diff options
author | Andreas Maunz <andreas@maunz.de> | 2011-07-01 15:27:00 +0200 |
---|---|---|
committer | Andreas Maunz <andreas@maunz.de> | 2011-07-01 15:27:00 +0200 |
commit | 0a58b2de8bdcbe3bcc598b3ffccdcd077709080e (patch) | |
tree | d2090d465aac8d703a295e2f370718412ad27c04 /fminer.rb | |
parent | fe6a64a503507d905a61505958e795b2bca251b1 (diff) |
Updated tests according to fminer regression value conversion.
Diffstat (limited to 'fminer.rb')
-rw-r--r-- | fminer.rb | 80 |
1 files changed, 40 insertions, 40 deletions
@@ -68,7 +68,7 @@ class FminerTest < Test::Unit::TestCase feature = File.join @@regression_training_dataset.uri,"feature/LC50_mmol" @dataset_uri = OpenTox::Algorithm::Fminer::BBRC.new.run({:dataset_uri => @@regression_training_dataset.uri, :prediction_feature => feature, :subjectid => @@subjectid, :feature_type=>"paths"}).to_s dump - assert_equal 132, @dataset.features.size # 32 bit + assert_equal 131, @dataset.features.size # 32 bit #assert_equal 219, @dataset.features.size # assert no hit counts present @@ -76,7 +76,7 @@ class FminerTest < Test::Unit::TestCase @dataset.data_entries.each { |c,e| if c.to_s.scan('InChI=1S/C5H10N2O2S/c1-4(10-3)7-9-5(8)6-2/h1-3H3,(H,6,8)').size > 0 e.each { |p,h| - if p.to_s.scan('bbrc/87').size>0 + if p.to_s.scan('bbrc/86').size>0 count += 1 if h[0] == true end if p.to_s.scan('bbrc/54').size>0 @@ -141,44 +141,44 @@ class FminerTest < Test::Unit::TestCase end - def test_regression_last - feature = File.join @@regression_training_dataset.uri,"feature/LC50_mmol" - @dataset_uri = OpenTox::Algorithm::Fminer::LAST.new.run({:dataset_uri => @@regression_training_dataset.uri, :prediction_feature => feature, - :min_frequency => 40, - :subjectid => @@subjectid}).to_s - dump - assert_equal 21, @dataset.features.size - - - # assert no hit counts present - count=0 - @dataset.data_entries.each { |c,e| - if c.to_s.scan('InChI=1S/C9H10O3/c1-2-12-9-5-7(6-10)3-4-8(9)11/h3-6,11H,2H2,1H3').size > 0 - e.each { |p,h| - if p.to_s.scan('last/17').size>0 - count += 1 if h[0] == true - end - if p.to_s.scan('last/18').size>0 - count += 1 if h[0] == true - end - if p.to_s.scan('last/20').size>0 - count += 1 if h[0] == true - end - } - end - } - assert_equal 3, count - - # assert some values - @dataset.features.each { |c,e| - if c.to_s.scan('feature/last/3').size > 0 - assert_equal e['http://www.opentox.org/api/1.1#effect'], "activating" - assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.99 - assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#6&A]-[#6&a]:[#6&a]:[#6&a]:[#6&a]:[#6&a]" - end - } - cleanup - end +def test_regression_last + feature = File.join @@regression_training_dataset.uri,"feature/LC50_mmol" + @dataset_uri = OpenTox::Algorithm::Fminer::LAST.new.run({:dataset_uri => @@regression_training_dataset.uri, :prediction_feature => feature, + :min_frequency => 40, + :subjectid => @@subjectid}).to_s + dump + assert_equal 14, @dataset.features.size + + + # assert no hit counts present + count=0 + @dataset.data_entries.each { |c,e| + if c.to_s.scan('InChI=1S/C9H10O3/c1-2-12-9-5-7(6-10)3-4-8(9)11/h3-6,11H,2H2,1H3').size > 0 + e.each { |p,h| + if p.to_s.scan('last/5').size>0 + count += 1 if h[0] == true + end + if p.to_s.scan('last/11').size>0 + count += 1 if h[0] == true + end + if p.to_s.scan('last/13').size>0 + count += 1 if h[0] == true + end + } + end + } + assert_equal 3, count + + # assert some values + @dataset.features.each { |c,e| + if c.to_s.scan('feature/last/3').size > 0 + assert_equal e['http://www.opentox.org/api/1.1#effect'], "activating" + assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 1.0 + assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#8&A]=[#6&A]-[#8&A]-[#6&A]" + end + } + cleanup +end |