)Cl)Cl,0 -CN1CCC(CC1)=C3C2=C(C=CC=C2)C=CC4=C3C=CC=C4,0 -COC1=CC=C(C=C1)O,0 -CCC(=C)C(=O)C1=C(C(=C(C=C1)OCC(O)=O)Cl)Cl,0 -CS(C)(=O)=O,0 -CC(C)(N=NC(C)(C)C#N)C#N,0 -CCC(O)=O,0 -CC(C)CN(CC(C)C)CC(C)C,0 -OC1=CC2=C(C(=C1)O)C(C(C(O2)C3=CC=CC=C3)=O)=O,0 -OCC1=C(C=CC=C1[N+]([O-])=O)[N+]([O-])=O,0 -CCCCCC=CCC=CCCCCCCCC(O)=O,0 -CC1=C(C2=C(C=C1[N+]([O-])=O)C(CC2(C)C)(C)C)[N+]([O-])=O,0 -CCCCCCCCCCC1CO1,0 -O=P(OC1=CC=CC=C1)(OC2=CC=CC=C2)OC3=CC=CC=C3,0 -OC1=C(C(=C(C=C1Cl)Cl)Cl)Cl,0 -OCC(=O)N(O)C1=CC=C(C=C1)Cl,0 -CNP1(=NP(=NP(=N1)(NC)NC)(NC)NC)NC,0 -CC(C)(C#N)C(C)(C)C#N,0 -CS(=N)(=O)CCC(N)C(O)=O,0 -CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)C4=NC3=CC=CC=C3[N]4C,0 -NC(CC1=C[NH]C2=CC=C(O)C=C12)C(O)=O,0 -NC1=C(C=CC=C1)C(=O)OCCC2=CC=CC=C2,0 -OC(=O)C=CC1=C(C=CC=C1)[N+]([O-])=O,0 -CC1=CC3=C(C=C1)C2=CC=C(C=C2C3)C,0 -NC(=O)CCCCC(N)=O,0 -NC(=O)C1=C(C=CC=C1)O,0 -NC(CSC=CCl)C(O)=O,0 -O3C4C1OC1C2=C(C=CC=N2)C34,0 -C[N]2C(=NC3=NC1=NC=CC=C1C=C23)N,0 -CC1=C(C=CC=C1)C=O,0 -CCCCCN(CCCCC)CCCCC,0 -CC(=O)OC2=C1N=CC=CC1=CC=C2,0 -OC(=O)C2=C(C=C1C=CC=CC1=C2)O,0 -CCCCC(CC)CNCC(CC)CCCC,0 -CC(C)NC1=NC(=NC(=N1)N)Cl,0 -[NH]1C=CN=C1,0 -OC(=O)CC(NC(=O)COC1=C(C=C(C=C1)Cl)Cl)C(O)=O,0 -OCCS,0 -O=S1(=O)CCCC1,0 -CC(C)C(C(=O)OC(C#N)C1=CC(=CC=C1)OC2=CC=CC=C2)C3=CC=C(C=C3)Cl,0 -CCC(C)N,0 -CCCCNC(=O)[N]1C(=NC2=CC=CC=C12)NC(=O)OC,0 -O(C1=CC=CC=C1)C2=CC=CC=C2,0 -CC(C)(C)NCC(O)C1=CC(=C(C=C1)O)NC(N)=O,0 -CN2C(=O)CC(=O)N(C1=CC=CC=C1)C3=C2C=CC(=C3)Cl,0 -CN(CCO)CCO,0 -CC1=C(C(=CC=C1)O)N,0 -CCC(CO)=[N+](O)[O-],0 -OC(=O)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)Cl,0 -CC(C)OC(=O)CC(O)(CC(O)=O)C(O)=O,0 -CC(C)(C)OC(=O)OC(=O)OC(C)(C)C,0 -ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O,0 -OC1=CC(=CC=C1)NC2=CC=CC=C2,0 -CC1=C(C=CC=C1N=[N+]([O-])C2=C(C(=CC=C2)[N+]([O-])=O)C)[N+]([O-])=O,0 -NC=O,0 -OC1=C(C=C(C=C1)Cl)CC2=CC=CC=C2,0 -CN(N)C=O,0 -CC2=CC=C1N=N[NH]C1=C2,0 -CCCCCCCC(O)=O,0 -CC1=CC=C(C=C1)N(O)C(C)=O,0 -COC1=C(C=C(C(=C1)N)C)N,0 -COC(=O)C1=CC=C(C=C1)O,0 -OC(=O)CC(=CC(O)=O)C(O)=O,0 -NC(=O)C1=NC=CN=C1,0 -CCN(CC1=CC=CC=C1)C2=CC=CC=C2,0 -CNC(=O)ON=CC(C)(C)SC,0 -O=CC2=C1C=CC=CC1=CC3=CC=CC=C23,0 -C1COCO1,0 -OC(=O)C(Br)=C,0 -C=CC1=C(C=CC=C1)C=C,0 -OS(=O)(=O)C1=CC=CC=C1,0 -CCCCCN(CCCOC)C(=O)C(CCC(O)=O)NC(=O)C1=CC(=C(C=C1)Cl)Cl,0 -C=CC(=O)OCCCCOC(=O)C=C,0 -C(OCC1=CC=CC=C1)C2=CC=CC=C2,0 -BrC1=C(C2=C(C(=C1Br)Br)C(=O)OC2=O)Br,0 -CC(C)N2C(=O)C1=C(C=CC=C1)NS2(=O)=O,0 -CCOP(=S)(OCC)SCN1C(=O)OC2=C1C=CC(=C2)Cl,0 -C=CCN(CC=C)CC=C,0 -CCNC1=CC=CC=C1,0 -NC1=C(C=CC=C1O)[N+]([O-])=O,0 -CC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O,0 -CC(C)(OC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)Cl)C(O)=O,0 -CCOC(=O)C4=CC1=C(C3=C2C(=C1)CCCN2CCC3)OC4=O,0 -COC(=O)C(=CC1=C(C=CC=C1)Br)C#N,0 -CCCCC1C(=O)N(N(C1=O)C2=CC=CC=C2)C3=CC=CC=C3,0 -CC(C)(C)OOC(C)(C)C,0 -CC1=C(C=CC=C1)C(N)=O,0 -CC(C)(OOC(C)(C)C1=CC=CC=C1)C2=CC=CC=C2,0 -CCCCOC(=O)CCC,0 -CCCCOCCCC,0 -CCC(C)=[N+](O)[O-],0 -NC(=O)C1CCCN1C(=O)C(CC2=C[NH]C=N2)NC(=O)C3CCC(=O)N3,0 -CCCC=C(CC)C=O,0 -CC1=CC=C(C=C1)C#N,0 -C2=CC1=CN=NC=C1C=C2,0 -ClC1=C(C(=CC=C1)Cl)C=O,0 -COC1=C(C=CC(=C1)C(C)=O)O,0 -CC(C)COC(=O)C(C)=C,0 -CC(C)(C)C1=C(C=CC(=C1)O)O,0 -NC1CCCC(N)C1,0 -CCCCOC(=O)C1=CC=C(C=C1)N,0 -CC1CCC(CC1)C(C)C,0 -NCCCN,0 -CC1=CC3=C(C=C1)C(=O)C2=C(C=CC=C2)C3=O,0 -OC1=CC=C(C=C1)NC3=CC2=CC=CC=C2C=C3,0 -CCCCC(CC)C(O)=O,0 -ClCC(Cl)C=C,0 -CC(C)CCOC(=O)CC(C)C,0 -NCC(O)=O,0 -OCC1=CC=C(C=C1)F,0 -CCCCOCCOCCSC#N,0 -O=C2N(SC1CCCCC1)C(=O)C3=C2C=CC=C3,0 -CC3=NN=C4CN=C(C1=C(C=CC=C1)Cl)C2=CC(=CC=C2[N]34)Cl,0 -OC1=CC=C(C=C1)C=CC(=O)C2=CC=CC=C2,0 -ON(C=O)C1=CC=CC=C1,0 -[O-][N+](=O)C1=CC(=CC=C1)Cl,0 -[O-][N+](=O)C1=CC2=C(C=C1)NC(=O)CN=C2C3=CC=CC=C3,0 -OC(C(O)C(O)=O)C(O)=O,0 -CS(=O)(=O)C=C,0 -CC(C)CC(C)O,0 -O=CC=CC1=CC=CC=C1,0 -CC(C)CNCC(C)C,0 -BrC1=C(C=CC=C1)C2=CC=CC=C2,0 -NC1=CC=C(C=C1)S(=O)(=O)NC3=NC2=CC=CC(=C2N=C3)Cl,0 -CN2C(=O)N(C)C1=C(N=C[NH]1)C2=O,0 -COC=O,0 -OC(=O)C(O)=O,0 -ClC(Cl)(Cl)C(Cl)(Cl)Cl,0 -CSCCC(NC(=O)COC1=C(C=C(C(=C1)Cl)Cl)Cl)C(O)=O,0 -CCCCCCCCCCCCCCCCCCO,0 -OC(=O)CN(CC(O)=O)CC(O)=O,0 -CCCN(CCC)C(=O)SCC,0 -CC1=C(C=C(C=C1)NCCO)O,0 -CC=O,0 -CC1(C)C=C(C(O)=O)C(C)(C)N1O,0 -OC(O)=O,0 -CCCCCCC1CO1,0 -CCCCCC(=O)CC2=C1C(OC3=C(OC1=CC(=C2)O)C(=C(C(O)=O)C(=C3)O)CCCCC)=O,0 -COC1=C(C=C(C=C1)CC=C)OC,0 -CC1=CC(=CC=C1)OP(=O)(OC2=CC=CC=C2)OC3=CC=CC=C3,0 -[O-][N+](=O)C1=CC=C(C=C1)OC2=C(C=C(C=C2Cl)Cl)Cl,0 -O=C3OC2=C1C=COC1=CC=C2C=C3,0 -COC1=C(C(=CC(=C1)C(C)=O)OC)O,0 -COC1(CCCC1)OC5CCC6C4CCC3CC2SC2CC3(C)C4CCC56C,0 -OCC(O)COP(O)(O)=O,0 -CCCCCCNCCCCCC,0 -CSCCC=O,0 -OCCOCCO,0 -CN(C)C1=CC=C(C=C1)C(=C2C=CC(=N)C=C2)C3=CC=C(C=C3)N(C)C,0 -O=C1NC(=O)C2CC=CCC12,0 -CN1CCCC1=O,0 -C=CC1=NC=CC=C1,0 -CCCCC(CC)COP(=O)(OC1=CC=CC=C1)OC2=CC=CC=C2,0 -OC1=CC3=C(C=C1)C(=O)C2=C(C=CC(=C2)O)C3=O,0 -C3CCC2OCCOCCOCCOC1CCCCC1OCCOCCOCCOC2C3,0 -CCCCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1,0 -NCC(=O)NCC(=O)NCC(=O)NCC(O)=O,0 -OC1=C(C=CC=C1)C3=NC2=CC=CC=C2O3,0 -CCOP(=O)(CC)OCC,0 -CC(C)=CCC2C(=O)C(=O)C1=C(C=CC=C1)C2=O,0 -BrCC1=CC=C(C=C1)Br,0 -CC1=CC(=O)C=C(C)C1=O,0 -CC5CC2C(CC3=C[N](CC1CC1)C4=CC(=CC2=C34)Br)N(C)C5,0 -CC(=C)C(=O)OCCOCCOCCOC(=O)C(C)=C,0 -OC[P+](CO)(CO)CO,0 -OC2=CC1=C(C=C(C=C1C=C2)S(O)(=O)=O)S(O)(=O)=O,0 -CC(=O)OC3(CCC4C2C=C(Cl)C1=CC(=O)OCC1(C)C2CCC34C)C(C)=O,0 -C1=CC=C4C(=C1)N=C3C2=C(C=CC=C2)C6=C3C4=C5C=CC=CC5=N6,0 -CC1=CC=C(C=C1)N=NC3=C2C=CC=CC2=CC=C3O,0 -COC1=CC(=C(C(=C1)OC)Cl)N2C(=CC(=O)C(=C2C3=CC=C(C=C3)F)C)C4=CC=CC=C4,0 -COC1=CC=C(C=C1)C(Cl)=C(C2=CC=C(C=C2)OC)C3=CC=C(C=C3)OC,0 -ClCC1=C(C=CC=C1)CCl,0 -CCC(=C(CC)C1=CC=C(C=C1)OP(O)(O)=O)C2=CC=C(C=C2)OP(O)(O)=O,0 -CC1=NOC(=C1C)NS(=O)(=O)C2=CC=C(C=C2)N,0 -CCCCCCCCCCCCCCCCC1CO1,0 -COC(=O)C1=C(C)NC(=C(C1C2=C(C=CC=C2)[N+]([O-])=O)C(=O)OC)C,0 -OC1=CC=C(C=C1)CC=C,0 -ClC1=CC(=CC=C1)Cl,0 -CC1=C(C=C(C=C1)[N+]([O-])=O)NO,0 -CC3(O)CCC4C2CCC1CC(=O)C(CC1(C)C2CCC34C)C=O,0 -CC1=C(C(=CC=C1)C)NC2=NC(=NC(=C2)Cl)SCC(=O)NCCO,0 -CCOC(=O)C1=C(C=CC=C1)N,0 -CCCC(O)=O,0 -NC3=NC(=C2N=C(O)[N](C1CC(O)C(CO)O1)C2=N3)O,0 -ClC1=CC(=C(N=C1)OC2=CC=C(C=C2)OC3=C(C=C(C=N3)Cl)Cl)Cl,0 -COC1=C(C=CC(=C1)CCC(C)=O)O,0 -NC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)N,0 -NC(=O)C1=CC=C(C=C1)N,0 -CC=[N+](O)[O-],0 -OC(=O)CCC(=O)NC1=CC(=C(C=C1)Cl)Cl,0 -CCCC(C)(COC(N)=O)COC(=O)NC(C)C,0 -COC2=CC1=CC=C(C=C1C=C2)CCC(C)=O,0 -OC(=O)COC1=C(C=C(C(=C1)Cl)Cl)Cl,0 -OCCN(CCO)CCO,0 -OC(C1CC1)(C2=CC=C(C=C2)Cl)C3=CC=C(C=C3)Cl,0 -CC(=O)N(O)C1=CC=C(C=C1)Cl,0 -ClC1=C(C(=CC=C1)Cl)Cl,0 -CC(C)[N+](C)(CCOC(=O)C2C1=C(C=CC=C1)OC3=C2C=CC=C3)C(C)C,0 -ClC1=CC=C(C=C1)Cl,0 -COC1=C(C=CC(=C1)C=CC(O)=O)O,0 -CCCCCCC1=CC=C(C=C1)C2=CC=C(C=C2)C#N,0 -CCN1C=C(C(O)=O)C(=O)C2=C1C(=C(C(=C2)F)C3=CC=NC=C3)F,0 -CC1=CC=CO1,0 -OCC1OC(CC1O)N2C=C(CCCl)C(=O)NC2=O,0 -NC1=NC(=CC(=N1)Cl)Cl,0 -OC1=C(C=CC=C1)C(=O)OCC2=CC=CC=C2,0 -C2=NC=C1C=NN=CC1=C2,0 -FC1=CC=C(C=C1)C=CC(=O)C2=CC=CC=C2,0 -NC(=O)C1=C(C=CC=C1)C(N)=O,0 -CC(=O)NC1=CC=C(C=C1)CC2=CC=C(C=C2)N,0 -COC3=C1C(N(C(C2=CC=CC(=C12)C=C3)=O)C)=O,0 -CCCCOC(=O)C=C,0 -O=C1OCC=C1,0 -[O-][N+](=NC1=CC3=C(C=C1)C2=CC=CC=C2C3)C4=CC6=C(C=C4)C5=CC=CC=C5C6,0 -CC(CS)C1CCC(C)C(S)C1,0 -CC(=O)C1C(=O)OC(=CC1=O)C,0 -NC(=O)NN=CC(O)=O,0 -CCCCCCNC(=O)N1C=C(F)C(=O)NC1=O,0 -N#CCC#N,0 -CC(CCC(O)=O)C3CCC4C2CCC1CC(O)CCC1(C)C2CCC34C,0 -[O-][N+](=O)C1=C(C=CC=C1)C(F)(F)F,0 -COC1=C(C(=C(C(=C1Cl)Cl)[N+]([O-])=O)Cl)Cl,0 -CCCCN(N)CCCC,0 -CCOC(=O)OC(C1CC2CCN1CC2C=C)C4=C3C=C(C=CC3=NC=C4)OC,0 -BrC1=CC=C(C=C1)C2=CC=CC=C2,0 -ClCC(CCl)(CCl)CCl,0 -ClC1=CC=C(C=C1)C3=NC2=CC=CC=C2O3,0 -FC(F)(F)C(F)(F)C(Cl)Cl,0 -CN(C)CCN(CC1=CSC=C1)C2=NC=CC=C2,0 -CC1=C(C=C(C=C1)[N+]([O-])=O)N=[N+]([O-])C2=C(C=CC(=C2)[N+]([O-])=O)C,0 -O=C(C=CC=CC1=CC2=C(C=C1)OCO2)N3CCCCC3,0 -CC(O)CNCC(C)O,0 -CCN(CC)C1=CC(=C(C=C1)N=O)O,0 -COC1=CC=C(C=C1)OC,0 -NC1=CC(=C(C(=C1)C(O)=O)O)S(O)(=O)=O,0 -NC1=C(C=CC(=C1)S(O)(=O)=O)O,0 -CCOP(O)(OC1=CC(=C(C=C1)SC)C)=NC(C)C,0 -FC1=CC=C(C=C1)C(=O)C=CC2=CC=CC=C2,0 -CC(Br)C1=CC=CC=C1,0 -OCCN1CCNCC1,0 -COC1=CC=C(C=C1)C2=NOC(=C2C3=CC=C(C=C3)OC)CC(O)=O,0 -OC1=C(C=C(C=C1Cl)Cl)NC(=O)C2=C(C(=CC(=C2O)Cl)Cl)Cl,0 -[O-][N+](=O)C1=C(C=CC=C1)C=CC(=O)C2=CC=CC=C2,0 -OC(=O)C1=CC=CC=C1,0 -S=C(NC1CCCCC1)NC2CCCCC2,0 -OC1=C(C=C(C=C1Br)C#N)Br,0 -CC1(C)CC(C(O)=O)C(C)(C)N1O,0 -OC1=C(C(=CC(=C1)Cl)Cl)Cl,0 -CC13CCC(=O)CC1=C2CC2C4C3CCC6(C)C4C5CC5C67CCC(=O)O7,0 -CN2C(=O)CN=C(C1=CC=CC=C1)C3=C2C=CC(=C3)Cl,0 -CC5=CC4=C3C=CC2=C1C=CC=C(C1=CC=C2C3=CC=C4C=C5)C,0 -CCCCCOC(=O)C=C,0 -CCCCOC4=C2C1=CC=CC=C1C=CC2=C3CCC(C3=C4)=O,0 -CNC(O)=NO,0 -CC1=CC(=CC(=C1)C)C,0 -CNCC(O)C1=CC(=C(C=C1)O)O,0 -O2C1=CC=CC=C1N=C2C3=CC=CC=C3,0 -CCCCCCCCOC(=O)C1=C(C=CC=C1)C(=O)OCCCCCCCC,0 -O=C1CN(CC2N1CCC3=C2C=CC=C3)C(=O)C4CCCCC4,0 -OCC1=CC=CC=C1,0 -CCN(CC)CC,0 -BrC1=CC=C(C=C1)C(=O)C=CC2=CC=CC=C2,0 -NC1=CC3=C(C=C1)C(=C2C=CC(C=C2O3)=N)C4=C(C=CC=C4)C(O)=O,0 -BrCC1=CC(=CC=C1)CBr,0 -OC1=C(C(=CC=C1)Cl)Cl,0 -CNCCO,0 -O=C(OC1CCCCC1)C2=C(C=CC=C2)C(=O)OC3CCCCC3,0 -CN(C)C(=O)C1=N[N](C(=N1)CNC(=O)CN)C2=C(C=C(C=C2)Cl)C(=O)C3=C(C=CC=C3)Cl,0 -CC(=C)C(=O)OCCCCCCOC(=O)C(C)=C,0 -CC(CCO)CCC=C(C)C,0 -CCSC(Cl)=O,0 -NC1=C(C(=CC(=C1)Cl)Cl)O,0 -ClN1C(=O)NC(=O)N(Cl)C1=O,0 -C[N+](C)(C)NCCC(O)=O,0 -ClC1=CC=C(C=C1)C(C2=CC=C(C=C2)Cl)C(Cl)(Cl)Cl,0 -OC(=O)C2=NC1=CC=CC=C1C(=C2)O,0 -ClC2=C(Cl)C3(Cl)C1COS(=O)OCC1C2(Cl)C3(Cl)Cl,0 -OC2=CC1=NC=CC=C1C=C2,0 -CC(=O)C1=C(C=CC=C1)[N+]([O-])=O,0 -CCNS(=O)(=O)C1=CC=C(C=C1)C,0 -CC(Cl)(Cl)C(O)=O,0 -C1=CC=C(C=C1)C2=CC(=CC=C2)C3=CC=CC=C3,0 -COC1=C(C(=CC=C1Cl)Cl)C(O)=O,0 -CCOC(=O)C(C)=C,0 -NCCC1=C[NH]C=N1,0 -CC(COC(=O)C1=CC=CC=C1)(COC(=O)C2=CC=CC=C2)COC(=O)C3=CC=CC=C3,0 -OC(=O)C1=CC=C(C=C1)C(O)=O,0 -O=CC1=CC(=CC=C1)C2=CC=CC=C2,0 -NCCCCCCN,0 -CNCC(O)=O,0 -OC1=CC(=CC(=C1)O)O,0 -CC(=O)C1=CC3=C(C=C1)OC2(CC2)C3=O,0 -CC(=C)C(=O)OCC(C)(C)COC(=O)C(C)=C,0 -OC1=C(C(=C(C=C1[N+]([O-])=O)[N+]([O-])=O)O)[N+]([O-])=O,0 -CCC(C)C=O,0 -NC1=C(C=CC(=C1)C(F)(F)F)Cl,0 -CN(C)C,0 -CC(C)NC1=CC=CC=C1,0 -OC(=O)C1=CC=C(C=C1)N=NC2=CC(=C(C=C2)O)C(O)=O,0 -OC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)O,0 -CN(C)C1=CC=CC=C1,0 -ClC1=CC=NC=C1,0 -FC(Cl)(Cl)Cl,0 -CC1(C)SSCC(NC1=O)C(O)=O,0 -C2=CC1=CC5=C(C=C1C=C2)C4=CC=C3C=CC=CC3=C4C=C5,0 -CC1=CC=C(C=C1)C3=NC2=CC=CC=C2O3,0 -CCCCCCCOC1=C(C=CC=C1)NC(=O)OC(C)CN(CC)CC,0 -CC(CCC(O)=O)C3CCC4C2C(O)CC1CC(O)CCC1(C)C2CCC34C,0 -CCOP(=S)(OCC)OC1=CC2=C(C=C1)C(=C(Cl)C(=O)O2)C,0 -FC1=C(C(=C(C(=C1F)Cl)F)Cl)F,0 -COC1=CC=C(C=C1)CCl,0 -NC1=C(C(=CC=C1)[N+]([O-])=O)O,0 -O=C3CCC(N2C(=O)C1=C(C=CC=C1)C2=O)C(=O)N3,0 -NC(=N)C1=CC=CC=C1,0 -CC(=C)C1CC=C(C)C(=O)C1,0 -CN(C)C1=CC=C(C=C1)N=NC2=CN=CC=C2,0 -ClCC(=O)C1=CC=CC=C1,0 -NC(CCCCNCC(N)C(O)=O)C(O)=O,0 -OC(=O)CCC(O)=O,0 -CC34C=CC2=C1CCC(=O)CC1=CCC2C3CCC4O,0 -OC(=O)C1=CN=CC=C1,0 -CC1=CC=C(C=C1)C=O,0 -CC(=C)C1CC=C(C)C(O)C1,0 -C2CCCCCC1OC1CCCC2,0 -CC(C)CN,0 -CC(=O)C=CC1=CC=CO1,0 -CCC2=C1[NH]C=C(C1=CC=C2)CCO,0 -CC2CC(C)(C)C1=C(C=C(C(=C1)C(C)=O)C)C2(C)C,0 -CCCCCCCCCCCC(=O)N(CCO)CCO,0 -CNC(CC(O)=O)C(=O)N(C2C1SC(C)(C)C(N1C2=O)C(O)=O)C(C(N)=O)C3=CC=C(C=C3)O,0 -CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=CC=C3,0 -NC2=NC(=C1[NH]C=NC1=N2)N,0 -OC1COC2C(COC12)O[N+]([O-])=O,0 -CC(C)CC(=O)OCC=C,0 -CCCC(=O)OC1CCCCC1,0 -COC3=CC(=C2C(=O)OC1=CC(=CC(=C1C2=C3)C)O)O,0 -ClC1=NC(=NC(=C1)Cl)Cl,0 -[O-][N+](=O)C1=C(C=CC=C1)NC2=CC=CC=C2,0 -OC(=O)C3CC1=C([NH]C2=CC=CC=C12)C(N3)C4=CC=CC=C4,0 -OCCC#N,0 -CC(C)CC(NC(=O)COC1=C(C=C(C(=C1)Cl)Cl)Cl)C(O)=O,0 -OC(=O)CCCC1=C[NH]C2=CC=CC=C12,0 -COP(=O)(OC)SC,0 -CCCCCCCCCCCOC(=O)C1=C(C=CC=C1)C(=O)OCCCCCCCCCCC,0 -OCC1=CC3=C(C=C1)C(=O)C2=C(C=CC=C2)C3=O,0 -CN1CCCN(C)C1=O,0 -OC2(CCN(CCCC(=O)C1=CC=C(C=C1)F)CC2)C3=CC=C(C=C3)Cl,0 -ClC1=CC(=C(C=C1)C=O)Cl,0 -CC1=CC(=CC=C1)N,0 -CC1(C)C2CCC1(C)C(O)C2,0 -BrC1=CC=C(C=C1)C=CC(=O)C2=CC=CC=C2,0 -C=CCOC(=O)C=C,0 -CCCCCC=[N+](O)[O-],0 -CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCC,0 -CS(O)(=O)=O,0 -O=C3C(=O)C1=C(C=CC2=CC=CC=C12)C4=C3C=CC=C4,0 -CC(C)=CC1C(C(O)=O)C1(C)C,0 -NC2=CC1=CC=CN=C1C=C2,0 -CCCCOCCOP(=O)(OCCOCCCC)OCCOCCCC,0 -OC1=CC=C(C=C1)C(=O)C=CC2=CC=CC=C2,0 -OCC1=CC(=CC=C1)[N+]([O-])=O,0 -NC1=CC=C(C=C1)S(=O)(=O)NC2=NC=CS2,0 -ON=CC(=O)NC1=CC=CC=C1,0 -CC(C=O)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C,0 -CC(C)C1=CC(=C(C=C1)C)O,0 -CC(=O)CCC(C)=O,0 -OC(=O)CC1=C[NH]C2=CC=C(O)C=C12,0 -CCCCC(CC)COC(=O)C(C#N)=C(C1=CC=CC=C1)C2=CC=CC=C2,0 -CC(=O)CC(=O)CCC(O)=O,0 -OC(=O)C=CC1=CC(=C(C=C1)O)O,0 -OC2=C1N=CC=CC1=C(C=C2I)Cl,0 -CC(C)(C)C(=O)C(OC1=CC=C(C=C1)Cl)[N]2C=CN=C2,0 -CC3=C2C=C1C=CC=CC1=CC2=CC=C3,0 -OC1OCC=C2OC(=O)C=C12,0 -CC3=C2C1=CC(=CC(=C1C(OC2=CC(=C3)O)=O)O)O,0 -CC(=C)C(=O)OCCOCCOC(=O)C(C)=C,0 -CCCCC(CC)C=O,0 -CCC2=CN(C1CC(O)C(CO)O1)C(=O)NC2=O,0 -NS(=O)(=O)C1=C(C=C2C(=C1)S(NCN2)(=O)=O)Cl,0 -CC(C)C1=C(C=C(C=C1)C)O,0 -ClC1=CC(=CN=C1)Cl,0 -CCC2NC(=O)C1=C(C=C(C(=C1)S(N)(=O)=O)Cl)N2,0 -CN(C)C1=CC=C(C=C1)C=CC=O,0 -CC(C)NCC(O)COC2=C1C=CC=CC1=CC=C2,0 -O=CC1=CC=CC=C1,0 -CC(C(O)=O)C1=CC=C(C=C1)OC2=NC=CS2,0 -ClC2=C(C1=CC=CC=C1C(=C2Cl)Cl)Cl,0 -CCNCC#CC(C)(C)OC(=O)C(O)(C1CCCCC1)C2=CC=CC=C2,0 -O=C(C=CC1=CC=C(C=C1)C2=CC=CC=C2)C3=CC=CC=C3,0 -COC2=CC1=C(C=CN=C1C=C2)C(O)C3CC4CCN3CC4C=C,0 -ClCC1=CC(=CC=C1)CCl,0 -CCN=C=S,0 -NC1CCC(N)CC1,0 -OC1=C(C=CC=C1)C2=C(C=CC=C2)O,0 -FCC(F)(F)F,0 -FC(F)(F)C1=CC=CC=C1,0 -OC2=C(C1=CC=C(C=C1C=C2)S(O)(=O)=O)N=NC3=CC=C(C=C3)S(O)(=O)=O,0 -CC(CCC=C(C)C)CC=O,0 -ClCCN(CCCl)CCCl,0 -ClCC1=CC=C(C=C1)Br,0 -CCCCCCCCC1CO1,0 -O=C1CCCO1,0 -ClC1=C(C3=C(C(=C1Cl)Cl)OC2=C(C(=C(C(=C2Cl)Cl)Cl)Cl)O3)Cl,0 -CCOC(=O)C(C)=O,0 -CCCCCCCCC,0 -O=C1C=CC(=O)N1C2=CC=C(C=C2)CC3=CC=C(C=C3)N4C(=O)C=CC4=O,0 -FC1=CC=C(C=C1)C2OC2C(=O)C3=CC=CC=C3,0 -CCC1=CC=C(C=C1)C,0 -C2CC1OC1CCC3OC23,0 -CC1=CC(=CC=C1)Br,0 -CCSC(=O)N1CCCCCC1,0 -CN(C)CC1=CC=CC=C1,0 -CC1=CC(=CC=C1)C,0 -O(P(OC1=CC=CC=C1)OC2=CC=CC=C2)C3=CC=CC=C3,0 -ClC=CCl,0 -CSSC,0 -N#CC=CC#N,0 -CN3C(=O)C24CC1=CC=CC(O)C1N2C(=O)C3(CO)SS4,0 -OC(=O)C=CC=CC(O)=O,0 -C=CC(=O)N1CCN(CC1)C2=CC=CC=C2,0 -COC1=CC=C(C=C1)C=O,0 -ClC1=CC=C(C=C1)CSC2=CC=C(C=C2)Cl,0 -ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl,0 -CC1=C(SCCO1)C(=O)NC2=CC=CC=C2,0 -CCOC(=O)C(SP(=S)(OC)OC)C1=CC=CC=C1,0 -CCOP(=S)(OCC)OC1=NC(=NC(=C1)C)C(C)C,0 -CN3C(C(=O)NC1=NC=CC=C1)C(=O)C2=C(C=CS2)S3(=O)=O,0 -CCOP(=S)(OCC)SCSCC,0 -CCCCOCCOCCO,0 -COC1=CC=C(C=C1)CO,0 -OC3=C2C(=C1C(=CC=CC1=CC2=CC=C3)O)O,0 -CC1=C(C(=C(C(=C1C)[N+]([O-])=O)C(C)(C)C)[N+]([O-])=O)C,0 -CCCCCC(=O)OCC,0 -C[N]1C=CC=C1,0 -OC(C#N)C1=CC=CC=C1,0 -CC(O)C2C1SC(=C(N1C2=O)C(O)=O)C3CCCO3,0 -CCC(C)(C)C1=CC=C(C=C1)O,0 -OCC(O)C(O)C(O)C(O)CO,0 -ClC1=CC=C(C=C1)C=O,0 -FC1=C(C(=C(C(=C1F)F)Cl)F)F,0 -[O-][N+](=O)C1=CC=C(C=C1)C2OC2C(=O)C3=CC=CC=C3,0 -O=C(NC1=CC=CC=C1)NC2=CC=CC=C2,0 -CC(C)(C)C2=CC(=CC=C1C=C(C(=O)C(=C1)C(C)(C)C)C(C)(C)C)C=C(C2=O)C(C)(C)C,0 -CCC1(CC(O)=O)OCCC2=C1[NH]C3=C(C=CC=C23)C(C)O,0 -O[N+]([O-])=C=CC1=CC=CO1,0 -CC(C)C1CC=C(C)C2CC=C(C)CC12,0 -[O-][N+](=O)C1=C(C=CC=C1)CBr,0 -CC1(C)C2CCC(=C)C1C2,0 -N#CC1=CC=CC=C1,0 -OS(=O)(=O)C1=C(C=CC=C1)[N+]([O-])=O,0 -CCCCC(CC)COC(=O)CCCCC(=O)OCC(CC)CCCC,0 -CC(=O)NC1=CC=C(C=C1)CC(O)=O,0 -CC4SC5=C(C(O)=O)C(=O)C1=C(C=C(C(=C1)F)N2CCN(CC2)CC3=C(C)OC(=O)O3)N45,0 -CCCCCCCCOC1=CC=C(C=C1)C(O)=O,0 -CN(C)C1=CC=C(C=C1)C(C2=CC=CC=C2)C3=CC=C(C=C3)N(C)C,0 -N#CC(C#N)=C(C#N)C#N,0 -CC1=CN=CC=C1,0 -[O-][N+](=O)C2=C1C=CC=CC1=C(C3=CC=CC=C23)[N+]([O-])=O,0 -CCOCCO,0 -CN(C(C)=O)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)N(C)C(C)=O,0 -CC(C)CCCCCCCOC(=O)C(C)=C,0 -CCC(C(C)O)=[N+](O)[O-],0 -CCC34CCC1C(CCC2=CC(=O)CCC12)C3CCC4(O)C#C,0 -OCC2=C1C=CC=CC1=NC=C2,0 -OC2=CC1=CC=CN=C1C=C2,0 -NC1=C(C=CC=C1)C(=O)OCC=C,0 -NC1=NC=CC=C1,0 -CCCC=O,0 -CC(=O)CC(C)(C)NC(=O)C=C,0 -CCOP(=S)(OCC)SCCl,0 -ClC1=C(C(=CC=C1)C=O)Cl,0 -CCCCCCCCCCCCCCCCCCCC,0 -CC(=O)OCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C,0 -CC(C)COC(=O)CCCCC(=O)OCC(C)C,0 -OC(=O)C1=CC=C(C=C1)Cl,0 -CC(C)(N)C1CCC(C)(N)CC1,0 -CCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCC,0 -CC1=C(C=C(C(=C1)C)S(O)(=O)=O)N=NC3=C(C2=CC=CC=C2C(=C3)S(O)(=O)=O)O,0 -COC2=CC=C1[NH]C=C(CCNC(C)=O)C1=C2,0 -CC(C)NC1=NC(=NC(=N1)Cl)NC(C)C,0 -CC(C)COC(=O)CC1=CC=CC=C1,0 -CC(=C)C(=O)OC(C)(C)C,0 -COC(C)(C)CC(C)=O,0 -CC1=C(C=C(C(=N1)O)C#N)C2=CC=NC=C2,0 -CCOP(=O)(OCC)OC(=CBr)C1=C(C=C(C=C1)Cl)Cl,0 -COC1=CC=C(C=C1)CN(C)N=O,0 -CCOP(=S)(OCC)SCSC(C)(C)C,0 -FC1=C(C=CC=C1)C2=CC=CC=C2,0 -ClC2=CC1=CC=CC=C1C=C2,0 -OC(=O)C1CSCN1,0 -OC1=NSC2=CC=CC=C12,0 -NC1=C(C(=CC=C1)[N+]([O-])=O)CO,0 -N#CC1=CC(=CC=C1)C#N,0 -CCOC(=O)CNC(=O)CCCCSC2=C1N=C[NH]C1=NC=N2,0 -CCOCCOC(=O)C=CC1=CC=C(C=C1)OC,0 -CCCCCCCCCC=C,0 -CC(=O)CC(C)(C)O,0 -CCNC1=NC(=NC(=N1)N)Cl,0 -CC(C)=CCCC(C)=CCO,0 -CCCCC(CC)COC(=O)CCCCCCCCC(=O)OCC(CC)CCCC,0 -CC1=CC=C(C=C1)CO,0 -CCC(C)(C)OC,0 -ClC1=C(C=CC=C1)Cl,0 -CCOC1=C(C=CC=C1)N,0 -OCC1=CC4=C3C(=C1)C2=CC=CC=C2C3=CC=C4,0 -OCC1OC(CC1O)N2C=C(C=CBr)C(=O)NC2=O,0 -CC(=O)OC1=CC2=C(C=C1)C(=CC(=O)O2)CBr,0 -CCN(C(=O)N(CC)C1=CC=CC=C1)C2=CC=CC=C2,0 -CC(=O)NC1=CC=CC=C1,0 -CC1=CC(=CC=C1)OP(=O)(OC2=CC(=CC=C2)C)OC3=CC(=CC=C3)C,0 -CCNC(=O)NC1=CC(=C(C=C1)OCC(O)CNC(C)(C)C)C(C)=O,0 -OCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C,0 -ClC1=CC(=C(C(=C1)Cl)Cl)Cl,0 -CC(CCC(O)=O)C1CCC2C4C(CCC12C)C3(C)CCC(O)CC3CC4=O,0 -CCCCCCOC(=O)C(C)=C,0 -ClC1=CC=C(C=C1)N2C(=O)CCC2=O,0 -NC1=C(C=CC=C1O)C(O)=O,0 -CCCCOP(=O)(OCCCC)OCCCC,0 -C[N+]1=CC=C(C=C1)C2=CC=CC=C2,0 -CC(OC1=C(C=C(C=C1)Cl)Cl)C(O)=O,0 -[O-][N+](=O)C1=CC=C(C=C1)COC2=CC=CC=C2,0 -COC1=CC(=O)C=CC1=O,0 -CN(C)CCCN,0 -ON=CC1=CC=NC=C1,0 -OC(=O)CC1=CC(=CC=C1)[N+]([O-])=O,0 -CC1(C)C2CCC1(C)C(C)(O)C2,0 -C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=CC=C3,0 -CC(Br)(CCl)CBr,0 -COC1=CC(=C(C=C1)O)C(C)(C)C,0 -CCCCCNCCCCC,0 -OC1C(=O)C(=O)C1=O,0 -OCC1=CC=C(C=C1)C(F)(F)F,0 -OC2=C(C1=CC=CC=C1C=C2)N=NC4=C(C3=CC=CC=C3C=C4)S(O)(=O)=O,0 -CCOCC(O)=O,0 -CCC3=C2C1=CC=CC=C1C=CC2=CC4=CC=CC=C34,0 -CC(C)=C,0 -OC1=C(C=CC=C1[N+]([O-])=O)[N+]([O-])=O,0 -COC1=C(C2=C(C(=C1)OC)C(=O)C3(O2)C(C)CC(=O)C=C3OC)Cl,0 -O[N+]([O-])=C,0 -CCCCN(CC)CC,0 -NC(CCC(=O)NC1=CC=C(C=C1)[N+]([O-])=O)C(O)=O,0 -COP(=O)(OC)N1CCOCC1,0 -CC1=C(C=C(C=C1O)[N+]([O-])=O)[N+]([O-])=O,0 -[NH]1C=CC2=CC=CC=C12,0 -CCCCOC(=O)C1=C(C=CC=C1)C(=O)OCC2=CC=CC=C2,0 -FC(F)(F)C1=CC(=CC=C1)Cl,0 -OC2=C1C(C5=C(OC1=CC=C2)C=C4OC3OC=CC3C4=C5O)=O,0 -CC(C)CC(C)N,0 -CC(O)CN1CC(C)OC1=O,0 -CC1=CC(=C(C=C1)N)S(O)(=O)=O,0 -CC1=CC=C(C=C1)NC(=O)CBr,0 -[NH]1C=NC2=CC=CC=C12,0 -CCCCCCC(=O)OCC,0 -C1=CC3=C(N=C1)C2=NC=CC=C2C=C3,0 -CC(=O)NC1=CC=C(C=C1)CC2=CC=C(C=C2)NC(C)=O,0 -CC1=CC(=CC=C1)C#N,0 -NN(C1=CC=CC=C1)C2=CC=CC=C2,0 -CN(C)C1=CC=C(C=C1)C=CC(=O)C2=CC=CC=C2,0 -C=CN1CCCC1=O,0 -CC(C)CCCCCCCOP(=O)(OC1=CC=CC=C1)OC2=CC=CC=C2,0 -CC1=CC=C(C=C1)C(C)(C)C,0 -NC(=N)C1=CC=C(C=C1)C3=CC2=CC=C(C=C2[NH]3)C(N)=N,0 -CCCCC(CC)COC(=O)C1=C(C=CC=C1)C(O)=O,0 -CCN(CC)C(=O)NC1=CC(=C(C=C1)OCC(O)CNC(C)(C)C)C(C)=O,0 -CCCCCCCCCCCC=C,0 -S=C(NC1=CC=CC=C1)NC2=CC=CC=C2,0 -CCOC4=C2C1=CC=CC=C1C=CC2=C3CCC(C3=C4)=O,0 -CCCCCCCCCCCCCC=C,0 -OC(=O)C1=C(C=CC=C1)C(O)=O,0 -CC(=O)NC1=CC=C(C=C1)[N+]([O-])=O,0 -CN(C)[P+](O[N]1N=NC2=CC=CC=C12)(N(C)C)N(C)C,0 -CC(=C)C#N,0 -CCSCCC(N)C(O)=O,0 -CN(C)NC(=O)CCC(O)=O,0 -CSC(C)(C)C=NO,0 -CNC(=O)C1=CC(=CC=C1)NCC(=O)NCCC2=CC(=C(C=C2)OC)OC,0 -OC(=O)C1=CC=CO1,0 -ClC1=C(Cl)C(=O)C(=C(C#N)C1=O)C#N,0 -CC1=C(C=CC=C1)C#N,0 -CN(C)C(=S)N(C)C,0 -ClC1=CC(=O)C=CC1=O,0 -CCCCCCCCCC1=CC=C(C=C1)O,0 -CC([N]1C=CN=C1)=C(OCCOC2=CC=C(C=C2)Cl)C3=C(C=C(C=C3)Cl)Cl,0 -CC1=NC(=C(N=C1)C)C,0 -ONC1=CC=C(C=C1)Cl,0 -CC(CNC(=O)C1=CN=CC=C1)NC(=O)C2=CN=CC=C2,0 -CCOC(=O)CCl,0 -OC1=C(C=CC(=C1)Cl)Cl,0 -CC(C=CC(O)C1CC1)C2CCC3C(CCCC23C)=CC=C4CC(O)CC(O)C4=C,0 -CC1=C(N=CC=N1)C,0 -CCOC(=O)C1C(C=C(C)C)C1(C)C,0 -OC3N=C(C1=CC=CC=C1)C2=C(C=CC(=C2)Cl)NC3=O,0 -NCCS(O)(=O)=O,0 -CN1CCN(CC1)C3=CC=C2[NH]C(=NC2=C3)C5=CC=C4[NH]C(=NC4=C5)C6=CC=C(C=C6)O,0 -CC(CO)=[N+](O)[O-],0 -CC(C)NCC(O)COC3=C2C1=CC=CC=C1[NH]C2=CC=C3,0 -OCCOC(=O)C=C,0 -CC(C)(C)N(CCO)CCO,0 -C1CN=C(N1)C2=CC=C(C=C2)C4=CC3=CC=C(C=C3[NH]4)C5=NCCN5,0 -CCCCO,0 -CC1=C(C(=CC=C1)C)NC(=O)CN2CCCC2=O,0 -CCCCCOC1=CC(=CC=C1)NC(=O)OC2CCCCC2N3CCCC3,0 -CC(=O)NC1=CC(=CC=C1)C,0 -OC1=N[NH]C2=CC=CC=C12,0 -CCN(CC)C1=CC2=C(C=C1)C(=CC(O2)=O)C(F)(F)F,0 -CSCCC(NC=O)C(=O)NC(CC1=CC=CC=C1)C(O)=O,0 -CN(C)C1=CC=C(C=C1)C4CC2(C)C(CCC2(O)CCCO)C5CC=C3CC(=O)CCC3=C45,0 -[O-][N+](=O)C1=CC=C(C=C1)NC2=CC=C(C=C2)N=C=S,0 -CC1=CC(=C(C(=C1)CC2=C(C(=CC(=C2)C)C(C)(C)C)O)O)C(C)(C)C,0 -CC1SCC(NC1=O)C(=O)NC(CC2=C[NH]C=N2)C(=O)N3CCCC3C(N)=O,0 -CC(=O)NC1=CC=C(C=C1)OC2=CC=C(C=C2)NC(C)=O,0 -CON(C)C(=O)NC1=CC=C(C=C1)Br,0 -CC(=O)OC1=C(C=CC=C1)C(=O)OC2=C(C=CC=C2)C(O)=O,0 -CC1=CC(=C(C=C1)OP(=O)(OC2=C(C=C(C=C2)C)C)OC3=C(C=C(C=C3)C)C)C,0 -NC(=O)CN1CC(O)CC1=O,0 -CC(N)=S,0 -CCC1=NC=CN=C1,0 -CC(C)(S)C(=O)NC(CS)C(O)=O,0 -NN(CC1=CC=CC=C1)CC2=CC=CC=C2,0 -OC(=O)C(=O)NC1=CC(=CC=C1)C2=N[NH]N=N2,0 -OCCN1C(=O)N(CCO)C(=O)N(CCO)C1=O,0 -CC(=C)C1CCC(=CC1)C,0 -[O-][N+](=O)C1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl,0 -ClC1=CC(=CC=C1)C=O,0 -NC1=CC(=CC=C1)S(O)(=O)=O,0 -C1=CC=C(C=C1)C=CC2=CC=CC=C2,0 -O=C1OC(=O)C2=C1C=CC=C2,0 -COC(=O)C1=C(C=CC=C1)N,0 -OC(=O)C1CSCN1C(=O)C2CCC(=O)N2,0 -CNC(=O)N(C)C2=NC1=CC=CC=C1S2,0 -CCCCOC(=O)C1=C(C=CC=C1)C(=O)OC2CCCCC2,0 -COCCO,0 -CCCCCCCCCCCCC1CO1,0 -CNC(=O)NC,0 -COC1=CC=C(C=C1)NC2=CC=C(C=C2)OC,0 -[O-][N+](=O)C3=C2C=CC1=CC=CC=C1C2=CC4=CC=CC=C34,0 -CCCCOCC(O)=O,0 -NC1=C(C=CC=C1)Cl,0 -CN1CCNCC1,0 -COC(=O)CC(C)=O,0 -FC(F)(F)C(Cl)Br,0 -CCC(C)(C)C,0 -O=C(C=CC1=CC=CC=C1)C2=CC=C(C=C2)C3=CC=CC=C3,0 -CC(C)OC(C)=O,0 -CC3(C)C(C(=O)OC(C#N)C1=CC(=CC=C1)OC2=CC=CC=C2)C3(C)C,0 -CC(=O)C1=C2C(=CC(=C1)C(C)(C)C)C(CC2)(C)C,0 -NC2=C(C1=C(C=C(C=C1C=C2)S(O)(=O)=O)O)N=NC3=C(C=C(C=C3)[N+]([O-])=O)S(O)(=O)=O,0 -C1=NC=CN=C1,0 -[O-][N+](=O)C1=CC(=CC=C1)C(F)(F)F,0 -COC5=C1OC2C(C=CC3C4CC(=C1C23CCN4C)C=C5)O,0 -CC1=CC=CS1,0 -CC2CCC1C(OC(=O)C1=C)C3(C)C(=O)CC=C23,0 -OC1=C(C=CC=C1)[N+]([O-])=O,0 -NC1=CC(=C(C(=C1)Cl)Cl)Cl,0 -N(C1=CC=CC=C1)C3=C2C=CC=CC2=CC=C3,0 -OC1=C(C=C(C=C1)C2=CC=CC=C2)[N+]([O-])=O,0 -NC(=O)NNC(N)=O,0 -[O-][N+](=O)C1=C(C=CC(=C1)C(F)(F)F)Cl,0 -CCN(CC)C1=CC=C(C=C1)N=NC2=CC=CC=C2,0 -ON=C,0 -OC2=C1C=CC=CC1=NC=C2,0 -NCCN1CCNCC1,0 -O=C2C1=C(C=CC=C1)C3=C2C=CC=C3,0 -CC(C)(COC(=O)C=C)COC(=O)C=C,0 -CC(C)(Br)C(=O)NC1=CC=CC=C1,0 -CC(C)(OC1=CC=C(C=C1)C2CCCC3=C2C=CC=C3)C(O)=O,0 -CC(C)C1CCC(C)CC1OC(=O)C2=C(C=CC=C2)N,0 -OC1=C(C=C(C=C1Br)Br)C(=O)NC2=CC=C(C=C2)Br,0 -C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3,0 -COC(=O)NC2=NC1=CC(=CC=C1[NH]2)SC3=CC=CC=C3,0 -O=NN(C1=CC=CC=C1)C2=CC=CC=C2,0 -O=C2NC1=C(CCC1)C(=O)N2C3CCCCC3,0 -NC1=C(C=CC=C1)C(=O)OCC=CC2=CC=CC=C2,0 -C1CSCCO1,0 -O=C(C=CC1=CC=CC=C1)C2=CC=CC=C2,0 -CC1=CC2=C(C(=C1)O)C(=O)C=C(C2=O)C3=C(C4=C(C=C3C)C(=O)C=CC4=O)O,0 -CC1=NN(C(=O)C1)C2=CC=CC=C2,0 -NC1=CC(=CC=C1)C(F)(F)F,0 -NC(=O)C1=CC=[N+](C=C1)COC[N+]2=C(C=CC=C2)C=NO,0 -NCC=C,0 -COP(=S)(OC)OC1=C(C=C(C(=N1)Cl)Cl)Cl,0 -CC1OCCC2=C1C=C3C(=C2)C(C(C3(C)C)C)(C)C,0 -NC1=CC(=C(C=C1)N)S(O)(=O)=O,0 -CCC1=C(C=CC=C1)O,0 -CCCCCC(=O)OCC=C,0 -CC1=C(C=C(C=C1)N=[N+]([O-])C2=CC(=C(C=C2)C)[N+]([O-])=O)[N+]([O-])=O,0 -NN2C(=O)C1=C(C=CC=C1)C2=O,0 -CC(=O)C1=NC=CC=C1,0 -COC4=C1C(C5=C(OC1=C3C2CCOC2OC3=C4)C=CC=C5O)=O,0 -CCOCN(C(=O)CCl)C1=C(C=CC=C1C)CC,0 -CC(N)=O,0 -OC(=O)COC1=CC=C(C=C1)Cl,0 -NC1=CC(=C(C=C1)Cl)Cl,0 -ClC1=CN=CC=C1,0 -O=C1CNC(=O)N1,0 -CCCC(O)C(CC)CO,0 -CC(=O)C1=C(C=CC(=C1)N)OCC(O)CNC(C)(C)C,0 -OC1(CCCCC1)C#N,0 -O=C(C1=CC=CC=C1)C(=O)C2=CC=CC=C2,0 -C=CC(=O)OCCOCCOCCOCCOC(=O)C=C,0 -CC(C)C=O,0 -[O-][N+](=O)C1=C(C=CC=C1)C2=CC=CC=C2,0 -CS(=O)C1=CC=C(C=C1)Cl,0 -OCC1OC(CC1O)N2CC(=O)C(=N)NC2=O,0 -OC(=O)C(Cl)(Cl)Cl,0 -CCC1=C(C=CC=C1)[N+]([O-])=O,0 -NC(=N)NC(N)=NCCC1=CC=CC=C1,0 -CC1=CC(C)(C)NC2=C1C=CC=C2,0 -COP(=S)(OC)SCC(=O)NCC=O,0 -CC(C)OC(=O)COC1=C(C=C(C=C1)Cl)Cl,0 -CC(C)[N]2C1=CC=CC=C1C(=C2C=CC(O)CC(O)CC(O)=O)C3=CC=C(C=C3)F,0 -CCOC(C)(C)C,0 -CCCCCCCCCCCCC=C,0 -CCCCCCCCCC,0 -C1COCCOCCOCCOCCO1,0 -CC2=NC1=C(C=CC=C1)C2(C)C,0 -CCCCCCCCCC(O)=O,0 -CCC=O,0 -CCCCCCCCCC=CCC1CC(=O)OC1=O,0 -COC3=C(C=C2C1C(C5=C(OC1COC2=C3)C4=C(OC(C4)C(C)=C)C=C5)=O)OC,0 -COC1=CC(=O)C(=O)C(=C1)C(C)(C)C,0 -CC(=O)OCC(=O)NCCCOC1=CC(=CC=C1)CN2CCCCC2,0 -CC1=C(C=CC=C1)Br,0 -C[N+]1([O-])CCCC1C2=CN=CC=C2,0 -CC(C)NC(=O)NS(=O)(=O)C1=C(C=CN=C1)NC2=CC(=CC=C2)C,0 -CCNC3=C(C=C2C(=C1C=C(C(C=C1OC2=C3)=NCC)C)C4=C(C=CC=C4)C(=O)OCC)C,0 -O=C4C2=CC=C1N=C(SC1=C2C(=O)C5=CC=C3N=C(SC3=C45)C6=CC=CC=C6)C7=CC=CC=C7,0 -CC5=C2C1=CC=CC=C1C=CC2=C4C3OC3C(C(C4=C5)O)O,0 -CC(C)CC1NC(=O)CNC1=O,0 -OC2=CC1=CC=CC=C1N=C2,0 -CCOC(=O)C(CCC1=CC=CC=C1)NC(C)C(=O)N(CC(O)=O)C3CC2=C(C=CC=C2)C3,0 -CCCCN(CCO)CCCC,0 -ClNC1=NC(=NC(=N1)NCl)NCl,0 -CC1CN(CCN1)C3=C(C(=C2C(C(=CN(C2=C3)C4CC4)C(O)=O)=O)C)F,0 -OCC(O)CO,0 -CNC(=O)C1=CC=CC=C1,0 -CCC1=C(C=CC=C1)N,0 -OC(=O)C1=CC2=C(C=C1)C(=O)OC2=O,0 -CC(C)CC(C)NC1=CC=C(C=C1)NC2=CC=CC=C2,0 -O=C3OC2=C(C=C1C=COC1=C2)C=C3,0 -NC1=C(C=CC(=C1)Cl)Cl,0 -CCCCOC(=O)C=CC(=O)OCCCC,0 -CNNC,0 -O=C1C=CC(=O)C(=C1)C2=CC=CC=C2,0 -CC(N)CN,0 -CCOC2=C1N=CC=CC1=CC=C2,0 -CC1=C(C=CC=C1)C3=NC2=CC=CC=C2O3,0 -NC(N)=S,0 -BrCC1=CC=C(C=C1)CBr,0 -OC(=O)C(=O)C(O)=O,0 -OC(=O)C1=CC3=C(C(=C1)O)C(=O)C2=C(C=C(C=C2O)O)C3=O,0 -ClCC1=CC=NC=C1,0 -CC(N(C)C)C1=CC=CC=C1,0 -CC2COC1=C(C(=CC3=C1N2C=C(C(O)=O)C3=O)F)C4(N)CC4,0 -[O-][N+](=O)C1=CC=C(C=C1)NC2=CC=CC=C2,0 -O=C(OOC(=O)C1=CC=CC=C1)C2=CC=CC=C2,0 -CCC2=C1[NH]C3=C(C1=CC=C2)CCOC3(C)CC,0 -COC2=CC1=CC=C(C=C1C=C2)C(C)C(O)=O,0 -CN1C(CCC1=O)C2=CN=CC=C2,0 -CCCCCC=CC=CC=O,0 -COC1=C(C=CC(=C1)C3OC2=C(C(=CC(=C2)O)O)C(=O)C3=O)O,0 -COC(C)(C)C,0 -O=C2CCC1=C(C=CC=C1)O2,0 -CC=CC=CC(O)=O,0 -CCN(CC)S(=O)(=O)C1=CC=C(C=C1)N,0 -OCNC(=O)C=C,0 -CC(C)=CCCC(C)=CC=O,0 -CC2=NC1=CC=CC=C1N=C2,0 -CC(O)CCC(=O)C1=COC=C1,0 -CN(C)C(C)=O,0 -CN1CCOCC1,0 -CC(=C)OC(C)=O,0 -CCOC(=O)CC(C)=O,0 -OS(=O)(=O)C1=CC(=CC=C1)[N+]([O-])=O,0 -CSC(C)(C)C(=O)NC(CS)C(O)=O,0 -ClC1=NC(=NC(=N1)Cl)NC2=C(C=CC=C2)Cl,0 -CC1COC3=C2N1C=C(C(C2=CC(=C3N4CCN(C)CC4)F)=O)C(O)=O,0 -COC(=O)C(=CC1=CC=CO1)C#N,0 -CC(=C)C=C,0 -C1=CC=CC=C1,0 -CCCCC(CC)COCCCN,0 -[O-][N+](=O)C1=CC(=CC=C1)CBr,0 -CN(C)C=NC1=C(C=C(C=C1)Cl)C,0 -COC(=O)C1=C(C)NC(=C(C1C2=C(C=CC=C2)[N+]([O-])=O)C(=O)OCC(C)=O)C,0 -NCC1CCC(CC1)C(=O)C2=CC=C(C=C2)CCC(O)=O,0 -CCOC(=O)C1OC1C(=O)NC(CC(C)C)C(=O)NCCC(C)C,0 -CC1=CC(=O)OC2=C1C(=CC(=C2)O)O,0 -CN(C)C1=CC=C(C=C1)N=NC2=C(C=CC=C2)C,0 -CC(=O)NC1=CC=C(C=C1)OC(=O)C2=C(C=CC=C2)OC(C)=O,0 -C1CCC2(CC1)CO2,0 -NC(=S)NCC=C,0 -CC(CCC(O)=O)C3CCC4C2CCC1CC(O)CCC1(C)C2CC(O)C34C,0 -CC(=O)NC1=CC=C(C=C1)S(=O)(=O)NC2=NC=CC=C2,0 -CCCCCC(C)(O)C=CC1C(O)CC(=O)C1CC=CCCCC(O)=O,0 -CC(=C)C1=CC=CC=C1,0 -O=CC=CC1=CC=CO1,0 -CCCCCCCCCCCCCCCCCC(O)=O,0 -CCCCCCCCCCCCCCCCN,0 -CCNC1=NC(=NC(=N1)Cl)NCC,0 -COP(=S)(OC)OC,0 -ClC1=C(C(=C(C(=C1)Cl)Cl)Cl)Cl,0 -CCCC=[N+](O)[O-],0 -CNC1=CC=CC=C1,0 -OC(=O)C=C,0 -CCCCCCCCCCCCCCCCCCN,0 -COC1=CC2=C(C=C1)C(=CC(=O)O2)CBr,0 -CCC#N,0 -CC=C1CC2CC1C=C2,0 -CC(C)C(C)C,0 -COCC(O)=O,0 -CNC(=O)NC1=CC=CC=C1,0 -O2C1=C(C=CC=C1)SC3=C2C=CC=C3,0 -C=CC(=O)OCCOC(=O)C=C,0 -CC1=CC=C(C=C1)S(=O)(=O)NC2CCCCC2,0 -CCC(C)NC1=CC=C(C=C1)NC(C)CC,0 -CC(C)OC(=O)C(C)(C)OC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)Cl,0 -OC1=CC(=C(C=C1)Cl)Cl,0 -CCNC2=C(C=C1C(=CC(OC1=C2)=O)C)C,0 -CCOP(=O)(OCC)OC(=CCl)C1=C(C=C(C=C1)Cl)Cl,0 -OC1=NC(=NC(=N1)Cl)Cl,0 -COC1=CC=C(C=C1)C(=O)C=CC2=CC=CC=C2,0 -COC1=C(C=C(C(=C1)S(O)(=O)=O)C)N=NC3=C2C=CC(=CC2=CC=C3O)S(O)(=O)=O,0 -CC(=O)CC(=O)NC1=CC=C(C=C1)C,0 -CCCCNCC,0 -NS(=O)(=O)C1=C(C=C(C(=C1)C(O)=O)NCC2=CC=CO2)Cl,0 -CC(C)NCC(O)COC1=CC=C(C=C1)NC(C)=O,0 -CC(F)(F)F,0 -CCCCCCCCC=O,0 -C1=CC=C(C=C1)C2=CC=CC=C2,0 -FC(F)(F)C1=C(C=CC=C1)Cl,0 -CC(C)CC(=O)CC(C)C,0 -CCCCCC(C=O)=CC1=CC=CC=C1,0 -CN(C)CC(O)=O,0 -CCOC(=O)CC(=O)CCl,0 -OC(=O)COC1=CC=CC=C1,0 -BrC1=CC(=CC=C1)C2=CC=CC=C2,0 -CC1=C(C=CC=C1)C,0 -CCC1=C4C(=C(C2=CC=CC=C12)C)C3=CC=CC=C3C=C4,0 -CC(C)CCCCCCOC(=O)CCCCC(=O)OCCCCCCC(C)C,0 -OC1=C(C=CC=C1)O,0 -NC1=C(C=CC=C1)C(=O)OC2CCCCC2,0 -C1CCNC1,0 -CCCCN(CCCC)CCCC,0 -CC(C)C2=C(C)N(C)N(C1=CC=CC=C1)C2=O,0 -C(SCC1=CC=CC=C1)C2=CC=CC=C2,0 -COC(=O)C1=CC=CO1,0 -OC1=C(C=C(C=C1I)C#N)[N+]([O-])=O,0 -COC1=C(C=C(C=C1)C=O)OC,0 -O=C2C(=O)C1=C(C=CC=C1)C3=C2C=CC=C3,0 -CCO,0 -CC(=O)N=C1C=CC(=O)C=C1,0 -CC(C)(C)OOC(C)(C)C1=CC(=CC=C1)C(C)(C)OOC(C)(C)C,0 -CSC1=CC=C(C=C1)Cl,0 -O=C2C1=C(C=CC=C1)C6=C4C2=CC=C5C3=CC=CC=C3C(C(=C45)C=C6)=O,0 -OC1=CC=C(C=C1)C2(OC(=O)C3=C2C=CC=C3)C4=CC=C(C=C4)O,0 -ClCC1=CC=C(C=C1)CCl,0 -S=C1SSC2=NCCN12,0 -CC(O)C(C)O,0 -NCCO,0 -CCNC1=NC(=NC(=N1)Cl)NC(C)C,0 -OC(=O)CCC(=O)NC1=CC=C(C=C1)Cl,0 -OCC1NC(CC2=C1[NH]C3=CC=CC=C23)C(O)=O,0 -COC(=O)C=C,0 -CC(C)NC1=CC=C(C=C1)NC2=CC=CC=C2,0 -CCCC(=O)OCCC(C)C,0 -COC(=O)C1=C(C)NC(=C(C1C2=CC(=CC=C2)[N+]([O-])=O)C(=O)OCC=CC3=CC=CC=C3)C,0 -CCN=[N+]([O-])CC,0 -CNC(=O)OC2=C1OC(CC1=CC=C2)(C)C,0 -CN(C)C1=CC=NC=C1,0 -CCCCCCCCCCCC(=O)NCCO,0 -CC(=C)C(O)=O,0 -CC1=CC(=CC(=C1)C)N=NC3=C2C=CC=CC2=CC=C3O,0 -CCCCCCCC1CCC(=O)O1,0 -NC1=CC(=C(C=C1)O)C(O)=O,0 -CCOP(=O)(C#N)N(C)C,0 -CC(C)(C)C1=C(C(=CC(=C1)C=CC2=CC(=C(C(=C2)C(C)(C)C)O)C(C)(C)C)C(C)(C)C)O,0 -NC1=C(C=C(C=C1Cl)Cl)Cl,0 -OC(=O)CS,0 -CC(C)COC(=O)C=C,0 -CC1(C)CC(N)CC(C)(CN)C1,0 -CC1=C(C=C(C=C1)NO)[N+]([O-])=O,0 -ClC(Cl)=C(Cl)C1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl,0 -CNC(=O)OC1=CC=CC=C1,0 -NC1=CC=C(C=C1)C=CC(O)=O,0 -OC2(O)C(=O)C1=C(C=CC=C1)C2=O,0 -CC1=N[N](C(=C1)C)C2=C4C(=C(N=N2)NN)C3=CC=CC=C3[NH]4,0 -NC1=NC(=NC(=N1)N)N,0 -CC1=C(C(=C(C=C1)C)C)C,0 -CC1=C(C(=C(C(=C1C)N)C)C)N,0 -CC(C)COC(=O)C1=C(C=CC=C1)N,0 -CCOC1=C(C=CC=C1)OCC2CNCCO2,0 -CC1=CC=C(C=C1)NC(N)=O,0 -OC(=O)CCl,0 -OC(=O)C1CSC(N1C(=O)CCS)C2=C(C=CC=C2)O,0 -CC2=NC1=CC=CC=C1S2,0 -[O-][N+](=O)C1=CC=C(C=C1)S(=O)(=O)NC2=NC=CC=C2,0 -CC1(C)CCCC(C)(C)N1O,0 -CCCCCCCCCCC=CC1CC(=O)OC1=O,0 -CCOP(=O)(OCC)OC1=C(C=C(C(=N1)Cl)Cl)Cl,0 -CC(O)C(O)=O,0 -NCCCCC(NC(CCC1=CC=CC=C1)C(O)=O)C(=O)N2CCCC2C(O)=O,0 -NC1=CC(=C(C=C1)C=CC2=C(C=C(C=C2)N)S(O)(=O)=O)S(O)(=O)=O,0 -C1CN(CCO1)SC3=NC2=CC=CC=C2S3,0 -CCCCOCCOC(=O)COC1=C(C=C(C=C1)Cl)Cl,0 -CCOC(=O)C(CCC1=CC=CC=C1)NC(C)C(=O)N3C2CCCCC2CC3C(O)=O,0 -OC1=C(C=CC=C1)C=O,0 -ClC1=CN=C(C=C1)Cl,0 -CCC(=O)NC1=CC(=C(C=C1)Cl)Cl,0 -N#CCCNCCC#N,0 -COC(=O)C(C)(C)OC1=CC=C(C=C1)C2=CC=C(C=C2)Cl,0 -CCCNCCC,0 -CCCCCCC(CC=CCCCCCCCC(=O)OC)OC(C)=O,0 -[O-][N+](=O)C1=C(C(=CC(=C1)C(F)(F)F)[N+]([O-])=O)Cl,0 -CCOC(=O)CC(SP(=O)(OC)SC)C(=O)OCC,0 -OCC3OC1C(OC2=NC(=N)C=CN12)C3O,0 -OC(C(COC(=O)CCC(O)=O)NC(=O)C(Cl)Cl)C1=CC=C(C=C1)[N+]([O-])=O,0 -CC(C)(C)C(=O)C2C(=O)C1=C(C=CC=C1)C2=O,0 -CC(=O)NS(=O)(=O)C1=CC=C(C=C1)N,0 -CC(=C)C(=O)OCCOC(=O)NNC(=O)OCCOC(=O)C(C)=C,0 -FC1=CC=C(C=C1)C(=O)CCCN2CCN(CC2)C3=NC=CC=C3,0 -CNCCS(O)(=O)=O,0 -[O-][N+](=O)C1=C(C=CC=C1)C#N,0 -CC=C(C)C#N,0 -OC(=O)C1=C(C=CC(=C1)N=NC2=CC=C(C=C2)S(=O)(=O)NC3=NC=CC=C3)O,0 -CCCCCCCCC1OC1CCCCCCCC(=O)OCC(CC)CCCC,0 -O=C(C1=CC=CC=C1)C2=CC=CC=C2,0 -BrCCCBr,0 -CC(=O)OC(C)(C)C3CC2=C(C=C1OC(C(=CC1=C2)C(C)(C)C=C)=O)O3,0 -OC1=C5C(=CC=C1)C4=CC3=C2C=CC=CC2=CC=C3N=C4C=C5,0 -CN3CCC14C5OC2=C1C(=CC=C2O)CC3C4C=CC5O,0 -NC1=C(C=CC=C1)C(F)(F)F,0 -CN(C)CCN(CC1=CC=C(S1)Cl)C2=NC=CC=C2,0 -C2COCCOC1=C(C=CC=C1)OCCOCCO2,0 -CC1CS1,0 -CC(CCC(O)=O)C3CCC4C2CCC1CC(O)CCC1(C)C2CC(=O)C34C,0 -OC1=C(C=C(C(=C1)Cl)O)Cl,0 -OCC(CO)NC1CC(O)(CO)C(O)C(O)C1O,0 -CC(=O)NC1=CC=C(C=C1)S(N)(=O)=O,0 -CCCCCCCCC1=CC=C(C=C1)NC2=CC=C(C=C2)CCCCCCCC,0 -CCOC(=O)C(=C)C#N,0 -CC1=CC(=O)C=CC1=O,0 -CC34CCC1C(CCC2=C1C=CC(=C2)O)C35CCC4(O)C(O)C5,0 -OC3C(O)C1=C(C=CC2=CC=CC=C12)C4=C3C=CC=C4,0 -CC(=C)C(=O)OCCCCOC(=O)C(C)=C,0 -OC(=O)C1=CC(=CC=C1)Cl,0 -OC(=O)C(Cl)CCl,0 -CNS(=O)(=O)C1=CC=C(C=C1)N,0 -CC(C)NC(C)C,0 -OC1=C(C(=C(C(=C1)Cl)Cl)Cl)Cl,0 -BrCC#N,0 -OCNC(=O)CCl,0 -CCCCCCCCC=CCCCCCCCC(O)=O,0 -CC1=C(C=C(C(=C1)N)S(O)(=O)=O)Cl,0 -OC1=CC=C(C=C1)[N+]([O-])=O,0 -NC(=O)NCC(O)=O,0 -CN1CCN(C)CC1,0 -CN(C)N=NC1=CC=C(C=C1)C(O)=O,0 -CC(OC1=C(C=C(C=C1)Cl)C)C(O)=O,0 -ClC2=C(N=C1C=CC=CC1=N2)Cl,0 -CN(C)CCN(C)C,0 -OC=O,0 -CCCCCCOC(=O)C=C,0 -COC1=C(OC)C(=O)C(=CC1=O)C,0 -COC(=O)C1=C(C2=C(C(=C1)OC)OCO2)C3=C(C=C(C4=C3OCO4)OC)C(=O)OC,0 -C1CC3=C2C1=CC=CC2=CC=C3,0 -OC(=O)C=CC1=CN=C[NH]1,0 -N(C1=CC=CC=C1)C3=CC2=CC=CC=C2C=C3,0 -CC(C)CC1=CC=C(C=C1)C(C)C(O)=O,0 -COC(=O)NC2=NC1=CC(=CC=C1[NH]2)C(=O)C3=CC=C(C=C3)F,0 -OC(=O)C1=C(C=CC=C1)NC2=CC(=CC=C2)C(F)(F)F,0 -ClC1=CC=C(C=C1)C(=C(Cl)Cl)C2=CC=C(C=C2)Cl,0 -CC(C)N,0 -OCC1CCCO1,0 -CC(O)C(C)=O,0 -CC2C(C)(C)C1=C(C(=O)CCC1)C2(C)C,0 -CC2C(C)(C)C1=C(C=C(C(=C1)C)C(C)=O)C2(C)C,0 -CCCCCC,0 -CCCSSCC=C,0 -C[N]2C(=NC3=NC1=CC=NC=C1C=C23)N,0 -NC1=CC=C(C=C1)S(N)(=O)=O,0 -NC1=C(C(=CC(=C1)Cl)S(O)(=O)=O)O,0 -ClC1=CC=CC=C1,0 -COC(=O)C1=CC=CC=C1,0 -CC4=C2C1=CC=CC=C1C=CC2=C3CCCC3=C4,0 -CCNCC,0 -CCC(C1=CC=C(C=C1)O)=C(CC)C2=CC=C(C=C2)O,0 -CC(=O)NC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)NC(C)=O,0 -COC(=O)CCl,0 -CC(=C)C(C)=O,0 -CC(C)OC1=CC=C(C=C1)NC2=CC=CC=C2,0 -CC1=CC(=O)C(=CC1=O)C,0 -O=C3N2CC1=C(C=CC=C1)C(=O)N2CC4=C3C=CC=C4,0 -CCCCCCCCOC(=O)C(C)=C,0 -CC(C)OC(=O)CCl,0 -CC(C)(O)C#N,0 -CC1=C(C=CC(=C1)Cl)OCC(O)=O,0 -CC(C)NCC(O)COC2=C1OCC(CC1=CC=C2)O,0 -[O-][N+](=O)C1=CC=C(C=C1)CNC3=C2[NH]C=NC2=NC=N3,0 -CC(=O)OC(C)=O,0 -CC(C)(C)CBr,0 -OC(=O)COC1=C(C=C(C=C1)Cl)Cl,0 -NC1=C(N=CC(=C1)C2=CC=NC=C2)O,0 -CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C,0 -BrCC1=C(C=CC=C1)CBr,0 -CC(C)OP(C)(F)=O,0 -O=C1C(=O)C4=C3C2=C1C=CC=C2C=CC3=CC=C4,0 -CC(C)(C)CC(C)(S)CC(C)(C)C,0 -C=CCOC(=O)C1=C(C=CC=C1)C(=O)OCC=C,0 -OC1=CC2=C(C(=C1)O)C(=O)C=C(O2)C3=CC(=C(C=C3)O)O,0 -OCC1OC(CC1O)[N]2C=NC3=C2N=C[N]4C=CN=C34,0 -CN(C)P(=O)(N(C)C)N(C)C,0 -CC(=O)NC2=CC1=CC=CC=C1N=C2,0 -CC(O)C1=CC=CC=C1,0 -[O-][N+](=O)C1=CC=C(C=C1)C#N,0 -NCCNCCN,0 -CC(CC(O)=O)C(O)=O,0 -CCCCCCCCCCCCOCC1CO1,0 -OCC1=CC=CO1,0 -CCC=CCCC=CC=O,0 -CN1CCC(=CC1)C2=CC=CC=C2,0 -ClCC#N,0 -OC(=O)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)Cl,0 -COCCCN,0 -N2C1=C(C=CC=C1)SC3=C2C=CC=C3,0 -CC3(C)SC2C(NC(=O)C(N)C1=CC=CC=C1)C(=O)N2C3C(O)=O,0 -CC(C)(C)[N+]([O-])=O,0 -CC(C)C(O)CCC(C)C1CCC2C(CCCC12C)=CC=C3CC(O)CC(O)C3=C,0 -OC(=O)CC1=C(C=CC=C1)Cl,0 -OC2=CC1=CC=C(C=C1C=C2)SSC4=CC3=CC=C(C=C3C=C4)O,0 -CC(=O)OCC1=CC2=C(C=C1)OCO2,0 -CN(C)C#N,0 -CCCCC(CC)COC(=O)C1=CC=C(C=C1)C(=O)OCC(CC)CCCC,0 -O=C1CCC(=O)O1,0 -COC(=O)C1=CC=C(C=C1)C=O,0 -CC(=O)C=CC1=CC2=C(C=C1)OCO2,0 -COC1=CC(=CC=C1)[N+]([O-])=O,0 -OCC1OC(C(O)C1O)[N]4C=NC5=C(NCC(O)COC3=C2C=CC=CC2=CC=C3)N=CN=C45,0 -C1=CC=C(C=C1)C(C2=CC=CC=C2)C3=CC=CC=C3,0 -CC1=CCC(CC1)C(C)(C)O,0 -COC1=C(C=C(C=C1)C(=O)N2CCN(CC2)C3=CC4=C(C=C3)NC(=O)CC4)OC,0 -NC(=N)C1=CC=C(C=C1)OCCCCCOC2=CC=C(C=C2)C(N)=N,0 -OCC1=C(C=CC=C1)[N+]([O-])=O,0 -CC(=O)NC3=C(C=C2C1=CC=CC=C1CC2=C3)O,0 -CC(=O)C1=C(C=CC(=C1)NC(=O)NC(C)(C)C)OCC(O)CNC(C)(C)C,0 -BrCC(=O)NC1=CC=CC=C1,0 -C2CC=CCCC1OC1CCC=C2,0 -CC(=O)NC1=CC(=CC=C1)O,0 -C=CCNCC=C,0 -C[N]1C=NC2=C1C(N(C(N2C)=O)C)=O,0 -ClC1=C(C=C(C=C1)C=O)Cl,0 -CC(C)NCC(O)COC2=C1OCC(CC1=CC=C2)O[N+]([O-])=O,0 -CC=NN(C)C=O,0 -CC2=C(C=C1C=CC=CC1=C2)[N+]([O-])=O,0 -CC(C)(C)C1=C(C(=CC(=C1)CC2=CC(=C(C(=C2)C(C)(C)C)O)C(C)(C)C)C(C)(C)C)O,0 -C1CN(CCN1)C2=CC=CC=C2,0 -FC1=NC(=CC=C1)F,0 -CCCCCCCCCCCCCCC1CO1,0 -ClC1=CC(=C(C=C1)Cl)Cl,0 -C1CNCCN1,0 -CC=C1CC(C)C(O)(CO)C(=O)OCC2=CC[N+]3([O-])CCC(OC1=O)C23,0 -CC1=C(C=CC=C1)Cl,0 -CCC1=C4C(=C(C2=CC=CC=C12)CC)C3=CC=CC=C3C=C4,0 -CCSCCOP(=S)(OC)OC,0 -CCOC(=O)C(Cl)C(C)=O,0 -CC2=C1C=CC=CC1=C3C(=C2)C4=C(C=C3)C(O)C(O)C5OC45,0 -NC1=CC=C(C=C1)Br,0 -C1COCCOCCOCCO1,0 -O=C1CCCCCN1,0 -[O-][N+](=O)C1=C(C(=C(C(=C1)Cl)Cl)Cl)Cl,0 -OCC1OC(C(O)C1O)N2CC(=O)C(=N)NC2=O,0 -OCCCC1=CC=CC=C1,0 -CC1=NC(=NC(=C1)C)SC(=O)OC(C)(C)C,0 -OC(=O)C=CC1=CC=CC=C1,0 -CCOP(=O)(OCC)OC1=NOC(=C1)C2=CC=CC=C2,0 -CC(O)=O,0 -N#CCC1=CC=CC=C1,0 -CC1(C)N(Cl)C(=O)N(Cl)C1=O,0 -CCC(C)=O,0 -OC1=C(C(=C(C(=C1Br)Br)Br)Br)Br,0 -CCN(CC)C1=CC2=C(C=C1)C(=CC(=O)O2)C,0 -NCCCNCCCN,0 -CCOC1=C(C=CC(=C1)C=O)O,0 -CN1N(C(=O)C=C1C)C2=CC=CC=C2,0 -COC1=C(C=C(C(=C1)OC)C=O)OC,0 -CCCNC(=O)NS(=O)(=O)C1=CC=C(C=C1)Cl,0 -CC(NC(=O)COC1=C(C=C(C=C1)Cl)Cl)C(O)=O,0 -C[N]2C(=NC3=NC1=CC=CN=C1C=C23)N,0 -OS(=O)(=O)C2=C1N=CC=CC1=CC=C2,0 -CC1=NC2=C(C=N1)CCC2,0 -CN(C1CCN(CC1)C3=NC2=CC=CC=C2[N]3CC4=CC=C(C=C4)F)C5=NC(=CC=N5)O,0 -OC1=CC=C(C=C1)C3CC(=O)C2=C(C=C(C=C2O)O)O3,0 -CC(=O)C(=O)C1=CC=CC=C1,0 -O=C(CN1C(=O)SC2=C1C=CC=C2)OCC3=CC=CC=C3,0 -ClC1=C(Cl)C(Cl)(Cl)C(=C1Cl)Cl,0 -BrCC(=O)C1=CC=CC=C1,0 -CCCCCCC=O,0 -O2C1=CC=CC=C1C3=CC=CC=C23,0 -CC1=CC=C(O1)C=O,0 -C2CCCC1OC1CC2,0 -C1COCCN1,0 -OC2=NC1=CC=CC=C1O2,0 -NC2=C(C1=CC=CC=C1C=C2)N=NC3=CC=CC=C3,0 -O=CNC1=CC=CC=C1,0 -CCSCCSP(=S)(OC)OC,0 -COP(O)(SC)=NC(C)=O,0 -CC(C)(C)OOC(C)(C)CCC(C)(C)OOC(C)(C)C,0 -CC1=C(C=C(C=C1)Cl)[N+]([O-])=O,0 -CCOC(=O)C1OC1(C)C2=CC=CC=C2,0 -COC(=O)CCC(=O)OC,0 -CCCCCCCOC1=C(C=CC=C1)NC(=O)OCCN2CCCCC2,0 -CC(=C)C1=C(C=C(C(=C1)O)C)O,0 -O1C=CC2=CC=CC=C12,0 -CC(=O)C1=CC=CC=C1,0 -CCCCSCCC(N)C(O)=O,0 -OCC1=CC=C(C=C1)[N+]([O-])=O,0 -CC(C)(C)OC(=O)ON=C(C#N)C1=CC=CC=C1,0 -CCCOC(=O)C(C)=C,0 -CC(=O)[N]1C=CN=C1,0 -OC(=O)C2=NC1=C(C=CC=C1C(=C2)O)O,0 -ON=CC=NO,0 -N#CCCC#N,0 -NC1=CC=C(C=C1)S(O)(=O)=O,0 -OC2=C1C=C(C(OC1=CC=C2)=O)C4CCC3=C(C=CC=C3)C4,0 -CC1=CC(=O)OC2=C1C=CC(=C2)N,0 -CC(=O)NC1=C(C3=C(C=C1)C2=CC=CC=C2C3)O,0 -CC(O)CN(CCN(CC(C)O)CC(C)O)CC(C)O,0 -CCCCOCCOCCOCC2=C(C=C1OCOC1=C2)CCC,0 -CC(=O)OC1=CC=C(C=C1)CO,0 -CO,0 -COCCOCCOC,0 -CCC(=O)C(C)=O,0 -CC1(C)CC(C(N)=O)C(C)(C)N1O,0 -CC1=C(C=CC(=C1)Cl)OCCCC(O)=O,0 -O=C1OC(=O)C=C1,0 -CCCCC(CC)CN,0 -CC(C)C1=CC3=C(C=C1)OC2=C(C=C(C(=N2)N)C(O)=O)C3=O,0 -FC(F)(F)C1=CC=C(C=C1)Cl,0 -CC1=NN=C(S1)NS(=O)(=O)C2=CC=C(C=C2)N,0 -CCN(CC)S(=O)(=O)C1=CC=C(C=C1)NC(C)=O,0 -OC1=CC2=C(C=C1)OCO2,0 -CCC(C)C(C)CO,0 -OC1(O)C(=O)NC(=O)NC1=O,0 -NC(CC(O)=O)C(O)=O,0 -CC(C)OC(=O)C(C)=C,0 -COC1=C(C=CC(=C1)C=C)O,0 -CCCCCCCCCCC,0 -CC(=O)OC1=C(C=CC=C1)C(O)=O,0 -CCCCOC(=O)C1=C(C=CC=C1)N,0 -CC3=C(C2=C1C=CC=CC1=CC=C2C=C3)C,0 -NC(=O)C1=CN=CC=C1,0 -CC2(C)C3CCC1(CO1)C2C3,0 -BrC1=CC=CC=C1,0 -CCCCCCCCCCCCCC(O)=O,0 -NC(C#N)C(=N)C#N,0 -ClC2=NC1=CC=CC=C1C=C2,0 -OC1=CC(=C(C=C1)N=NC2=CC=C(C=C2)[N+]([O-])=O)O,0 -O=C4C=CC3=C2C=CC1=CC=CC=C1C2=CC=C3C4=O,0 -CC1=CC=C(C=C1)C(=O)C2=CC(=C(C(=C2)O)O)[N+]([O-])=O,0 -CN(C)C1=CC=C(C=C1)C4CC2(C)C(CCC2(O)C=CCO)C5CC=C3CC(=O)CCC3=C45,0 -CCCC(C1=C(C=C(C(=C1)C(C)(C)C)O)C)C2=C(C=C(C(=C2)C(C)(C)C)O)C,0 -CN(C)CCO,0 -OC1=C(C=C(C=C1)Cl)Cl,0 -OC(=O)C2=C1N=CC=CC1=CC=C2,0 -C1=CC=NC=C1,0 -ON=CC1=NC=CC=C1,0 -OCCOC1=C(C=C(C(=C1)Cl)Cl)Cl,0 -OCCO,0 -OS(=O)(=O)C1=C(C=C(C=C1)[N+]([O-])=O)[N+]([O-])=O,0 -OC1=C(C=C(C=C1)[N+]([O-])=O)[N+]([O-])=O,0 -CCN(CC)C(=O)CC1=CC=CC=C1,0 -OC1COC(O)(CN(CC(O)=O)N=O)C(O)C1O,0 -C[N+]1=CC=C(C=C1)C2=CC=[N+](C=C2)C,0 -COC4=C1C5=C(C(OC1=C3C2CCOC2OC3=C4)=O)C(OCC5)=O,0 -CC(C)CCCCCCCOC(=O)C1=C(C=CC=C1)C(=O)OCCCCCCCC(C)C,0 -CC(=O)OCC1=CC=CC=C1,0 -OC2=CC=C1[NH]C=CC1=C2,0 -CC(Br)Br,0 -COC(=O)C1=C(C)NC(=C(C1C2=C(C(=CC=C2)Cl)Cl)C(=O)OC(C)C)COC(N)=O,0 -OCC(CO)(CO)CO,0 -OC1=CC(=CC(=C1)Cl)Cl,0 -CC1=C(C=C(C=C1)N)Cl,0 -CCCCCCCCCCOC(=O)C(C)=C,0 -COC1=CC(=CC(=C1)OC2=C(C=C(C=C2)Cl)Cl)[N+]([O-])=O,0 -ClC1=CC=C(C=C1)NC(=O)NC2=CC(=C(C=C2)Cl)Cl,0 -C=CC1CCC=CC1,0 -NCCC1=C[NH]C2=CC=C(O)C=C12,0 -COC1=C(C=CC(=C1)C=O)O,0 -COP(=O)(OC)OC(=CCl)C1=C(C=C(C(=C1)Cl)Cl)Cl,0 -CC(C=O)=CC1=CC=CC=C1,0 -CC(C)C1=CC3=C(C=C1)C2=CC=CC(=C2C=C3)C,0 -OC1=CC=C(C=C1)C2(CCCCC2)C3=CC=C(C=C3)O,0 -COC(=CC(O)=O)C(=O)C(C)=C,0 -C=CC(=O)OCCOCCOC(=O)C=C,0 -C=CC(=O)OCCCCCCOC(=O)C=C,0 -OCC=O,0 -CN(C)C=O,0 -COC2=C1OC3=C(C(C1=C(C=C2)O)=O)C(=CC5=C3C4CCOC4O5)OC,0 -CC(C)CCCCCCOC(=O)C1=C(C=CC=C1)C(=O)OCCCCCCC(C)C,0 -C1COCCOCCOCCOCCOCCO1,0 -CC1CCCC(C)N1CCCC(O)(C2=CC=CC=C2)C3=NC=CC=C3,0 -CC(C)COC(=O)C1=C(C=CC=C1)C(=O)OCC(C)C,0 -CCCCCCCCCCCCCl,0 -CNC(=O)N(C1=CC=CC=C1)C2=CC=CC=C2,0 -CCCCCC(O)=O,0 -CCCCC(CC)COP(OCC(CC)CCCC)OCC(CC)CCCC,0 -OC2=NC1=CC=CC=C1C=C2,0 -OC1=C(C(=C(C=C1)Cl)Cl)Cl,0 -OCC1=CC=C(C=C1)Br,0 -CC1=NC=CC=C1,0 -COC1=C(C2=C(C=C1O)OC(=CC2=O)C3=CC=C(C=C3)O)O,0 -CC(C)NCC(O)COC1=C(C=CC=C1)OCC=C,0 -CCCCCC1=CC(=CC(=C1)O)O,0 -C=CC(=O)OCCCCCOC(=O)C=C,0 -CC(=O)C(C)=NO,0 -CCC1(CC(O)=O)OCCC2=C1[N](C3=CC=CC=C23)C,0 -COC3=C1C=COC1=NC4=C(O)C2=C(OCO2)C(=C34)CC=C(C)C,0 -COC3=C(C=C2C16CCN7CC5=CCOC4C(C1N(C2=C3)C(C4)=O)C5CC67)OC,0 -OC(=O)COC2=CC1=CC=CC=C1C=C2,0 -CCC=CC#N,0 -CC1=C(C=CC(=C1C)N)N,0 -OC1=C2C=CC3=CC=CC4=CC=C(C=N1)C2=C34,0 -CNCC1=CC=C(O1)CSCCNC(NS(C)(=O)=O)=NCC(O)C2=CC=C(C=C2)O,0 -CNNCC1=CC=C(C=C1)C(=O)NC(C)C,0 -CC1=CC=C(C=C1)N(CCCl)CCCl,0 -CN(C)S(=O)(=O)N(SC(F)(Cl)Cl)C1=CC=CC=C1,0 -OCCNCCO,0 -CC(C)(C)C1CCC2(CC1)CO2,0 -COC(F)(F)C(Cl)Cl,0 -OC2=C1N=CC=CC1=C(C=C2Cl)Cl,0 -CCCCC=O,0 -CC(=O)C=CC1=C(C)CCCC1(C)C,0 -CC1=C(C=C(C=C1)S(O)(=O)=O)C,0 -CCC2=C1OC(=CC1=CC=C2)C(O)CNC(C)(C)C,0 -CC(C)=CCCC(C)(OC(=O)C1=C(C=CC=C1)N)C=C,0 -CC4=C3N=C2C1=CC=CC=C1C=CC2=CC3=CC=C4,0 -ClCC1=C3C=CC4=CC=CC5=CC=C(C2=CC=CC=C12)C3=C45,0 -OC1=CC=C(C=C1)C3=COC2=C(C=CC(=C2)O)C3=O,0 -O=C1NC(=O)C(N1)(C2=CC=CC=C2)C3=CC=CC=C3,0 -CCCCCCOC(=O)C1=C(C=CC=C1)C(=O)OCCCCCC,0 -[NH]1C=CC=C1,0 -CCC1=C(C(=CC(=C1)N)C)CC2=C(C=C(C=C2C)N)CC,0 -OCC#N,0 -CC(=O)CC(C)=O,0 -OC(=O)CC1=C[NH]C2=CC=CC=C12,0 -O=C2CN(CCCN1CC(=O)NC(=O)C1)CC(=O)N2,0 -CC(C)C2=CC=C(C)C1=C(C=C(C)C1=C2)S(O)(=O)=O,0 -CC(=O)C1=C(C(=C(C(=C1C)[N+]([O-])=O)C(C)(C)C)[N+]([O-])=O)C,0 -ClCC1(CCl)C2CC(Cl)(Cl)C1(CCl)C(Cl)C2Cl,0 -ClC1=C(C(=C(C=C1)Cl)Cl)Cl,0 -COC1=C(C=CC=C1)O,0 -FC(F)(F)C1=CC=C(C=C1)CCl,0 -OC(=O)CCC1=CC=CC=C1,0 -COC4=CC2C3CC1=C(C(=C(C=C1)OC)O)C2(CCN3C)CC4=O,0 -OC2=C(C1=CC=CC=C1C=C2)N=O,0 -COC3=CC=C2C1=C(C(=NCC1)C)[NH]C2=C3,0 -CNC1=C(C=CC=C1)C(=O)OC,0 -OC(=O)CCCOC1=C(C=C(C=C1)Cl)Cl,0 -ClC(Cl)C(C1=CC=C(C=C1)Cl)C2=C(C=CC=C2)Cl,0 -CCCCC(CC)CO,0 -CC(C)=CCCC(C)(O)C=C,0 -CC(C)(C)C(Br)C(=O)NC1=CC=CC=C1,0 -OS(=O)(=O)C1=CC=C(C=C1)[N+]([O-])=O,0 -CS(=O)(=O)C1=CC=C(C=C1)Cl,0 -CCC2=C1[NH]C3=C(C1=CC=C2)CCOC3(CC)CC(O)=O,0 -CCCCOC(=O)CC(CC(=O)OCCCC)(OC(C)=O)C(=O)OCCCC,0 -CC(=O)C1(CCNCC1)C2=CC=CC=C2,0 -CCN(CC)C(=S)SSC(=S)N(CC)CC,0 -NC1=CC=C(C=C1)C(O)=O,0 -CC(C(O)=O)C1=CC(=CC=C1)C(=O)C2=CC=CC=C2,0 -ClC1=C(C=CC=C1)C=C,0 -CN(C)C(=N)N(C)C,0 -CC4=C(COC(=O)C1N3C(SC1(C)C)C(NC(=O)C(N)C2=CC=CC=C2)C3=O)OC(=O)O4,0 -N#CSCSC#N,0 -OC(=O)C1=C(C=CC(=C1)Cl)Cl,0 -CCCCC(CC)COC(=O)C=C,0 -OC(=O)CCCCC(O)=O,0 -BrCC(=O)C1=CC=C(C=C1)Br,0 -C2CCC1=C(C=CC=C1)C2,0 -CCC(C1=CC=CC=C1)=C(C2=CC=CC=C2)C3=CC=C(C=C3)OCCN(C)C,0 -CC(=C)C1CCC(=CC1)C=O,0 -OC(C(F)(F)F)C(F)(F)F,0 -CC(C)CC=O,0 -ClC1C=CC2C1C3(Cl)C(=C(Cl)C2(Cl)C3(Cl)Cl)Cl,0 -CC1(CO1)C=C,0 -CC(C)CCC(C)NC1=CC=C(C=C1)NC(C)CCC(C)C,0 -COC(C)=O,0 -CC(C)(C)N,0 -CNC,0 -CC1=CC(O)C2CC1C2(C)C,0 -CN(C)C(=O)NC1=CC=C(C=C1)Cl,0 -CCOP(=O)(OCC)OCC,0 -CC(OC1=C(C=C(C(=C1)Cl)Cl)Cl)C(O)=O,0 -NC1=NC(=O)N(C=C1)C2OC(COP(O)(O)=O)C(O)C2O,0 -CC(C)O,0 -CC1=CC(=O)CC(C)(C)C1,0 -CCCN(CCC)S(=O)(=O)C1=CC=C(C=C1)C(O)=O,0 -OC(=O)C1=C(C=CC=C1Cl)Cl,0 -CC1=CC=C(C=C1)C,0 -CCCO,0 -S1C=CC=C1,0 -O=S1(=O)CC=CC1,0 -NC1=C(C(=CC(=C1)[N+]([O-])=O)S(O)(=O)=O)O,0 -CC(=O)OC2C1OC(=O)C(OC(C)=O)C1OC2=O,0 -ClCC1=CC=C(C=C1)C#N,0 -OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O,0 -CCCCCCCCC=C,0 -ClC2=C(C=C1OC3=C(OC1=C2)C=C(Cl)C(=C3)Cl)Cl,0 -OC1=CC=C(C=C1)C2(NC(=O)NC2=O)C3=CC=CC=C3,0 -C1=CC=C(C=C1)C2=C(C=CC=C2)C3=CC=CC=C3,0 -CC1=CC=C(C=C1)CCl,0 -O=C([N]1C=CN=C1)[N]2C=CN=C2,0 -CC(=O)CC(=O)NC1=CC=CC=C1,0 -[O-][N+](=O)C1=CC=C(C=C1)[N]2N=C(N=[N+]2C3=CC=C(C=C3)I)C4=CC=CC=C4,0 -CCC(C)C1=C(C=CC=C1)O,0 -C1CN2CCN1CC2,0 -COP(=O)(OC)OC(=CBr)C1=C(C=C(C=C1)Cl)Cl,0 -CC(O)COCC(C)O,0 -COP(=S)(OC)OC1=CC(=C(C=C1)[N+]([O-])=O)C,0 -CCCCCCCCCCCC(O)=O,0 -NC(=O)C1=CC=CC=C1,0 -CC(=O)CCl,0 -NC(CC1=CC=C(C=C1)F)C(O)=O,0 -COC1=CC=C(C=C1)C=CC(=O)C2=CC=CC=C2,0 -ClC2=C1C=CC=CC1=CN=N2,0 -CCC1=CC=CC=C1,0 -COC1=C(C=CC(=C1)C=CC(=O)CC(=O)C=CC2=CC(=C(C=C2)O)OC)O,0 -CC(=O)NNC(=O)C1=NC=CC=C1,0 -COC2=C(C=C1[NH]C=C(C1=C2)CCNC(C)=O)O,0 -BrCC(Br)C1CCC(Br)C(Br)C1,0 -NCCC#N,0 -OC1=CC=C(C=C1)CCC(=O)C2=C(C=C(C=C2O)O)O,0 -CC(Cl)Cl,0 -OC2=C1C=CC=CC1=NC3=CC=CC=C23,0 -OC4C(O)C3=C(C=C2C1=CC=CC=C1C=CC2=N3)C5=C4C=CC=C5,0 -CCC1=NC=CC(=C1)C(N)=S,0 -CCCC,0 -OC(=O)C=CC1=CC=C(C=C1)Cl,0 -CCCCN,0 -CCC(C)(C)C1=CC(=C(C(=C1)N3NC2=C(C=CC=C2)N3)O)C(C)(C)CC,0 -NC1=CC=C(C=C1)O,0 -OC1CCCCC1,0 -[O-][N+](=O)C1=CC(=CC=C1)C=CC(=O)C2=CC=CC=C2,0 -COP(C)(=O)OC,0 -CCCCCCCCCCCCO,0 -ClC1=C(C2=C(C(=C1Cl)Cl)C(=O)OC2=O)Cl,0 -S=C1SC=C(S1)C2=CC=CC=C2,0 -OC(=O)C1=C(N=CC=C1)NC2=CC(=CC=C2)C(F)(F)F,0 -CC1CCCC1,0 -OC2CC13OC1(C2)C=CC=C3,0 -CC(C)(C)OC(=O)C=C,0 -CC1=CSC=C1,0 -COP(=O)(OC)C(OC(=O)CCl)C(Cl)(Cl)Cl,0 -OCC1=CC=C(C=C1)Cl,0 -ClC1=C(Cl)C(=O)C(Cl)(Cl)C1=O,0 -CCCCCCCCOP(=O)(OCCCCCCCC)OCCCCCCCC,0 -CCC1=CC=CO1,0 -OC4=C2C1=CC=CC=C1C=CC2=C3C=CC=CC3=C4,0 -CC1=C(C=CC(=C1)S(O)(=O)=O)N,0 -CCN(CC)C(=O)C1=CC(=CC=C1)C,0 -CC(C(O)=O)C1=CC3=C(C=C1)C2=CC(=CC=C2[NH]3)Cl,0 -OCC(O)C(O)C(OC1OC(CO)C(O)C(O)C1O)C(O)CO,0 -CCN,0 -NS(=O)(=O)C2=C1N=CC=CC1=CC=C2,0 -CC1=C(C(=CC=C1)NC2=NC(=NC(=C2)Cl)SCC(O)=O)C,0 -CC1=C(C=C(C(=C1)C)C)C,0 -CCCCOC(=O)CCCCCCCCC(=O)OCCCC,0 -CCCCCCC1=C(C=C(C=C1)O)O,0 -CC(O)CN(CC(C)O)CC(C)O,0 -OC(=O)C2=N[N](CC1=C(C=C(C=C1)Cl)Cl)C3=CC=CC=C23,0 -OC1=C(C=C(C=C1Br)Br)Br,0 -NC2=NC=C1N=C[NH]C1=N2,0 -N(C1=CC=CC=C1)C2=CC=CC=C2,0 -CCOC(=O)C(C)(C)OC1=CC=C(C=C1)Cl,0 -OCCCCO,0 -CCCCOP(=O)(OCCCC)OC1=CC=CC=C1,0 -NC2=C1C(C4=C(C(C1=C(C=C2S(O)(=O)=O)NC3CCCCC3)=O)C=CC=C4)=O,0 -NC(=O)CBr,0 -[O-][N+](=NC1=CC(=C(C=C1)Cl)Cl)C2=CC(=C(C=C2)Cl)Cl,0 -FC(F)C(F)(F)F,0 -CCC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C,0 -O=C1OC4=C3C2=C1C=CC=C2C=CC3=CC=C4,0 -NC(=O)CI,0 -CC1=C(SSC1=S)C2=NC=CN=C2,0 -NC1=C(C(=C(C=C1)Cl)Cl)Cl,0 -CC1=C(C(=C(C(=C1[N+]([O-])=O)C)[N+]([O-])=O)C(C)(C)C)[N+]([O-])=O,0 -O=C2C1=C(C=CC=C1)CCC3=C2C=CC=C3,0 -CC1=CC(=C(C=C1)C)C,0 -ClC(=O)OCC1=CC=CC=C1,0 -OC2=C1C(C5=C(OC1=CC=C2)C3=C(OC4OCCC34)C=C5O)=O,0 -OC(=O)CC(Cl)C(O)=O,0 -CC1=CCC(=O)O1,0 -ClC2=C1C=CC=CC1=C(N=N2)Cl,0 -OCC4=C2C=CC=C3C1=CC=CC=C1C(=C23)C=C4,0 -CC1=C(C(=CC(=C1)[N+]([O-])=O)[N+]([O-])=O)C,0 -C1COCCO1,0 -CC1=CC=C(O1)C,0 -OCC1=CC=C(C=C1)O,0 -O[N+]([O-])=C2C1=C(C=CC=C1)C(=O)C3=C2C=CC=C3,0 -CC(=O)OC3CC2C1(C)CCCC(C)(C)C1CCC2(C)C4(O)CC(=C(C=O)C34C)C=O,0 -COC2=C(C(=C1C(OCC1=C2C)=O)O)CC=C(C)CCC(O)=O,0 -CC(C)C(=O)NC1=CC=CC=C1,0 -OC(=O)CC1=CC=C(C=C1)Cl,0 -C2=CC1=CC=NC=C1C=C2,0 -OC1=C(C4=C2C(=C1)C(=O)OC3=C2C(=CC(=C3O)O)C(=O)O4)O,0 -OC1=C(C(=CC(=C1Cl)Cl)Cl)Cl,0 -CC1=CC=CC=C1,0 -ClC1=C(C(=CC=C1)Cl)C#N,0 -CC(C)OC1=CC2=C(C=C1)C(C(=CO2)C3=CC=CC=C3)=O,0 -[O-][N+]2=C1C=CC=CC1=CC=C2,0 -CCN(CC)CC1=C(C=CC(=C1)NC3=C2C=CC(=CC2=NC=C3)Cl)O,0 -C1CCC(CC1)NSC3=NC2=CC=CC=C2S3,0 -CCN(N=O)C1=CC=CC=C1,0 -O=C1CC(=O)C1=O,0 -CC(C)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O,0 -CC(=O)NC1=CC=C(C=C1)C(=O)C=CC2=CC=CC=C2,0 -CC(=O)OO,0 -CC(=O)C1=CC=C(C=C1)S(=O)(=O)NC(=O)NC2CCCCC2,0 -CC(C)(C)O,0 -CC(C)(OC1=CC=C(C=C1)C2CC2(Cl)Cl)C(O)=O,0 -CC1=CC(=CC=C1)[N+]([O-])=O,0 -CCC=[N+](O)[O-],0 -C1OCOCO1,0 -CCC3=C2C1=CC=CC=C1C=CC2=C(C4=CC=CC=C34)C,0 -CCOC(C)=O,0 -CCOC1=CC=C(C=C1)NC(N)=O,0 -CC(C)=O,0 -CC1=CC=C(C=C1)Cl,0 -CCCCC(CC)COCCC#N,0 -ClCC1=CC=C(C=C1)Cl,0 -OC1=C(C=CC=C1)C(=O)OC2=CC=CC=C2,0 -ClC(=C)C#N,0 -CCOC(=O)OC(=O)OCC,0 -CC(CCN(C)C)N(C)C,0 -CC1=C(C)C(=O)C(=C(C)C1=O)C,0 -C=CCN1C(=O)N(CC=C)C(=O)N(CC=C)C1=O,0 -OC(=O)C1CC2=C(CN1)[NH]C3=CC=CC=C23,0 -CCCCCN,0 -[O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O,0 -COC1=C(C5=C(C(=C1)O)C(=O)C2=C(C3=C(C=C2OC)OC4OCCC34)O5)OC,0 -OC(=O)C1=C(C=CC=C1)Cl,0 -O=C1CCCCC1,0 -CC1=CC=C(C=C1)OP(=O)(OC2=CC(=CC=C2)C)OC3=CC(=CC=C3)C,0 -OC(=O)C1=C(C=CC=C1)NC2=C(C=CC(=C2)Cl)C(O)=O,0 -CCCCCC(N)=O,0 -CCCCCCCCCCCC(=O)OCCS(O)(=O)=O,0 -OC1=C(C=C(C=C1Cl)Cl)SC2=C(C(=CC(=C2)Cl)Cl)O,0 -[O-][N+]4=C2C=CC1=CC=CC=C1C2=CC5=C3C=CC=CC3=CC=C45,0 -ClC1=CC=C(C=C1)S(=O)(=O)C2=C(C=C(C(=C2)Cl)Cl)Cl,0 -CC(OP(C)(Cl)=O)C(C)(C)C,0 -ClC1=CC(=CC(=C1)Cl)N2C(=O)CCC2=O,0 -NCC1=CC(=CC=C1)CN,0 -OC(=O)COC1=C(C(=C(C=C1)C(=O)C2=CC=CS2)Cl)Cl,0 -O=C1C5=C4C3=C2C1=CC=CC2=CC=C3C=CC4=CC=C5,0 -CC1=NC=CN=C1,0 -CCC(O)CN,0 -CC(=O)C3C(=O)C=C2OC1=C(C(=C(C(=C1C(C)=O)O)C)O)C2(C)C3=O,0 -O=C1CSC(=S)N1,0 -FC2=CC1=CC=CC=C1N=C2,0 -OC1=CC=C(C=C1)C3=CC(=O)C2=C(C=C(C=C2O)O)O3,0 -OC(=O)C1=CC(=C(C(=C1)O)O)O,0 -C=COC(=O)C=C,0 -CC(CCl)OP(=O)(OC(C)CCl)OC(C)CCl,0 -CC1(C)C2CCC1(C)C(=O)C2=O,0 -NC1=CC=C(C=C1)C(=O)OCCCOC(=O)C2=CC=C(C=C2)N,0 -COC1=C(C=CC(=C1)C=CC)O,0 -CC(C)CC(NC(=O)COC1=C(C=C(C=C1)Cl)Cl)C(O)=O,0 -OC(=O)C1=CC(=CC(=C1)Cl)Cl,0 -CCCCOC(C)=O,0 -C2CCC1CCCCC1C2,0 -CCC1=CC=C(C=C1)[N+]([O-])=O,0 -CC1=C(C(=C(C(=C1Br)Br)Br)Br)Br,0 -C[N+](C)(C)CC1=CC=CC=C1,0 -CC#N,0 -CC(C)(C)CC(C)(C)C1=CC=C(C=C1)OCCOCC[N+](C)(C)CC2=CC=CC=C2,0 -CCCCCCCCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1,0 -CCCCC(CC)COS(O)(=O)=O,0 -OCCN4CCN(CCCN2C1=C(C=CC=C1)SC3=C2C=C(C=C3)C(F)(F)F)CC4,0 -OC(COC2=C1C(C=C(OC1=CC=C2)C(O)=O)=O)COC4=C3C(C=C(OC3=CC=C4)C(O)=O)=O,0 -OC2=C(C1=CC=C(C=C1C=C2)S(O)(=O)=O)N=NC3=CC=CC=C3,0 -OC2=C(C1=C(C=C(C=C1C=C2)S(O)(=O)=O)S(O)(=O)=O)N=NC3=CC=CC=C3,0 -CN(C)CCN(CC1=CC=CC=C1)C2=CC=CC=C2,0 -CC(C)C1CCC(C)CC1O,0 -COC(=O)C(C1CCCCN1)C2=CC=CC=C2,0 -CC(CCC1=CC=CC=C1)NCC(O)C2=CC(=C(C=C2)O)C(N)=O,0 -NC2=C1C(=C(C(=CC1=CC(=C2)S(O)(=O)=O)S(O)(=O)=O)N=NC3=CC=CC=C3)O,0 -CC3=C(OC1=C(C=CC=C1C(=O)OCCN2CCCCC2)C3=O)C4=CC=CC=C4,0 -CC(CN2C1=C(C=CC=C1)SC3=C2C=CC=C3)N(C)C,0 -CC(C)CCCC(C)CCCC(C)CCCC2(C)CCC1=C(C(=C(C(=C1C)O)C)C)O2,0 -C[N+](C)(C)CC(O)=O,0 -CON,0 -OC2=C(C1=CC=CC=C1C=C2)N=NC3=CC=C(C=C3)S(O)(=O)=O,0 -CC1=NC(=C(C=N1)C[N+]2=CSC(=C2C)CCO)N,0 -OC1=NC(=NC(=N1)O)O,0 -OC2=C1[N+](=CC=CC1=CC=C2)[O-],0 -OC(=O)C1C(C(O)=O)C2(Cl)C(=C(Cl)C1(Cl)C2(Cl)Cl)Cl,0 -OC2=C1C=CC=CC1=CN=N2,0 -C(NC2=C1[NH]C=NC1=NC=N2)C3=CC=CC=C3,0 -CC=C1CC(C)C(C)(O)C(=O)OCC2=CCN3CCC(OC1=O)C23,0 -NC2=NC1=N[NH]N=C1C(=N2)O,0 -CCCCCCCCCCCCCCCC(=O)OCC(O)C1=C(C(=C(O1)O)O)O,0 -CCCCCC(CC)OC(=O)C1=CC(=CC=C1)C(=O)OC(CC)CCCCC,0 -OC2=C1C=CC=CC1=C(N=N2)O,0 -SC2=NC1=CC=CC=C1S2,0 -OCC(O)C(O)CO,0 -CC2(C)C3CC1OC1(C)C2C3,0 -CC(=O)C1=C(O)[N]5C(=C1O)C2C(CC4=C3C2=C[NH]C3=CC=C4)C5(C)C,0 -CC(C)CC(=O)OC4CC1(OC(C)=O)C(OC2C(O)C(OC(C)=O)C1(C)C23CO3)C=C4C,0 -CC(=O)OCC12CCC(=CC1OC3C(O)C(OC(C)=O)C2(C)C34CO4)C,0 -CC4CC3OC1C(O)C(OC(C)=O)C(C)(C12CO2)C3(CO)C(=O)C4=O,0 -CC4CC3OC1C(O)C(O)C(C)(C12CO2)C3(CO)C(=O)C4=O,0 -NC1=NN=C(S1)S,0 -ClCC1C(CCl)C2(Cl)C(=C(Cl)C1(Cl)C2(Cl)Cl)Cl,0 -ClC1=CC3=C(C=C1)N2C=NNC2=CN=C3C4=CC=CC=C4,0 -C=CC1CC2CC1C=C2,0 -ClC3=C(Cl)C4(Cl)C2C1CC(C=C1)C2C3(Cl)C4(Cl)Cl,0 -CC1C(=O)OC2CCN3CC=C(COC(=O)C(C)(O)C1(C)O)C23,0 -OC2CC(O)(CC(OC(=O)C=CC1=CC(=C(C=C1)O)O)C2O)C(O)=O,0 -CN(C=NC=NC1=C(C=C(C=C1)C)C)C2=C(C=C(C=C2)C)C,0 -NC3=NC(=C2N=C(O)[N](C1OC(CO)C(O)C1O)C2=N3)O,0 -CC1(CO)C(O)CCC2(C)C1CCC3CC4CC23CCC4(O)CO,0 -CNC(=N)N[N+]([O-])=O,0 -CC(=O)OC4(CCC5C3C=C(Cl)C2=CC(=O)C1CC1C2(C)C3CCC45C)C(C)=O,0 -CC12CCC(CC1)C(C)(C)O2,0 -CC12CCCC(C)(C1CCC34CC(=C)C(O)(CCC23)C4)C(O)=O,0 -CNC3=C1CC(=O)C(=CC=C1C2=C(C(=C(C=C2CC3)OC)OC)OC)OC,0 -CC34CC(O)C1C(CCC2=CC(=O)C=CC12C)C3CCC4(O)C(O)C=O,0 -CC34CCC1C(CCC2=C1C=CC(=C2)O)C3CC(O)C4O,0 -CC34CCC1C(CCC2=C1C=CC(=C2)O)C3CCC4O,0 -CC2=CN(C1CC(O)C(CO)O1)C(=O)NC2=O,0 -OC1=NC(=C(C=N1)F)O,0 -CC(=O)OC3(CCC4C2CCC1=C(CCC(=O)C1)C2CCC34C)C#C,0 -CC1CCC6(OC1)OC5CC4C3CC=C2CC(O)CCC2(C)C3CCC4(C)C5C6C,0 -CC4CC3OC1C(O)CC(C)(C12CO2)C3(CO)C(=O)C4=O,0 -OC3=C(C=C2C1C4=C(OCC1(CC2=C3)O)C(=C(O)C=C4)O)O,0 -COC1=C(C(=CC(=C1)C3C2C(COC2=O)C(O)C5=C3C=C4OCOC4=C5)OC)OC,0 -CC2OC=C1C(=O)C(C(O)=O)C(=O)C(=C1C2C)C,0 -NC2=C1C(=NN=C(C1=CC=C2)O)O,0 -CC34CCC1C(CC=C2CC(O)CCC12C)C3CCC4=O,0 -CN1CCCC1C2=CN=CC=C2,0 -OCC1OC(CC1O)N2C=C(I)C(=O)NC2=O,0 -CC(C)C12CC1C(C)C(=O)C2,0 -CC(N)(CC1=CC(=C(C=C1)O)O)C(O)=O,0 -CC1=NC(=NC(=C1)O)S,0 -CC34CCC1C(CCC2=C1C=CC(=C2)O)C3CCC4(O)C#C,0 -CC(=O)C3CCC4C2CC=C1CC(=O)CCC1(C)C2CCC34C,0 -NC2=C1N=C[N](C1=NC=N2)C3OC(CO)C(O)C3O,0 -OC(=O)CCCCC1SCC2NC(=O)NC12,0 -NS(=O)(=O)C1=C(C=C2C(=C1)S(NC=N2)(=O)=O)Cl,0 -SC2=NC1=CC=CC=C1[NH]2,0 -OCC1OC(CC1O)N2C=C(Br)C(=O)NC2=O,0 -NC2=NC1=NC=C(N=C1C(=N2)O)CNC3=CC=C(C=C3)C(=O)NC(CCC(O)=O)C(O)=O,0 -CC1=C(N=C(N=C1)S)O,0 -CC=CC(=O)OC2CC3OC1=CC(C)C(=O)CC1(C)C2(C)C34CO4,0 -CC(C)CCCC(C)C1CCC2C(CCCC12C)=CC=C3CC(O)CCC3=C,0 -NC(CC1=CC=CC=C1)C(O)=O,0 -CC34CCC1C(CC=C2CC(=O)CCC12)C3CCC4(O)C#C,0 -CC(=O)OC3(CCC4C2CC(=C1CC(=O)CCC1(C)C2CCC34C)C)C(C)=O,0 -CC14C(O)C=CC5(OC1=O)C2CCC3(O)CC2(CC3=C)C(C45)C(O)=O,0 -C2C=CC3C1CC(C=C1)C23,0 -CC1=CCC2CC1C2(C)C,0 -CC6CCC5C(C)C3C(CC4C2CC=C1CC(O)CCC1(C)C2CCC34C)N5C6,0 -CC(CCC(O)=O)C3CCC4C2C(O)CC1CC(O)CCC1(C)C2CC(O)C34C,0 -[O-][N+](=O)OC1COC2C(COC12)O[N+]([O-])=O,0 -CC2=CCCC(=C)C1CC(C)(C)C1CC2,0 -CC1=C(N=C(N=N1)O)O,0 -OCC1OC(CC1O)N2C=CC(=O)NC2=O,0 -NC2=C1N=C[N](C1=NC=N2)C3CC(O)C(CO)O3,0 -CCCC(=O)OCC,0 -CC(=O)C1=CC=NC=C1,0 -ClC1=NC(=CC=C1)Cl,0 -CC(O)CO,0 -CC(C)CO,0 -CC1CCC(=O)C1=O,0 -CC1=CC(=O)OC2=C1C=CC(=C2)O,0 -CCN(CC)C1=CC=CC=C1,0 -CCCCOC(=O)C(C)=C,0 -CN(C)C(=O)OC1=C[N+](=CC=C1)C,0 -CCC(CO)NCCNC(CC)CO,0 -CC12CCC(CC1O2)C=C,0 -NC2=C1C=CC=CC1=CC=C2O,0 -CN1CCC(C1)CN3C2=C(C=CC=C2)SC4=C3C=CC=C4,0 -CCCCCC(=O)OC3(CCC4C2CCC1=C(CCC(=O)C1)C2CCC34C)C(C)=O,0 -O=C1NS(=O)(=O)C2=C1C=CC=C2,0 -OC2=C(C=C1C=C(C=CC1=C2)S(O)(=O)=O)S(O)(=O)=O,0 -NC1=CC=CC=C1,0 -COC1=C(C4=C(C=C1Cl)C3(C(C25SSC(C(N2C3N4C)=O)(C)N(C5=O)C)O)O)OC,0 -CCCCCCCCCCCCOS(O)(=O)=O,0 -OC(=O)CC1=C(C=CC=C1)NC2=C(C=CC=C2Cl)Cl,0 -NC2=C1N=C[N](C1=NC(=N2)O)C3OC(CO)C(O)C3O,0 -COC1=C(C(=CC(=C1)CC2NCCC3=C2C=C(C(=C3)O)O)OC)OC,0 -OC(=O)C2=NN(C1=CC=C(C=C1)S(O)(=O)=O)C(=O)C2N=NC3=CC=C(C=C3)S(O)(=O)=O,0 -CN(C)C4C3C(O)C2C(C(=O)C1=C(C=CC=C1O)C2(C)O)C(=O)C3(O)C(=O)C(C(N)=O)C4=O,0 -CCNC1=NC(=NC(=N1)O)NC(C)C,0 -ON1CN(Cl)CN(Cl)C1,0 -C[N+]1(C)CCOCC1,0 -ClC1=CC=C(C=C1)COC(C[N]2C=CN=C2)C3=C(C=C(C=C3)Cl)Cl,0 -O[N]1N=NC2=CC=CC=C12,0 -CN2CCN=C(C1=CC=CC=C1)C3=C2C=CC(=C3)Cl,0 -CC(CCC(O)=O)C3CCC4C2CCC1CC(=O)CCC1(C)C2CC(=O)C34C,0 -NC(CSCC1=CC=CC=C1)C(O)=O,0 -CCNC(=O)CCC(N)C(O)=O,0 -CCC3CN2CCC1=C(C=C(C(=C1)OC)OC)C2CC3CC4NCCC5=C4C=C(C(=C5)OC)OC,0 -NC1=CC(=C(C=C1)Cl)C(F)(F)F,0 -CCN(CC)CCCN(C2CC1=C(C=CC=C1)C2)C3=CC=CC=C3,0 -OC1C(O)C(OC1COP(O)(O)=O)N2C=CC(=O)NC2=O,0 -NCCC1=C[NH]C2=CC=CC=C12,0 -CCCC(=O)NC1=CC(=C(C=C1)OCC(O)CNC(C)C)C(C)=O,0 -FC1=CC=C(C=C1)CCl,0 -CCCC(=O)NC2=C1N=C[N](C1=NC=N2)C4OC3COP(O)(=O)OC3C4OC(=O)CCC,0 -FC1=CN=CC=C1,0 -CCCCCCC(=O)OC3(CCC4C2CCC1=CC(=O)CCC1C2CCC34C)C#C,0 -OCC1OC(C(O)C1O)[N]3C=NC4=C(NCC2=CC=C(C=C2)[N+]([O-])=O)N=CN=C34,0 -OCC1OC(CC1O)N2C=C(C=O)C(=O)NC2=O,0 -OC1C(O)C(OC1COP(O)(O)=O)[N]2C=NC3=C(O)N=CN=C23,0 -OC2=C1C=CC=CC1=NC=N2,0 -CCC5=C(CC1NCCC2=C1C=C(C(=C2)OC)OC)CC3N(CCC4=C3C=C(C(=C4)OC)OC)C5,0 -CC(C)C3=CC2=CCC1C(C)(CCCC1(C)C(O)=O)C2CC3,0 -OC1=CC2=C(C=C1)C4(C3=C(O2)C=C(O)C=C3)OC(=O)C5=C4C=CC=C5,0 -OC2=CC(=C1C=C(O)C(=[O+]C1=C2)C3=CC(=C(C(=C3)O)O)O)O,0 -CCCCCCC(O)CC=CCCCCCCCC(O)=O,0 -C[N+]1=CC(=CC=C1)C(O)=O,0 -OC(=O)C1=C(C=CC=C1)O,0 -NC2=NC1=CC=C(C=C1[NH]2)Cl,0 -CCCOC(C(=O)OC1CCN(C)CC1)(C2=CC=CC=C2)C3=CC=CC=C3,0 -NC3=NC(=C2N=C[N](C1OC(COP(O)(O)=O)C(O)C1O)C2=N3)O,0 -CNC(=O)OC1=CC2=C(C=C1)N(C)C3N(C)CCC23C,0 -CC(C)CCCC(C)C3CCC4C2CC=C1CCCCC1(C)C2CCC34C,0 -CC4CC2(C)C(CCC3C1CCC(O)C1(C)CCC23)CC4=O,0 -CC1=C(C(=C(C=N1)CO)CO)O,0 -CC1=CC(=C(C=C1)N=NC3=C2C=CC=CC2=CC(=C3O)C(O)=O)S(O)(=O)=O,0 -CN,0 -CC1=C(C(=CC=C1)OCC(O)CNC(C)(C)C)C,0 -CN[N+]([O-])=O,0 -ClC4=C(Cl)C5(Cl)C3C1CC(C2OC12)C3C4(Cl)C5(Cl)Cl,0 -CC(C)CC(NC(=O)C(CC1=CC=CC=C1)NC(=O)CNC(=O)CN)C(O)=O,0 -CC1=NCCC2=C1[NH]C3=CC(=CC=C23)O,0 -CC(C)CCCC(C)C3CCC4C2CC=C1CC(CCC1(C)C2CCC34C)OC(C)=O,0 -CNCC(O)C1=CC(=CC=C1)O,0 -NC1=NC=N[NH]1,0 -NC1=NC(=O)N(C=C1I)C2CC(O)C(CO)O2,0 -NC(CC1=CC(=C(C=C1)O)[N+]([O-])=O)C(O)=O,0 -COC1=CC=C(C=C1)CN(CCN(C)C)C2=NC=CC=N2,0 -CN(C)C4C3CC2C(C(=O)C1=C(C=CC=C1O)C2(C)O)C(=O)C3(O)C(=O)C(C(N)=O)C4=O,0 -COC1=CC=C2C(=CC1=O)C(CCC3=C2C(=C(C(=C3)OC)OC)OC)NC(C)=O,0 -CN1C2CC(CC1C3OC23)OC(=O)C(CO)C4=CC=CC=C4,0 -CNC(C=[N+](O)[O-])=NCCSCC1=CC=C(O1)CN(C)C,0 -OCC1OC(C(O)C1O)N2C=CC(=N)NC2=O,0 -OC1=NC(=NC=N1)O,0 -CC2(C)C1CCC(C1)C2=C,0 -CCCCCCCCCCCCOCCOCCOCCOCCOCCOCCOCCO,0 -OCC1=CC(C(O)C1O)N2C=CC(=N)NC2=O,0 -O=C1NC(=S)NC(=O)C1C(=O)NC2=CC=CC=C2,0 diff --git a/test/data/multi_cell_call.csv b/test/data/multi_cell_call.csv deleted file mode 100644 index a4f4762..0000000 --- a/test/data/multi_cell_call.csv +++ /dev/null @@ -1,1067 +0,0 @@ -SMILES, Rodent carcinogenicity -C12(C(=C(/N=N/C3=C(C4=C(C(=C3)S(=O)(=O)[O-])C=CC=C4)O)C=CC=1S(=O)(=O)[O-])C=CC=C2).[Na+].[Na+], 0 -O=C(C2=CC=CC=C2)S\C(CCOC(C3=CC=CC=C3)=O)=C(C)/N(C=O)CC1=CN=C(C)N=C1N.Cl, 0 -O=S(=O)(C1=CC=C(C=C1)C)NC(=O)NN2CCCCCC2, 0 -OC1=CC=C2C(=C1/N=N/C3=C(C=C(C=C3)C)[N+](=O)[O-])C=CC=C2, 1 -BrC(CCl)CBr, 1 -NC(=S)NNC(=S)N, 0 -O=S(=O)(C1=CC=C(C=C1)C)NC(=O)NCCCC, 0 -[O-][N+](=O)C1=CC=CC(=C1)NC(=O)C2=CC3=CC=CC=C3C(=C2O)/N=N/C4=CC(=CC=C4OC)[N+]([O-])=O, 0 -O[C@@H]([C@@H](O)[C@H](O)CBr)[C@@H](O)CBr, 1 -C12(C(=CC(=C(C=1/N=N/C3=C(C=C(C=C3)C)C)O)S(=O)(=O)[O-])C=C(C=C2)S(=O)(=O)[O-]).[Na+].[Na+], 1 -BrCCBr, 1 -ClC1/C=C\C2C1C3(Cl)C(/Cl)=C(/Cl)C2(Cl)C3(Cl)Cl, 1 -ClC(C(C)=C2)=CC(S(=O)([O-])=O)=C2/N=N/C1=C3C(C=CC=C3)=CC=C1O.ClC(C(C)=C5)=CC(S(=O)([O-])=O)=C5/N=N/C4=C6C(C=CC=C6)=CC=C4O.[Ba+2], 1 -O[C@H]([C@H](O)CBr)[C@H](O)[C@H](O)CBr, 1 -C(CCCCCCCC)CCCNC(N)=N.CC(=O)O, 0 -CC1=CC=CC=C1, 1 -C1(=CC(=C2C(=C1)N=CC=C2)Br)Br, 0 -C1CCCNCCC1, 0 -O=C(N(CCCC)N=O)NCCCC, 1 -[Na+].C1(=CC=C2C(=C1S([O-])(=O)=O)C=CC=C2)/N=N/C3=C(C=CC4=C3C=CC=C4)O, 0 -CC(=O)O[Sn](OC(=O)C)(CCCC)CCCC, 0 -CC1=CC(C)=C(/N=N/C2=C(C(S([O-])(=O)=O)=CC3=C2C=CC(S([O-])(=O)=O)=C3)O)C=C1C.[Na+].[Na+], 1 -ClC1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl, 1 -NC1=CC=CC(C)=C1.[H]Cl, 1 -C1=C(Cl)C=C3C(=C1)N(CCO)C(=O)C(O)N=C3C2=CC=CC=C2F, 0 -Cl\C(Cl)=C(Cl)/C(Cl)=C(Cl)\Cl, 1 -S=P(OC1=CC=C(C=C1)[N+](=O)[O-])(OCC)OCC, 0 -C1(=CC=C(N)C=C1)C.[H]Cl, 1 -[O-]C1=C(I)C=C(C(C2=C(C([O-])=O)C=CC=C2)=C3C=C(C(C(I)=C3O4)=O)I)C4=C1I.