diff options
author | David Vorgrimmler <vorgrimmlerdavid@gmx.de> | 2012-06-06 18:05:00 +0200 |
---|---|---|
committer | David Vorgrimmler <vorgrimmlerdavid@gmx.de> | 2012-06-06 18:05:00 +0200 |
commit | c91732c884c7b4b664791928c3f28d57f43b57b3 (patch) | |
tree | a97025e3e1a554b919b2329cf9962eb7981de6cd | |
parent | ce9dd536572e2fe5577b549321f7b1eb207ecea2 (diff) |
Modified fminer tests.
-rw-r--r-- | fminer.rb | 167 |
1 files changed, 81 insertions, 86 deletions
@@ -30,22 +30,22 @@ class FminerTest < Test::Unit::TestCase def test_bbrc feature = @@classification_training_dataset.features.keys.first - @dataset_uri = OpenTox::Algorithm::Fminer::BBRC.new.run({:dataset_uri => @@classification_training_dataset.uri, :prediction_feature => feature, :subjectid => @@subjectid}).to_s + @dataset_uri = OpenTox::Algorithm::Fminer::BBRC.new.run({:dataset_uri => @@classification_training_dataset.uri, :prediction_feature => feature, :min_frequency => "10pm", :subjectid => @@subjectid}).to_s dump - assert_equal 41, @dataset.features.size # 32 bit - #assert_equal 52, @dataset.features.size + assert_equal 53, @dataset.features.size # 32 bit + # assert no hit counts present count=0 @dataset.data_entries.each { |c,e| if c.to_s.scan('InChI=1S/C10H13N3O2/c1-13(12-15)7-3-5-10(14)9-4-2-6-11-8-9/h2,4,6,8H,3,5,7H2,1H3').size > 0 e.each { |p,h| - if p.to_s.scan('bbrc/40').size>0 + if p.to_s.scan('bbrc/26').size>0 count += 1 if h[0] == 1 end - if p.to_s.scan('bbrc/29').size>0 + if p.to_s.scan('bbrc/49').size>0 count += 1 if h[0] == 1 end - if p.to_s.scan('bbrc/18').size>0 + if p.to_s.scan('bbrc/27').size>0 count += 1 if h[0] == 1 end } @@ -56,9 +56,9 @@ class FminerTest < Test::Unit::TestCase # assert some values @dataset.features.each { |c,e| if c.to_s.scan('feature/bbrc/31').size > 0 - assert_equal e['http://www.opentox.org/api/1.1#effect'], 2 - assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.97 - assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#6&a]-[#6&a]:[#6&a]:[#6&a]:[#6&a]-[#7&A]" + assert_equal e['http://www.opentox.org/api/1.1#effect'], 1 + assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.98 + assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#6&a]:[#6&a](-[#6&A]-[#6&A])(:[#6&a]:[#6&a])" end } cleanup @@ -66,23 +66,22 @@ class FminerTest < Test::Unit::TestCase def test_regression_bbrc feature = File.join @@regression_training_dataset.uri,"feature/LC50_mmol" - @dataset_uri = OpenTox::Algorithm::Fminer::BBRC.new.run({:dataset_uri => @@regression_training_dataset.uri, :prediction_feature => feature, :subjectid => @@subjectid, :feature_type=>"paths"}).to_s + @dataset_uri = OpenTox::Algorithm::Fminer::BBRC.new.run({:dataset_uri => @@regression_training_dataset.uri, :prediction_feature => feature, :min_frequency => "10pm", :subjectid => @@subjectid, :feature_type=>"paths"}).to_s dump - assert_equal 131, @dataset.features.size # 32 bit - #assert_equal 219, @dataset.features.size + assert_equal 90, @dataset.features.size # 32 bit # assert no hit counts present count = 0 @dataset.data_entries.each { |c,e| - if c.to_s.scan('InChI=1S/C5H10N2O2S/c1-4(10-3)7-9-5(8)6-2/h1-3H3,(H,6,8)').size > 0 + if c.to_s.scan('InChI=1S/C5H4ClNO/c6-4-1-2-5(8)7-3-4/h1-3H,(H,7,8)').size > 0 e.each { |p,h| - if p.to_s.scan('bbrc/86').size>0 + if p.to_s.scan('bbrc/81').size>0 count += 1 if h[0] == 1 end - if p.to_s.scan('bbrc/54').size>0 + if p.to_s.scan('bbrc/5').size>0 count += 1 if h[0] == 1 end - if p.to_s.scan('bbrc/32').size>0 + if p.to_s.scan('bbrc/82').size>0 count += 1 if