require 'rubygems' require 'opentox-ruby' require 'test/unit' require 'validate-owl.rb' class Float def round_to(x) (self * 10**x).round.to_f / 10**x end end class FminerTest < Test::Unit::TestCase def setup @dump_dir = FileUtils.mkdir_p File.join(File.dirname(__FILE__),"dump",File.basename(__FILE__,".rb")) FileUtils.mkdir_p File.join(File.dirname(__FILE__),"reference",File.basename(__FILE__,".rb")) end def cleanup # executed only when assertions succeed (teardown is called even when assertions fail) FileUtils.cp @dumpfile, @dumpfile.sub(/dump/,"reference") FileUtils.rm @dumpfile @dataset.delete(@@subjectid) end def dump @dataset = OpenTox::Dataset.find @dataset_uri, @@subjectid @dumpfile = File.join(@dump_dir,caller[0][/`.*'/][1..-2])+".yaml" File.open(@dumpfile,"w+"){|f| f.puts @dataset.to_yaml} end def test_bbrc feature = @@classification_training_dataset.features.keys.first @dataset_uri = OpenTox::Algorithm::Fminer::BBRC.new.run({:dataset_uri => @@classification_training_dataset.uri, :prediction_feature => feature, :subjectid => @@subjectid}).to_s dump assert_equal 41, @dataset.features.size # 32 bit #assert_equal 52, @dataset.features.size # assert no hit counts present count=0 @dataset.data_entries.each { |c,e| if c.to_s.scan('InChI=1S/C10H13N3O2/c1-13(12-15)7-3-5-10(14)9-4-2-6-11-8-9/h2,4,6,8H,3,5,7H2,1H3').size > 0 e.each { |p,h| if p.to_s.scan('bbrc/40').size>0 count += 1 if h[0] == 1 end if p.to_s.scan('bbrc/29').size>0 count += 1 if h[0] == 1 end if p.to_s.scan('bbrc/18').size>0 count += 1 if h[0] == 1 end } end } assert_equal 3, count # assert some values @dataset.features.each { |c,e| if c.to_s.scan('feature/bbrc/31').size > 0 assert_equal e['http://www.opentox.org/api/1.1#effect'], 2 assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.97 assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#6&a]-[#6&a]:[#6&a]:[#6&a]:[#6&a]-[#7&A]" end } cleanup end def test_regression_bbrc feature = File.join @@regression_training_dataset.uri,"feature/LC50_mmol" @dataset_uri = OpenTox::Algorithm::Fminer::BBRC.new.run({:dataset_uri => @@regression_training_dataset.uri, :prediction_feature => feature, :subjectid => @@subjectid, :feature_type=>"paths"}).to_s dump assert_equal 131, @dataset.features.size # 32 bit #assert_equal 219, @dataset.features.size # assert no hit counts present count = 0 @dataset.data_entries.each { |c,e| if c.to_s.scan('InChI=1S/C5H10N2O2S/c1-4(10-3)7-9-5(8)6-2/h1-3H3,(H,6,8)').size > 0 e.each { |p,h| if p.to_s.scan('bbrc/86').size>0 count += 1 if h[0] == 1 end if p.to_s.scan('bbrc/54').size>0 count += 1 if h[0] == 1 end if p.to_s.scan('bbrc/32').size>0 count += 1 if h[0] == 1 end } end } assert_equal 3, count # assert some values @dataset.features.each { |c,e| if c.to_s.scan('feature/bbrc/188').size > 0 assert_equal e['http://www.opentox.org/api/1.1#effect'], "activating" assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 1.0 assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#6&a]:[#6&a]:[#8&a]:[#6&a]:[#6&a]" end } cleanup end def test_last feature = @@classification_training_dataset.features.keys.first @dataset_uri = OpenTox::Algorithm::Fminer::LAST.new.run({:dataset_uri => @@classification_training_dataset.uri, :prediction_feature => feature, :subjectid => @@subjectid}).to_s dump assert_in_delta 21, @dataset.features.size, 2 # 32 bit # assert no hit counts present count = 0 @dataset.data_entries.each { |c,e| if c.to_s.scan('InChI=1S/C5H10N2O/c8-6-7-4-2-1-3-5-7/h1-5H2').size > 0 e.each { |p,h| if p.to_s.scan('last/11').size>0 count += 1 if h[0] == true end if p.to_s.scan('last/5').size>0 count += 1 if h[0] == true end if p.to_s.scan('last/13').size>0 count += 1 if h[0] == true end } end } #assert_equal 3, count # assert some values #@dataset.features.each { |c,e| # if c.to_s.scan('feature/last/3').size > 0 # assert_equal e['http://www.opentox.org/api/1.1#effect'], 2 # assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.99 # assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#8&A]=[#6&A]-[#6&A]-[#6&A]" # end #} cleanup end def