[Na+].[Na+], 0 -C(CC(=O)O)C(=O)O.C(OCCN(C)C)(C)(C1=CC=CC=C1)C2=CC=CC=N2, 1 -Cl[C@@H]1[C@H](Cl)[C@@H](Cl)[C@@H](Cl)[C@H](Cl)[C@H]1Cl, 1 -CC(C)(O)CC[C@@H](O)[C@@H](C)[C@H]2CC[C@@]1(O)C/3=C/C(=O)[C@@H]4C[C@@H](O)[C@@H](O)C[C@]4(C)[C@H]\3CC[C@@]12C, 1 -Cl[C@H]1[C@H](Cl)[C@@H](Cl)[C@H](Cl)[C@@H](Cl)[C@@H]1Cl, 1 -N12([C@@H]([C@@H](C1=O)NC(COC3=CC=CC=C3)=O)SC([C@@H]2C(=O)[O-])(C)C).[K+], 0 -ClCC/C(C2=CC=CC=C2)=C(C3=CC=CC=C3)/C1=CC=C(C=C1)OCCN(C)C.OC(C(O)=O)(CC(O)=O)CC(O)=O, 0 -[Na+].[O-]S(=O)(=O)c4ccc(c1c3cc(C)c(cc3[o+]c2cc(c(C)cc12)N(CC)CC)N(CC)CC)c(c4)S([O-])(=O)=O, 0 -Cl[C@@H]1[C@@H](Cl)[C@H](Cl)[C@H](Cl)[C@@H](Cl)[C@@H]1Cl, 1 -ClC1=C(C(=C(C(=C1OC)Cl)Cl)Cl)Cl, 1 -C1(=C(C=C(N)C=C1)[N+](=O)[O-])NCCO, 0 -ClC(C(Cl)Cl)(Cl)Cl, 1 -O=CC(\Cl)=C(\Cl)C(O)=O, 0 -O=C(C4=CC(OC)=C(OC)C(OC)=C4)O[C@@H]1C[C@@]3([H])[C@@](C[C@](N5C3)([H])C2=C(CC5)C(C=C6)=C(C=C6OC)N2)([H])[C@H]([C@](OC)=O)[C@H]1OC, 1 -C1(C(=CC=C(C=1)NC(C(C)=C)=O)Cl)Cl, 0 -C([O-])(=O)CN(CC(=O)O)CCN(CC([O-])=O)CC([O-])=O.[Na+].[Na+].[Na+].[H]O[H].[H]O[H].[H]O[H], 0 -ClC1(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl, 0 -OC1=CC(=CC=C1)O, 0 -OC1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl, 1 -O=C1C2=C(C=CC=C2)C(=O)C(=C1Cl)Cl, 0 -ClC(C(Cl)(Cl)Cl)(Cl)Cl, 1 -CC1(C(=C(CCC1)C)C=CC(=CC=CC(=CC(=O)O)C)C)C, 0 -OC1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl, 1 -O=[N+](C1=CC(=C(C(=C1)Cl)N)Cl)[O-], 0 -OC1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl, 1 -NC1=C(C=C(C=C1Cl)N)Cl, 1 -OC(=O)C(Cl)Cl, 1 -OC1=C(C=C(C(=C1CC2=C(C(=CC(=C2Cl)Cl)Cl)O)Cl)Cl)Cl, 0 -CC1(C(=C(CCC1)C)C=CC(=CC=CC(=CCOC(=O)C)C)C)C, 1 -ClC#CCl, 1 -C12C(C3C(CC1C3)NC(N(C)C)=O)CCC2, 0 -NC1=C2C(=NC(=N1)N)N=C(C(=N2)C3=CC=CC=C3)N, 1 -CC1(C(=C(CCC1)C)C=CC(=CC=CC(=CCOC(=O)CCCCCCCCCCCCCCC)C)C)C, 0 -C1N2CN3CN(C2)CN1C3, 0 -BrC(Br)Br, 1 -CCCC/C=N/N(C=O)C, 1 -Cl\C2=C(/Cl)C3(Cl)C1C4CC(C1C2(Cl)C3(Cl)Cl)C5OC45, 0 -N1=C(N=C(N(CO)CO)N=C1N(CO)CO)N(CO)CO, 1 -O=C(OCC)C4=C(C=CC=C4)C(C(C=C(C)C(NCC)=C3)=C3O1)=C(C=C2C)C1=C/C2=N/CC.Cl, 0 -ClC1=C(C=CC=C1)Cl, 0 -FC(C(F)Cl)(OC(F)F)F, 0 -[O-][N+](=O)C1=C(Cl)C(=C(Cl)C(=C1)[N+]([O-])=O)Cl, 0 -CCCCCNN.[H]Cl, 1 -ClC1=CC=C(C=C1)Cl, 1 -CCCCC/C=N/N(C=O)C, 1 -C(C(F)(Cl)Cl)(F)(F)Cl, 0 -O=C(CN=C2C3=CC=CC=C3)NC1=C2N(N=C1C)CC, 1 -ClC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)Cl)N, 1 -ClC(C(=O)O)(Cl)Cl, 1 -C1=C(C=CC(=C1)C(C2=CC=C(N)C(=C2)C)=C3C=CC(=N)C=C3)N.[H]Cl, 0 -OC(=O)\C=C/C(O)=O.C(C(C1CCCCC1)C2CCCCC2)C3CCCCN3, 0 -FC(F)Cl, 0 -O=S(O)(O)=O.O[C@@H]([C@H](C)NC)[C@@]1=CC=CC=C1.O[C@@H]([C@H](C)NC)[C@@]2=CC=CC=C2, 0 -NC1=C(C=C(C=C1Cl)Cl)Cl, 1 -C(C1=CC=C(C=C1)N)(C2=CC=C(C=C2)N)=C3C=CC(C=C3)=N.[H]Cl, 1 -CN1CC[C@H]2OC(=O)C3(C[C@@H](C)[C@@](C)(O)C(=O)OC\C(=C\C1)C2=O)O[C@@H]3C, 1 -ClCC1CO1, 1 -O=C(N(CCCCCC)N=O)N, 1 -O=C([C@](C(C=C4OC)=C(C=C4OC)OC3)([H])[C@]3([H])O2)C(C=C5)=C2C1=C5O[C@@H]([C@@](C)=C)C1, 0 -CC(=O)NC1=CC=C(C=C1)OCC, 1 -C([N+](C)(C)C)CCl.[Cl-], 0 -ClC1=CC2=C(C=C1)OC3=C(C=CC(=C3)Cl)O2, 0 -OC1=C(C=CC(=C1)O)CCCCCC, 0 -OC2=CC1=C(C(O)=C2)C(C(O[C@@H]4O[C@@H]([C@H]([C@H](O)[C@H]4O)O)CO[C@H]3[C@H](O)[C@H](O)[C@H]([C@H](C)O3)O)=C(C5=CC(O)=C(C=C5)O)O1)=O.O=S(O)(O)=O, 0 -CN1N(C2=CC=CC=C2)C(=O)C=C1C, 1 -FC(F)(Cl)Cl, 0 -ClC(CCl)Cl, 1 -NC1=CC=C(/N=N/C2=CC=CC=C2)C(N)=N1.Cl, 1 -FCCl, 1 -CC(Cl)Cl, 0 -CCC1CO1, 1 -CC(Cl)(Cl)Cl, 0 -O=C(O[C@@H]5CC([C@@](CC5)(C)[C@]([H])3CC4)=CC[C@@]3([H])[C@@]2([H])[C@@]4(C)[C@]([C@H](C)CCCC(C)C)([H])CC2)CC1=CC=C(N(CCCl)CCCl)C=C1, 1 -ClC(Cl)Cl, 1 -ClCCCl, 1 -ClC(=CCl)Cl, 1 -OC2=CC1=C(C(O)=C2)C(C(O[C@@H]4O[C@@H]([C@H]([C@H](O)[C@H]4O)O)CO[C@H]3[C@H](O)[C@H](O)[C@H]([C@H](C)O3)O)=C(C5=CC(O)=C(C=C5)O)O1)=O, 0 -ClCOC, 1 -ClC1=C(C=CC(=C1)Cl)O, 0 -ClC(=CCl)Cl, 1 -C12=C(C(=O)NS1(=O)=O)C=CC=C2, 0 -OC1(=C(O)C(=O)O[C@H]1[C@@H](C[O-])O).[Na+], 0 -C1(C=CC=CN=1)CCl.Cl, 0 -FC(Cl)(Cl)Cl, 0 -O=C(O[C@H](CC)[C@](O)(C)[C@H](O)[C@@H](C)C2=O)[C@H](C)[C@@H](O[C@H]3C[C@](OC)(C)[C@@H](O)[C@H](C)O3)[C@H](C)[C@H]([C@@](O)(C)C[C@H]2C)O[C@H]1[C@H](O)[C@@H]([N@H+](C)C)C[C@@H](C)O1.[O-]C(CCCCCCCCCCCCCCCCC)=O, 0 -C1(=CC=CN=C1)CCl.[H]Cl, 1 -O=C1N(C(=O)C2=C1C=CC=C2)SC(Cl)(Cl)Cl, 1 -C1(CCNC(NC(N)=N)=N)=CC=CC=C1.[H]Cl, 0 -ClC1=C(OC(C)C(O)=O)C=CC(Cl)=C1, 0 -C1=C(Cl)C=C3C(=C1)N4C(CN=C3C2=CC=CC=C2)=NN=C4, 0 -OC1=C(C=C(C=C1Cl)Cl)Cl, 1 -C=CCC1=CC=C2C(=C1)OCO2, 1 -O=C1C(C2=CC=CC=C2)(C(=O)NC(=O)N1)CC, 1 -ClC1=C(C=C(C=C1)Cl)OC(C(=O)O)C, 0 -ClC1=C(C=C(C(=C1)Cl)Cl)OC(C(=O)O)C, 0 -C1(C2=CC=CC=C2)(C(NC(=NC1=O)[O-])=O)CC.[Na+], 1 -O=S(=O)(C1=CC=C(C=C1)Cl)OC2=CC=C(C=C2)Cl, 0 -ClC1=C(C=CC(=C1)Cl)OCC(=O)O, 0 -ClCCN(CCCl)C1=CC=C(CC(OC3=CC=C(C4=C3)[C@]2([H])[C@](CC4)([H])[C@@](CC[C@@H]5OC(CC6=CC=C(N(CCCl)CCCl)C=C6)=O)([H])[C@]5(C)CC2)=O)C=C1, 1 -ClC1=C(C=C(C(=C1)Cl)Cl)OCC(=O)O, 0 -C3=CC=CC(NS(=O)(=O)C2=CC=C(N=NC1=CC=C(O)C(C(O)=O)=C1)C=C2)=N3, 1 -OC1=CC=CC=C1, 0 -O=C(N(C)C)NC1=CC=C(C=C1)Cl, 1 -ClC1=C(C=CC(=C1)Cl)OCC(=O)OCCCC, 0 -O=C1OC(C2=C1C=CC=C2)(C3=CC=C(C=C3)O)C4=CC=C(C=C4)O, 1 -ClC4=C(C=CC=C4)C2=NC(C)C1=NN=C(C)N1C3=C2C=C(CCC5=CC=C(CC(C)C)C=C5)S3, 0 -O=C([C@H](CO)[C@]2=CC=CC=C2)O[C@@H]1C[C@H](N4C)[C@@H](O3)[C@@H]3[C@@H]4C1.Br.O.O.O, 0 -N1C2=C(C=CC=C2)SC3=CC=CC=C13, 0 -C(N)(=O)OC(C#C)(C1C=CC=CC=1)C2C=CC(=CC=2)Cl, 1 -ClC1=CC(=CC=C1OCC(=O)OC(C)C)Cl, 0 -ClCCN(C(COC2=CC=CC=C2)C)CC1=CC=CC=C1.Cl, 1 -ClC1=CC(=C(C=C1SC2=CC=C(C=C2)Cl)Cl)Cl, 0 -ClC1=C(C=CC(=C1)NC(=O)N(C)C)Cl, 0 -ClCC(Cl)CCl, 1 -ClC([N+](=O)[O-])(Cl)Cl, 0 -ClC1=C(C=CC(=C1)Cl)OS(=O)(=O)C2=CC=CC=C2, 0 -NC(CCSCC)C(=O)O, 1 -S=C=NC1=CC=CC=C1, 0 -C=C(Cl)C=C, 1 -CC(Cl)CCl, 1 -OCCN(CCO)CCO, 1 -O=P(OC=C(Cl)Cl)(OC)OC, 1 -[O-][N+](C1=CC=C(C2=CSC(NC(C(F)(F)F)=O)=N2)O1)=O, 1 -O=C1N(C2=CC=CC=C2)N=C(C1)C, 0 -ClC1=C(C(=C(C(=C1C#N)Cl)Cl)Cl)C#N, 1 -O=[N+](C1=C(C(=CC(=C1)C(F)(F)F)[N+](=O)[O-])N(CCC)CCC)[O-], 1 -S=C(S[Se](SC(=S)N(C)C)(SC(=S)N(C)C)SC(=S)N(C)C)N(C)C, 0 -C1=C2C(=CC=C1NC3=CC=CC=C3)C=CC=C2, 0 -CC1=CC(NC2=C1C=C(C=C2)OCC)(C)C, 0 -NC1(=CC=C(C=C1)NC2=CC=CC=C2).[H]Cl, 0 -O=NN(C)CCCCCCCCCCCC, 1 -S=C(NC1CCCCC1)NC1CCCCC1, 0 -O=C(OCC)C=C, 1 -O=C(C(C)=C2C)C(C(CCCCCC(O)=O)C1=CC=CC=C1)=C(C)C2=O, 0 -[Se]=S, 1 -OC(=O)CCCC\C=C(\c1cccnc1)c2ccccc2, 0 -O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NC(=O)N(CCCl)N=O, 1 -C13CC(C4C3O4)C2C1C5C(O5)C2, 0 -CCO, 1 -CC1=CC(=C(C=C1C)N)C, 1 -NC(=S)NC1=CC=CC=C1, 0 -C[N+](CCC(C1=CC=C(C=C1)Cl)C2=NC=CC=C2)C.C(\C(=C(/C(=O)[O-])[H])[H])(=O)O, 0 -Cl\C2=C(/Cl)C3(Cl)C1C4CC(C1C2(Cl)C3(Cl)Cl)C5OC45, 1 -[O-]\[N+](CC)=N/CC, 1 -C1=C(C(=CC(=C1N)C)C)C.[H]Cl, 1 -OC1=CC2=C(C=C1)OCO2, 1 -OC1=CC=C2C(=C1/N=N/C3=CC=CC=C3)C=CC=C2, 1 -C1=CC=CC(=C1)CCN(C)N=O, 1 -O=S(=O)(C1=CC=C(C=C1)Cl)NC(=O)NCCC, 0 -ClC6C4(Cl)C3C1C5C(C3C2OC12)C4(Cl)C(Cl)(Cl)C56Cl, 0 -[O-]\[N+](CC)=N/C, 1 -ClC1=NC(=NC(=N1)NCC)NCC, 0 -O=C1N(C2=CC=CC=C2)N(C3=CC=CC=C3)C(=O)C1CCCC, 1 -N(CCCCCCCCCCCCCC)(C)N=O, 1 -C(O)(=O)[O-].[Na+], 0 -NC1=CC(=CC=C1)N, 0 -N(CCCCCCCCCC)(C)N=O, 1 -OCC1=C(C(=C(C(=C1)/N=N/C2=C3C=CC=CC3=C(C=C2)S(=O)(=O)[O-])O)/N=N/C4=C5C=CC=CC5=C(C=C4)S(=O)(=O)[O-])O.[Na+].[Na+], 0 -NC1=CC=C(C=C1)N, 0 -CN(C(=O)N)N=O, 1 -C([N+](C)(C)C)CO.[Cl-], 0 -ClC(C(C1=CC=C(C=C1)CC)C2=CC=C(C=C2)CC)Cl, 0 -C1(=C(C=CC=C1N)N).[H]Cl.[H]Cl, 0 -C1N(C(OC1)=O)N=O, 1 -S=P(OC1=NC(=C(C=C1Cl)Cl)Cl)(OCC)OCC, 0 -C1(SC2=C(C(=CC(=C2)Cl)Cl)[O-])(=C(C(=CC(=C1)Cl)Cl)[O-]).[Na+].[Na+], 0 -O=C(C)CN(N=O)CCO, 1 -CC(=O)[O-].[O-]C(=O)C.[O-]C(=O)C.[Cr+3], 0 -.[Na+].[Cl-], 0 -N(N)(CC)C=O, 1 -O=C1C2=C(C=CC=C2O)C(=O)C3=CC=CC(=C13)O, 1 -[Na+].[O-]Cl=O, 0 -C1(=C(C=CC=C1)N)N.[H]Cl.[H]Cl, 1 -CC1(C2=CC=CC=C2)C(O1)C(=O)OCC, 0 -C1(CSCCNC(NC)=NC#N)=C(C)NC=N1, 0 -O=C([O-])C(C(/C(CC([O-])=O)=C([C@@H](CCC([O-])=O)[C@@H]5C)\N=C5/C=C4\[N-]\C(C(C=C)=C4C)=C3)=N2)=C(C)/C2=C/C1=C(CC)C(C)=C/3[N-]1.[Na+].[Na+].[Na+].[Cu+2], 0 -C1(=CC(=CC=C1N)N).[H]Cl.[H]Cl, 0 -N=C(N(CC)N=O)N[N+]([O-])=O, 1 -C1([C@H](CNC)O)(=CC(=CC=C1)O).[H]Cl, 0 -O=C(C(O)(C2=CC=CC=C2)C1CCCCC1)OC(C)(C)C#CCN(CC)CC.O.Cl, 0 -NC(=O)N(CC)N=O, 1 -O=NN(CC=C1)CC1, 1 -O.[Na+].O.O.CCN(CC)C([S-])=S, 0 -S=C(S[Te](SC(=S)N(CC)CC)(SC(=S)N(CC)CC)SC(=S)N(CC)CC)N(CC)CC, 0 -N(CC(F)(F)F)(CC)N=O, 1 -Cl[O-].[Na+], 0 -C1(=CC=CC=C1)CCNN.S(O)(O)(=O)=O, 1 -ClC1(C(C2=CC=C(C=C2)OC(C(=O)O)(C)C)C1)Cl, 1 -OC(=O)C=CC=CC, 0 -O(C1=CC=CC=C1)CC2CO2, 1 -OCCBr, 1 -CCC1=CC=CC=C1, 1 -C1C(N(C(CN1N=O)C)C)C, 1 -OC(CNC(C)C)C1=CC=C(NS(=O)(C)=O)C=C1.[H]Cl, 0 -OC2=CC=C(C=C2)/C(CC)=C(CC)/C1=CC=C(O)C=C1, 1 -C(CO)O, 0 -N(CC(CO)O)(CC=C)N=O, 1 -[O-]C12[C@@H](CC[N+](C)1CC=C2COC([C@](OC(C)=O)(C)[C@@H](C)\C=C3C=C)=O)OC/3=O, 1 -S=C(NCC)NCC, 1 -N(CC(C)O)(CC=C)N=O, 1 -NNC1=CC=CC=C1.[H]Cl, 1 -C=CC=C, 1 -NC(CCCN)(C(=O)O)C(F)F, 0 -C1CN1, 1 -N(CC(C)=O)(CC=C)N=O, 1 -CC(CC1=CC=CC=C1)NN.[H]Cl, 0 -CC(C)(C)O, 1 -CC(OC1=CC=C(C=C1)Cl)(C(=O)OCC)C, 1 -O=CNNC=O, 1 -N(CC=C)(CCO)N=O, 1 -O=C1C2=C(C=C3C(=C2OC4=CC=CC(=C14)O)C5C(O3)OC=C5)OC, 1 -O=C1N2CC3=CC=CC=C3C(=O)N2CC4C=CC=CC1=4, 1 -O=C(N(CCCCC)N=O)OCC, 1 -O=[C@](O[C@H](O[C@H](CO)[C@H]1O)[C@H](O)[C@H]1O)[C@@]5(C)[C@](CC3)([H])[C@](CCC5)(C)[C@@](CC4)([H])[C@@](C2)3C[C@]4(O[C@H]6[C@H](O[C@H]7[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O7)[C@@H](O)[C@H](O)[C@@H](CO)O6)[C@@]2=C, 0 -CCCCCl, 0 -OCCN.O=C(C1=C(C=CC(=C1)Cl)O)NC2=CC=C(C=C2Cl)[N+](=O)[O-], 0 -N(N1CCCCC1C2=CC=CN=C2)=O, 1 -[C@@H]1(NC(N(N=O)C)=O)[C@H]([C@H](O)[C@H](O[C@@H]1O)CO)O, 1 -CC(=O)O[Hg]C1=CC=CC=C1, 0 -OC1=C(C=C(C=C1C(CC)C)[N+](=O)[O-])[N+](=O)[O-], 0 -O=S([N-]C1=O)(OC(C)=C1)=O.[K+], 0 -Cl[C@@]1(C(C)2C)C(Cl)(Cl)C(Cl)([C@](Cl)(C2=C)C1Cl)Cl, 1 -C1=C(C=CC=C1OCC2CO2)OCC3CO3, 1 -N(N)(CCCC)C=O, 1 -C=CC1=CC=CC=C1, 1 -OC1=CC=C(C=C1)C2=CC=CC=C2, 0 -C(C1=CC=C(C=C1)O)(=O)OCCCC, 0 -[Na+].[O-]C1=C(C=CC=C1)C2=CC=CC=C2, 1 -O.O.O.O.[Co+2].O.O.O.[O-]S([O-])(=O)=O, 1 -O=NN(CC(C)O)CC(C)O, 1 -N#[N+]C1=CC=CC=C1.O=S([O-])(O)=O, 1 -C1C(C2=CC=CC=C2)O1, 1 -N1(=C2C(=CC(=C1)C3=CC=CC=C3)N(C(=N2)N)C).[H]Cl, 1 -O[C@@H]1C2[C@@]34C5=C(C=CC(=C5O2)OC)CC(C3C=C1)N(C)CC4, 0 -O=NN(CC(=O)C)CC(=O)C, 1 -O=C1OC(=O)CC1, 0 -O=C1OC2=C(C=CC=C2)CC1, 1 -N(N(CC(F)(F)F)CC(F)(F)F)=O, 0 -CCCCOCCO, 1 -N(CCCCO)(CCCC)N=O, 1 -O[C@H]1[C@H](O[C@H](CO)[C@@H](O)[C@@H]1O)O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O, 0 -OC1=CC(C2=NC(N(C(C)C)C3=C2C=CC(C)=C3)=O)=CC=C1, 0 -CCCC1=CC2=C(C=C1)OCO2, 1 -O=NN(C)C2=NC1=CC=C(Cl)C=C1C(C3=CC=CC=C3)=[N+]([O-])C2, 0 -OC1=C(C=C(C=C1C(C)(C)C)CO)C(C)(C)C, 0 -S=C(N(CC)CC)SCC(=C)Cl, 1 -P, 0 -O=NN(/C(=N\C#N)NCCSCC1=C(N=CN1)C)C, 0 -C[C@@H]3O[C@]1(CS3)C2CCN(CC2)C1.C[C@@H]6O[C@]4(CS6)C5CCN(CC5)C4.O.Cl.Cl, 0 -NC(=O)C1=C(C=CC=C1)C(=O)N, 0 -C1(=C(C=CC(=C1)[C@H](CN[C@@H](CCC2=CC=CC=C2)C)O)O)C(N)=O.[H]Cl, 0 -O=NN(CCCC)CCCC, 1 -CC(=C)CCl, 1 -S=C([S-])N(C)C.[S-]C(N(C)C)=S.[Cu+2], 0 -O=C1C2=C(C=CC=C2)C(=O)O1, 0 -O=NN(CCO)CCO, 1 -C=C(Cl)C=C, 0 -O=C(N(CCCC)N=O)N, 1 -N1=CC=CC2=CC=CC(=C12)O[Cu]OC3=CC=CC4=CC=CN=C34, 0 -O=S(=O)(C1=CC=C(C=C1)N)NC2=NC(=CC(=N2)C)C, 1 -S=P(SCC(=O)NC)(OC)OC, 0 -CCN(CC)N=O, 1 -CC(=O)NN, 1 -CC1=C(Cl)C(=O)OC2=C1C=CC(=C2)OP(=S)(OCC)OCC, 0 -CN(N=O)C, 1 -OC(=O)CCl, 0 -OC1=C(C=C(C=C1C(C)(C)C)C)C(C)(C)C, 1 -O=C1OC2=C(C=CC=C2)C=C1, 1 -C2=C(N)C=CC(S(=O)(=O)NC1ON=C(C)C=1C)=C2, 0 -ClC1=C(Cl)N=C(C(O)=O)C(Cl)=C1N, 0 -NN(CCCC)CCCC, 1 -COC1=CC(=C(C=C1)N)C, 1 -[O-]S(S(=O)[O-])(=O)=O.[K+].[K+], 0 -OC(CN(C1=CC=C(N=N1)NN)C)C.Cl.Cl, 0 -O=C/C=C/C1=CC=CC=C1, 0 -O[As](O)(C)=O, 0 -CC1CC(OC(O1)C)OC(=O)C, 1 -Cl.CCCCNN, 1 -O=S1(=O)CC=CC1, 0 -c1(n(cnc1)C)C[C@@H]2[C@@H](C(=O)OC2)CC, 0 -[Na+].[O-]C(=O)[C@@H](N)CC(O)=O, 0 -CC1CC(OC(O1)C)OC(=O)C, 0 -N(NCCCC)CCCC.Cl.Cl, 1 -O=NN(C1=CC=CC=C1)C2=CC=CC=C2, 1 -C\1=C/C(O[C@@H](C/C=C/C=C/C=C/C=C/[C@@H](C[C@@H]3O[C@](C[C@H](C[C@H]2O[C@H]/12)O)(C[C@@H]([C@H]3C(O)=O)O)O)O[C@@H]4O[C@@H]([C@H]([C@@H]([C@@H]4O)N)O)C)C)=O, 0 -NC1=CC(=CC=C1OC)C, 1 -NC1=CC=C(/C=C/C2=CC(OC)=CC=C2OC)C=C1, 1 -N(C1C=CC(=CC=1)N=O)C2=CC=CC=C2, 1 -OC(=O)CCC(=O)OCC2(CCCC)C(=O)N(c1ccccc1)N(C2=O)c3ccccc3, 0 -C1CNCCN1, 0 -O=C(NC2=C(Cl)C=NC=C2Cl)C1=CC(OC3CCCC3)=C(OC)C=C1, 1 -C1(=CC(=CC=C1N)OC)OC.[H]Cl, 0 -O=NN(CCC)CCC, 1 -CC(C)C(O)(C(C)O)C(=O)OC\C1=C\CN2CC[C@@H](OC(=O)C(\C)=C\C)[C@@H]12, 1 -C1CCNCC1, 0 -[Na+].O=C([O-])[C@@H](N)CCC(O)=O, 0 -CC(C)(C)c1cc(O)ccc1O, 0 -[N+].C1(N(N=O)[O-])=CC=CC=C1, 1 -COC1=C(C=CC(=C1)C2=CC(=C(C=C2)N=C=O)OC)N=C=O, 1 -O=C3[C@@]2(C)CC[C@]1([H])[C@](CC[C@H](OS(=O)(O)=O)C4)(C)C4=CC[C@]([H])1[C@@]([H])2CC3, 0 -CC(C)CC(=O)O[C@H]1C[C@]2(COC(C)=O)[C@@]4(C)[C@H](OC(C)=O)[C@@H](O)[C@@H](O[C@@H]2/C=C1/C)[C@]34CO3, 1 -CCCC1=CC2=C(C=C1COCCOCCOCCCC)OCO2, 1 -C(CCC(=O)O)([O-])=O.[Na+], 0 -[Ca+2].[N-2]C#N, 0 -NC1=CC=C(C2=CC=C(N)C(OC)=C2)C=C1OC.Cl.Cl, 1 -O=NN(CCCCCC1)CCCCCC1, 1 -ClC(=C(C1=CC=C(C=C1)OC)C2=CC=C(C=C2)OC)C3=CC=C(C=C3)OC, 0 -CCCC1=CC2=C(C=C1COCCOCCOCCCC)OCO2, 0 -NC(=O)NCCCC, 0 -NC(=N)NC#N, 0 -C1=CC=CC=C1C(O)C(N(C)N=O)C, 1 -S(=O)(=O)(c1ccc(Cl)cc1)c2ccc(Cl)cc2, 0 -O=[N+]([O-])C3=CC=C(O3)/C=N/N1C(O[C@@H](CN2CCOCC2)C1)=O.Cl, 1 -C1(NS(=O)(=O)[O-])CCCCC1.[Na+], 1 -CN(CC)N=O, 1 -CCN(CC)C(=O)C1=CC=CC(C)=C1, 0 -Cl.CC3CCCC(C)N3CCCC(O)(c1ccccc1)c2ccccn2, 0 -O=C1CCCO1, 0 -O=C(N(CC)N=O)OCC, 1 -[Cd+2].[O-]C(C)=O.[O-]C(C)=O, 0 -N=C\2/N=C3/O[C@H]1[C@H](O)[C@@H](CO)O[C@H]1N3/C=C/2, 0 -CC(C(O)=O)(OC1=CC=C(C=C1)C2CCCC3=C2C=CC=C3)C, 1 -[Cl-].[Cd+2].[Cl-], 1 -O[C@@H]8[C@@H](O)[C@@H]1O[C@H](CO)[C@H]8O[C@H]7O[C@H](CO)[C@@H](O[C@H]6O[C@H](CO)[C@@H](O[C@H]5O[C@H](CO)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O1)[C@H](O)[C@H]2O)[C@H](O)[C@H]3O)[C@H](O)[C@H]4O)[C@H](O)[C@H]5O)[C, 0 -O=NN1CCCCCCC1, 1 -O=C1C2=C(N=C(C=C2)C)N(C=C1C(=O)O)CC, 1 -[Cd+2].[Cl-].[Cl-].[H]O[H], 0 -O=C1CCCCC1, 0 -O(CC1(C)C)C1=O, 1 -C1=C2C(=CC=C1)C=CC=C2, 1 -O=C(C)NCCSP(=S)(OC)OC, 0 -N(C([S-])=S)(CC)CC.[S-]C(N(CC)CC)=S.[Cd+2], 0 -NC(=O)CC1=C2C(=CC=C1)C=CC=C2, 0 -O=S(=O)([O-])[O-].[Cd+2], 1 -O=NN1CCCCCC1, 1 -N1=C(SNC2CCCCC2)SC3=C1C=CC=C3, 0 -C1(NC(CN1N=O)=O)=O, 1 -OC(=O)CC1=C2C(=CC=C1)C=CC=C2, 0 -C1(CCCCC1)N.[H]Cl, 0 -O=P(H)(OC)OC, 1 -O=[C@]([C@@H]1C[C@@H](O)CN1N=O)O, 0 -[Cd+2].[Cd+2].[Cd+2].[O-]S(=O)(=O)[O-].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.O.O.O.O.O.O.O.O, 0 -C1(CCCCC1[N+]).O=S(=O)([O-])O, 0 -N(N(CC(O)=O)CC(O)=O)=O, 0 -O=C1c2c(O)cc(C)cc2C(=O)c3cc(O)cc(O)c13, 0 -NC1=C2C(=CC=C1)C(=CC=C2)N, 1 -OC1=C(C=CC(=C1)/C=C/C(=O)O)O, 1 -P(=O)(OC)(OC)N1CCOCC1, 1 -N(CC(CO)O)(C)N=O, 1 -C1=C(CO)OC=C1, 1 -C12C(=CC=CC=1NCCN)C=CC=C2.