diff options
author | Christoph Helma <helma@in-silico.ch> | 2010-11-19 17:31:27 +0100 |
---|---|---|
committer | Christoph Helma <helma@in-silico.ch> | 2010-11-19 17:31:27 +0100 |
commit | 2824a2fdb2aa308ad77ead17ee6c7cba9c69ab46 (patch) | |
tree | 807aa180a7edd24c044bb8f651adeb72e8e37d13 /compound.rb | |
parent | 533e1b918a80d23af78a886442d4c82d853f829f (diff) |
Initial sketch of unit tests, cucumber tests are obsolete
Diffstat (limited to 'compound.rb')
-rw-r--r-- | compound.rb | 29 |
1 files changed, 29 insertions, 0 deletions
diff --git a/compound.rb b/compound.rb new file mode 100644 index 0000000..b6addc2 --- /dev/null +++ b/compound.rb @@ -0,0 +1,29 @@ +require 'rubygems' +require 'opentox-ruby-api-wrapper' +require 'test/unit' + +class CompoundTest < Test::Unit::TestCase + + def test_compound + + c = OpenTox::Compound.from_smiles "F[B-](F)(F)F.[Na+]" + assert_equal "InChI=1S/BF4.Na/c2-1(3,4)5;/q-1;+1", c.inchi + #assert_equal "[Na+].F[B-](F)(F)F", c.smiles # still does not work on 64bit machines + c = OpenTox::Compound.from_smiles "CC(=O)CC(C)C#N" + assert_equal "InChI=1S/C6H9NO/c1-5(4-7)3-6(2)8/h5H,3H2,1-2H3", c.inchi + assert_equal "CC(CC(=O)C)C#N", c.to_smiles + c = OpenTox::Compound.from_name "Benzene" + assert_equal "InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H", c.inchi + assert_equal "c1ccccc1", c.to_smiles + c = OpenTox::Compound.from_smiles "N#[N+]C1=CC=CC=C1.F[B-](F)(F)F" + assert_equal "InChI=1S/C6H5N2.BF4/c7-8-6-4-2-1-3-5-6;2-1(3,4)5/h1-5H;/q+1;-1", c.inchi + assert_equal "N#[N+]c1ccccc1.F[B-](F)(F)F", c.to_smiles + c = OpenTox::Compound.from_inchi "InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H" + assert_equal "c1ccccc1", c.to_smiles + c = OpenTox::Compound.new "http://apps.ideaconsult.net:8080/ambit2/compound/144036" + assert_equal "InChI=1S/C6H11NO2/c1-3-5-6(4-2)7(8)9/h5H,3-4H2,1-2H3", c.inchi + assert_equal "CCC=C(CC)N(=O)=O", c.to_smiles + end + + +end |