1 files changed, 104 insertions, 0 deletions
diff --git a/views/help.haml b/views/help.haml
new file mode 100644
index 0000000..eabf978
--- /dev/null
+++ b/views/help.haml
@@ -0,0 +1,104 @@
+= link_to "Back to model creation", '/create'
+%p
+  Input files have two columns. Enter in the first column the chemical structure in
+  %a{:href => "http://en.wikipedia.org/wiki/Simplified_molecular_input_line_entry_specification"} SMILES
+  format, in the second column the toxic activity.
+%dl
+  %dt Classification datasets 
+  %dd Please use 1/0, active/inactive or true/false to indicate active/inactive compounds.
+  %dt Regression datasets
+  %dd
+    Enter a quantitative value. For optimal performance you should
+    %ul
+      %li
+        use
+        %a{:href => "http://en.wikipedia.org/wiki/Molar_(concentration)"} molar
+        units
+      %li enter non-logarithmic values (logarithms are taken internally)
+      %li avoid 0 activities (will be ignored)
+%p 
+  Input files are accepted in 
+  %a{:href => "http://en.wikipedia.org/wiki/Microsoft_Excel"} Excel
+  and
+  %a{:href => "en.wikipedia.org/wiki/Comma-separated_values"} CSV
+  formats.
+
+%h3 Excel example
+
+- n = 0
+
+.code
+  %table
+    %tr
+      %td
+      %th A
+      %th B
+    %tr
+      - n += 1
+      %th= n
+      %td CC(=O)Nc1ccc(O)cc1
+      %td 1  
+    %tr
+      - n += 1
+      %th= n
+      %td O=c1[nH]cnc2[nH]ncc12
+      %td 1  
+    %tr
+      - n += 1
+      %th= n
+      %td CCCCNc1cc(cc(c1Oc2ccccc2)S(=O)(=O)N)C(=O)O
+      %td 1  
+    %tr
+      - n += 1
+      %th= n
+      %td CC(C)(C)NCC(O)COc1cccc2NC(=O)CCc12
+      %td 1  
+    %tr
+      - n += 1
+      %th= n
+      %td CN(C)CCCC1(OCc2cc(C#N)ccc21)c3ccc(F)cc3
+      %td 1  
+    %tr
+      - n += 1
+      %th= n
+      %td CCC(CC)CCN1C(=O)CN=C(C2CCCCC2F)c3cc(Cl)ccc13
+      %td 0 
+    %tr
+      - n += 1
+      %th= n
+      %td CCN(CC)CC(=O)Nc1c(C)cccc1C
+      %td 0 
+    %tr
+      - n += 1
+      %th= n
+      %td CC(C)(C)NCC(O)COc1cccc2CC(O)C(O)Cc12
+      %td 0 
+    %tr
+      - n += 1
+      %th= n
+      %td CN1CCCC1c2cccnc2
+      %td 0 
+
+%p
+  Excel example file for download:
+  = link_to "hamster_carcinogenicity.xls", "/hamster_carcinogenicity.xls"
+
+%h3 CSV example
+
+.code
+  %code
+    %br CC(=O)Nc1ccc(O)cc1, 1  
+    %br O=c1[nH]cnc2[nH]ncc12, 1  
+    %br CCCCNc1cc(cc(c1Oc2ccccc2)S(=O)(=O)N)C(=O)O, 1  
+    %br CC(C)(C)NCC(O)COc1cccc2NC(=O)CCc12, 1  
+    %br CN(C)CCCC1(OCc2cc(C#N)ccc21)c3ccc(F)cc3, 1  
+    %br CCC(CC)CCN1C(=O)CN=C(C2CCCCC2F)c3cc(Cl)ccc13, 0 
+    %br CCN(CC)CC(=O)Nc1c(C)cccc1C, 0 
+    %br CC(C)(C)NCC(O)COc1cccc2CC(O)C(O)Cc12, 0 
+    %br CN1CCCC1c2cccnc2, 0 
+
+%p
+  CSV example for download:
+  = link_to "hamster_carcinogenicity.csv", "/hamster_carcinogenicity.csv"
+
+%p You can create CSV files in Excel: Create a sheet with two columns and export them as CSV file with the "Save As" option from the menu, selecting the CSV (comma delimited) format.