test_regression_last feature = File.join @@regression_training_dataset.uri,"feature/LC50_mmol" @dataset_uri = OpenTox::Algorithm::Fminer::LAST.new.run({:dataset_uri => @@regression_training_dataset.uri, :prediction_feature => feature, :min_frequency => 40, :subjectid => @@subjectid}).to_s dump assert_in_delta 16, @dataset.features.size, 8 # assert no hit counts present #count=0 #@dataset.data_entries.each { |c,e| # if c.to_s.scan('InChI=1S/C9H10O3/c1-2-12-9-5-7(6-10)3-4-8(9)11/h3-6,11H,2H2,1H3').size > 0 # e.each { |p,h| # if p.to_s.scan('last/5').size>0 # count += 1 if h[0] == true # end # if p.to_s.scan('last/11').size>0 # count += 1 if h[0] == true # end # if p.to_s.scan('last/13').size>0 # count += 1 if h[0] == true # end # } # end #} #assert_in_delta 3, count, 2 # assert some values #@dataset.features.each { |c,e| # if c.to_s.scan('feature/last/3').size > 0 # assert_equal e['http://www.opentox.org/api/1.1#effect'], "activating" # assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 1.0 # assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#8&A]=[#6&A]-[#8&A]-[#6&A]" # end #} cleanup end def test_bbrc_rest_parameters_nr_hits feature = @@classification_training_dataset.features.keys.first @dataset_uri = OpenTox::RestClientWrapper.post(File.join(CONFIG[:services]["opentox-algorithm"],"fminer","bbrc"),{ "dataset_uri" => @@classification_training_dataset.uri, "prediction_feature" => feature, "nr_hits" => true, :subjectid => @@subjectid }) dump assert_equal 41, @dataset.features.size # 32 bit #assert_equal 52, @dataset.features.size # assert hit counts present @dataset.data_entries.each { |c,e| if c.to_s.scan('InChI=1S/C14H19N3S.ClH/c1-16(2)9-10-17(12-13-6-5-11-18-13)14-7-3-4-8-15-14;/h3-8,11H,9-10,12H2,1-2H3;1H').size > 0 e.each { |p,h| if p.to_s.scan('bbrc/39').size>0 assert_equal 6, h[0] end if p.to_s.scan('bbrc/18').size>0 assert_equal 5, h[0] end if p.to_s.scan('bbrc/38').size>0 assert_equal 14, h[0] end } end } # assert some values @dataset.features.each { |c,e| if c.to_s.scan('feature/bbrc/31').size > 0 assert_equal e['http://www.opentox.org/api/1.1#effect'], 2 assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.97 assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#6&a]-[#6&a]:[#6&a]:[#6&a]:[#6&a]-[#7&A]" end } cleanup end def test_bbrc_rest_parameters_bb_false feature = @@classification_training_dataset.features.keys.first @dataset_uri = OpenTox::RestClientWrapper.post(File.join(CONFIG[:services]["opentox-algorithm"],"fminer","bbrc"),{ "dataset_uri" => @@classification_training_dataset.uri, "prediction_feature" => feature, "backbone" => false, :subjectid => @@subjectid }) dump assert_equal 139, @dataset.features.size # 32 bit #assert_equal 52, @dataset.features.size # assert no hit counts present count=0 @dataset.data_entries.each { |c,e| if c.to_s.scan('InChI=1S/C10H13N3O2/c1-13(12-15)7-3-5-10(14)9-4-2-6-11-8-9/h2,4,6,8H,3,5,7H2,1H3').size > 0 e.each { |p,h| if p.to_s.scan('bbrc/113').size>0 count += 1 if h[0] == 1 end if p.to_s.scan('bbrc/99').size>0 count += 1 if h[0] == 1 end if p.to_s.scan('bbrc/77').size>0 count += 1 if h[0] == 1 end } end } assert_equal 3, count # assert some values @dataset.features.each { |c,e| if c.to_s.scan('feature/bbrc/31').size > 0 assert_equal e['http://www.opentox.org/api/1.1#effect'], 2 assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.99 assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#8&A]-[#6&A]-[#7&A]-[#7&A]=[#8&A]" end } cleanup end def test_bbrc_multinomial feature = @@multinomial_training_dataset.features.keys.first @dataset_uri = OpenTox::Algorithm::Fminer::BBRC.new.run({:dataset_uri => @@multinomial_training_dataset.uri, :prediction_feature => feature, :subjectid => @@subjectid}).to_s dump assert_equal 152, @dataset.features.size # 32 bit #assert no hit counts present count=0 @dataset.data_entries.each { |c,e| if c.to_s.scan('InChI=1S/C10H7NO2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H').size > 0 e.each { |p,h| if p.to_s.scan('bbrc/37').size>0 count += 1 if h[0] == 1 end if p.to_s.scan('bbrc/38').size>0 