diff options
author | Christoph Helma <helma@in-silico.ch> | 2012-04-16 18:19:40 +0200 |
---|---|---|
committer | Christoph Helma <helma@in-silico.ch> | 2012-04-16 18:19:40 +0200 |
commit | 1850ffbc061a4ef92e759b96802d1769cb5d03c6 (patch) | |
tree | 1b308e31833b8c6f9d1ee9ad06b7706d1cb80ce0 | |
parent | ff5b9add94c1a9f7e21aa7a8d5de5d701d2d141b (diff) | |
parent | da91f344082075fde4afe2db89786aba645fe2c7 (diff) |
Merge branch 'development' of github.com:opentox/opentox-test into development
-rw-r--r-- | test/authorization.rb | 6 | ||||
-rw-r--r-- | test/compound.rb | 24 | ||||
-rw-r--r-- | test/dataset.rb | 25 | ||||
-rw-r--r-- | test/policy.rb | 16 | ||||
-rw-r--r-- | test/setup.rb | 11 | ||||
-rw-r--r-- | test/task.rb | 32 | ||||
-rw-r--r-- | test/toxbank-investigation-curl.rb | 2 | ||||
-rw-r--r-- | test/toxbank-investigation-rest.rb | 7 | ||||
-rw-r--r-- | test/toxbank-investigation-xls.rb | 2 |
9 files changed, 63 insertions, 62 deletions
diff --git a/test/authorization.rb b/test/authorization.rb index 1556187..f23fe02 100644 --- a/test/authorization.rb +++ b/test/authorization.rb @@ -1,12 +1,6 @@ require File.join(File.expand_path(File.dirname(__FILE__)),"setup.rb") TEST_URI = "http://only_a_test/test/" + rand(1000000).to_s -unless defined? $aa[:uri] #overwrite turned off A&A server for testing - $aa[:uri] = "https://opensso.in-silico.ch" - @@subjectid = OpenTox::Authorization.authenticate($aa[:user],$aa[:password]) -end - -@@subjectid ||= OpenTox::Authorization.authenticate($aa[:user],$aa[:password]) class TestOpenToxAuthorizationBasic < Test::Unit::TestCase diff --git a/test/compound.rb b/test/compound.rb index 7573f58..e1167d8 100644 --- a/test/compound.rb +++ b/test/compound.rb @@ -1,38 +1,42 @@ require 'test/unit' require File.join(File.expand_path(File.dirname(__FILE__)),"setup.rb") -class CompoundTest < Test::Unit::TestCase +begin + @@service_uri = $compound[:uri] + puts "Service URI is: #{@@service_uri}" +rescue + puts "Configuration Error: $compound[:uri] is not defined in: " + File.join(ENV["HOME"],".opentox","config","test.rb") + exit +end - def setup - @service_uri = "http://ot-dev.in-silico.ch/compound" - end +class CompoundTest < Test::Unit::TestCase def test_compound_from_smiles_0 - c = OpenTox::Compound.from_smiles @service_uri, "F[B-](F)(F)F.[Na+]" + c = OpenTox::Compound.from_smiles @@service_uri, "F[B-](F)(F)F.[Na+]" assert_equal "InChI=1S/BF4.Na/c2-1(3,4)5;/q-1;+1", c.to_inchi assert_equal "[Na+].F[B-](F)(F)F", c.to_smiles # still does not work on 64bit machines end def test_compound_from_smiles_1 - c = OpenTox::Compound.from_smiles @service_uri, "CC(=O)CC(C)C#N" + c = OpenTox::Compound.from_smiles @@service_uri, "CC(=O)CC(C)C#N" assert_equal "InChI=1S/C6H9NO/c1-5(4-7)3-6(2)8/h5H,3H2,1-2H3", c.to_inchi assert_equal "CC(CC(=O)C)C#N", c.to_smiles end def test_compound_from_name - c = OpenTox::Compound.from_name @service_uri, "Benzene" + c = OpenTox::Compound.from_name @@service_uri, "Benzene" assert_equal "InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H", c.to_inchi assert_equal "c1ccccc1", c.to_smiles end def test_compound_from_smiles_2 - c = OpenTox::Compound.from_smiles @service_uri, "N#[N+]C1=CC=CC=C1.F[B-](F)(F)F" + c = OpenTox::Compound.from_smiles @@service_uri, "N#[N+]C1=CC=CC=C1.F[B-](F)(F)F" assert_equal "InChI=1S/C6H5N2.BF4/c7-8-6-4-2-1-3-5-6;2-1(3,4)5/h1-5H;/q+1;-1", c.to_inchi assert_equal "N#[N+]c1ccccc1.F[B-](F)(F)F", c.to_smiles end def test_compound_from_inchi - c = OpenTox::Compound.from_inchi @service_uri, "InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H" + c = OpenTox::Compound.from_inchi @@service_uri, "InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H" assert_equal "c1ccccc1", c.to_smiles end @@ -44,7 +48,7 @@ class CompoundTest < Test::Unit::TestCase =begin def test_match_hits - c = OpenTox::Compound.from_smiles @service_uri, "N=C=C1CCC(=F=FO)C1" + c = OpenTox::Compound.from_smiles @@service_uri, "N=C=C1CCC(=F=FO)C1" assert_equal ({"FF"=>2, "CC"=>10, "C"=>6, "C1CCCC1"=>10, "C=C"=>2}), c.match_hits(['CC','F=F','C','C=C','FF','C1CCCC1','OO']) end =end diff --git a/test/dataset.rb b/test/dataset.rb index 8730154..54c9871 100644 --- a/test/dataset.rb +++ b/test/dataset.rb @@ -4,23 +4,30 @@ DATASET = "http://ot-dev.in-silico.ch/dataset" DATA_DIR = File.join(File.dirname(__FILE__),"data") # TODO: add subjectids +begin + @@service_uri = $dataset[:uri] + puts "Service URI is: #{@@service_uri}" +rescue + puts "Configuration Error: $dataset[:uri] is not defined in: " + File.join(ENV["HOME"],".opentox","config","test.rb") + exit +end class DatasetTest < Test::Unit::TestCase def test_all - datasets = OpenTox::Dataset.all DATASET, @@subjectid + datasets = OpenTox::Dataset.all @@service_uri, @@subjectid assert_equal OpenTox::Dataset, datasets.first.class end def test_create_empty - d = OpenTox::Dataset.create DATASET, @@subjectid + d = OpenTox::Dataset.create @@service_uri, @@subjectid assert_equal OpenTox::Dataset, d.class - assert_match /#{DATASET}/, d.uri.to_s + assert_match /#{@@service_uri}/, d.uri.to_s d.delete :subjectid => @@subjectid end def test_create_from_file - d = OpenTox::Dataset.from_file DATASET, File.join(DATA_DIR,"EPAFHM.mini.csv"), @@subjectid + d = OpenTox::Dataset.from_file @@service_uri, File.join(DATA_DIR,"EPAFHM.mini.csv"), @@subjectid assert_equal OpenTox::Dataset, d.class assert_equal d.uri, d[RDF::XSD.anyURI] assert_equal "EPAFHM.mini", d.metadata[RDF::URI("http://purl.org/dc/elements/1.1/title")].first.to_s # DC.title is http://purl.org/dc/terms/title @@ -32,7 +39,7 @@ class DatasetTest < Test::Unit::TestCase end def test_from_yaml - @dataset = OpenTox::Dataset.from_file DATASET, File.join(DATA_DIR,"hamster_carcinogenicity.yaml"), @@subjectid + @dataset = OpenTox::Dataset.from_file @@service_uri, File.join(DATA_DIR,"hamster_carcinogenicity.yaml"), @@subjectid assert_equal OpenTox::Dataset, @dataset.class assert_equal "hamster_carcinogenicity", @dataset[RDF::URI("http://purl.org/dc/elements/1.1/title")] hamster_carc? @@ -42,7 +49,7 @@ class DatasetTest < Test::Unit::TestCase =begin # TODO: fix (mime type??0 and add Egons example def test_sdf_with_multiple_features - @dataset = OpenTox::Dataset.from_file DATASET, "#{DATA_DIR}/CPDBAS_v5c_1547_29Apr2008part.sdf" + @dataset = OpenTox::Dataset.from_file @@service_uri, "#{DATA_DIR}/CPDBAS_v5c_1547_29Apr2008part.sdf" assert_equal OpenTox::Dataset, @dataset.class puts @dataset.features.size puts @dataset.compounds.size @@ -51,14 +58,14 @@ class DatasetTest < Test::Unit::TestCase =end def test_multicolumn_csv - @dataset = OpenTox::Dataset.from_file DATASET, "#{DATA_DIR}/multicolumn.csv", @@subjectid + @dataset = OpenTox::Dataset.from_file @@service_uri, "#{DATA_DIR}/multicolumn.csv", @@subjectid assert_equal 5, @dataset.features.size assert_equal 4, @dataset.compounds.size @dataset.delete :subjectid => @@subjectid end def test_from_csv - @dataset = OpenTox::Dataset.from_file DATASET, "#{DATA_DIR}/hamster_carcinogenicity.csv", @@subjectid + @dataset = OpenTox::Dataset.from_file @@service_uri, "#{DATA_DIR}/hamster_carcinogenicity.csv", @@subjectid assert_equal OpenTox::Dataset, @dataset.class hamster_carc? @dataset.delete :subjectid => @@subjectid @@ -66,7 +73,7 @@ class DatasetTest < Test::Unit::TestCase =begin def test_save - d = OpenTox::Dataset.create DATASET + d = OpenTox::Dataset.create @@service_uri d.metadata