[H]Cl.[H]Cl, 0 -C(O)(=O)[O-].[K+], 1 -O=C1C2=C(N=CN2C)N(C(=O)N1C)C, 0 -ClCCN(CCCl)[P]1(=O)NCCCO1, 1 -C1(=CC(=NC(=N1)C2=CC=C(O2)[N+]([O-])=O)C)C, 1 -CN(CCO)N=O, 1 -O=CCCCC=O, 0 -C1=C2C(=CC=C1NC3=CC=C(C=C3)NC4=CC=C5C(=C4)C=CC=C5)C=CC=C2, 0 -.[K+].[Cl-], 0 -C[C@H](C\C=C\C)[C@@H](O)[C@@H]1N(C)C(=O)[C@H](C(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](NC(=O)[C@H](CC(C)C)N(C)C(=O)CN(C)C(=O)[C@H](CC)NC1=O)C(C)C, 0 -N(N(CCCO)C)=O, 1 -NC(=S)NC1=C2C(=CC=C1)C=CC=C2, 0 -CC(C)NCC(O)COc1ccc(cc1)NC(C)=O, 0 -O=[As](O)(O)[O-].[Na+], 0 -O=C1[C@H]3[C@H](C3)[C@@]([C@]4([H])[C@@]([C@@]5([H])[C@]([C@@](CC5)(OC(C)=O)[C@@](C)=O)(C)CC4)([H])C=C2Cl)(C)C2=C1, 1 -O=C(C1=CC=C(C=C1)C(=O)OC)OC, 0 -CC(O)CN(C)N=O, 1 -[As]21O[As]3O[As](O1)O[As](O2)O3, 0 -O=C(O)[C@H](CS)N.Cl, 0 -CN(C)C(C)=O, 0 -CN(CC(C)=O)N=O, 1 -[Na+].[As](=O)[O-], 0 -C(C(C)O)(O[Ca]OC(C(C)O)=O)=O, 0 -O=C(/C=C(C(C1=CC=C(C=C1)OC)=O)/Br)[O-].[Na+], 1 -O=NN(C)CCOS(C1=CC=C(C)C=C1)(=O)=O, 1 -NC1=CC2=C(C=CC=C2)C=C1, 1 -O.O=C(Nc3cccc1c3O/C(=C\C1=O)C2=N\N\N=N2)c5ccc(OCCCCc4ccccc4)cc5.O=C(Nc3cccc1c3O/C(=C\C1=O)/C=2N\N=N/N=2)c5ccc(OCCCCc4ccccc4)cc5, 0 -O=C(N)C1=C(N=CN1)/N=N/N(C)C, 1 -C1(=C2C(=CC=C1N)C=CC=C2)S(=O)(O)=O, 0 -O=C1N(C2=CC=C(C=C2C(=NC1)C3=CC=CC=C3)Cl)CC4CC4, 0 -OC=1[C@H](OC(=O)C=1O)[C@@H](O)CO, 0 -O=C(CN1C(=O)CCC1)NC2=C(C=CC=C2C)C, 0 -O=C1N2C(C3=C(C=CC=C3)CC2)CN(C1)C(=O)C4CCCCC4, 0 -O=C([C@H](CC1=CC=CC=C1)NC(=O)[C@H](CC(=O)O)N)OC, 0 -CC(OC(=O)OC1CCCCC1)OC(=O)c5cccc6nc(OCC)n(Cc2ccc(cc2)c3ccccc3C\4=N\N=N/N/4)c56, 0 -[Ni], 0 -O=C(CCC(=O)O)NN(C)C, 1 -OC(=O)C1=C(C=CC=C1)OC(=O)C, 0 -C([O-])(C)=O.[O-]C(C)=O.[Ni+2], 0 -O=S(=O)(C1=CC=C(C=C1)N)C2=CC=C(C=C2)N, 1 -OCC(=O)[C@@]3(O)CC[C@H]2[C@@H]4CC\C1=C\C(=O)/C=C\[C@]1(C)[C@H]4C(=O)C[C@@]23C, 0 -CN(C1=CC=CC=C1)N=O, 1 -O=C1CCCCCN1, 0 -ClC(C(C1=C(C=CC=C1)Cl)C2=CC=C(C=C2)Cl)Cl, 0 -C1=CC=C(C(C(=O)OC)C2N(N=O)CCCC2)C=C1, 0 -S=C(N(CCCC)CCCC)S[Ni]SC(=S)N(CCCC)CCCC, 0 -OC1=C(C=C(C=C1)CNC(=O)CCCC/C=C/C(C)C)OC, 1 -ClC(C(C1=CC=C(C=C1)Cl)C2=CC=C(C=C2)Cl)Cl, 1 -CC1=CC=CC=C1OCC(O)CNCCN2/C=C(/C)C(=O)NC2=O.[H]Cl, 0 -CN(CCCCCCCCCCC)N=O, 1 -O=S(=O)([O-])[O-].O.O.O.O.O.O.[Ni+2], 0 -C1=CC=C5C(=C1)N(CC2=CC=C(F)C=C2)C(NC4CCN(CCC3=CC=C(OC)C=C3)CC4)=N5, 0 -C12C(C(=O)N(C1=O)SC(C(Cl)Cl)(Cl)Cl)C\C=C/C2, 1 -ClC(=C(C1=CC=C(C=C1)Cl)C2=CC=C(C=C2)Cl)Cl, 1 -O=NN1CCOCC1, 1 -NC(=O)C1=CC=CN=C1, 0 -CC(C)NCC(O)COC1(=CC=C(C=C1)CC(=O)N).[H]Cl, 0 -O=C1N(C(=O)C2C1CC=CC2)SC(Cl)(Cl)Cl, 1 -ClC(C(C1=CC=C(C=C1)Cl)C2=CC=C(C=C2)Cl)(Cl)Cl, 1 -C1=CC=C(C=[N+]1[O-])C2CCCN2N=O, 1 -ClC1=NC(=NC(=N1)NC(C)C)NCC, 1 -C(NN)(N)=O.Cl, 1 -BrC1=C(OC2=C(Br)C(Br)=C(Br)C(Br)=C2Br)C(Br)=C(Br)C(Br)=C1Br, 1 -O=NN(CCC1)C(C1)C(=O)O, 0 -CN(CCC2)[C@@H]2[C@]1=CN=CC=C1, 0 -O=C(O[C@@H]2C[C@@H](CC3)N(C)[C@H]3C2)C(CO)C1=CC=CC=C1, 0 -NC(=O)NNC1=CC=CC=C1, 1 -O=NN(CCN1)CC1, 1 -CN(CCC2)[C@@H]2[C@]1=CN=CC=C1.Cl, 0 -N=C(C2=CC=C(N(C)C)C=C2)C1=CC=C(N(C)C)C=C1.[H]Cl, 1 -O[As](=O)(C1=CC=C(C=C1)NC(=O)N)O, 0 -CNNCC1(=CC=C(C=C1)C(=O)NC(C)C).[H]Cl, 1 -NC(N3C)=NC2=C3C(C)=CC1=NC=CC=C12, 1 -OC(=O)C1=CC=CN=C1, 0 -CC(=O)O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1OC(=O)C)COC(=O)C)S[Au]=P(CC)(CC)CC)OC(=O)C, 0 -O[C@@H]3C\C4=C\C[C@@H]2[C@H](CC[C@]1(C)C(=O)CC[C@H]12)[C@@]4(C)CC3, 1 -CN1C2=C(C3=NC(=CN=C3C=C2)C)N=C1N, 1 -O=C(C1=CC=CN=C1)NN, 1 -N/C1=N/C(=O)N(/C=N1)[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O, 1 -C12C3=C(C=CC=C3)NC1=CC=CC=2, 1 -N1(C2C(SC3=C1C=CC=C3)=CC=CC=2)CC(N(C)C)C.[H]Cl, 0 -O=C(NC)OC1=CC=CC(C2)=C1OC2(C)C, 0 -O=NN1CCCCC1, 1 -C1=CC=C2C(=C1)C=C(C=C2)C(CNC(C)C)O, 0 -OC(C(C=CC=C1)=C1S(N2C)(=O)=O)=C2C(NC3=NC=C(C)S3)=O, 0 -CC(=O)O[C@@H]3C\C4=C\C[C@@H]2[C@H](CC[C@]1(C)C(=O)CC[C@H]12)[C@@]4(C)CC3, 1 -O=NN1CCC[C@H]1[C@@](O)=O, 0 -C12=C(C=CC(=C1)C(CNC(C)C)O)C=CC=C2.[H]Cl, 0 -OC([C@H](CC1=CC=C(N(CCCl)CCCl)C=C1)N)=O, 1 -[O-][N+](C1=CN=C(NC(NCC)=O)S1)=O, 1 -Br/C(Br)=C/[C@H]3[C@@H](C(=O)O[C@H](C#N)c2cccc(Oc1ccccc1)c2)C3(C)C, 0 -[O-][N+](C(N=C3)=C(SC1=NC=NC2=C1NC=N2)N3C)=O, 1 -O=NN1CCCC1, 1 -O=S1(=O)CCCO1, 1 -OC(CC(C1)C)C(C1)C(C)C, 0 -O=[N+]([O-])[O-].[Na+], 0 -ClC(Cl)(Cl)Cl, 1 -CC1SC(SC(N1N=O)C)C, 1 -ClC1=NC(=NC(=N1)NC(C)C)NC(C)C, 0 -N(C(=O)N)(N=O)CC(=O)O, 1 -O=NN1CCSCC1, 1 -O=C1CCO1, 1 -[O-][N+](C1=CC=CC(C2C(C(OC3CN(C(C5=CC=CC=C5)C4=CC=CC=C4)C3)=O)=C(NC(C)=C2C(OC(C)C)=O)N)=C1)=O, 0 -BrC(C(=O)NC(=O)N)(CC)CC, 0 -CC1=C(C=CC=C1)N=O, 1 -OC(COC1=CC=CC2=C1C=CC=C2)CNC(C)C.[H]Cl, 0 -SC1=NC2=C(C=CC=C2)S1, 1 -OC(=O)CN(CC(=O)O)CC(=O)O, 1 -[Na+].[N-]=[N+]=[N-], 0 -CC2(C)CCCC(\C)=C2\C=C\C(\C)=C\C=C\C(\C)=C\C=C\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(/C)CCCC1(C)C, 0 -N#[N+][O-], 0 -O=C(N(CCCC)CC)SCCC, 0 -[S-]C1=NC(C=CC=C2)=C2S1.[S-]C3=NC(C=CC=C4)=C4S3.[Zn+2], 0 -O=C1C2=C(C=CC=C2)N=NN1CSP(=S)(OC)OC, 0 -C1(/N=N/C2=CC=CC=C2)=CC=CC=C1, 1 -N(CC(=O)[O-])(CC(=O)[O-])CC(=O)[O-].[Na+].[Na+].[Na+].O, 1 -C[N+](=NC)[O-], 1 -O=C1C[C@H](C\C=C1\C)C(C)=C, 0 -O=C2CC3=C(CC2)[C@]1([H])[C@](CC3)([H])[C@@](CC4)([H])[C@]([C@]4(O)C#C)(C)CC1, 0 -O=N[O-].[Na+], 1 -[N+](=N/CCC)(/CCC)[O-], 1 -OC1=C(C=CC=C1)O, 1 -CC(N(C1=CC=CC2=C1CC3=C2C=CC=C3)C(C)=O)=O, 1 -S=C1NC=NC2=C1N=CN2, 0 -O=[N+](C1=CC(=C(C=C1)OC)N)[O-], 1 -C\C1=C\N(C(=O)NC1=O)[C@H]2C[C@H](/N=[N+]=[N-])[C@@H](CO)O2, 1 -C1(=C(C=CC(=C1)NC(N(CC)CC)=O)OCC(CNC(C)(C)C)O)C(C)=O, 0 -O=[N+](C1=CC=C(O1)/C=N/NC(=O)N)[O-], 1 -CC(=O)NNC(=O)C, 0 -COc3cc4CC[C@@H]1[C@H](CC[C@]2(C)[C@@](O)(CC[C@@H]12)C#C)c4cc3, 0 -O=C(O[C@H](C)C2)C1=C2C(Cl)=CC(C(N[C@@H](CC3=CC=CC=C3)[C@@](O)=O)=O)=C1O, 1 -[O-][N+](C3=CC=C(O3)C1=CN=C2N1C=CC=C2)=O, 1 -O=C(C1=C(C=CC=C1)C(=O)OCC=C)OCC=C, 0 -ClC1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)C(=C(Cl)Cl)Cl, 0 -CN(C)CCN(CC1=CC=CO1)C2=CC=CC=N2, 0 -N(N)(CC=C)CC=C, 1 -CC(=O)[O-].[O-]C(=O)C.[Ba+2], 0 -N(NCC=C)CC=C.[H]Cl.[H]Cl, 1 -CN(C)CCN(CC1=CC=CS1)C2=CC=CC=C2, 0 -O=C(C)NCC1=NC(=NO1)C2=CC=C(O2)[N+]([O-])=O, 1 -[Cl-].[Ba+2].[Cl-].O.O, 0 -ClCCN(C1=CC=C(C=C1)CCCC(=O)O)CCCl, 1 -C=CCN(CC=C)N=O, 1 -C(C\C=C/CCCCCCCC)CCCCCC(=O)[O-].[Na+], 0 -CN(C)CCN(CC2=CC=CS2)C1=NC=CC=C1.Cl, 1 -NC2=NC(C3=CC=CC=C3)=C(CCOCC)C1=NC=NN12, 1 -CC(=O)NC1=NN=C(S1)C2=CC=C(O2)[N+]([O-])=O, 1 -NC1C=CC2=C(N=1)NC3=CC=CC=C23, 1 -O=C(C1=CC(=CC=C1O)/N=N/C2=CC=C(C=C2)C(=O)O)O, 0 -C1(=C(/C=C/C2=C(S(=O)(=O)[O-])C=C(C=C2)N)C=CC(=C1)N)S(=O)(=O)[O-].[Na+].[Na+], 0 -CC1=C(SSC1=S)C2=CN=CC=N2, 0 -[O-][N+](C2=CC=C(O2)C1=CSC=N1)=O, 1 -CC=O, 1 -O=CC1=CC=CC=C1, 1 -O=C1C(=C(C(=O)C(=C1Cl)Cl)Cl)Cl, 0 -NC(C=C(C=C1)N)=C1OC.O=S(O)(O)=O, 1 -N/1C(N(\C=C\1)C)=S, 1 -[O-][N+](C1=CC=C(C2=CSC(NC(C)=O)=N2)O1)=O, 1 -CC=NN(C)C=O, 1 -C1=CC=CC=C1, 1 -ClC2(C(Cl)3Cl)C(Cl)=C(Cl)C3(Cl)C1CC(Cl)C(Cl)C12, 1 -NC1=CC=C(C=C1)/N=N/C2=CC=C(C=C2)N, 0 -NC(C(=O)O)CCSC, 0 -[O-][N+](=O)C1=CC=C(O1)C2=CSC(=N2)NC=O, 1 -ClC2(Cl)C1(Cl)C(\Cl)=C(\Cl)C2(Cl)C(C1C(O)=O)C(O)=O, 1 -NC1=C2C(=NC(=N1)N)N=CC(=N2)CN(C3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)O)C(=O)O)C, 0 -CC(=O)N, 1 -NC1=CC=C(C2=CC=C(N)C=C2)C=C1, 1 -O=S(C1=NC2=C(C=CC(=C2)OC)N1)CC3=C(C(=C(C=N3)C)OC)C, 1 -NC2=CC=C(C(OC)=C2)\N=N/C1=CC=CC=C1, 0 -C1(=CC=C(C=C1)O)NC(C)=O, 1 -C1(C2=CC=C(C=C2)N)=CC=C(C=C1)N.[H]Cl.[H]Cl, 1 -O[As](=O)(C1=CC(=C(C=C1)O)[N+](=O)[O-])O, 0 -O=S(=O)(C1=CC=C(C=C1)C(=O)C)NC(=O)NC2CCCCC2, 0 -C1=CC2=CC=CC3=CC=C4C(=C23)C1=C5C(=C4)C=CC=C5, 1 -C12(=C(C=C(C=C1C=CC(=C2/N=N/C3=CC=CC=C3)O)S(=O)(=O)[O-])S(=O)(=O)[O-]).[Na+].[Na+], 0 -NC1=C(C=C2C3=C(C=CC=C3)OC2=C1)OC, 1 -O=[N+](C1=CC(=C(C=C1)N)N)[O-], 0 -O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].Cl[O-].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+], 0 -CC#N, 0 -ClC(C(C1=CC=C(C=C1)OC)C2=CC=C(C=C2)OC)(Cl)Cl, 0 -O=[N+](C1=CC(=C(C=C1)C)N)[O-], 1 -C1(=CC=CC=C1)C(=O)[O-].[Na+], 0 -C1=COC2=C1C=CC=C2, 1 -ClCl, 0 -O=C(C(=NOC(=O)NC)SC)N(C)C, 0 -COC1=CC=C(C=C1)O, 1 -NC1=NC(=NC(=N1)N)C2=CC=CC=C2, 0 -ClC1=CC=C2C(=C1)C(=NC(O)C(=O)N2)C3=CC=CC=C3, 1 -O=[N+](C1=CC=C2C3=C1C=CC=C3CC2)[O-], 1 -C1=CC=C(C(OC)C(=O)O)C=C1, 0 -NC1=CC=C(C=C1)OC2=CC=C(C=C2)Cl, 1 -O=C(C)NC3=CC=C(C2=C3)C1=C(C2=O)C=CC=C1, 1 -O=[N+](C1=CC=C(C=C1)N)[O-], 0 -N(NC(C)=O)C1=CC=C(C=C1)CO, 1 -C1=CC=CC(=C1)C(C(C2=CC=CC=C2)=O)O, 0 -O=C1OC(O)C(C(Cl)Cl)=C1Cl, 1 -N(NC(C)=O)C(C1=CC=NC=C1)=O, 1 -O=C1C=CC(=O)C=C1, 1 -COC1=C2C(=CC3=C1OC=C3)C=CC(=O)O2, 1 -COC1=C(C=CC=C1)[N+](=O)[O-], 1 -O=C1C(C(=O)OC(=C1)C)C(=O)C, 0 -N1=C(SSC2=NC3=C(C=CC=C3)S2)SC4=C1C=CC=C4, 0 -ClC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-], 0 -[O-]\[N+](C)=N/CC, 1 -O=[N+](C1=CC(=C(C=C1)C(=O)O)N)[O-], 0 -C1(NNC(C)=O)=CC=CC=C1, 1 -N1C2=C(C=CC=C2)N=N1, 0 -CC(=C)CCl, 1 -O=C(N(CC(C)=O)N=O)NCCCl, 1 -N[C@@H](C\C1=C\N=C/N1)C(O)=O.Cl, 0 -CBr, 0 -O=[N+](C1=CC=CC=C1)[O-], 1 -ClC(C1=CC=CC=C1)(Cl)Cl, 1 -N(C(=O)N)(N=O)CC(C)=O, 1 -CC(OC)(C)C, 1 -O=[N+](C1=CC2=C(C=C1)NC=N2)[O-], 1 -O=C(C1=CC=CC=C1)NN, 1 -NN, 1 -NC(=O)OC, 1 -ClC1=C(C=CC=C1)[N+](=O)[O-], 1 -C12C3=C(C=CC=C3)CC1=CC(=CC=2)NC(C)=O, 1 -OC(CNC(C)C)COC1=CC=CC=C1OCC=C.Cl, 0 -OS(=O)(=O)O.NN, 1 -O=C(NN)OC, 0 -O=[N+](C1=CC=C(C=C1)Cl)[O-], 1 -NC1=CC=C(C=C1)OC2=CC=C(C=C2)N, 1 -C1(N=C(SC=1)NN)C2=CC=C(C=C2)N, 1 -O=C(C(C)(OC1=CC=C(C=C1)C2=CC=C(C=C2)Cl)C)OC, 1 -Cl.O=P1(OCC(C)(C)CO1)C\4=C(/C)NC(/C)=C(/C(=O)OCCN(Cc2ccccc2)c3ccccc3)C/4c5cccc(c5)[N+]([O-])=O.CCO, 0 -NC1=C(C=CC(=C1)N)Cl, 1 -S=C(N1CCOCC1)SN1CCOCC1, 1 -NNC1=NC(=CS1)C2=CC=C(O2)[N+]([O-])=O, 1 -[K+].C1(=CC=C2C(=N1)N(C=C(C2=O)C([O-])=O)C)/C=C/C3=CC=C(O3)[N+]([O-])=O, 1 -O=[N+](CC)[O-], 0 -CC(=O)OCC1=CC=CC=C1, 1 -NC1=C(C=CC(=C1)Cl)N, 1 -N1=C(SC2=C1C=CC=C2)SN3CCOCC3, 0 -NNC1=NC(C2=CC=C([N+]([O-])=O)C=C2)=CS1, 1 -OCC1=CC=CC=C1, 0 -Nc1cc(Cl)c(N)cc1.OS(O)(=O)=O, 0 -O=C1[C@](C(O)=C2[C@@]3([H])[C@@](O)(C)C4=C(C(O)=CC=C4)C2=O)(O)[C@]([C@H]3O)([H])[C@H](N(C)C)C(O)=C1C(N)=O.Cl, 0 -O=C(O)Cc1ccc(cc1)NC(C)=O, 0 -ClCC1=CC=CC=C1, 1 -ClC1=C(C=CC(=C1)Cl)OC2=CC=C(C=C2)[N+](=O)[O-], 1 -ClC1=C(C=CC(=C1)N)C, 0 -O=C(OC)C1=C(C)NC(C)=C(C(OCC(C)(C)CN(CC3=CC=CC=C3)C)=O)C1C2=CC([N+]([O-])=O)=CC=C2F.Cl, 0 -[O-][N+](=O)c1ccc2c3ccccc3Cc2c1, 1 -OC(=O)C1=C(C=CC(=C1)OC2=CC=C(C=C2Cl)C(F)(F)F)[N+](=O)[O-], 1 -NC1=CC(=CC=C1C)Cl, 1 -CN(N)C=O, 1 -O=C1N(CC(=O)N1)/N=C/C2=CC=C(O2)[N+](=O)[O-], 1 -C1(=CC=C(NN)C=C1)C(O)=O.[H]Cl, 1 -C=CC=O, 0 -C1(=C(C=CC(=C1)Cl)N)C.[H]Cl, 1 -O=C(C3)C(C(O)=CC(O[C@H]4[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO[C@H]5[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O5)O4)=C2)=C2O[C@@H]3[C@@]1=CC(OC)=C(OC)C=C1, 0 -[O-][N+](=O)C1=CC=C(O1)C=NN2CCNC2=O, 1 -C=CC(OCC)OCC, 0 -C(CCl)(F)(F)F, 1 -N(C1=CC=CC=C1)NC2=CC=CC=C2, 1 -C=C/C=N/O, 0 -CN1C2=C(C(OC)=CC3=C2C=CC(O3)(C)C)C(C4=C1C=CC=C4)=O, 1 -NC(=O)Cc2c([O-])on[n+]2Cc1ccccc1, 1 -ClC(Cl)C(F)(F)F, 1 -O=C(C(=C)C)OC, 0 -NC(=O)C=C, 1 -[Be+2].O=S(=O)([O-])[O-], 0 -O=S1(=O)C2=C(C=C(C(=C2)S(=O)(=O)N)Cl)NCN1, 0 -CS(=O)(=O)OC, 1 -[O-][N+](C)=O, 1 -ClC1=CC(=NC(=N1)SCC(=O)O)NC2=CC=CC(=C2C)C, 1 -OC(=O)C=C, 0 -OCC(=O)[C@@]2(O)CC[C@H]3[C@@H]4CC\C1=C\C(=O)CC[C@]1(C)[C@H]4[C@@H](O)C[C@]23C, 0 -N=C(N(N=O)C)N[N+](=O)[O-], 1 -O=[N+](C1=C2C(=CC=C1)C=CC=C2)[O-], 0 -ClC1=NC(SCC(NCCO)=O)=NC(NC2=CC=CC(C)=C2C)=C1, 1 -C=CC#N, 1 -O=C1C2=C(C(=CC=C2C(=O)C3=C1C=CC=C3)C)[N+](=O)[O-], 1 -O=C(OCC2=CC=CC(C3=CC=CC=C3)=C2C)C1C(C)(C)C1/C=C(Cl)/C(F)(F)F, 0 -OC1=CC=C(C=C1)O, 1 -C1=C(C=CC=C1)C2=CC=CC=C2, 0 -O=C(C1=CC=CC=C1)CCl, 0 -OC1=CC=C(C=C1)OCC2=CC=CC=C2, 0 -OC(=O)C(C)(C)CCCOc1ccc(OCCCC(C)(C)C(O)=O)c(c1)c2ccccc2, 1 -ClCC(=O)C1=CC=C(NC(=O)C)C=C1, 0 -O=[N+](CCC)[O-], 0 -C12C(OC3=C(N=1)C(=CC=C3C)C(N[C@@H]4C(N[C@@H](C(N5[C@@H](CCC5)C(N(CC(N([C@H](C(O[C@H]4C)=O)C(C)C)C)=O)C)=O)=O)C(C)C)=O)=O)=C(C(C(=C2C(N[C@@H]6C(N[C@@H](C(N7[C@@H](CCC7)C(N(CC(N([C@H](C(O[C@H]6C)=O)C(C)C)C)=O)C)=O)=O)C(C)C)=O)=O)N)=O)C, 1 -NC1=CC=C(C=C1)Cl, 0 -CC([N+](=O)[O-])C, 0 -NC(=O)CCCCC(=O)N, 0 -OCC(CO)(CBr)CBr, 1 -C1(=CC=C(Cl)C=C1)N.[H]Cl, 1 -C(C1C=CC=CC=1)(=O)N(N=O)C, 1 -OC(=O)CC[N+](=O)[O-], 0 -CC(=O)N(O)C1=CC2=C(C=C1)C3=CC=CC=C3C2, 1 -O=C(N)\C(C2=CC=CO2)=C/C1=CC=C([N+]([O-])=O)O1, 1 -C1C(CC(CC1(OOC(C)(C)C)OOC(C)(C)C)(C)C)C, 0 -ClC1=CC=CC=C1C=C(C#N)C#N, 0 -C1(=CC(=CC(=C1N)C)C)C.[H]Cl, 1 -CN(N=O)C(=O)NCCC[C@H](N)C(O)=O, 1 -O=[N+](C1=CC=C2C3=C4C(=CC=C13)C=CC=C4C=C2)[O-], 1 -CCCC[Sn](O[Sn](CCCC)(CCCC)CCCC)(CCCC)CCCC, 0 -O=[N+](C1=CC2=CC=CN=C2C=C1)[O-], 0 -C12=C3C(C4=C(C(O3)=O)C(=O)CC4)=C(C=C1OC5C2C=CO5)OC, 1 -CC(CCl)OC(C)CCl, 1 -OC(C1=CC=C(C=C1)Cl)(C2=CC=C(C=C2)Cl)C(=O)OCC, 1 -O=[N+](C1=CC=CC2=CC=CN=C12)[O-], 1 -O=C1C2=C(C=CC=C2C(=O)C3=C1C=CC=C3)O, 1 -S=P(OC1=CC=C(C=C1)[N+](=O)[O-])(OC)OC, 0 -N(CCCC(F)(F)F)(CCCC(F)(F)F)N=O, 1 -C1(OCC=C)=CC=C(CC(=O)O)C=C1Cl, 0 -CC(C1=C(C(=C(C(=C1[N+](=O)[O-])C)[N+](=O)[O-])C)[N+](=O)[O-])(C)C, 1 -O=C1N(CCC1)C, 1 -N1C(N(CC(C1=O)C)N=O)=O, 0 -CC(C=NOC(=O)NC)(SC)C, 0 -[O-][N+](C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1)=O, 0 -CNC1=NC=NC2=C1N=CN2, 0 -O=NN1CCC(=O)NC1=O, 1 -O=C(N(CCO)N=O)NCC, 1 -O=[N+](OC(CO[N+](=O)[O-])CO[N+](=O)[O-])[O-], 1 -O[C@H]([C@@H]2O)[C@@H](O[C@@H]2CO)N1C(N=CN=C3NC)=C3N=C1, 0 -O=C(N(CCO)N=O)N, 1 -CC(=O)O[Sn](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3, 0 -O[Sn](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3, 0 -ClCOCCl, 1 -N(CC(CO)O)(CC(O)C)N=O, 1 -O=P(OCC(CBr)Br)([O-])OCC(CBr)Br.O=P(OCC(CBr)Br)([O-])OCC(CBr)Br.[Mg+2], 1 -N(CC(CO)O)(CC(C)=O)N=O, 1 -O=C1C(NC(=O)N1)NC(=O)N, 0 -CC(C/C=N/N(C=O)C)C, 1 -O=C(N(CCCO)N=O)N, 1 -CC3=CC=C(C=C3)\C(C2=CC=CC=N2)=C/CN1CCCC1.O.Cl, 0 -C=CCO, 0 -C1=CC=C2C(=C1)N=C(N=C2N(CCO)CCO)C3=CC=C(S3)[N+]([O-])=O, 1 -OC1=C(C=CC(=C1)C)O, 1 -O=P(OCCCl)(OCCCl)OCCCl, 1 -C=CCCl, 0 -OC1=CC=CC2=CC=CN=C12, 0 -O=C(N(CCO)N=O)NCCCl, 1 -OC(C=C)C1=CC=C2OCOC2=C1, 1 -Oc1ccc(C[C@](C)(N)C(O)=O)cc1O.OC(=O)[C@@](C)(N)Cc1cc(O)c(O)cc1.O.O.O, 0 -O=P(OCC(CBr)Br)(OCC(CBr)Br)OCC(CBr)Br, 1 -C1CO1, 1 -C1(=C(C=CC(=C1)CCNC)OC(C(C)C)=O)OC(C(C)C)=O.[H]Cl, 0 -O=C(N(CC(C)O)N=O)NCCCl, 1 -O=C(CC(C)C)OCC=C, 1 -S=C1NCCN1, 1 -C2C(=O)NC(=O)CN2CC(C)N1CC(=O)NC(=O)C1, 1 -ClC1=C(C=CC(=C1)CC2=CC(=C(C=C2)N)Cl)N, 1 -N(CC(C)O)(CCO)N=O, 1 -NC(=O)N(CC=C)N=O, 1 -O=C1NCCN1, 0 -FC(F)(F)CNC(=N)Nc1ccn(CCCCC(N)=O)n1, 1 -N1C2=C(C3=C1C=CC=C3)C(=NC(=C2C)N)C.CC(=O)O, 1 -[Na+].[Na+].S=C(NCCNC(=S)[S-])[S-], 0 -CS(=O)(=O)OCCCNCCCOS(C)(=O)=O.