diff options
author | Andreas Maunz <andreas@maunz.de> | 2011-06-29 07:16:10 +0200 |
---|---|---|
committer | Andreas Maunz <andreas@maunz.de> | 2011-06-29 07:16:10 +0200 |
commit | 7ec723afbb2367ae45690e58a7e9255918f51901 (patch) | |
tree | a78c8f1e8e0e9f0b2e8d06e8938f9ff68c6ebbdc /fminer.rb | |
parent | fa269567ccd7c2a2803b6e61c3d8cef32092d435 (diff) |
Detailed Fminer tests
Diffstat (limited to 'fminer.rb')
-rw-r--r-- | fminer.rb | 304 |
1 files changed, 290 insertions, 14 deletions
@@ -3,6 +3,12 @@ require 'opentox-ruby' require 'test/unit' require 'validate-owl.rb' +class Float + def round_to(x) + (self * 10**x).round.to_f / 10**x + end +end + class FminerTest < Test::Unit::TestCase def setup @@ -28,6 +34,33 @@ class FminerTest < Test::Unit::TestCase dump assert_equal 41, @dataset.features.size # 32 bit #assert_equal 52, @dataset.features.size + # assert no hit counts present + count=0 + @dataset.data_entries.each { |c,e| + if c.to_s.scan('InChI=1S/C10H13N3O2/c1-13(12-15)7-3-5-10(14)9-4-2-6-11-8-9/h2,4,6,8H,3,5,7H2,1H3').size > 0 + e.each { |p,h| + if p.to_s.scan('bbrc/40').size>0 + count += 1 if h[0] == true + end + if p.to_s.scan('bbrc/29').size>0 + count += 1 if h[0] == true + end + if p.to_s.scan('bbrc/18').size>0 + count += 1 if h[0] == true + end + } + end + } + assert_equal 3, count + + # assert some values + @dataset.features.each { |c,e| + if c.to_s.scan('feature/bbrc/31').size > 0 + assert_equal e['http://www.opentox.org/api/1.1#effect'], "false" + assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.97 + assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#6&a]-[#6&a]:[#6&a]:[#6&a]:[#6&a]-[#7&A]" + end + } cleanup end @@ -37,55 +70,298 @@ class FminerTest < Test::Unit::TestCase dump assert_equal 207, @dataset.features.size # 32 bit #assert_equal 219, @dataset.features.size + + # assert no hit counts present + count = 0 + @dataset.data_entries.each { |c,e| + if c.to_s.scan('InChI=1S/C5H10N2O2S/c1-4(10-3)7-9-5(8)6-2/h1-3H3,(H,6,8)').size > 0 + e.each { |p,h| + if p.to_s.scan('bbrc/107').size>0 + count += 1 if h[0] == true + end + if p.to_s.scan('bbrc/57').size>0 + count += 1 if h[0] == true + end + if p.to_s.scan('bbrc/158').size>0 + count += 1 if h[0] == true + end + } + end + } + assert_equal 3, count + + # assert some values + @dataset.features.each { |c,e| + if c.to_s.scan('feature/bbrc/188').size > 0 + assert_equal e['http://www.opentox.org/api/1.1#effect'], "activating" + assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 1.0 + assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#6&a]:[#6&a]:[#8&a]:[#6&a]:[#6&a]" + end + } + cleanup end def test_last + feature = @@classification_training_dataset.features.keys.first @dataset_uri = OpenTox::Algorithm::Fminer::LAST.new.run({:dataset_uri => @@classification_training_dataset.uri, :prediction_feature => feature, :subjectid => @@subjectid}).to_s dump #assert_equal 23, @dataset.features.size assert_equal 21, @dataset.features.size # 32 bit + + # assert no hit counts present + count = 0 + @dataset.data_entries.each { |c,e| + if c.to_s.scan('InChI=1S/C5H10N2O/c8-6-7-4-2-1-3-5-7/h1-5H2').size > 0 + e.each { |p,h| + if p.to_s.scan('last/11').size>0 + count += 1 if h[0] == true + end + if p.to_s.scan('last/5').size>0 + count += 1 if h[0] == true + end + if p.to_s.scan('last/13').size>0 + count += 1 if h[0] == true + end + } + end + } + assert_equal 3, count + + # assert some values + @dataset.features.each { |c,e| + if c.to_s.scan('feature/last/3').size > 0 + assert_equal e['http://www.opentox.org/api/1.1#effect'], "true" + assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.99 + assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#8&A]=[#6&A]-[#6&A]-[#6&A]" + end + } cleanup end - def test_bbrc_rest_parameters + + def test_regression_last + feature = File.join @@regression_training_dataset.uri,"feature/LC50_mmol" + @dataset_uri = OpenTox::Algorithm::Fminer::LAST.new.run({:dataset_uri => @@regression_training_dataset.uri, :prediction_feature => feature, + :min_frequency => 40, + :subjectid => @@subjectid}).to_s + dump + assert_equal 8, @dataset.features.size + + + # assert no hit counts present + count=0 + @dataset.data_entries.each { |c,e| + if c.to_s.scan('InChI=1S/C9H14O3/c1-7(2)9(10)12-6-8-4-3-5-11-8/h8H,1,3-6H2,2H3').size > 0 + e.each { |p,h| + if p.to_s.scan('last/2').size>0 + count += 1 if h[0] == true + end + if p.to_s.scan('last/3').size>0 + count += 1 if h[0] == true + end + if p.to_s.scan('last/7').size>0 + count += 1 if h[0] == true + end + } + end + } + assert_equal 3, count + + # assert some values + @dataset.features.each { |c,e| + if c.to_s.scan('feature/last/3').size > 0 + assert_equal e['http://www.opentox.org/api/1.1#effect'], "deactivating" + assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 1.00 + assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#8&A]-[#6&A](-[#6&A])-[#6&A]" + end + } + cleanup + end + + + + def test_bbrc_rest_parameters_nr_hits feature = @@classification_training_dataset.features.keys.first @dataset_uri = OpenTox::RestClientWrapper.post(File.join(CONFIG[:services]["opentox-algorithm"],"fminer","bbrc"),{ "dataset_uri" => @@classification_training_dataset.uri, "prediction_feature" => feature, - "backbone" => true, - "min_frequency" => 2, "nr_hits" => true, :subjectid => @@subjectid }) dump assert_equal 41, @dataset.features.size # 32 bit #assert_equal 52, @dataset.features.size + + # assert hit counts present @dataset.data_entries.each { |c,e| if c.to_s.scan('InChI=1S/C14H19N3S.ClH/c1-16(2)9-10-17(12-13-6-5-11-18-13)14-7-3-4-8-15-14;/h3-8,11H,9-10,12H2,1-2H3;1H').size > 0 e.each { |p,h| - if p.to_s.scan('39').size>0 + if p.to_s.scan('bbrc/39').size>0 assert_equal 6, h[0] end - if p.to_s.scan('18').size>0 + if p.to_s.scan('bbrc/18').size>0 assert_equal 5, h[0] end - if p.to_s.scan('38').size>0 + if p.to_s.scan('bbrc/38').size>0 assert_equal 14, h[0] end } end } + + # assert some values + @dataset.features.each { |c,e| + if c.to_s.scan('feature/bbrc/31').size > 0 + assert_equal e['http://www.opentox.org/api/1.1#effect'], "false" + assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.97 + assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#6&a]-[#6&a]:[#6&a]:[#6&a]:[#6&a]-[#7&A]" + end + } + + cleanup + end + + def test_bbrc_rest_parameters_bb_false + feature = @@classification_training_dataset.features.keys.first + @dataset_uri = OpenTox::RestClientWrapper.post(File.join(CONFIG[:services]["opentox-algorithm"],"fminer","bbrc"),{ + "dataset_uri" => @@classification_training_dataset.uri, + "prediction_feature" => feature, + "backbone" => false, + :subjectid => @@subjectid }) + dump + assert_equal 139, @dataset.features.size # 32 bit + #assert_equal 52, @dataset.features.size + + # assert no hit counts present + count=0 + @dataset.data_entries.each { |c,e| + if c.to_s.scan('InChI=1S/C10H13N3O2/c1-13(12-15)7-3-5-10(14)9-4-2-6-11-8-9/h2,4,6,8H,3,5,7H2,1H3').size > 0 + e.each { |p,h| + if p.to_s.scan('bbrc/113').size>0 + count += 1 if h[0] == true + end + if p.to_s.scan('bbrc/99').size>0 + count += 1 if h[0] == true + end + if p.to_s.scan('bbrc/77').size>0 + count += 1 if h[0] == true + end + } + end + } + assert_equal 3, count + + + # assert some values + @dataset.features.each { |c,e| + if c.to_s.scan('feature/bbrc/31').size > 0 + assert_equal e['http://www.opentox.org/api/1.1#effect'], "false" + assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.99 + assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#8&A]-[#6&A]-[#7&A]-[#7&A]=[#8&A]" + end + } + cleanup end -# Deactivated by AM because of efficiency problems (does not return) -# def test_regression_last -# feature = File.join @@regression_training_dataset.uri,"feature/LC50_mmol" -# @dataset_uri = OpenTox::Algorithm::Fminer::LAST.new.run({:dataset_uri => @@regression_training_dataset.uri, :prediction_feature => feature, :subjectid => @@subjectid}).to_s -# dump -# assert_equal 4, d.features.size -# cleanup -# end + def test_bbrc_multinomial + feature = @@multinomial_training_dataset.features.keys.first + @dataset_uri = OpenTox::Algorithm::Fminer::BBRC.new.run({:dataset_uri => @@multinomial_training_dataset.uri, :prediction_feature => feature, :subjectid => @@subjectid}).to_s + dump + assert_equal 152, @dataset.features.size # 32 bit + #assert no hit counts present + count=0 + @dataset.data_entries.each { |c,e| + if c.to_s.scan('InChI=1S/C10H7NO2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H').size > 0 + e.each { |p,h| + if p.to_s.scan('bbrc/37').size>0 + count += 1 if h[0] == true + end + if p.to_s.scan('bbrc/38').size>0 + count += 1 if h[0] == true + end + if p.to_s.scan('bbrc/39').size>0 + count += 1 if h[0] == true + end + } + end + } + assert_equal 3, count + + # assert some values + @dataset.features.each { |c,e| + if c.to_s.scan('feature/bbrc/0').size > 0 + assert_equal e['http://www.opentox.org/api/1.1#effect'], "1" + assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 1.00 + assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#6&A]-[#6&A](=[#6&A])(-[#6&A])" + end + } + @dataset.features.each { |c,e| + if c.to_s.scan('feature/bbrc/92').size > 0 + assert_equal e['http://www.opentox.org/api/1.1#effect'], "2" + assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.99 + assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#6&a]:[#6&a](:[#6&a])(:[#6&a]:[#6&a]:[#6&a]:[#6&a]-[#16&A])" + end + } + @dataset.features.each { |c,e| + if c.to_s.scan('feature/bbrc/42').size > 0 + assert_equal e['http://www.opentox.org/api/1.1#effect'], "0" + assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.99 + assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#6&a]:[#6&a](:[#7&a]:[#6&a])(:[#6&a]:[#6&a])" + end + } + cleanup + end + + def test_last_multinomial + feature = @@multinomial_training_dataset.features.keys.first + @dataset_uri = OpenTox::Algorithm::Fminer::LAST.new.run({:dataset_uri => @@multinomial_training_dataset.uri, :prediction_feature => feature, :subjectid => @@subjectid}).to_s + dump + assert_equal 138, @dataset.features.size # 32 bit + + #assert no hit counts present + count=0 + @dataset.data_entries.each { |c,e| + if c.to_s.scan('InChI=1S/C7H6N2O4/c8-6-3-4(9(12)13)1-2-5(6)7(10)11/h1-3H,8H2,(H,10,11)').size > 0 + e.each { |p,h| + if p.to_s.scan('last/127').size>0 + count += 1 if h[0] == true + end + if p.to_s.scan('last/54').size>0 + count += 1 if h[0] == true + end + if p.to_s.scan('last/120').size>0 + count += 1 if h[0] == true + end + } + end + } + assert_equal 3, count + + # assert some values + @dataset.features.each { |c,e| + if c.to_s.scan('feature/last/54').size > 0 + assert_equal e['http://www.opentox.org/api/1.1#effect'], "0" + assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.99 + assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#7&A;$([#7&A](=[#8&A])=[#8&A]),$([#7&A](-[#6&a])=[#8&A])](~*)=[#8&A]" + end + } + @dataset.features.each { |c,e| + if c.to_s.scan('feature/last/48').size > 0 + assert_equal e['http://www.opentox.org/api/1.1#effect'], "1" + assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.99 + assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#6&A]=[#6&A](-[#6&A])-[#6&A]" + end + } + @dataset.features.each { |c,e| + if c.to_s.scan('feature/bbrc/76').size > 0 + assert_equal e['http://www.opentox.org/api/1.1#effect'], "2" + assert_equal e['http://www.opentox.org/api/1.1#pValue'].to_f.round_to(2), 0.0 + assert_equal e['http://www.opentox.org/api/1.1#smarts'], "[#7&A]-[#6&a]:[#6&a]:[#6&a](-[#16&A;$([#16&A](-,=[#8&A])-[#6&a]),$([#16&A](=[#8&A])-[#6&a])](~*)):[#6&a]:[#6&a;$([#6&a](:[#6&a])(:[#6&a]):[#6&a]),$([#6&a](:[#6&a])(:[#6&a]):[#6&a])](~*)(~*):[#6&a]:[#6&a]" + end + } + cleanup + end end |