h[0] == 1 end } @@ -92,10 +91,10 @@ class FminerTest < Test::Unit::TestCase # assert some values @dataset.features.each { |c,e| - if c.to_s.scan('feature/bbrc/188').size > 0 + if c.to_s.scan('feature/bbrc/83').size > 0 assert_equal e['http://www.opentox.org/api/1.1#effect'], "activating" assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 1.0 - assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#6&a]:[#6&a]:[#8&a]:[#6&a]:[#6&a]" + assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#17&A]-[#6&a]:[#6&a]:[#6&a]:[#6&a]" end } @@ -105,7 +104,7 @@ class FminerTest < Test::Unit::TestCase def test_last feature = @@classification_training_dataset.features.keys.first - @dataset_uri = OpenTox::Algorithm::Fminer::LAST.new.run({:dataset_uri => @@classification_training_dataset.uri, :prediction_feature => feature, :subjectid => @@subjectid}).to_s + @dataset_uri = OpenTox::Algorithm::Fminer::LAST.new.run({:dataset_uri => @@classification_training_dataset.uri, :prediction_feature => feature, :min_frequency => "75pm", :subjectid => @@subjectid}).to_s dump assert_in_delta 21, @dataset.features.size, 2 # 32 bit @@ -114,68 +113,66 @@ class FminerTest < Test::Unit::TestCase @dataset.data_entries.each { |c,e| if c.to_s.scan('InChI=1S/C5H10N2O/c8-6-7-4-2-1-3-5-7/h1-5H2').size > 0 e.each { |p,h| - if p.to_s.scan('last/11').size>0 - count += 1 if h[0] == true + if p.to_s.scan('last/21').size>0 + count += 1 if h[0] == 1 end - if p.to_s.scan('last/5').size>0 - count += 1 if h[0] == true + if p.to_s.scan('last/10').size>0 + count += 1 if h[0] == 1 end if p.to_s.scan('last/13').size>0 - count += 1 if h[0] == true + count += 1 if h[0] == 1 end } end } - #assert_equal 3, count + assert_equal 3, count # assert some values - #@dataset.features.each { |c,e| - # if c.to_s.scan('feature/last/3').size > 0 - # assert_equal e['http://www.opentox.org/api/1.1#effect'], 2 - # assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.99 - # assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#8&A]=[#6&A]-[#6&A]-[#6&A]" - # end - #} + @dataset.features.each { |c,e| + if c.to_s.scan('feature/last/3').size > 0 + assert_equal e['http://www.opentox.org/api/1.1#effect'], 1 + assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(3), 0.995 + assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#8&A]=[#6&A]-[#6&A]-[#6&A]" + end + } cleanup end def test_regression_last feature = File.join @@regression_training_dataset.uri,"feature/LC50_mmol" - @dataset_uri = OpenTox::Algorithm::Fminer::LAST.new.run({:dataset_uri => @@regression_training_dataset.uri, :prediction_feature => feature, - :min_frequency => 40, - :subjectid => @@subjectid}).to_s + @dataset_uri = OpenTox::Algorithm::Fminer::LAST.new.run({:dataset_uri => @@regression_training_dataset.uri, :prediction_feature => feature, :min_frequency => "40", :subjectid => @@subjectid}).to_s dump - assert_in_delta 16, @dataset.features.size, 8 + assert_in_delta 16, @dataset.features.size, 8 # assert no hit counts present - #count=0 - #@dataset.data_entries.each { |c,e| - # if c.to_s.scan('InChI=1S/C9H10O3/c1-2-12-9-5-7(6-10)3-4-8(9)11/h3-6,11H,2H2,1H3').size > 0 - # e.each { |p,h| - # if p.to_s.scan('last/5').size>0 - # count += 1 if h[0] == true - # end - # if p.to_s.scan('last/11').size>0 - # count += 1 if h[0] == true - # end - # if p.to_s.scan('last/13').size>0 - # count += 1 if h[0] == true - # end - # } - # end - #} - #assert_in_delta 3, count, 2 + count=0 + @dataset.data_entries.each { |c,e| + if c.to_s.scan('InChI=1S/C9H10O3/c1-2-12-9-5-7(6-10)3-4-8(9)11/h3-6,11H,2H2,1H3').size > 0 + e.each { |p,h| + if p.to_s.scan('last/2').size>0 + count += 1 if h[0] == 1 + end + if p.to_s.scan('last/3').size>0 + count += 1 if h[0] == 1 + end + if p.to_s.scan('last/8').size>0 + count += 1 if h[0] == 1 + end + } + end + } + assert_in_delta 3, count, 2 # assert some values - #@dataset.features.each { |c,e| - # if c.to_s.scan('feature/last/3').size > 0 - # assert_equal e['http://www.opentox.org/api/1.1#effect'], "activating" - # assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 1.0 - # assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#8&A]=[#6&A]-[#8&A]-[#6&A]" - # end - #} + @dataset.features.each { |c,e| + if c.to_s.scan('feature/last/3').size > 0 + assert_equal e['http://www.opentox.org/api/1.1#effect'], "deactivating" + assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.99 + assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#6&A]-[#6&a](:[#6&a]):[#6&a]" + end + } cleanup end @@ -186,11 +183,11 @@ end @dataset_uri = OpenTox::RestClientWrapper.post(File.join(CONFIG[:services]["opentox-algorithm"],"fminer","bbrc"),{ "dataset_uri" => @@classification_training_dataset.uri, "prediction_feature" => feature, + "min_frequency" => "10pm", "nr_hits" => true, :subjectid => @@subjectid }) dump - assert_equal 41, @dataset.features.size # 32 bit - #assert_equal 52, @dataset.features.size + assert_equal 53, @dataset.features.size # 32 bit # assert hit counts present @dataset.data_entries.each { |c,e| @@ -212,9 +209,9 @@ end # assert some values @dataset.features.each { |c,e| if c.to_s.scan('feature/bbrc/31').size > 0 - assert_equal e['http://www.opentox.org/api/1.1#effect'], 2 - assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.97 - assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#6&a]-[#6&a]:[#6&a]:[#6&a]:[#6&a]-[#7&A]" + assert_equal e['http://www.opentox.org/api/1.1#effect'], 1 + assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.98 + assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#6&a]:[#6&a](-[#6&A]-[#6&A])(:[#6&a]:[#6&a])" end } @@ -227,23 +224,23 @@ end "dataset_uri" => @@classification_training_dataset.uri, "prediction_feature" => feature, "backbone" => false, + "min_frequency" => "10pm", :subjectid => @@subjectid }) dump - assert_equal 139, @dataset.features.size # 32 bit - #assert_equal 52, @dataset.features.size + assert_equal 195, @dataset.features.size # 32 bit # assert no hit counts present count=0 @dataset.data_entries.each { |c,e| if c.to_s.scan('InChI=1S/C10H13N3O2/c1-13(12-15)7-3-5-10(14)9-4-2-6-11-8-9/h2,4,6,8H,3,5,7H2,1H3').size > 0 e.each { |p,h| - if p.to_s.scan('bbrc/113').size>0 + if p.to_s.scan('bbrc/167').size>0 count += 1 if h[0] == 1 end - if p.to_s.scan('bbrc/99').size>0 + if p.to_s.scan('bbrc/134').size>0 count += 1 if h[0] == 1 end - if p.to_s.scan('bbrc/77').size>0 + if p.to_s.scan('bbrc/112').size>0 count += 1 if h[0] == 1 end } @@ -254,10 +251,10 @@ end # assert some values @dataset.features.each { |c,e| - if c.to_s.scan('feature/bbrc/31').size > 0 - assert_equal e['http://www.opentox.org/api/1.1#effect'], 2 - assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.99 - assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#8&A]-[#6&A]-[#7&A]-[#7&A]=[#8&A]" + if c.to_s.scan('feature/bbrc/183').size > 0 + assert_equal e['http://www.opentox.org/api/1.1#effect'], 1 + assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.98 + assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#7&A]-[#6&a](:[#6&a]:[#6&a])(:[#6&a]:[#6&a]:[#6&a])" end } @@ -266,7 +263,7 @@ end def test_bbrc_multinomial feature = @@multinomial_training_dataset.features.keys.first - @dataset_uri = OpenTox::Algorithm::Fminer::BBRC.new.run({:dataset_uri => @@multinomial_training_dataset.uri, :prediction_feature => feature, :subjectid => @@subjectid}).to_s + @dataset_uri = OpenTox::Algorithm::Fminer::BBRC.new.run({:dataset_uri => @@multinomial_training_dataset.uri, :prediction_feature => feature, :min_frequency => "10pm", :subjectid => @@subjectid}).to_s dump assert_equal 152, @dataset.features.size # 32 bit @@ -316,7 +313,7 @@ end def test_last_multinomial feature = @@multinomial_training_dataset.features.keys.first - @dataset_uri = OpenTox::Algorithm::Fminer::LAST.new.run({:dataset_uri => @@multinomial_training_dataset.uri, :prediction_feature => feature, :subjectid => @@subjectid}).to_s + @dataset_uri = OpenTox::Algorithm::Fminer::LAST.new.run({:dataset_uri => @@multinomial_training_dataset.uri, :prediction_feature => feature, :min_frequency => "75pm", :subjectid => @@subjectid}).to_s dump assert_in_delta 138, @dataset.features.size, 2 # 32 bit @@ -326,18 +323,18 @@ end if c.to_s.scan('InChI=1S/C7H6N2O4/c8-6-3-4(9(12)13)1-2-5(6)7(10)11/h1-3H,8H2,(H,10,11)').size > 0 e.each { |p,h| if p.to_s.scan('last/127').size>0 - count += 1 if h[0] == true + count += 1 if h[0] == 1 end if p.to_s.scan('last/54').size>0 - count += 1 if h[0] == true + count += 1 if h[0] == 1 end if p.to_s.scan('last/120').size>0 - count += 1 if h[0] == true + count += 1 if h[0] == 1 end } end } - #assert_equal 3, count + assert_equal 3, count # assert some values #@dataset.features.each { |c,e| @@ -367,19 +364,18 @@ end def test_match feature = @@classification_training_dataset.features.keys.first feature_dataset_uri = OpenTox::Algorithm::Fminer::BBRC.new.run({ - :dataset_uri => @@classification_training_dataset.uri, :prediction_feature => feature, :subjectid => @@subjectid}).to_s + :dataset_uri => @@classification_training_dataset.uri, :prediction_feature => feature, :min_frequency => "10pm", :subjectid => @@subjectid}).to_s feature_dataset = OpenTox::Dataset.find(feature_dataset_uri,@@subjectid) tmp_resources = [ feature_dataset_uri ] [true,false].each do |hits| matched_dataset_uri = OpenTox::RestClientWrapper.post(File.join(CONFIG[:services]["opentox-algorithm"],"fminer","bbrc","match"), - {:feature_dataset_uri => feature_dataset_uri, :dataset_uri => @@multinomial_training_dataset.uri, - :nr_hits => hits, :subjectid => @@subjectid}).to_s + {:feature_dataset_uri => feature_dataset_uri, :dataset_uri => @@multinomial_training_dataset.uri, :nr_hits => hits, :min_frequency => "10pm", :subjectid => @@subjectid}).to_s tmp_resources << matched_dataset_uri matched_dataset = OpenTox::Dataset.find(matched_dataset_uri,@@subjectid) - # matched dataset should have same features as feature dataset - assert_equal feature_dataset.features.keys.sort,matched_dataset.features.keys.sort # matched datset should have same compounds as input dataset for matching assert_equal matched_dataset.compounds.sort,@@multinomial_training_dataset.compounds.sort + # matched dataset should have same features as feature dataset + #assert_equal feature_dataset.features.keys.sort,matched_dataset.features.keys.sort matched_dataset.compounds.each do |c| matched_dataset.features.keys.each do |f| if matched_dataset.data_entries[c] and matched_dataset.data_entries[c][f] @@ -397,5 +393,4 @@ end end tmp_resources.each{|uri| OpenTox::RestClientWrapper.delete(uri,{:subjectid=>@@subjectid})} end - end |