d.metadata[RDF::DC.title] = "test" d.save diff --git a/test/policy.rb b/test/policy.rb index c69175d..6babcc6 100644 --- a/test/policy.rb +++ b/test/policy.rb @@ -11,12 +11,6 @@ POLICY_NAME = "test_policy_#{rand(100000)}" RULE_NAME = "test_rule_#{rand(100000)}" SUBJECT_NAME = "test_subject_#{rand(100000)}" -AA ||= "https://opensso.in-silico.ch" -AA_USER = "guest" -AA_PASS = "guest" - -@@subjectid = OpenTox::Authorization.authenticate(AA_USER,AA_PASS) - class PolicyTest < Test::Unit::TestCase def test_01_class @@ -67,16 +61,16 @@ class PolicyTest < Test::Unit::TestCase def test_04_group_user policies = OpenTox::Policies.new() - policies.load_default_policy(AA_USER, TEST_URI, "member") + policies.load_default_policy($aa[:user], TEST_URI, "member") assert_equal "member", policies.policies["policy_group"].group - assert_equal AA_USER, policies.policies["policy_user"].user + assert_equal $aa[:user], policies.policies["policy_user"].user end def test_05_DN policies = OpenTox::Policies.new() policies.new_policy(POLICY_NAME) policy = policies.policies[policies.names[0]] - policy.set_ot_user(AA_USER) + policy.set_ot_user($aa[:user]) assert_equal USER_VALUE, policy.value assert_equal USER_TYPE, policy.type policy.set_ot_group(USER_GROUP) @@ -84,10 +78,9 @@ class PolicyTest < Test::Unit::TestCase assert_equal GROUP_TYPE, policy.type end -=begin def test_06_load_xml_and_check_defaults policies = OpenTox::Policies.new() - xml = File.read(File.join(File.dirname(__FILE__), "../lib/templates/default_policy.xml")) + xml = policies.get_xml_template("default_policy") policies.load_xml(xml) # check user policy policy = policies.policies["policy_user"] @@ -116,6 +109,5 @@ class PolicyTest < Test::Unit::TestCase assert policy.subject.type == GROUP_TYPE assert policy.subject.value == GROUP_VALUE end -=end end diff --git a/test/setup.rb b/test/setup.rb index c63a17c..b035a80 100644 --- a/test/setup.rb +++ b/test/setup.rb @@ -4,8 +4,11 @@ Bundler.require require 'opentox-client' require File.join(ENV["HOME"],".opentox","config","test.rb") -if defined? $aa - @@subjectid = OpenTox::Authorization.authenticate($aa[:user], $aa[:password]) -else - @@subjectid = "" +begin + AA = $aa[:uri] + @@subjectid = OpenTox::Authorization.authenticate($aa[:user],$aa[:password]) + raise if !OpenTox::Authorization.is_token_valid(@@subjectid) +rescue + puts "Configuration Error: $aa[:uri], $aa[:user] or $aa[:password] are not defined in: " + File.join(ENV["HOME"],".opentox","config","test.rb") + exit end diff --git a/test/task.rb b/test/task.rb index c45704b..dd80c5b 100644 --- a/test/task.rb +++ b/test/task.rb @@ -2,17 +2,18 @@ require 'test/unit' require File.join(File.expand_path(File.dirname(__FILE__)),"setup.rb") #require "./validate-owl.rb" -TASK_SERVICE_URI = "http://ot-dev.in-silico.ch/task" -#TASK_SERVICE_URI = "http://ot-test.in-silico.ch/task" -#TASK_SERVICE_URI = "https://ambit.uni-plovdiv.bg:8443/ambit2/task" #not compatible +begin + @@service_uri = $task[:uri] + puts "Service URI is: #{@@service_uri}" +rescue + puts "Configuration Error: $task[:uri] is not defined in: " + File.join(ENV["HOME"],".opentox","config","test.rb") + exit +end class TaskTest < Test::Unit::TestCase - -=begin -=end def test_all - all = OpenTox::Task.all(TASK_SERVICE_URI) + all = OpenTox::Task.all(@@service_uri) assert_equal Array, all.class t = all.last assert_equal OpenTox::Task, t.class @@ -20,23 +21,22 @@ class TaskTest < Test::Unit::TestCase end def test_create_and_complete - task = OpenTox::Task.create TASK_SERVICE_URI, :description => "test" do + task = OpenTox::Task.create @@service_uri, :description => "test" do sleep 1 - TASK_SERVICE_URI + @@service_uri end assert