[H]Cl, 0 -CC1=C(C=CC(=C1)CC2=CC(=C(C=C2)N)C)N, 1 -S=C(N(C)C)S[Bi](SC(=S)N(C)C)SC(=S)N(C)C, 0 -N1C2=C(C3=C1C=CC=C3)C(=NC(=C2)N)C.CC(=O)O, 1 -N(CC(=O)[O-])CC(=O)O.[Na+], 0 -ClCCl, 1 -CN(C)C2=CC=C(C=C2)CC1=CC=C(N(C)C)C=C1, 1 -C=CCNN.HCl, 1 -C(C1C=CC(=CC=1)O)(C2=CC=C(C=C2)O)(C)C, 0 -O=C(O)[C@@H](N)CC1=CNC2=C1C=CC=C2, 0 -CCC(COC(=O)CCCCC(=O)OCC(CCCC)CC)CCCC, 1 -OC(=O)CC1=CNC2=C1C=CC=C2, 0 -O=S(=O)([O-])[O-].O=S(=O)([O-])[O-].[Al+3].[K+], 0 -C12C(=C(C=CC=1NC(C)=O)S(=O)(=O)[O-])C=C(C(=C2O)/N=N/C3=C4C(=C(C=C3)/N=N\C5=CC=C(C=C5)S(=O)(=O)[O-])C=CC(=C4)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+].[Na+].[Na+], 0 -O=C(C1=C(C=CC=C1)C(=O)OCC(CCCC)CC)OCC(CCCC)CC, 1 -O=C(NC2=C1C=C(C3=NNC(CC3)=O)C=C2)C1(C)C, 1 -O=C1C2=C(C(=CC(=C2C(=O)C3=C1C=CC=C3)Br)Br)N, 1 -NC1=C5C(C=C(S(=O)([O-])=O)C(/N=N/C6=CC=CC=C6)=C5O)=CC(S(=O)([O-])=O)=C1/N=N/C2=CC=C(C3=CC=C(/N=N/C4=C(N)C=C(N)C=C4)C=C3)C=C2.[Na+].[Na+], 1 -OC1=C(C=C(C=C1C(C)(C)C)C)CC2=CC(=CC(=C2O)C(C)(C)C)C, 0 -O=S(C1=C(/N=N/C2=CC=C(C3=CC=C(\N=N/C4=C(S(=O)([O-])=O)C=C5C(C(N)=CC(S(=O)([O-])=O)=C5)=C4O)C=C3)C=C2)C(O)=C(C(N)=CC(S(=O)([O-])=O)=C6)C6=C1)([O-])=O.[Na+].[Na+].[Na+].[Na+], 1 -O=[W](=O)([O-])[O-].[Na+].[Na+], 0 -C(C1=CC=C(C=C1)N)C2=CC=C(C=C2)N.[H]Cl.[H]Cl, 1 -CCNN.[H]Cl, 1 -CCN1(C2C(=CC=CC=2)C3=C1C=CC(=C3)N).[H]Cl, 1 -C12C(=CC(=C(C=1O)/N=N/C3=C(C=C(C=C3)C4=CC(=C(C=C4)/N=N/C5=C(C=C6C(=C5O)C(=CC(=C6)S(=O)(=O)[O-])N)S(=O)(=O)[O-])OC)OC)S(=O)(=O)[O-])C=C(C=C2N)S(=O)(=O)[O-].[Na+].[Na+].[Na+].[Na+], 1 -O=C(N(CC)N=O)NCCO, 1 -NC1=CC(S(=O)([O-])=O)=CC2=C1C(O[Cu]OC4=C(C=CC(C5=CC(O[Cu]OC7=C(C(S(=O)([O-])=O)=CC8=C7C(N)=CC(S(=O)([O-])=O)=C8)\N=N6)=C/6C=C5)=C4)\N=N3)=C/3C(S(=O)([O-])=O)=C2.[Na+].[Na+].[Na+].[Na+], 1 -N=C(N)NC1=NC(CSCCNC2=NSN=C2N)=CS1, 1 -O=C1C2=C(C(=CC=C2N)N)C(=O)C3=C(C=CC(=C13)N)N, 1 -O=C(O[C@H](CC)C(/C=C(C)/C=C/C4=O)CO[C@H](O[C@H](C)[C@H]2O)[C@H](OC)[C@@H]2OC)C[C@@H](O)[C@H](C)[C@H]([C@@H](CC=O)C[C@H]4C)O[C@H]1[C@H](O)[C@@H](N(C)C)[C@H](O[C@H](O[C@@H](C)[C@@H]3O)C[C@@]3(C)O)[C@@H](C)O1.OC(C)C(O)=O, 0 -O=C(N(CC)N=O)NCC(=O)C, 1 -CNN, 1 -O=C1C2=C(C(=CC=C2C(=O)C3=C1C=CC=C3)C)N, 1 -O=S(=O)(C1=C(C=CC=C1)/C(=C2\C=C/C(=[N+](/CC3=CC(=CC=C3)S(=O)(=O)[O-])CC)C=C2)C4=CC=C(C=C4)N(CC5=CC(=CC=C5)S(=O)(=O)[O-])CC)[O-].[Na+].[Na+], 0 -O=C1NC(=O)NC=C1, 1 -N#CN(CC)N=O, 1 -IC(I)I, 0 -N(C)[N+].S(=O)(=O)([O-])O, 1 -O1C(=NN=C1C2OC(=CC=2)[N+](=O)[O-])N, 1 -COc3ccccc3N2CCN(CCCN\C1=C\C(=O)N(C)C(=O)N1C)CC2, 0 -O=C(NCCCN(CC)CC)CN1N=CC(C3=CC=CC=C3)=C1C2=CC=CC=C2.O=C(O)/C([H])=C([H])/C(O)=O, 0 -NC1=NN=C(C2=CC=C([N+]([O-])=O)O2)S1, 1 -C(N)(N)=O, 0 -NC1=NC(C3=C(N=CC=C3)C=C2)=C2N1C, 1 -CC1=C2C(=CC=C1)C=CC=C2, 0 -C1(=C2/C(C3=CC(S(=O)(=O)[O-])=CC=C3N2)=O)/C(C4=CC(S(=O)(=O)[O-])=CC=C4N1)=O.[Na+].[Na+], 0 -NC(=O)OCC, 1 -CC(=O)O[C@H]\1CC[C@H]4C(=C/1)/CC[C@@H]2[C@@H]4CC[C@]3(C)[C@@](CC[C@@H]23)(C#C)OC(C)=O, 0 -NC1=NC(C3=C(N=CC=C3)C=C2)=C2N1C.[H]Cl, 1 -CC2=CC1=CC=CC=C1C=C2, 0 -C1(=C(C=CC(=C1)N(CCO)CCO)NC)[N+]([O-])=O, 1 -O=S(=O)([O-])[O-].[V+2]=O, 0 -CCC1(C2=C(C3=C(C(=CC=C3)CC)N2)CCO1)CC(=O)O, 0 -O=C(O[C@@H]1CC[N+]2([O-])[C@@]([H])1C3=CC2)\C(C[C@@H](C)[C@](O)(CO)C(OC3)=O)=C([H])/C, 1 -CN[N+](=O)[O-], 1 -NC1=NC(C2=CC=C([N+]([O-])=O)O2)=CS1, 1 -NC1=NC(/C=C/C2=CC=C([N+]([O-])=O)O2)=NO1, 1 -C1(=C(C=CC(=C1)N(CCO)CCO)NCCO)[N+]([O-])=O, 0 -OC1=C(C=C(C=C1)CC=C)OC, 0 -C1(C(OCC(C)C)=O)=CC=C(O)C=C1, 0 -OB(O)O, 0 -Cl.N#Cc1ccc(cc1)C3CCCc2cncn23, 0 -Br(=O)(=O)[O-].[K+], 1 -C(CCCN(N=O)C)(O)C1C=NC=CC=1, 1 -O=CCBr, 0 -O=C(C1=CC=CN=C1)CCCN(N=O)C, 1 -CC(=O)OC=C, 1 -[Na+].CN(C)c1ccc(/N=N/S([O-])(=O)=O)cc1, 0 -CC(CON=O)C, 1 -C=CBr, 1 -O.O.O.O.NC(=O)[C@@H]3CCCN3C(=O)[C@@H](NC(=O)[C@@H]1CC(=O)N(C)C(=O)N1)C\C2=C\N=C/N2, 0 -O=[N+](C1=CN=C(S1)N)[O-], 1 -ClC(Cl)Br, 1 -O=NN(C)C1=NC=NC2=C1N=CN2[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O, 1 -NC(=O)OC=C, 1 -CC/C(C2=CC=CC=C2)=C(C1=CC=CC=C1)/C(C=C3)=CC=C3OCCN(C)C.OC(C(CC(O)=O)(O)CC(O)=O)=O, 1 -CCBr, 1 -S=P(OC1=CC(=C(C=C1)SC)C)(OC)OC, 0 -FC(C(OC(F)F)Cl)(F)F, 0 -C=CCl, 1 -O=C1C2=CC(=CC=C2C(=O)C3=C1C=CC=C3)N, 1 -O=C(C(C1=CC=C(C=C1)Cl)C(C)C)OC(C2=CC=CC(=C2)OC3=CC=CC=C3)C#N, 0 -O=C(NCO)C=C, 1 -C=CF, 1 -CC1=C(C=CC=C1)/N=N/C2=CC(=C(C=C2)N)C, 1 -.[Cl-].[Fe+3].[Cl-].[Cl-], 0 -COC1C=C(C=CC=1C2NC3=CN=CC=C3N=2)S(C)=O, 1 -C(C1=CC=CC=C1)(C2CCCCN2)C(OC)=O.[H]Cl, 1 -NCCS(O)(=O)=O, 0 -[Fe+3].O=C([O-])CC(O)(CC(=O)[O-])C([O-])=O.O.O.O.O, 0 -O=C(C1=CC=NC=C1)NN, 1 -CC1=CC2=CC=CN=C2C=C1, 0 -O=C(N1)N(C2OCCC2)C=C(F)C1=O, 0 -N(C)(C)C([S-])=S.[Fe+3].[S-]C(=S)N(C)C.[S-]C(=S)N(C)C, 0 -NC(=O)C1=CC=NC=C1, 0 -CC1=CC=CC2=CC=CN=C12, 0 -C=C(Cl)Cl, 1 -Cl/C2=C(\Cl)C3(Cl)C1C(Cl)OC(Cl)C1C2(Cl)C3(Cl)Cl, 0 -OC(=O)C1=CC=NC=C1, 0 -C=CC1=CC=C(C=C1)C, 0 -C=C(F)F, 0 -C1(C(NCC2CCCCN2)=O)=C(C=CC(=C1)OCC(F)(F)F)OCC(F)(F)F.CC(=O)O, 0 -COC1=C(O)C=CC(=C1)C=NNC(=O)C2=CC=NC=C2, 1 -NC1=CC=C(C=C1)C2=CC=CC=C2, 1 -CC1(CC(=CC(=O)C1)C)C, 1 -CN1C2=CC=C(C=C2C(=NC(C1=O)O)C3=CC=CC=C3)Cl, 0 -O=C(NC1=CC=CC(=C1)C(F)(F)F)N(C)C, 0 -NC3=CC1=C(C=C3)OC2=C1C=CC=C2, 1 -O=C1N(C=C)CCC1, 1 -CN1CCN(CC1)/C2=N/C3=CC=CC=C3SC4C=CC(C)=CC2=4, 0 -O=C(C(F)(F)F)NC1=CC3=C(C2=CC=CC=C2C3)C=C1, 1 -C(/C1=CC=C(C=C1)N(CC2=CC(=CC=C2)S(=O)(=O)[O-])CC)(=C3\C=C/C(C=C3)=[N+](/CC4=CC(=CC=C4)S(=O)(=O)[O-])CC)C5=CC=C(C=C5)N(C)C.[Na+], 1 -ClCCN[P]1(=O)OCCCN1CCCl, 1 -N1(C(=CN=C1C)[N+](=O)[O-])CCO, 1 -OS(O)(=O)=O.OCCN(CCO)c1ccc(N)cc1, 0 -O[C@H]1[C@@H](NC(CO)CO)C[C@](O)(CO)[C@@H](O)[C@@H]1O, 0 -CC(=C)C=C, 1 -CC1=C(C(=CC(=C1)OC(=O)NC)C)N(C)C, 0 -C1(N=CNN=1)N, 1 -O=C(OC)C1=C(C)NC(C)=C(C(OCCC3=CC=C(N4CCN(C(C6=CC=CC=C6)C5=CC=CC=C5)CC4)C=C3)=O)C1C2=CC([N+]([O-])=O)=CC=C2.Cl.Cl, 0 -[Na+].[F-], 0 -OC(C)C, 0 -O=C(C1=CC=C(C=C1)N(C)C)C2=CC=C(C=C2)N(C)C, 1 -OC1=C(C=C(C=C1C(C)(C)C)C(C)(C)C)C(C)(C)C, 0 -OC(=O)CCCCCCCCCCN, 1 -NC2=CC=C(C=C2N)C1=CC=C(N)C(N)=C1.Cl.Cl.Cl.Cl, 1 -NC1=CC=C(C=C1)C2=CC=C(C=C2)F, 1 -CC(OC1=CC=C(C=C1)NC2=CC=CC=C2)C, 0 -ClC53C1(Cl)C4(Cl)C2(Cl)C1(Cl)C(Cl)(Cl)C5(Cl)C2(Cl)C3(Cl)C4(Cl)Cl, 1 -Cl.CC(C)(C)NCC(O)COc1cccc(C)c1C, 0 -Clc1c([N+]([O-])=O)c(Cl)c(Cl)c(OC)c1Cl, 0 -Cl.CC(=O)O[C@@H](CC)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2, 1 -O=C(NC1=CC=CC(=C1)Cl)OC(C)C, 0 -CC(C)C=O, 0 -ClC1=CC(=C(C=C1C2=C(C=C(C(=C2)Cl)N)Cl)Cl)N, 0 -O=C(C(C1=CC=CC=C1)(C2=CC=CC=C2)CC(N(C)C)C)CC.[H]Cl, 0 -N(=C(C=1)C)N(C(C)C)C=1OC(=O)N(C)C, 0 -C1(C[C@H]([C@@H]([C@H]1CCCCCCC(=O)OC)/C=C/CC(O)(CCCC)C)O)=O, 0 -ClC1=CC2=C(C=C1Cl)OC3=C(C=C(C(=C3)Cl)Cl)O2, 1 -CN(C)CNc2nnc(/C=C/c1ccc(o1)[N+]([O-])=O)o2, 1 -O=C1C(=CNC(=O)N1)F, 1 -O=C(NC1=CC=CC=C1)OC(C)C, 0 -O=C(C(C)=C4N)C2=C(C4=O)[C@](COC(N)=O)([H])[C@@](N2C3)(OC)[C@@]1([H])N[C@@]31[H], 1 -CC(=O)O[C@@H]3CC(=O)O[C@H](C)C\C=C\C=C\[C@H](O)[C@H](C)C[C@H](CC=O)[C@H](O[C@@H]2O[C@H](C)[C@@H](O[C@H]1C[C@@](C)(O)[C@H](OC(=O)CC(C)C)[C@H](C)O1)[C@H](N(C)C)[C@H]2O)C3OC, 0 -O=S(=O)(C1=CC(=C(C=C1Cl)Cl)Cl)C2=CC=C(C=C2)Cl, 0 -C1=C(C(=C(C=C1O)C)N(C)C)C, 0 -C(NC)CC(OC1=CC=C(C=C1)C(F)(F)F)C2=CC=CC=C2.[H]Cl, 0 -C/C=C/C1=CC2=C(C=C1)OCO2, 0 -O=[Mo](=O)=O, 1 -[N+].[O-], 0 -C1(C(=CC=C(C=1)C)C)N.[H]Cl, 1 -ClC(CCl)(Cl)Cl, 1 -O=C1N(C2=CC=CC=C2)N(C(=C1N(C)C)C)C, 0 -O=C1C2=C(C=C(C=C2O)O)OC(=C1O)C3=CC=C(C=C3)O, 0 -O=C1C(O)=COC(CO)=C1, 1 -ClC(C(Cl)Cl)Cl, 1 -C=O, 1 -O=S(O)(O)=O.C1(=CC=CC=C1CC(N)C).C2=CC=CC=C2CC(N)C, 0 -CC(=C)C#N, 0 -ClC(=C(Cl)Cl)Cl, 1 -O=NN(CCN(C)C)C(=O)[NH2+]CC.[O-]N=O, 1 -[H][C@@]12[C@]([H])(NC([C@H](N)C3=CC=CC=C3)=O)C(N1[C@@H]([C@@](O)=O)C(C)(C)S2)=O.O.O.O, 0 -O=C(O)COC1=C(C)C=C(Cl)C=C1, 0 -OC1=C(C=C(C=C1)C)/N=N/C2=CC=C(C=C2)NC(=O)C, 1 -O=C(N(CCCCC)N=O)N, 1 -CCC(C)=NO, 1 -C1=CC=C(NC(=O)C(/N=N/C2=C(Cl)C=C(C3=CC(Cl)=C(/N=N/C(C(=O)NC4=CC=CC=C4)C(=O)C)C=C3)C=C2)C(=O)C)C=C1, 0 -ClC54C(=O)C1(Cl)C2(Cl)C5(Cl)C3(Cl)C4(Cl)C1(Cl)C2(Cl)C3(Cl)Cl, 1 -O(C)c1cc(CC=C)ccc1OC, 1 -ClC1=CC(Cl)=C(/N=N/C(C(=O)NC2=C(C=C(C3=CC(C)=C(NC(=O)C(/N=N/C4=C(Cl)C=C(Cl)C=C4)C(=O)C)C=C3)C=C2)C)C(=O)C)C=C1, 0 -CC1=NC=CN1, 1 -C1(C2=CC=C(C(=C2)Cl)N=NC(C(C)=O)C(=O)NC3=C(C=C(C(=C3)OC)Cl)OC)=CC(=C(C=C1)N=NC(C(C)=O)C(=O)NC4=CC(=C(C=C4OC)Cl)OC)Cl, 0 -Cl.CN(C)[C@@H]2C(\O)=C(\C(N)=O)C(=O)[C@@]3(O)C(/O)=C4/C(=O)c1c(cccc1O)[C@@](C)(O)[C@H]4C[C@@H]23, 0 -C/C=C/C1=CC=C(C=C1)OC, 0 -[O-][N+](=O)C1=CC=C(O1)C2=CSC(=N2)NNC=O, 1 -[H][C@]12N(CC=C2COC([C@@](O)(C(O)(C)C)[C@H](C)OC)=O)CC[C@@H]1OC(\C(C)=C/C)=O, 1 -S=C(N(CC)CC)SSC(=S)N(CC)CC, 0 -S=C([S-])NCCNC([S-])=S.[Zn+2], 0 -O[C@H]1[C@@H]([C@H](O)CO)O[C@H]2[C@@H]1O[C@@H]([C@@](Cl)(Cl)Cl)O2, 0 -O=C([O-])C(NN1C2=CC=C(S(=O)([O-])=O)C=C2)=C(/N=N/C3=CC=C(S(=O)([O-])=O)C=C3)C1=O.[Na+].[Na+].[Na+], 0 -ClC1=NC(=NC(=N1)NC2=CC=CC=C2Cl)Cl, 0 -O=CNN, 1 -[O-]C(C)=O.[O-]C(C)=O.[Pb+2].[OH-].[OH-].[Pb+2].[OH-].[OH-].[Pb+2], 1 -O=S(C1=CC=C2C(C=CC(O)=C2\N=N/C3=CC=C(S(=O)([O-])=O)C=C3)=C1)([O-])=O.[Na+].[Na+], 0 -C1(C2=CC(=C(N)C=C2)C)(=CC(=C(N)C=C1)C).[H]Cl.[H]Cl, 1 -S=C(S[Pb]SC(N(C)C)=S)N(C)C, 0 -F/C(F)=C(\F)F, 1 -[N+](=O)([O-])c1ccccc1C, 1 -O=C(N(C)C)Cl, 1 -O=C(C[C@@H]([C@@](O)=O)CC(O)=O)O[C@H]([C@@H](C)CCCC)[C@@H](C[C@H](C)C[C@@H](O)CCCC[C@@H](O)C[C@H](O)[C@@H](N)C)OC(C[C@@H]([C@@](O)=O)CC(O)=O)=O, 1 -OCCNC1=C(OCCO)C=C([N+]([O-])=O)C=C1, 0 -C(S)(=S)N(C)C.N(C)C, 0 -O=C2C1=C(CCC2)C(OC[C@@H](O)CNC(C)(C)C)=CC=C1.Cl, 0 -O=C(O)\C=C/C(O)=O.O=C(NC3CC(N4C)CCC4C3)C1=C2C(CC(C)(C)O2)=CC(Cl)=C1, 0 -OC2=C1[C@@](C=C(C)CC3)([H])[C@]3([H])C(C)(C)OC1=CC(CCCCC)=C2, 0 -NC1=CC=CC=C1[H]Cl, 1 -C[N+](CCCCCCCCCCCC)(C)[O-], 0 -C1=COC=C1, 1 -C1CCCO1, 1 -C1(=C(C=CC=C1)N)OC.[H]Cl, 1 -O=S(\N=C(NCCSCC2=CC=C(CNC)O2)/NCC(C1=CC=C(O)C=C1)O)(C)=O, 1 -CN(C=O)C, 0 -O=CC1=CC=CO1, 1 -O=C(O)CC[C@@H](C)[C@]3([H])[C@](CC2)(C)[C@](CC3)([H])[C@@](CC4)([H])[C@@]2([H])[C@]1(C)[C@@]4([H])C[C@H](O)CC1, 0 -C1(=CC=C(N)C=C1)OC.[H]Cl, 0 -O=C3C[C@@H]4CC[C@@H]1[C@H](CC[C@]2(C)[C@@](C)(O)CC[C@@H]12)[C@@]4(C)C\C3=C\O, 1 -CN(C)N, 1 -OC1=CC(=CC2=C1C(=O)O[C@H](CCCC(=O)CCC/C=C\2)C)O, 1 -C1=CC=CC=C1C(COC(N)=O)COC(N)=O, 1 -NC1=C(C=CC=C1)C(=O)O, 0 -N(NC)C.[H]Cl.[H]Cl, 1 -O=C1C2=C(C=CC=C2)C(=O)C3=C1C=CC=C3, 0 -[O-][N+](C2=CC=C(O2)C1=CSC(NN(C)C)=N1)=O, 1 -S=C([S-])N(CCCC)CCCC.[S-]C(N(CCCC)CCCC)=S.[Zn+2], 0 -[Cl-].OC[P+](CO)(CO)CO, 0 -C1(=N\CCN/1)C(C)OC2C(=CC=CC=2Cl)Cl.[H]Cl, 0 -[O-][N+](=O)N(C)C, 1 -S=C([S-])N(CC)CC.[S-]C(N(CC)CC)=S.[Zn+2], 0 -OC[P+](CO)(CO)CO.[O-]S([O-])(=O)=O.OC[P+](CO)(CO)CO, 0 -CC(COC1=CC=C(C=C1)C(C)(C)C)OS(=O)OCCCl, 1 -OC(=O)C1=NN(C2=C1C=CC=C2)CC3=CC=C(C=C3Cl)Cl, 0 -S=C([S-])N(C)C.[S-]C(N(C)C)=S.[Zn+2], 1 -S=C(N(C)C)SSC(=S)N(C)C, 0 -NN(C=O)CCC, 1 -O=C(OC)C1=CCCN(C)C1.[H]Cl, 1 -CC(C)(CO)CCCCCCC(C)(C)CO, 0 -OC(C(SC(Cl)=C1)=C1S(N2C)(=O)=O)=C2C(NC3=NC=CC=C3)=O, 0 -S=C(N(C)C)SC(=S)N(C)C, 0 -O=C(C1=CC(=C(C(=C1)O)O)O)OCCC, 0 -[K+].[I-], 1 -C\C(C)=C/Cl, 1 -C[C@@H](CC)C(=O)O[C@H]2C[C@@H](C)\C=C3\C=C/[C@H](C)[C@H](CC[C@@H]1C[C@@H](O)CC(=O)O1)[C@@H]23, 1 -O=[N+](C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])[O-], 1 -CCCOC(=O)[CH]1[CH](C)CC2=C(C=C3OCOC3=C2)[CH]1C(=O)OCCC, 0 -C2(=O)C(C1=CC=CC=C1)(CC)C(=O)NCN2, 1 -C(=O)(/C=C/C)OC1=C(C(CCCCCC)C)C=C(C=C1[N+]([O-])=O)[N+]([O-])=O, 0 -[Cl-].C/[N+](C)=C1\C=C/C(C=C1)=C(\c2ccc(cc2)N(C)C)c3ccc(cc3)N(C)C, 1 -Cn3nc(CO)nc3NCCCOc2cc(CN1CCCCC1)ccc2, 1 -N#[N+]C1=CC=CC=C1.F[B-](F)(F)F, 0 -S1C=CC(=C1)CN(C2=NC=CC=C2)CCN(C)C, 0 -OC(COC(C)(C)C)C, 1 -CS(=O)(=O)OC1=C(C=C(C=C1C(C)(C)C)[N+]([O-])=O)[N+](=O)[O-], 0 -Cl.Cl.Cl.Cc1ccc(cn1)C\C2=C\N/C(=N\C2=O)NCCSCc3ccc(CN(C)C)o3, 1 -O=C2C=1/N=C\NC=1N(C)C(=O)N2C, 0 -N1=CC=CC=C1, 1 -O=NN(C(=O)N)CCC, 1 -O=C1C23C4C5C6(C(=O)C7=C(O)C(C)=CC(=C7C(C6=C(C2C5O)O)=O)O)C(C4O)C(=C3C(=O)C8=C1C(O)=C(C)C=C8O)O, 1 -N(CCN(C)C)(C)N=O, 1 -N1C(=NC2=C1C=CC=C2)C3=CSC=N3, 0 -[H][C@]12C3=CCN1CC[C@H]2OC(/C(CC([C@@](CO)(O)C(OC3)=O)=C)=C\C)=O, 1 -CC=C, 0 -OC(=O)[C@@H]3[C@]51C[C@@](O)(CC[C@H]1[C@@]24\C=C/[C@H](O)[C@@](C)(C(=O)O2)[C@@H]34)C(=C)C5, 0 -OC[C@@H](NC(C(Cl)Cl)=O)[C@H](O)C1=CC=C(S(=O)(C)=O)C=C1, 0 -CC(CO)O, 0 -O=NN(CCN1N=O)CCC1, 1 -N1C2=C(N3C=1/C(=C\C=C/3)C)N=C(C=C2)N, 1 -Cl[Mg]Cl.O.O.O.O.O.O, 0 -S=P(N1CC1)(N1CC1)N1CC1, 1 -ClC1=C(Cl)C=CC([C@H]2C3=C(C=CC=C3)[C@@H](NC)CC2)=C1.Cl, 0 -CC1CO1, 1 -N12C3=C(C=CC(=N3)N)N=C1C=CC=C2, 1 -C1(CN(N=O)CC(O1)C)C, 1 -[O-]P(=O)=O.[Na+], 0 -NNCCC.[H]Cl, 1 -O=NN1CCN(N=O)CC1, 1 -O=C1C=C(NC(=S)N1)CCC, 1 -O=C(C(SP(=O)(OC)OC)CC(=O)OCC)OCC, 0 -CCOC(=O)N(C)N=O, 1 -CC(=S)N, 1 -O[C@@H]1[C@@](O[C@@H](O[C@H](CO)[C@@H]2Cl)[C@H](O)[C@H]2O)(CCl)O[C@H](CCl)[C@H]1O, 0 -O=C(C(SP(=S)(OC)OC)CC(=O)OCC)OCC, 0 -C1N(COC1)N=O, 1 -CC(C1=CC(=C(C=C1O)C)SC2=CC(=C(C=C2C)O)C(C)(C)C)(C)C, 0 -O=C1C=CC(=O)NN1, 0 -O=C(N(CCC1=CC=CC=C1)N=O)N, 1 -OC1=C(C=C(C=C1SC2=C(C(=CC(=C2)Cl)Cl)O)Cl)Cl, 0 -O=C(O[C@@H]1[C@@](O[C@@H](O[C@H](COC(C)=O)[C@H]2OC(C(C)C)=O)[C@H](OC(C(C)C)=O)[C@H]2OC(C(C)C)=O)(COC(C)=O)O[C@H](COC(C(C)C)=O)[C@H]1OC(C(C)C)=O)C(C)C, 0 -C1(=CC=C2C(=C1)N(C(\N=C/2C3=CC=CC=C3)=O)C(C)C)C, 0 -C1=CC(=CC=C1NNC(CC[C@@H](C(O)=O)N)=O)CO, 0 -C(=C/C=O)\[O-].[Na+], 1 -C([S-])#N.[Na+], 0 -CCCCOP(=O)(OCCCC)OCCCC, 1 -C1(=CC=C(C=C1)SC2=CC=C(C=C2)N)N, 1 -CC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-], 0 -O=S(=O)([O-])[O-].O.[Mn+2], 0 -N1C=CC=C(C=1)C2N(N=O)CCC2, 1 -F[B-](F)(F)F.[Na+], 0 -O=P(OC(CCl)CCl)(OC(CCl)CCl)OC(CCl)CCl, 1 -OC(CO)CCl, 0 -Cl.Cl.[O-][N+](=O)c1cccc(c1)C/2C(\C(=O)OC)=C(\C)NC(\C)=C\2C(=O)OCCN3CCN(CC3)C(c4ccccc4)c5ccccc5, 0 -O=C(C1=CC=C(C=C1)N)NC2=CC=C(C=C2)N, 0 -NC(=S)NN, 0 -C1COCCO1, 1 -O[C@@H]([C@H](O)[C@H](O)CO)[C@H](O)CO, 0 -O=C(NC3=CC2=C(C=C3)C1=CC=C(NC(C)=O)C=C1C2)C, 0 -O=C1NC(=S)NC=C1, 1 -NC(=O)C1=NC=CN=C1, 0 -S=P(SC1C(SP(=S)(OCC)OCC)OCCO1)(OCC)OCC, 0 -OCC1CO1, 1 -NC1=C(C=CC(=C1)N)C, 1 -COC2=CC=C(C=C2)CN(CCN(C)C)C1=NC=CC=C1.OC(\C=C/C(O)=O)=O, 1 -[NH3+]C2=C(C)C=C(C3=N2)C1=C(N3)C=CC=C1.O=C([O-])C, 1 -NC1(=C(C=CC(=C1)N)C).[H]Cl.[H]Cl, 1 -S=C(N1CCCCC1)SSSSSSC(=S)N1CCCCC1, 0 -CN(C)[C@@H]2/C=C\CC[C@@]2(c1ccccc1)C(=O)OCC.OC(=O)\C=C\C(O)=O, 0 -NC1=C(C(=NC(=N1)N)CC)C2=CC=C(C=C2)Cl, 0 -C1(=CC(=C(C(=C1)N)C)N).[H]Cl.[H]Cl, 0 -O=NN(CCCCC)CCCCC, 1 -OCC(=O)[C@@]4(O)C[C@H](O[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1)c5c(O)c3C(=O)c2c(OC)cccc2C(=O)c3c(O)c5C4, 0 -O=C1C2=C(C=C(C=C2O)O)OC(=C1O)C3=CC(=C(C=C3)O)O, 1 -NC1=C(C)C=C(N)C=C1.O=S(O)(O)=O, 0 -C(C1=CC=CC=C1)(C2=CC=CC=C2)OCCN(C)C.[H]Cl, 0 -O=C1C2=C(C=C(C=C2O)O)O/C(=C\1O)C3=CC(=C(C=C3)O)O.O.O, 0 -CN1C2=C(C=C(C=C2)Cl)C(=NCC1=O)C3=CC=CC=C3, 0 -N(C1=CC=C(C=C1)NC2=CC=CC=C2)C3=CC=CC=C3, 0 -Cl.CC(C)(C)NCC(O)CO/C1=C/N(C)C(=O)c2ccccc12, 0 -S=P(OC1=NC(=NC(=C1)C)C(C)C)(OCC)OCC, 0 -N#CC(C1=CC=CC=C1)C2=CC=CC=C2, 0 -[Sn+2].