count += 1 if h[0] == 1 end if p.to_s.scan('bbrc/39').size>0 count += 1 if h[0] == 1 end } end } assert_equal 3, count # assert some values @dataset.features.each { |c,e| if c.to_s.scan('feature/bbrc/0').size > 0 assert_equal e['http://www.opentox.org/api/1.1#effect'], 2 assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 1.00 assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#6&A]-[#6&A](=[#6&A])(-[#6&A])" end } @dataset.features.each { |c,e| if c.to_s.scan('feature/bbrc/92').size > 0 assert_equal e['http://www.opentox.org/api/1.1#effect'], 1 assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.99 assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#7&A]-[#6&a](:[#6&a]:[#6&a]:[#6&a])(:[#6&a]:[#6&a]-[#16&A])" end } @dataset.features.each { |c,e| if c.to_s.scan('feature/bbrc/42').size > 0 assert_equal e['http://www.opentox.org/api/1.1#effect'], 3 assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.99 assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#6&a]:[#6&a]:[#6&a]:[#6&a]:[#6&a]:[#7&a]:[#6&a]" end } cleanup end def test_last_multinomial feature = @@multinomial_training_dataset.features.keys.first @dataset_uri = OpenTox::Algorithm::Fminer::LAST.new.run({:dataset_uri => @@multinomial_training_dataset.uri, :prediction_feature => feature, :subjectid => @@subjectid}).to_s dump assert_in_delta 138, @dataset.features.size, 2 # 32 bit #assert no hit counts present count=0 @dataset.data_entries.each { |c,e| if c.to_s.scan('InChI=1S/C7H6N2O4/c8-6-3-4(9(12)13)1-2-5(6)7(10)11/h1-3H,8H2,(H,10,11)').size > 0 e.each { |p,h| if p.to_s.scan('last/127').size>0 count += 1 if h[0] == true end if p.to_s.scan('last/54').size>0 count += 1 if h[0] == true end if p.to_s.scan('last/120').size>0 count += 1 if h[0] == true end } end } #assert_equal 3, count # assert some values #@dataset.features.each { |c,e| # if c.to_s.scan('feature/last/54').size > 0 # assert_equal e['http://www.opentox.org/api/1.1#effect'], 1 # assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.99 # assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#7&A;$([#7&A](=[#8&A])=[#8&A]),$([#7&A](-[#6&a])=[#8&A])](~*)=[#8&A]" # end #} #@dataset.features.each { |c,e| # if c.to_s.scan('feature/last/48').size > 0 # assert_equal e['http://www.opentox.org/api/1.1#effect'], 2 # assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.99 # assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#6&A]=[#6&A](-[#6&A])-[#6&A]" # end #} #@dataset.features.each { |c,e| # if c.to_s.scan('feature/bbrc/76').size > 0 # assert_equal e['http://www.opentox.org/api/1.1#effect'], "2" # assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.0 # assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#7&A]-[#6&a]:[#6&a]:[#6&a](-[#16&A;$([#16&A](-,=[#8&A])-[#6&a]),$([#16&A](=[#8&A])-[#6&a])](~*)):[#6&a]:[#6&a;$([#6&a](:[#6&a])(:[#6&a]):[#6&a]),$([#6&a](:[#6&a])(:[#6&a]):[#6&a])](~*)(~*):[#6&a]:[#6&a]" # end #} cleanup end def test_match feature = @@classification_training_dataset.features.keys.first feature_dataset_uri = OpenTox::Algorithm::Fminer::BBRC.new.run({ :dataset_uri => @@classification_training_dataset.uri, :prediction_feature => feature, :subjectid => @@subjectid}).to_s feature_dataset = OpenTox::Dataset.find(feature_dataset_uri,@@subjectid) matched_dataset_uri = OpenTox::RestClientWrapper.post(File.join(CONFIG[:services]["opentox-algorithm"],"fminer","bbrc","match"), {:feature_dataset_uri => feature_dataset_uri, :dataset_uri => @@multinomial_training_dataset.uri, :subjectid => @@subjectid}).to_s matched_dataset = OpenTox::Dataset.find(matched_dataset_uri,@@subjectid) # matched dataset should have same features as feature dataset assert_equal feature_dataset.features.keys.sort,matched_dataset.features.keys.sort # matched datset should have same compounds as input dataset for matching assert_equal matched_dataset.compounds.sort,@@multinomial_training_dataset.compounds.sort [feature_dataset_uri, matched_dataset_uri].each{|uri| OpenTox::RestClientWrapper.delete(uri,{:subjectid=>@@subjectid})} end end