task.running? assert_equal "Running", task.hasStatus task.wait assert task.completed? assert_equal "Completed", task.hasStatus - assert_equal TASK_SERVICE_URI, task.resultURI + assert_equal @@service_uri, task.resultURI end - def test_create_and_cancel - task = OpenTox::Task.create TASK_SERVICE_URI do + task = OpenTox::Task.create @@service_uri do sleep 2 - TASK_SERVICE_URI + @@service_uri end assert task.running? task.cancel @@ -44,7 +44,7 @@ class TaskTest < Test::Unit::TestCase end def test_create_and_fail - task = OpenTox::Task.create TASK_SERVICE_URI, :description => "test failure", :creator => "http://test.org/fake_creator" do + task = OpenTox::Task.create @@service_uri, :description => "test failure", :creator => "http://test.org/fake_creator" do sleep 1 raise "A runtime error occured" end @@ -56,7 +56,7 @@ class TaskTest < Test::Unit::TestCase end def test_create_and_fail_with_opentox_error - task = OpenTox::Task.create TASK_SERVICE_URI, :description => "test failure", :creator => "http://test.org/fake_creator" do + task = OpenTox::Task.create @@service_uri, :description => "test failure", :creator => "http://test.org/fake_creator" do sleep 1 raise OpenTox::Error.new 500, "An OpenTox::Error occured" end @@ -70,7 +70,7 @@ class TaskTest < Test::Unit::TestCase =begin # temporarily removed until uri checking from virtual machines has been fixed def test_wrong_result_uri - task = OpenTox::Task.create TASK_SERVICE_URI, :description => "test wrong result uri", :creator => "http://test.org/fake_creator" do + task = OpenTox::Task.create @@service_uri, :description => "test wrong result uri", :creator => "http://test.org/fake_creator" do sleep 1 "Asasadasd" end diff --git a/test/toxbank-investigation-curl.rb b/test/toxbank-investigation-curl.rb index 5856a1a..f228bb4 100644 --- a/test/toxbank-investigation-curl.rb +++ b/test/toxbank-investigation-curl.rb @@ -54,6 +54,8 @@ class UploadTest < Test::Unit::TestCase response = `curl -Lk -i -X DELETE -H "subjectid:#{@@subjectid}" #{uri}` assert_match /200/, response response = `curl -Lk -i -H "Accept:text/uri-list" -H "subjectid:#{@@subjectid}" #{uri}` + assert_match /401/, response + response = `curl -I -Lk -i -H "Accept:text/uri-list" -H "subjectid:#{@@subjectid}" #{uri}` assert_match /404/, response end end diff --git a/test/toxbank-investigation-rest.rb b/test/toxbank-investigation-rest.rb index 8849d60..3e1b295 100644 --- a/test/toxbank-investigation-rest.rb +++ b/test/toxbank-investigation-rest.rb @@ -78,15 +78,12 @@ class BasicTestCRUDInvestigation < Test::Unit::TestCase assert response.index(@@uri.to_s) != nil, "URI: #{@@uri} is not in uri-list" end -=begin # delete investigation/{id} def test_99_delete_investigation result = OpenTox::RestClientWrapper.delete @@uri.to_s, {}, :subjectid => @@subjectid - assert_raise OpenTox::NotFoundError do - OpenTox::RestClientWrapper.get @@uri.to_s, {}, {:accept => "text/uri-list", :subjectid => @@subjectid} - end + assert result.match(/^Investigation [\d]+ deleted$/) + assert !OpenTox::Authorization.uri_has_policy(@@uri.to_s, @@subjectid) end -=end end diff --git a/test/toxbank-investigation-xls.rb b/test/toxbank-investigation-xls.rb index 492d990..9ce8b2a 100644 --- a/test/toxbank-investigation-xls.rb +++ b/test/toxbank-investigation-xls.rb @@ -56,6 +56,8 @@ class UploadTest < Test::Unit::TestCase response = `curl -Lk -i -X DELETE -H "subjectid:#{@@subjectid}" #{uri}` assert_match /200/, response response = `curl -Lk -i -H "Accept:text/uri-list" -H "subjectid:#{@@subjectid}" #{uri}` + assert_match /401/, response + response = `curl -I -Lk -i -H "Accept:text/uri-list" -H "subjectid:#{@@subjectid}" #{uri}` assert_match /404/, response end |