[Cl-].[Cl-], 0 -[Na+].[Na+].OC(=O)[C@]5(C)C[C@H]6/C7=C/C(=O)[C@H]4[C@@](C)(CC[C@@H]3[C@]4(C)CC[C@H](OC2O[C@H](C([O-])=O)[C@@H](O)[C@H](O)[C@H]2O[C@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)C([O-])=O)C3(C)C)[C@]7(C)CC[C@@]6(C)CC5, 0 -O=[Ti]=O, 0 -C(/C1=CC=C(C=C1)N(CC2=CC(=CC=C2)S(=O)(=O)[O-])CC)(=C3\C=C/C(C=C3)=[N+](\CC4=CC(=CC=C4)S(=O)(=O)[O-])CC)C5=CC=CC=C5.[Na+], 1 -C(C(=O)[O-])(O[Ti](OC(C(=O)[O-])=O)=O)=O.[K+].[K+], 0 -Cl.CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N2Cc3ccccc3C[C@H]2C(O)=O, 0 -O=C(OC1=CC=CC=C1)OC2=CC=CC=C2, 0 -[Ti+2](C1=CC=CC1)C2(=CC=CC2).[Cl-].[Cl-], 0 -C(/C1=C(C=C(C=C1)O)S(=O)(=O)[O-])(C2=CC=C(C=C2)N(CC3=CC(=CC=C3)S(=O)(=O)[O-])CC)=C4/C=C/C(C=C4)=[N+](\CC5=CC(=CC=C5)S(=O)(=O)[O-])CC.[Na+].[Na+], 0 -Cl.O=C(c2cn(C)c1ccccc12)[C@H]3CC=4N\C=N/C=4CC3, 0 -O1C2=C(C=CC=C2)OC3=CC=CC=C13, 0 -O=C2C1=C(OC)C=C(OC)C(Cl)=C1O[C@]32C(OC)=CC(C[C@@](C)3[H])=O, 1 -C1(=C(C)C2OC(CCC=2C(=C1OC(=O)C)C)(CCCC(CCCC(CCCC(C)C)C)C)C)C, 0 -CC1=CC(C4=CC(C)=C(/N=N/C5=CC=C(OS(=O)(C6=CC=C(C)C=C6)=O)C=C5)C=C4)=CC=C1/N=N/C2=C(O)C=CC3=CC(S(=O)([O-])=O)=CC(S(=O)([O-])=O)=C23.[Na+].[Na+], 1 -N1(C2=CC=CC=C2)C(C(N(CS(=O)(=O)[O-])C)=C(N1C)C)=O.[Na+], 1 diff --git a/test/data/multicolumn.csv b/test/data/multicolumn.csv deleted file mode 100644 index 2fa9a1c..0000000 --- a/test/data/multicolumn.csv +++ /dev/null @@ -1,5 +0,0 @@ -SMILES, Hamster Carcinogenicity, numeric feature, classification, mixed, string -c1ccccc1NN , 1, 1, true , true , "test" -C12C3=C(C=CC=C3)CC1=CC(=CC=2)NC(C)=O , 1, 2, false, 7.5 , "test" -O=C(N)\C(C2=CC=CO2)=C/C1=CC=C([N+]([O-])=O)O1, 1, 3, true , 5 , "test" -C1(N=CNN=1)N , 0, 4, false, false, "test" diff --git a/test/dataset.rb b/test/dataset.rb deleted file mode 100644 index b3190b8..0000000 --- a/test/dataset.rb +++ /dev/null @@ -1,99 +0,0 @@ -require 'test/unit' -$LOAD_PATH << File.join(File.dirname(__FILE__),'..','lib') -require File.join File.dirname(__FILE__),'..','lib','opentox-client.rb' -DATASET = "http://ot-dev.in-silico.ch/dataset" -AA ||= "https://opensso.in-silico.ch" -AA_USER = "guest" -AA_PASS = "guest" -@@subjectid = OpenTox::Authorization.authenticate(AA_USER,AA_PASS) - -DATA_DIR = File.join(File.dirname(__FILE__),"data") -# TODO: add subjectids - - -class DatasetTest < Test::Unit::TestCase - - def test_all - puts @@subjectid - datasets = OpenTox::Dataset.all(DATASET, @@subjectid) - assert_equal OpenTox::Dataset, datasets.first.class - end - - def test_create_empty - d = OpenTox::Dataset.create(DATASET, @@subjectid) - assert_equal OpenTox::Dataset, d.class - assert_match /#{DATASET}/, d.uri.to_s - d.delete - end - - def test_create_from_file - d = OpenTox::Dataset.from_file DATASET, File.join(DATA_DIR,"EPAFHM.mini.csv"), @@subjectid - assert_equal OpenTox::Dataset, d.class - assert_equal d.uri, d[RDF::XSD.anyURI] - assert_equal "EPAFHM.mini", d.metadata[RDF::URI("http://purl.org/dc/elements/1.1/title")].first.to_s # DC.title is http://purl.org/dc/terms/title - assert_equal "EPAFHM.mini", d[RDF::URI("http://purl.org/dc/elements/1.1/title")] - d.delete - assert_raise OpenTox::NotFoundError do - d.get - end - end - - def test_from_yaml - @dataset = OpenTox::Dataset.from_file DATASET, File.join(DATA_DIR,"hamster_carcinogenicity.yaml"), @@subjectid - assert_equal OpenTox::Dataset, @dataset.class - assert_equal "hamster_carcinogenicity", @dataset[RDF::URI("http://purl.org/dc/elements/1.1/title")] - hamster_carc? - @dataset.delete - end - -=begin -# TODO: fix (mime type??0 and add Egons example - def test_sdf_with_multiple_features - @dataset = OpenTox::Dataset.from_file DATASET, "#{DATA_DIR}/CPDBAS_v5c_1547_29Apr2008part.sdf" - assert_equal OpenTox::Dataset, @dataset.class - puts @dataset.features.size - puts @dataset.compounds.size - @dataset.delete - end -=end - - def test_multicolumn_csv - @dataset = OpenTox::Dataset.from_file DATASET, "#{DATA_DIR}/multicolumn.csv", @@subjectid - assert_equal 5, @dataset.features.size - assert_equal 4, @dataset.compounds.size - @dataset.delete - end - - def test_from_csv - @dataset = OpenTox::Dataset.from_file DATASET, "#{DATA_DIR}/hamster_carcinogenicity.csv", @@subjectid - assert_equal OpenTox::Dataset, @dataset.class - hamster_carc? - @dataset.delete - end - -=begin - def test_save - d = OpenTox::Dataset.create DATASET - d.metadata - d.metadata[RDF::DC.title] = "test" - d.save - # TODO: save does not work with datasets - #puts d.response.code.inspect - #assert_equal "test", d.metadata[RDF::DC.title] # should reload metadata - d.delete - end -=end -=begin -=end - - - def hamster_carc? - assert_kind_of OpenTox::Dataset, @dataset - #require 'yaml' - #puts @dataset.data_entries.to_yaml - assert_equal 85, @dataset.data_entries.size - assert_equal 85, @dataset.compounds.size - assert_equal 1, @dataset.features.size - assert_equal @dataset.uri, @dataset[RDF::XSD.anyURI] - end -end diff --git a/test/error.rb b/test/error.rb deleted file mode 100644 index d736620..0000000 --- a/test/error.rb +++ /dev/null @@ -1,35 +0,0 @@ -require 'test/unit' -$LOAD_PATH << File.join(File.dirname(__FILE__),'..','lib') -require File.join File.dirname(__FILE__),'..','lib','opentox-client.rb' - -class ErrorTest < Test::Unit::TestCase - - def test_bad_request - object = OpenTox::Feature.new "http://this-is-a/fantasy/url" - assert_raise OpenTox::NotFoundError do - response = object.get - end - end - - def test_error_methods - assert_raise OpenTox::NotFoundError do - not_found_error "This is a test" - end - end - - def test_exception - assert_raise Exception do - raise Exception.new "Basic Exception" - end - end - - def test_backtick - assert_raise OpenTox::InternalServerError do - `this call will not work` - end - assert_raise OpenTox::InternalServerError do - `ls inexisting_directory` - end - end - -end diff --git a/test/feature.rb b/test/feature.rb deleted file mode 100644 index f37f298..0000000 --- a/test/feature.rb +++ /dev/null @@ -1,36 +0,0 @@ -require 'test/unit' -$LOAD_PATH << File.join(File.dirname(__FILE__),'..','lib') -require File.join File.dirname(__FILE__),'..','lib','opentox-client.rb' - -class FeatureTest < Test::Unit::TestCase - - def setup - @features = [ - #@@classification_training_dataset.features.keys.first, - "http://apps.ideaconsult.net:8080/ambit2/feature/35796", - #File.join(OpenTox::Model::Lazar.all.last,"predicted","value") - - ] - end - - def test_feature - @features.each do |uri| - f = OpenTox::Feature.new(uri) - assert_equal RDF::OT1.TUM_CDK_nAtom, f[RDF::OWL.sameAs] - assert_equal RDF::OT1.TUM_CDK_nAtom, f.metadata[RDF::OWL.sameAs].first.to_s - assert_equal [RDF::OT1.Feature,RDF::OT1.NumericFeature].sort, f[RDF.type].sort - end - end - -=begin - def test_owl - #@features.each do |uri| - validate_owl @features.first, @@subjectid unless CONFIG[:services]["opentox-dataset"].match(/localhost/) - validate_owl @features.last, @@subjectid unless CONFIG[:services]["opentox-dataset"].match(/localhost/) - # Ambit does not validate - #end - end -=end - - -end diff --git a/test/policy.rb b/test/policy.rb deleted file mode 100644 index eb7e2b6..0000000 --- a/test/policy.rb +++ /dev/null @@ -1,120 +0,0 @@ -require 'test/unit' -$LOAD_PATH << File.join(File.dirname(__FILE__),'..','lib') -require File.expand_path(File.join(File.dirname(__FILE__),'..','lib','opentox-client.rb')) - -TEST_URI = "http://only_a_test/test/" + rand(1000000).to_s -USER_TYPE = "LDAPUsers" -USER_VALUE = "uid=guest,ou=people,dc=opentox,dc=org" -USER_GROUP = "member" -GROUP_TYPE = "LDAPGroups" -GROUP_VALUE = "cn=member,ou=groups,dc=opentox,dc=org" -POLICY_NAME = "test_policy_#{rand(100000)}" -RULE_NAME = "test_rule_#{rand(100000)}" -SUBJECT_NAME = "test_subject_#{rand(100000)}" - -AA ||= "https://opensso.in-silico.ch" -AA_USER = "guest" -AA_PASS = "guest" - -@@subjectid = OpenTox::Authorization.authenticate(AA_USER,AA_PASS) - -class PolicyTest < Test::Unit::TestCase - - def test_01_class - policies = OpenTox::Policies.new() - assert_equal(policies.class, OpenTox::Policies) - assert_kind_of Array, policies.names - assert_kind_of Array, policies.uris - assert_kind_of Array, policies.names - end - - def test_02_subclasses - policies = OpenTox::Policies.new() - policies.new_policy(POLICY_NAME) - assert_equal(policies.names[0], POLICY_NAME) - assert_equal(policies.policies[policies.names[0]].class, OpenTox::Policy) - policy = policies.policies[policies.names[0]] - policy.rule.name = RULE_NAME - policy.uri = TEST_URI - assert_equal(policy.rule.class, OpenTox::Policy::Rule) - assert_equal(policy.rule.name, RULE_NAME) - assert_equal(policy.rule.uri, TEST_URI) - assert_equal(policy.uri, TEST_URI) - policy.subject.name = SUBJECT_NAME - policy.type = USER_TYPE - policy.value = USER_VALUE - assert_equal(policy.subject.class, OpenTox::Policy::Subject) - assert_equal(policy.subject.name, SUBJECT_NAME) - assert_equal(policy.subject.type, USER_TYPE) - assert_equal(policy.type, USER_TYPE) - assert_equal(policy.subject.value, USER_VALUE) - assert_equal(policy.value, USER_VALUE) - end - - def test_03_read_readwrite - policies = OpenTox::Policies.new() - policies.new_policy(POLICY_NAME) - policy = policies.policies[policies.names[0]] - policy.rule.name = RULE_NAME - policy.uri = TEST_URI - policy.rule.get = "allow" - assert policy.rule.read - assert !policy.rule.readwrite - policy.rule.post = "allow" - policy.rule.put = "allow" - assert !policy.rule.read - assert policy.rule.readwrite - end - - def test_04_group_user - policies = OpenTox::Policies.new() - policies.load_default_policy(AA_USER, TEST_URI, "member") - assert_equal "member", policies.policies["policy_group"].group - assert_equal AA_USER, policies.policies["policy_user"].user - end - - def test_05_DN - policies = OpenTox::Policies.new() - policies.new_policy(POLICY_NAME) - policy = policies.policies[policies.names[0]] - policy.set_ot_user(AA_USER) - assert_equal USER_VALUE, policy.value - assert_equal USER_TYPE, policy.type - policy.set_ot_group(USER_GROUP) - assert_equal GROUP_VALUE, policy.value - assert_equal GROUP_TYPE, policy.type - end - - def test_06_load_xml_and_check_defaults - policies = OpenTox::Policies.new() - xml = File.read(File.join(File.dirname(__FILE__), "../lib/templates/default_policy.xml")) - policies.load_xml(xml) - # check user policy - policy = policies.policies["policy_user"] - assert policy.name == "policy_user" - assert policy.rule.name == "rule_user" - assert policy.rule.uri == "uri" - assert policy.rule.get == "allow" - assert policy.rule.post == "allow" - assert policy.rule.delete == "allow" - assert policy.rule.put == "allow" - assert policy.subject_group == "subjects_user" - assert policy.subject.name == "subject_user" - assert policy.subject.type == USER_TYPE - assert policy.subject.value == USER_VALUE - # check group policy - policy = policies.policies["policy_group"] - assert policy.name == "policy_group" - assert policy.rule.name == "rule_group" - assert policy.rule.uri == "uri" - assert policy.rule.get == "allow" - assert !policy.rule.post - assert !policy.rule.delete - assert !policy.rule.put - assert policy.subject_group == "subjects_group" - assert policy.subject.name == "subject_group" - assert policy.subject.type == GROUP_TYPE - assert policy.subject.value == GROUP_VALUE - end - -end
\ No newline at end of file diff --git a/test/task.rb b/test/task.rb deleted file mode 100644 index 399c66e..0000000 --- a/test/task.rb +++ /dev/null @@ -1,85 +0,0 @@ -require 'test/unit' -$LOAD_PATH << File.join(File.dirname(__FILE__),'..','lib') -require File.join File.dirname(__FILE__),'..','lib','opentox-client.rb' -#require "./validate-owl.rb" - -TASK_SERVICE_URI = "http://ot-dev.in-silico.ch/task" -#TASK_SERVICE_URI = "http://ot-test.in-silico.ch/task" -#TASK_SERVICE_URI = "https://ambit.uni-plovdiv.bg:8443/ambit2/task" #not compatible - -class TaskTest < Test::Unit::TestCase - - -=begin -=end - def test_all - all = OpenTox::Task.all(TASK_SERVICE_URI) - assert_equal Array, all.class - t = all.last - assert_equal OpenTox::Task, t.class - assert_equal RDF::OT1.Task, t[RDF.type] - end - - def test_create_and_complete - task = OpenTox::Task.create TASK_SERVICE_URI, :description => "test" do - sleep 1 - TASK_SERVICE_URI - end - assert task.running? - assert_equal "Running", task.hasStatus - task.wait - assert task.completed? - assert_equal "Completed", task.hasStatus - assert_equal TASK_SERVICE_URI, task.resultURI - end - - - def test_create_and_cancel - task = OpenTox::Task.create TASK_SERVICE_URI do - sleep 2 - TASK_SERVICE_URI - end - assert task.running? - task.cancel - assert task.cancelled? - end - - def test_create_and_fail - task = OpenTox::Task.create TASK_SERVICE_URI, :description => "test failure", :creator => "http://test.org/fake_creator" do - sleep 1 - raise "A runtime error occured" - end - assert task.running? - assert_equal "Running", task.hasStatus - task.wait - assert task.error? - assert_equal "Error", task.hasStatus - end - - def test_create_and_fail_with_opentox_error - task = OpenTox::Task.create TASK_SERVICE_URI, :description => "test failure", :creator => "http://test.org/fake_creator" do - sleep 1 - raise OpenTox::Error.new 500, "An OpenTox::Error occured" - end - assert task.running? - assert_equal "Running", task.hasStatus - task.wait - assert task.error? - assert_equal "Error", task.hasStatus - end - -=begin - def test_wrong_result_uri - task = OpenTox::Task.create TASK_SERVICE_URI, :description => "test wrong result uri", :creator => "http://test.org/fake_creator" do - sleep 1 - "Asasadasd" - end - assert task.running? - assert_equal "Running", task.hasStatus - task.wait - assert task.error? - assert_equal "Error", task.hasStatus - end -=end - -end |